diff options
Diffstat (limited to 'js')
| -rw-r--r-- | js/core.js | 497 | ||||
| -rw-r--r-- | js/customizer.js | 42 | ||||
| -rw-r--r-- | js/popper.js | 2540 | ||||
| -rw-r--r-- | js/popper.min.js | 5 | ||||
| -rw-r--r-- | js/theme.js | 6540 | ||||
| -rw-r--r-- | js/theme.min.js | 1 |
6 files changed, 9625 insertions, 0 deletions
diff --git a/js/core.js b/js/core.js new file mode 100644 index 0000000..3e49842 --- /dev/null +++ b/js/core.js @@ -0,0 +1,497 @@ +/* global Symbol */ +// Defining this global in .eslintrc.json would create a danger of using the global +// unguarded in another place, it seems safer to define global only for this module + +define( [ + "./var/arr", + "./var/document", + "./var/getProto", + "./var/slice", + "./var/concat", + "./var/push", + "./var/indexOf", + "./var/class2type", + "./var/toString", + "./var/hasOwn", + "./var/fnToString", + "./var/ObjectFunctionString", + "./var/support", + "./core/DOMEval" +], function( arr, document, getProto, slice, concat, push, indexOf, + class2type, toString, hasOwn, fnToString, ObjectFunctionString, + support, DOMEval ) { + +"use strict"; + +var + version = "3.2.1", + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + + // The jQuery object is actually just the init constructor 'enhanced' + // Need init if jQuery is called (just allow error to be thrown if not included) + return new jQuery.fn.init( selector, context ); + }, + + // Support: Android <=4.0 only + // Make sure we trim BOM and NBSP + rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g, + + // Matches dashed string for camelizing + rmsPrefix = /^-ms-/, + rdashAlpha = /-([a-z])/g, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return letter.toUpperCase(); + }; + +jQuery.fn = jQuery.prototype = { + + // The current version of jQuery being used + jquery: version, + + constructor: jQuery, + + // The default length of a jQuery object is 0 + length: 0, + + toArray: function() { + return slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + + // Return all the elements in a clean array + if ( num == null ) { + return slice.call( this ); + } + + // Return just the one element from the set + return num < 0 ? this[ num + this.length ] : this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + each: function( callback ) { + return jQuery.each( this, callback ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map( this, function( elem, i ) { + return callback.call( elem, i, elem ); + } ) ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] ); + }, + + end: function() { + return this.prevObject || this.constructor(); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: arr.sort, + splice: arr.splice +}; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[ 0 ] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + + // Skip the boolean and the target + target = arguments[ i ] || {}; + i++; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction( target ) ) { + target = {}; + } + + // Extend jQuery itself if only one argument is passed + if ( i === length ) { + target = this; + i--; + } + + for ( ; i < length; i++ ) { + + // Only deal with non-null/undefined values + if ( ( options = arguments[ i ] ) != null ) { + + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject( copy ) || + ( copyIsArray = Array.isArray( copy ) ) ) ) { + + if ( copyIsArray ) { + copyIsArray = false; + clone = src && Array.isArray( src ) ? src : []; + + } else { + clone = src && jQuery.isPlainObject( src ) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend( { + + // Unique for each copy of jQuery on the page + expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ), + + // Assume jQuery is ready without the ready module + isReady: true, + + error: function( msg ) { + throw new Error( msg ); + }, + + noop: function() {}, + + isFunction: function( obj ) { + return jQuery.type( obj ) === "function"; + }, + + isWindow: function( obj ) { + return obj != null && obj === obj.window; + }, + + isNumeric: function( obj ) { + + // As of jQuery 3.0, isNumeric is limited to + // strings and numbers (primitives or objects) + // that can be coerced to finite numbers (gh-2662) + var type = jQuery.type( obj ); + return ( type === "number" || type === "string" ) && + + // parseFloat NaNs numeric-cast false positives ("") + // ...but misinterprets leading-number strings, particularly hex literals ("0x...") + // subtraction forces infinities to NaN + !isNaN( obj - parseFloat( obj ) ); + }, + + isPlainObject: function( obj ) { + var proto, Ctor; + + // Detect obvious negatives + // Use toString instead of jQuery.type to catch host objects + if ( !obj || toString.call( obj ) !== "[object Object]" ) { + return false; + } + + proto = getProto( obj ); + + // Objects with no prototype (e.g., `Object.create( null )`) are plain + if ( !proto ) { + return true; + } + + // Objects with prototype are plain iff they were constructed by a global Object function + Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor; + return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString; + }, + + isEmptyObject: function( obj ) { + + /* eslint-disable no-unused-vars */ + // See https://github.com/eslint/eslint/issues/6125 + var name; + + for ( name in obj ) { + return false; + } + return true; + }, + + type: function( obj ) { + if ( obj == null ) { + return obj + ""; + } + + // Support: Android <=2.3 only (functionish RegExp) + return typeof obj === "object" || typeof obj === "function" ? + class2type[ toString.call( obj ) ] || "object" : + typeof obj; + }, + + // Evaluates a script in a global context + globalEval: function( code ) { + DOMEval( code ); + }, + + // Convert dashed to camelCase; used by the css and data modules + // Support: IE <=9 - 11, Edge 12 - 13 + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + + each: function( obj, callback ) { + var length, i = 0; + + if ( isArrayLike( obj ) ) { + length = obj.length; + for ( ; i < length; i++ ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } else { + for ( i in obj ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } + + return obj; + }, + + // Support: Android <=4.0 only + trim: function( text ) { + return text == null ? + "" : + ( text + "" ).replace( rtrim, "" ); + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArrayLike( Object( arr ) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + return arr == null ? -1 : indexOf.call( arr, elem, i ); + }, + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + merge: function( first, second ) { + var len = +second.length, + j = 0, + i = first.length; + + for ( ; j < len; j++ ) { + first[ i++ ] = second[ j ]; + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, invert ) { + var callbackInverse, + matches = [], + i = 0, + length = elems.length, + callbackExpect = !invert; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + callbackInverse = !callback( elems[ i ], i ); + if ( callbackInverse !== callbackExpect ) { + matches.push( elems[ i ] ); + } + } + + return matches; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var length, value, + i = 0, + ret = []; + + // Go through the array, translating each of the items to their new values + if ( isArrayLike( elems ) ) { + length = elems.length; + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + } + + // Flatten any nested arrays + return concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + var tmp, args, proxy; + + if ( typeof context === "string" ) { + tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + args = slice.call( arguments, 2 ); + proxy = function() { + return fn.apply( context || this, args.concat( slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || jQuery.guid++; + + return proxy; + }, + + now: Date.now, + + // jQuery.support is not used in Core but other projects attach their + // properties to it so it needs to exist. + support: support +} ); + +if ( typeof Symbol === "function" ) { + jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ]; +} + +// Populate the class2type map +jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ), +function( i, name ) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +} ); + +function isArrayLike( obj ) { + + // Support: real iOS 8.2 only (not reproducible in simulator) + // `in` check used to prevent JIT error (gh-2145) + // hasOwn isn't used here due to false negatives + // regarding Nodelist length in IE + var length = !!obj && "length" in obj && obj.length, + type = jQuery.type( obj ); + + if ( type === "function" || jQuery.isWindow( obj ) ) { + return false; + } + + return type === "array" || length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj; +} + +return jQuery; +} ); +$(document).ready(function(){ + console.log("…preparing scroll button"); + $(window).scroll(function () { + if ($(this).scrollTop() > 50) { + $('#back-to-top').fadeIn(); + } else { + $('#back-to-top').fadeOut(); + } + }); + // scroll body to 0px on click + $('#back-to-top').click(function () { + $('#back-to-top').tooltip('hide'); + $('body,html').animate({ + scrollTop: 0 + }, 800); + return false; + }); + + $('#back-to-top').tooltip('show'); + +}); diff --git a/js/customizer.js b/js/customizer.js new file mode 100644 index 0000000..4351a33 --- /dev/null +++ b/js/customizer.js @@ -0,0 +1,42 @@ +/** + * File customizer.js. + * + * Theme Customizer enhancements for a better user experience. + * + * Contains handlers to make Theme Customizer preview reload changes asynchronously. + */ + +( function( $ ) { + + // Site title and description. + wp.customize( 'blogname', function( value ) { + value.bind( function( to ) { + $( '.site-title a' ).text( to ); + } ); + } ); + wp.customize( 'blogdescription', function( value ) { + value.bind( function( to ) { + $( '.site-description' ).text( to ); + } ); + } ); + + // Header text color. + wp.customize( 'header_textcolor', function( value ) { + value.bind( function( to ) { + if ( 'blank' === to ) { + $( '.site-title a, .site-description' ).css( { + 'clip': 'rect(1px, 1px, 1px, 1px)', + 'position': 'absolute' + } ); + } else { + $( '.site-title a, .site-description' ).css( { + 'clip': 'auto', + 'position': 'relative' + } ); + $( '.site-title a, .site-description' ).css( { + 'color': to + } ); + } + } ); + } ); +} )( jQuery ); diff --git a/js/popper.js b/js/popper.js new file mode 100644 index 0000000..a6c9c07 --- /dev/null +++ b/js/popper.js @@ -0,0 +1,2540 @@ +/**! + * @fileOverview Kickass library to create and place poppers near their reference elements. + * @version 1.14.4 + * @license + * Copyright (c) 2016 Federico Zivolo and contributors + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in all + * copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE + * SOFTWARE. + */ +(function (global, factory) { + typeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() : + typeof define === 'function' && define.amd ? define(factory) : + (global.Popper = factory()); +}(this, (function () { 'use strict'; + +var isBrowser = typeof window !== 'undefined' && typeof document !== 'undefined'; + +var longerTimeoutBrowsers = ['Edge', 'Trident', 'Firefox']; +var timeoutDuration = 0; +for (var i = 0; i < longerTimeoutBrowsers.length; i += 1) { + if (isBrowser && navigator.userAgent.indexOf(longerTimeoutBrowsers[i]) >= 0) { + timeoutDuration = 1; + break; + } +} + +function microtaskDebounce(fn) { + var called = false; + return function () { + if (called) { + return; + } + called = true; + window.Promise.resolve().then(function () { + called = false; + fn(); + }); + }; +} + +function taskDebounce(fn) { + var scheduled = false; + return function () { + if (!scheduled) { + scheduled = true; + setTimeout(function () { + scheduled = false; + fn(); + }, timeoutDuration); + } + }; +} + +var supportsMicroTasks = isBrowser && window.Promise; + +/** +* Create a debounced version of a method, that's asynchronously deferred +* but called in the minimum time possible. +* +* @method +* @memberof Popper.Utils +* @argument {Function} fn +* @returns {Function} +*/ +var debounce = supportsMicroTasks ? microtaskDebounce : taskDebounce; + +/** + * Check if the given variable is a function + * @method + * @memberof Popper.Utils + * @argument {Any} functionToCheck - variable to check + * @returns {Boolean} answer to: is a function? + */ +function isFunction(functionToCheck) { + var getType = {}; + return functionToCheck && getType.toString.call(functionToCheck) === '[object Function]'; +} + +/** + * Get CSS computed property of the given element + * @method + * @memberof Popper.Utils + * @argument {Eement} element + * @argument {String} property + */ +function getStyleComputedProperty(element, property) { + if (element.nodeType !== 1) { + return []; + } + // NOTE: 1 DOM access here + var css = getComputedStyle(element, null); + return property ? css[property] : css; +} + +/** + * Returns the parentNode or the host of the element + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @returns {Element} parent + */ +function getParentNode(element) { + if (element.nodeName === 'HTML') { + return element; + } + return element.parentNode || element.host; +} + +/** + * Returns the scrolling parent of the given element + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @returns {Element} scroll parent + */ +function getScrollParent(element) { + // Return body, `getScroll` will take care to get the correct `scrollTop` from it + if (!element) { + return document.body; + } + + switch (element.nodeName) { + case 'HTML': + case 'BODY': + return element.ownerDocument.body; + case '#document': + return element.body; + } + + // Firefox want us to check `-x` and `-y` variations as well + + var _getStyleComputedProp = getStyleComputedProperty(element), + overflow = _getStyleComputedProp.overflow, + overflowX = _getStyleComputedProp.overflowX, + overflowY = _getStyleComputedProp.overflowY; + + if (/(auto|scroll|overlay)/.test(overflow + overflowY + overflowX)) { + return element; + } + + return getScrollParent(getParentNode(element)); +} + +var isIE11 = isBrowser && !!(window.MSInputMethodContext && document.documentMode); +var isIE10 = isBrowser && /MSIE 10/.test(navigator.userAgent); + +/** + * Determines if the browser is Internet Explorer + * @method + * @memberof Popper.Utils + * @param {Number} version to check + * @returns {Boolean} isIE + */ +function isIE(version) { + if (version === 11) { + return isIE11; + } + if (version === 10) { + return isIE10; + } + return isIE11 || isIE10; +} + +/** + * Returns the offset parent of the given element + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @returns {Element} offset parent + */ +function getOffsetParent(element) { + if (!element) { + return document.documentElement; + } + + var noOffsetParent = isIE(10) ? document.body : null; + + // NOTE: 1 DOM access here + var offsetParent = element.offsetParent; + // Skip hidden elements which don't have an offsetParent + while (offsetParent === noOffsetParent && element.nextElementSibling) { + offsetParent = (element = element.nextElementSibling).offsetParent; + } + + var nodeName = offsetParent && offsetParent.nodeName; + + if (!nodeName || nodeName === 'BODY' || nodeName === 'HTML') { + return element ? element.ownerDocument.documentElement : document.documentElement; + } + + // .offsetParent will return the closest TD or TABLE in case + // no offsetParent is present, I hate this job... + if (['TD', 'TABLE'].indexOf(offsetParent.nodeName) !== -1 && getStyleComputedProperty(offsetParent, 'position') === 'static') { + return getOffsetParent(offsetParent); + } + + return offsetParent; +} + +function isOffsetContainer(element) { + var nodeName = element.nodeName; + + if (nodeName === 'BODY') { + return false; + } + return nodeName === 'HTML' || getOffsetParent(element.firstElementChild) === element; +} + +/** + * Finds the root node (document, shadowDOM root) of the given element + * @method + * @memberof Popper.Utils + * @argument {Element} node + * @returns {Element} root node + */ +function getRoot(node) { + if (node.parentNode !== null) { + return getRoot(node.parentNode); + } + + return node; +} + +/** + * Finds the offset parent common to the two provided nodes + * @method + * @memberof Popper.Utils + * @argument {Element} element1 + * @argument {Element} element2 + * @returns {Element} common offset parent + */ +function findCommonOffsetParent(element1, element2) { + // This check is needed to avoid errors in case one of the elements isn't defined for any reason + if (!element1 || !element1.nodeType || !element2 || !element2.nodeType) { + return document.documentElement; + } + + // Here we make sure to give as "start" the element that comes first in the DOM + var order = element1.compareDocumentPosition(element2) & Node.DOCUMENT_POSITION_FOLLOWING; + var start = order ? element1 : element2; + var end = order ? element2 : element1; + + // Get common ancestor container + var range = document.createRange(); + range.setStart(start, 0); + range.setEnd(end, 0); + var commonAncestorContainer = range.commonAncestorContainer; + + // Both nodes are inside #document + + if (element1 !== commonAncestorContainer && element2 !== commonAncestorContainer || start.contains(end)) { + if (isOffsetContainer(commonAncestorContainer)) { + return commonAncestorContainer; + } + + return getOffsetParent(commonAncestorContainer); + } + + // one of the nodes is inside shadowDOM, find which one + var element1root = getRoot(element1); + if (element1root.host) { + return findCommonOffsetParent(element1root.host, element2); + } else { + return findCommonOffsetParent(element1, getRoot(element2).host); + } +} + +/** + * Gets the scroll value of the given element in the given side (top and left) + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @argument {String} side `top` or `left` + * @returns {number} amount of scrolled pixels + */ +function getScroll(element) { + var side = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'top'; + + var upperSide = side === 'top' ? 'scrollTop' : 'scrollLeft'; + var nodeName = element.nodeName; + + if (nodeName === 'BODY' || nodeName === 'HTML') { + var html = element.ownerDocument.documentElement; + var scrollingElement = element.ownerDocument.scrollingElement || html; + return scrollingElement[upperSide]; + } + + return element[upperSide]; +} + +/* + * Sum or subtract the element scroll values (left and top) from a given rect object + * @method + * @memberof Popper.Utils + * @param {Object} rect - Rect object you want to change + * @param {HTMLElement} element - The element from the function reads the scroll values + * @param {Boolean} subtract - set to true if you want to subtract the scroll values + * @return {Object} rect - The modifier rect object + */ +function includeScroll(rect, element) { + var subtract = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; + + var scrollTop = getScroll(element, 'top'); + var scrollLeft = getScroll(element, 'left'); + var modifier = subtract ? -1 : 1; + rect.top += scrollTop * modifier; + rect.bottom += scrollTop * modifier; + rect.left += scrollLeft * modifier; + rect.right += scrollLeft * modifier; + return rect; +} + +/* + * Helper to detect borders of a given element + * @method + * @memberof Popper.Utils + * @param {CSSStyleDeclaration} styles + * Result of `getStyleComputedProperty` on the given element + * @param {String} axis - `x` or `y` + * @return {number} borders - The borders size of the given axis + */ + +function getBordersSize(styles, axis) { + var sideA = axis === 'x' ? 'Left' : 'Top'; + var sideB = sideA === 'Left' ? 'Right' : 'Bottom'; + + return parseFloat(styles['border' + sideA + 'Width'], 10) + parseFloat(styles['border' + sideB + 'Width'], 10); +} + +function getSize(axis, body, html, computedStyle) { + return Math.max(body['offset' + axis], body['scroll' + axis], html['client' + axis], html['offset' + axis], html['scroll' + axis], isIE(10) ? parseInt(html['offset' + axis]) + parseInt(computedStyle['margin' + (axis === 'Height' ? 'Top' : 'Left')]) + parseInt(computedStyle['margin' + (axis === 'Height' ? 'Bottom' : 'Right')]) : 0); +} + +function getWindowSizes(document) { + var body = document.body; + var html = document.documentElement; + var computedStyle = isIE(10) && getComputedStyle(html); + + return { + height: getSize('Height', body, html, computedStyle), + width: getSize('Width', body, html, computedStyle) + }; +} + +var classCallCheck = function (instance, Constructor) { + if (!(instance instanceof Constructor)) { + throw new TypeError("Cannot call a class as a function"); + } +}; + +var createClass = function () { + function defineProperties(target, props) { + for (var i = 0; i < props.length; i++) { + var descriptor = props[i]; + descriptor.enumerable = descriptor.enumerable || false; + descriptor.configurable = true; + if ("value" in descriptor) descriptor.writable = true; + Object.defineProperty(target, descriptor.key, descriptor); + } + } + + return function (Constructor, protoProps, staticProps) { + if (protoProps) defineProperties(Constructor.prototype, protoProps); + if (staticProps) defineProperties(Constructor, staticProps); + return Constructor; + }; +}(); + + + + + +var defineProperty = function (obj, key, value) { + if (key in obj) { + Object.defineProperty(obj, key, { + value: value, + enumerable: true, + configurable: true, + writable: true + }); + } else { + obj[key] = value; + } + + return obj; +}; + +var _extends = Object.assign || function (target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i]; + + for (var key in source) { + if (Object.prototype.hasOwnProperty.call(source, key)) { + target[key] = source[key]; + } + } + } + + return target; +}; + +/** + * Given element offsets, generate an output similar to getBoundingClientRect + * @method + * @memberof Popper.Utils + * @argument {Object} offsets + * @returns {Object} ClientRect like output + */ +function getClientRect(offsets) { + return _extends({}, offsets, { + right: offsets.left + offsets.width, + bottom: offsets.top + offsets.height + }); +} + +/** + * Get bounding client rect of given element + * @method + * @memberof Popper.Utils + * @param {HTMLElement} element + * @return {Object} client rect + */ +function getBoundingClientRect(element) { + var rect = {}; + + // IE10 10 FIX: Please, don't ask, the element isn't + // considered in DOM in some circumstances... + // This isn't reproducible in IE10 compatibility mode of IE11 + try { + if (isIE(10)) { + rect = element.getBoundingClientRect(); + var scrollTop = getScroll(element, 'top'); + var scrollLeft = getScroll(element, 'left'); + rect.top += scrollTop; + rect.left += scrollLeft; + rect.bottom += scrollTop; + rect.right += scrollLeft; + } else { + rect = element.getBoundingClientRect(); + } + } catch (e) {} + + var result = { + left: rect.left, + top: rect.top, + width: rect.right - rect.left, + height: rect.bottom - rect.top + }; + + // subtract scrollbar size from sizes + var sizes = element.nodeName === 'HTML' ? getWindowSizes(element.ownerDocument) : {}; + var width = sizes.width || element.clientWidth || result.right - result.left; + var height = sizes.height || element.clientHeight || result.bottom - result.top; + + var horizScrollbar = element.offsetWidth - width; + var vertScrollbar = element.offsetHeight - height; + + // if an hypothetical scrollbar is detected, we must be sure it's not a `border` + // we make this check conditional for performance reasons + if (horizScrollbar || vertScrollbar) { + var styles = getStyleComputedProperty(element); + horizScrollbar -= getBordersSize(styles, 'x'); + vertScrollbar -= getBordersSize(styles, 'y'); + + result.width -= horizScrollbar; + result.height -= vertScrollbar; + } + + return getClientRect(result); +} + +function getOffsetRectRelativeToArbitraryNode(children, parent) { + var fixedPosition = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; + + var isIE10 = isIE(10); + var isHTML = parent.nodeName === 'HTML'; + var childrenRect = getBoundingClientRect(children); + var parentRect = getBoundingClientRect(parent); + var scrollParent = getScrollParent(children); + + var styles = getStyleComputedProperty(parent); + var borderTopWidth = parseFloat(styles.borderTopWidth, 10); + var borderLeftWidth = parseFloat(styles.borderLeftWidth, 10); + + // In cases where the parent is fixed, we must ignore negative scroll in offset calc + if (fixedPosition && isHTML) { + parentRect.top = Math.max(parentRect.top, 0); + parentRect.left = Math.max(parentRect.left, 0); + } + var offsets = getClientRect({ + top: childrenRect.top - parentRect.top - borderTopWidth, + left: childrenRect.left - parentRect.left - borderLeftWidth, + width: childrenRect.width, + height: childrenRect.height + }); + offsets.marginTop = 0; + offsets.marginLeft = 0; + + // Subtract margins of documentElement in case it's being used as parent + // we do this only on HTML because it's the only element that behaves + // differently when margins are applied to it. The margins are included in + // the box of the documentElement, in the other cases not. + if (!isIE10 && isHTML) { + var marginTop = parseFloat(styles.marginTop, 10); + var marginLeft = parseFloat(styles.marginLeft, 10); + + offsets.top -= borderTopWidth - marginTop; + offsets.bottom -= borderTopWidth - marginTop; + offsets.left -= borderLeftWidth - marginLeft; + offsets.right -= borderLeftWidth - marginLeft; + + // Attach marginTop and marginLeft because in some circumstances we may need them + offsets.marginTop = marginTop; + offsets.marginLeft = marginLeft; + } + + if (isIE10 && !fixedPosition ? parent.contains(scrollParent) : parent === scrollParent && scrollParent.nodeName !== 'BODY') { + offsets = includeScroll(offsets, parent); + } + + return offsets; +} + +function getViewportOffsetRectRelativeToArtbitraryNode(element) { + var excludeScroll = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + + var html = element.ownerDocument.documentElement; + var relativeOffset = getOffsetRectRelativeToArbitraryNode(element, html); + var width = Math.max(html.clientWidth, window.innerWidth || 0); + var height = Math.max(html.clientHeight, window.innerHeight || 0); + + var scrollTop = !excludeScroll ? getScroll(html) : 0; + var scrollLeft = !excludeScroll ? getScroll(html, 'left') : 0; + + var offset = { + top: scrollTop - relativeOffset.top + relativeOffset.marginTop, + left: scrollLeft - relativeOffset.left + relativeOffset.marginLeft, + width: width, + height: height + }; + + return getClientRect(offset); +} + +/** + * Check if the given element is fixed or is inside a fixed parent + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @argument {Element} customContainer + * @returns {Boolean} answer to "isFixed?" + */ +function isFixed(element) { + var nodeName = element.nodeName; + if (nodeName === 'BODY' || nodeName === 'HTML') { + return false; + } + if (getStyleComputedProperty(element, 'position') === 'fixed') { + return true; + } + return isFixed(getParentNode(element)); +} + +/** + * Finds the first parent of an element that has a transformed property defined + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @returns {Element} first transformed parent or documentElement + */ + +function getFixedPositionOffsetParent(element) { + // This check is needed to avoid errors in case one of the elements isn't defined for any reason + if (!element || !element.parentElement || isIE()) { + return document.documentElement; + } + var el = element.parentElement; + while (el && getStyleComputedProperty(el, 'transform') === 'none') { + el = el.parentElement; + } + return el || document.documentElement; +} + +/** + * Computed the boundaries limits and return them + * @method + * @memberof Popper.Utils + * @param {HTMLElement} popper + * @param {HTMLElement} reference + * @param {number} padding + * @param {HTMLElement} boundariesElement - Element used to define the boundaries + * @param {Boolean} fixedPosition - Is in fixed position mode + * @returns {Object} Coordinates of the boundaries + */ +function getBoundaries(popper, reference, padding, boundariesElement) { + var fixedPosition = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : false; + + // NOTE: 1 DOM access here + + var boundaries = { top: 0, left: 0 }; + var offsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference); + + // Handle viewport case + if (boundariesElement === 'viewport') { + boundaries = getViewportOffsetRectRelativeToArtbitraryNode(offsetParent, fixedPosition); + } else { + // Handle other cases based on DOM element used as boundaries + var boundariesNode = void 0; + if (boundariesElement === 'scrollParent') { + boundariesNode = getScrollParent(getParentNode(reference)); + if (boundariesNode.nodeName === 'BODY') { + boundariesNode = popper.ownerDocument.documentElement; + } + } else if (boundariesElement === 'window') { + boundariesNode = popper.ownerDocument.documentElement; + } else { + boundariesNode = boundariesElement; + } + + var offsets = getOffsetRectRelativeToArbitraryNode(boundariesNode, offsetParent, fixedPosition); + + // In case of HTML, we need a different computation + if (boundariesNode.nodeName === 'HTML' && !isFixed(offsetParent)) { + var _getWindowSizes = getWindowSizes(popper.ownerDocument), + height = _getWindowSizes.height, + width = _getWindowSizes.width; + + boundaries.top += offsets.top - offsets.marginTop; + boundaries.bottom = height + offsets.top; + boundaries.left += offsets.left - offsets.marginLeft; + boundaries.right = width + offsets.left; + } else { + // for all the other DOM elements, this one is good + boundaries = offsets; + } + } + + // Add paddings + padding = padding || 0; + var isPaddingNumber = typeof padding === 'number'; + boundaries.left += isPaddingNumber ? padding : padding.left || 0; + boundaries.top += isPaddingNumber ? padding : padding.top || 0; + boundaries.right -= isPaddingNumber ? padding : padding.right || 0; + boundaries.bottom -= isPaddingNumber ? padding : padding.bottom || 0; + + return boundaries; +} + +function getArea(_ref) { + var width = _ref.width, + height = _ref.height; + + return width * height; +} + +/** + * Utility used to transform the `auto` placement to the placement with more + * available space. + * @method + * @memberof Popper.Utils + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function computeAutoPlacement(placement, refRect, popper, reference, boundariesElement) { + var padding = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : 0; + + if (placement.indexOf('auto') === -1) { + return placement; + } + + var boundaries = getBoundaries(popper, reference, padding, boundariesElement); + + var rects = { + top: { + width: boundaries.width, + height: refRect.top - boundaries.top + }, + right: { + width: boundaries.right - refRect.right, + height: boundaries.height + }, + bottom: { + width: boundaries.width, + height: boundaries.bottom - refRect.bottom + }, + left: { + width: refRect.left - boundaries.left, + height: boundaries.height + } + }; + + var sortedAreas = Object.keys(rects).map(function (key) { + return _extends({ + key: key + }, rects[key], { + area: getArea(rects[key]) + }); + }).sort(function (a, b) { + return b.area - a.area; + }); + + var filteredAreas = sortedAreas.filter(function (_ref2) { + var width = _ref2.width, + height = _ref2.height; + return width >= popper.clientWidth && height >= popper.clientHeight; + }); + + var computedPlacement = filteredAreas.length > 0 ? filteredAreas[0].key : sortedAreas[0].key; + + var variation = placement.split('-')[1]; + + return computedPlacement + (variation ? '-' + variation : ''); +} + +/** + * Get offsets to the reference element + * @method + * @memberof Popper.Utils + * @param {Object} state + * @param {Element} popper - the popper element + * @param {Element} reference - the reference element (the popper will be relative to this) + * @param {Element} fixedPosition - is in fixed position mode + * @returns {Object} An object containing the offsets which will be applied to the popper + */ +function getReferenceOffsets(state, popper, reference) { + var fixedPosition = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : null; + + var commonOffsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference); + return getOffsetRectRelativeToArbitraryNode(reference, commonOffsetParent, fixedPosition); +} + +/** + * Get the outer sizes of the given element (offset size + margins) + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @returns {Object} object containing width and height properties + */ +function getOuterSizes(element) { + var styles = getComputedStyle(element); + var x = parseFloat(styles.marginTop) + parseFloat(styles.marginBottom); + var y = parseFloat(styles.marginLeft) + parseFloat(styles.marginRight); + var result = { + width: element.offsetWidth + y, + height: element.offsetHeight + x + }; + return result; +} + +/** + * Get the opposite placement of the given one + * @method + * @memberof Popper.Utils + * @argument {String} placement + * @returns {String} flipped placement + */ +function getOppositePlacement(placement) { + var hash = { left: 'right', right: 'left', bottom: 'top', top: 'bottom' }; + return placement.replace(/left|right|bottom|top/g, function (matched) { + return hash[matched]; + }); +} + +/** + * Get offsets to the popper + * @method + * @memberof Popper.Utils + * @param {Object} position - CSS position the Popper will get applied + * @param {HTMLElement} popper - the popper element + * @param {Object} referenceOffsets - the reference offsets (the popper will be relative to this) + * @param {String} placement - one of the valid placement options + * @returns {Object} popperOffsets - An object containing the offsets which will be applied to the popper + */ +function getPopperOffsets(popper, referenceOffsets, placement) { + placement = placement.split('-')[0]; + + // Get popper node sizes + var popperRect = getOuterSizes(popper); + + // Add position, width and height to our offsets object + var popperOffsets = { + width: popperRect.width, + height: popperRect.height + }; + + // depending by the popper placement we have to compute its offsets slightly differently + var isHoriz = ['right', 'left'].indexOf(placement) !== -1; + var mainSide = isHoriz ? 'top' : 'left'; + var secondarySide = isHoriz ? 'left' : 'top'; + var measurement = isHoriz ? 'height' : 'width'; + var secondaryMeasurement = !isHoriz ? 'height' : 'width'; + + popperOffsets[mainSide] = referenceOffsets[mainSide] + referenceOffsets[measurement] / 2 - popperRect[measurement] / 2; + if (placement === secondarySide) { + popperOffsets[secondarySide] = referenceOffsets[secondarySide] - popperRect[secondaryMeasurement]; + } else { + popperOffsets[secondarySide] = referenceOffsets[getOppositePlacement(secondarySide)]; + } + + return popperOffsets; +} + +/** + * Mimics the `find` method of Array + * @method + * @memberof Popper.Utils + * @argument {Array} arr + * @argument prop + * @argument value + * @returns index or -1 + */ +function find(arr, check) { + // use native find if supported + if (Array.prototype.find) { + return arr.find(check); + } + + // use `filter` to obtain the same behavior of `find` + return arr.filter(check)[0]; +} + +/** + * Return the index of the matching object + * @method + * @memberof Popper.Utils + * @argument {Array} arr + * @argument prop + * @argument value + * @returns index or -1 + */ +function findIndex(arr, prop, value) { + // use native findIndex if supported + if (Array.prototype.findIndex) { + return arr.findIndex(function (cur) { + return cur[prop] === value; + }); + } + + // use `find` + `indexOf` if `findIndex` isn't supported + var match = find(arr, function (obj) { + return obj[prop] === value; + }); + return arr.indexOf(match); +} + +/** + * Loop trough the list of modifiers and run them in order, + * each of them will then edit the data object. + * @method + * @memberof Popper.Utils + * @param {dataObject} data + * @param {Array} modifiers + * @param {String} ends - Optional modifier name used as stopper + * @returns {dataObject} + */ +function runModifiers(modifiers, data, ends) { + var modifiersToRun = ends === undefined ? modifiers : modifiers.slice(0, findIndex(modifiers, 'name', ends)); + + modifiersToRun.forEach(function (modifier) { + if (modifier['function']) { + // eslint-disable-line dot-notation + console.warn('`modifier.function` is deprecated, use `modifier.fn`!'); + } + var fn = modifier['function'] || modifier.fn; // eslint-disable-line dot-notation + if (modifier.enabled && isFunction(fn)) { + // Add properties to offsets to make them a complete clientRect object + // we do this before each modifier to make sure the previous one doesn't + // mess with these values + data.offsets.popper = getClientRect(data.offsets.popper); + data.offsets.reference = getClientRect(data.offsets.reference); + + data = fn(data, modifier); + } + }); + + return data; +} + +/** + * Updates the position of the popper, computing the new offsets and applying + * the new style.<br /> + * Prefer `scheduleUpdate` over `update` because of performance reasons. + * @method + * @memberof Popper + */ +function update() { + // if popper is destroyed, don't perform any further update + if (this.state.isDestroyed) { + return; + } + + var data = { + instance: this, + styles: {}, + arrowStyles: {}, + attributes: {}, + flipped: false, + offsets: {} + }; + + // compute reference element offsets + data.offsets.reference = getReferenceOffsets(this.state, this.popper, this.reference, this.options.positionFixed); + + // compute auto placement, store placement inside the data object, + // modifiers will be able to edit `placement` if needed + // and refer to originalPlacement to know the original value + data.placement = computeAutoPlacement(this.options.placement, data.offsets.reference, this.popper, this.reference, this.options.modifiers.flip.boundariesElement, this.options.modifiers.flip.padding); + + // store the computed placement inside `originalPlacement` + data.originalPlacement = data.placement; + + data.positionFixed = this.options.positionFixed; + + // compute the popper offsets + data.offsets.popper = getPopperOffsets(this.popper, data.offsets.reference, data.placement); + + data.offsets.popper.position = this.options.positionFixed ? 'fixed' : 'absolute'; + + // run the modifiers + data = runModifiers(this.modifiers, data); + + // the first `update` will call `onCreate` callback + // the other ones will call `onUpdate` callback + if (!this.state.isCreated) { + this.state.isCreated = true; + this.options.onCreate(data); + } else { + this.options.onUpdate(data); + } +} + +/** + * Helper used to know if the given modifier is enabled. + * @method + * @memberof Popper.Utils + * @returns {Boolean} + */ +function isModifierEnabled(modifiers, modifierName) { + return modifiers.some(function (_ref) { + var name = _ref.name, + enabled = _ref.enabled; + return enabled && name === modifierName; + }); +} + +/** + * Get the prefixed supported property name + * @method + * @memberof Popper.Utils + * @argument {String} property (camelCase) + * @returns {String} prefixed property (camelCase or PascalCase, depending on the vendor prefix) + */ +function getSupportedPropertyName(property) { + var prefixes = [false, 'ms', 'Webkit', 'Moz', 'O']; + var upperProp = property.charAt(0).toUpperCase() + property.slice(1); + + for (var i = 0; i < prefixes.length; i++) { + var prefix = prefixes[i]; + var toCheck = prefix ? '' + prefix + upperProp : property; + if (typeof document.body.style[toCheck] !== 'undefined') { + return toCheck; + } + } + return null; +} + +/** + * Destroys the popper. + * @method + * @memberof Popper + */ +function destroy() { + this.state.isDestroyed = true; + + // touch DOM only if `applyStyle` modifier is enabled + if (isModifierEnabled(this.modifiers, 'applyStyle')) { + this.popper.removeAttribute('x-placement'); + this.popper.style.position = ''; + this.popper.style.top = ''; + this.popper.style.left = ''; + this.popper.style.right = ''; + this.popper.style.bottom = ''; + this.popper.style.willChange = ''; + this.popper.style[getSupportedPropertyName('transform')] = ''; + } + + this.disableEventListeners(); + + // remove the popper if user explicity asked for the deletion on destroy + // do not use `remove` because IE11 doesn't support it + if (this.options.removeOnDestroy) { + this.popper.parentNode.removeChild(this.popper); + } + return this; +} + +/** + * Get the window associated with the element + * @argument {Element} element + * @returns {Window} + */ +function getWindow(element) { + var ownerDocument = element.ownerDocument; + return ownerDocument ? ownerDocument.defaultView : window; +} + +function attachToScrollParents(scrollParent, event, callback, scrollParents) { + var isBody = scrollParent.nodeName === 'BODY'; + var target = isBody ? scrollParent.ownerDocument.defaultView : scrollParent; + target.addEventListener(event, callback, { passive: true }); + + if (!isBody) { + attachToScrollParents(getScrollParent(target.parentNode), event, callback, scrollParents); + } + scrollParents.push(target); +} + +/** + * Setup needed event listeners used to update the popper position + * @method + * @memberof Popper.Utils + * @private + */ +function setupEventListeners(reference, options, state, updateBound) { + // Resize event listener on window + state.updateBound = updateBound; + getWindow(reference).addEventListener('resize', state.updateBound, { passive: true }); + + // Scroll event listener on scroll parents + var scrollElement = getScrollParent(reference); + attachToScrollParents(scrollElement, 'scroll', state.updateBound, state.scrollParents); + state.scrollElement = scrollElement; + state.eventsEnabled = true; + + return state; +} + +/** + * It will add resize/scroll events and start recalculating + * position of the popper element when they are triggered. + * @method + * @memberof Popper + */ +function enableEventListeners() { + if (!this.state.eventsEnabled) { + this.state = setupEventListeners(this.reference, this.options, this.state, this.scheduleUpdate); + } +} + +/** + * Remove event listeners used to update the popper position + * @method + * @memberof Popper.Utils + * @private + */ +function removeEventListeners(reference, state) { + // Remove resize event listener on window + getWindow(reference).removeEventListener('resize', state.updateBound); + + // Remove scroll event listener on scroll parents + state.scrollParents.forEach(function (target) { + target.removeEventListener('scroll', state.updateBound); + }); + + // Reset state + state.updateBound = null; + state.scrollParents = []; + state.scrollElement = null; + state.eventsEnabled = false; + return state; +} + +/** + * It will remove resize/scroll events and won't recalculate popper position + * when they are triggered. It also won't trigger `onUpdate` callback anymore, + * unless you call `update` method manually. + * @method + * @memberof Popper + */ +function disableEventListeners() { + if (this.state.eventsEnabled) { + cancelAnimationFrame(this.scheduleUpdate); + this.state = removeEventListeners(this.reference, this.state); + } +} + +/** + * Tells if a given input is a number + * @method + * @memberof Popper.Utils + * @param {*} input to check + * @return {Boolean} + */ +function isNumeric(n) { + return n !== '' && !isNaN(parseFloat(n)) && isFinite(n); +} + +/** + * Set the style to the given popper + * @method + * @memberof Popper.Utils + * @argument {Element} element - Element to apply the style to + * @argument {Object} styles + * Object with a list of properties and values which will be applied to the element + */ +function setStyles(element, styles) { + Object.keys(styles).forEach(function (prop) { + var unit = ''; + // add unit if the value is numeric and is one of the following + if (['width', 'height', 'top', 'right', 'bottom', 'left'].indexOf(prop) !== -1 && isNumeric(styles[prop])) { + unit = 'px'; + } + element.style[prop] = styles[prop] + unit; + }); +} + +/** + * Set the attributes to the given popper + * @method + * @memberof Popper.Utils + * @argument {Element} element - Element to apply the attributes to + * @argument {Object} styles + * Object with a list of properties and values which will be applied to the element + */ +function setAttributes(element, attributes) { + Object.keys(attributes).forEach(function (prop) { + var value = attributes[prop]; + if (value !== false) { + element.setAttribute(prop, attributes[prop]); + } else { + element.removeAttribute(prop); + } + }); +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by `update` method + * @argument {Object} data.styles - List of style properties - values to apply to popper element + * @argument {Object} data.attributes - List of attribute properties - values to apply to popper element + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The same data object + */ +function applyStyle(data) { + // any property present in `data.styles` will be applied to the popper, + // in this way we can make the 3rd party modifiers add custom styles to it + // Be aware, modifiers could override the properties defined in the previous + // lines of this modifier! + setStyles(data.instance.popper, data.styles); + + // any property present in `data.attributes` will be applied to the popper, + // they will be set as HTML attributes of the element + setAttributes(data.instance.popper, data.attributes); + + // if arrowElement is defined and arrowStyles has some properties + if (data.arrowElement && Object.keys(data.arrowStyles).length) { + setStyles(data.arrowElement, data.arrowStyles); + } + + return data; +} + +/** + * Set the x-placement attribute before everything else because it could be used + * to add margins to the popper margins needs to be calculated to get the + * correct popper offsets. + * @method + * @memberof Popper.modifiers + * @param {HTMLElement} reference - The reference element used to position the popper + * @param {HTMLElement} popper - The HTML element used as popper + * @param {Object} options - Popper.js options + */ +function applyStyleOnLoad(reference, popper, options, modifierOptions, state) { + // compute reference element offsets + var referenceOffsets = getReferenceOffsets(state, popper, reference, options.positionFixed); + + // compute auto placement, store placement inside the data object, + // modifiers will be able to edit `placement` if needed + // and refer to originalPlacement to know the original value + var placement = computeAutoPlacement(options.placement, referenceOffsets, popper, reference, options.modifiers.flip.boundariesElement, options.modifiers.flip.padding); + + popper.setAttribute('x-placement', placement); + + // Apply `position` to popper before anything else because + // without the position applied we can't guarantee correct computations + setStyles(popper, { position: options.positionFixed ? 'fixed' : 'absolute' }); + + return options; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by `update` method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function computeStyle(data, options) { + var x = options.x, + y = options.y; + var popper = data.offsets.popper; + + // Remove this legacy support in Popper.js v2 + + var legacyGpuAccelerationOption = find(data.instance.modifiers, function (modifier) { + return modifier.name === 'applyStyle'; + }).gpuAcceleration; + if (legacyGpuAccelerationOption !== undefined) { + console.warn('WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!'); + } + var gpuAcceleration = legacyGpuAccelerationOption !== undefined ? legacyGpuAccelerationOption : options.gpuAcceleration; + + var offsetParent = getOffsetParent(data.instance.popper); + var offsetParentRect = getBoundingClientRect(offsetParent); + + // Styles + var styles = { + position: popper.position + }; + + // Avoid blurry text by using full pixel integers. + // For pixel-perfect positioning, top/bottom prefers rounded + // values, while left/right prefers floored values. + var offsets = { + left: Math.floor(popper.left), + top: Math.round(popper.top), + bottom: Math.round(popper.bottom), + right: Math.floor(popper.right) + }; + + var sideA = x === 'bottom' ? 'top' : 'bottom'; + var sideB = y === 'right' ? 'left' : 'right'; + + // if gpuAcceleration is set to `true` and transform is supported, + // we use `translate3d` to apply the position to the popper we + // automatically use the supported prefixed version if needed + var prefixedProperty = getSupportedPropertyName('transform'); + + // now, let's make a step back and look at this code closely (wtf?) + // If the content of the popper grows once it's been positioned, it + // may happen that the popper gets misplaced because of the new content + // overflowing its reference element + // To avoid this problem, we provide two options (x and y), which allow + // the consumer to define the offset origin. + // If we position a popper on top of a reference element, we can set + // `x` to `top` to make the popper grow towards its top instead of + // its bottom. + var left = void 0, + top = void 0; + if (sideA === 'bottom') { + // when offsetParent is <html> the positioning is relative to the bottom of the screen (excluding the scrollbar) + // and not the bottom of the html element + if (offsetParent.nodeName === 'HTML') { + top = -offsetParent.clientHeight + offsets.bottom; + } else { + top = -offsetParentRect.height + offsets.bottom; + } + } else { + top = offsets.top; + } + if (sideB === 'right') { + if (offsetParent.nodeName === 'HTML') { + left = -offsetParent.clientWidth + offsets.right; + } else { + left = -offsetParentRect.width + offsets.right; + } + } else { + left = offsets.left; + } + if (gpuAcceleration && prefixedProperty) { + styles[prefixedProperty] = 'translate3d(' + left + 'px, ' + top + 'px, 0)'; + styles[sideA] = 0; + styles[sideB] = 0; + styles.willChange = 'transform'; + } else { + // othwerise, we use the standard `top`, `left`, `bottom` and `right` properties + var invertTop = sideA === 'bottom' ? -1 : 1; + var invertLeft = sideB === 'right' ? -1 : 1; + styles[sideA] = top * invertTop; + styles[sideB] = left * invertLeft; + styles.willChange = sideA + ', ' + sideB; + } + + // Attributes + var attributes = { + 'x-placement': data.placement + }; + + // Update `data` attributes, styles and arrowStyles + data.attributes = _extends({}, attributes, data.attributes); + data.styles = _extends({}, styles, data.styles); + data.arrowStyles = _extends({}, data.offsets.arrow, data.arrowStyles); + + return data; +} + +/** + * Helper used to know if the given modifier depends from another one.<br /> + * It checks if the needed modifier is listed and enabled. + * @method + * @memberof Popper.Utils + * @param {Array} modifiers - list of modifiers + * @param {String} requestingName - name of requesting modifier + * @param {String} requestedName - name of requested modifier + * @returns {Boolean} + */ +function isModifierRequired(modifiers, requestingName, requestedName) { + var requesting = find(modifiers, function (_ref) { + var name = _ref.name; + return name === requestingName; + }); + + var isRequired = !!requesting && modifiers.some(function (modifier) { + return modifier.name === requestedName && modifier.enabled && modifier.order < requesting.order; + }); + + if (!isRequired) { + var _requesting = '`' + requestingName + '`'; + var requested = '`' + requestedName + '`'; + console.warn(requested + ' modifier is required by ' + _requesting + ' modifier in order to work, be sure to include it before ' + _requesting + '!'); + } + return isRequired; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function arrow(data, options) { + var _data$offsets$arrow; + + // arrow depends on keepTogether in order to work + if (!isModifierRequired(data.instance.modifiers, 'arrow', 'keepTogether')) { + return data; + } + + var arrowElement = options.element; + + // if arrowElement is a string, suppose it's a CSS selector + if (typeof arrowElement === 'string') { + arrowElement = data.instance.popper.querySelector(arrowElement); + + // if arrowElement is not found, don't run the modifier + if (!arrowElement) { + return data; + } + } else { + // if the arrowElement isn't a query selector we must check that the + // provided DOM node is child of its popper node + if (!data.instance.popper.contains(arrowElement)) { + console.warn('WARNING: `arrow.element` must be child of its popper element!'); + return data; + } + } + + var placement = data.placement.split('-')[0]; + var _data$offsets = data.offsets, + popper = _data$offsets.popper, + reference = _data$offsets.reference; + + var isVertical = ['left', 'right'].indexOf(placement) !== -1; + + var len = isVertical ? 'height' : 'width'; + var sideCapitalized = isVertical ? 'Top' : 'Left'; + var side = sideCapitalized.toLowerCase(); + var altSide = isVertical ? 'left' : 'top'; + var opSide = isVertical ? 'bottom' : 'right'; + var arrowElementSize = getOuterSizes(arrowElement)[len]; + + // + // extends keepTogether behavior making sure the popper and its + // reference have enough pixels in conjunction + // + + // top/left side + if (reference[opSide] - arrowElementSize < popper[side]) { + data.offsets.popper[side] -= popper[side] - (reference[opSide] - arrowElementSize); + } + // bottom/right side + if (reference[side] + arrowElementSize > popper[opSide]) { + data.offsets.popper[side] += reference[side] + arrowElementSize - popper[opSide]; + } + data.offsets.popper = getClientRect(data.offsets.popper); + + // compute center of the popper + var center = reference[side] + reference[len] / 2 - arrowElementSize / 2; + + // Compute the sideValue using the updated popper offsets + // take popper margin in account because we don't have this info available + var css = getStyleComputedProperty(data.instance.popper); + var popperMarginSide = parseFloat(css['margin' + sideCapitalized], 10); + var popperBorderSide = parseFloat(css['border' + sideCapitalized + 'Width'], 10); + var sideValue = center - data.offsets.popper[side] - popperMarginSide - popperBorderSide; + + // prevent arrowElement from being placed not contiguously to its popper + sideValue = Math.max(Math.min(popper[len] - arrowElementSize, sideValue), 0); + + data.arrowElement = arrowElement; + data.offsets.arrow = (_data$offsets$arrow = {}, defineProperty(_data$offsets$arrow, side, Math.round(sideValue)), defineProperty(_data$offsets$arrow, altSide, ''), _data$offsets$arrow); + + return data; +} + +/** + * Get the opposite placement variation of the given one + * @method + * @memberof Popper.Utils + * @argument {String} placement variation + * @returns {String} flipped placement variation + */ +function getOppositeVariation(variation) { + if (variation === 'end') { + return 'start'; + } else if (variation === 'start') { + return 'end'; + } + return variation; +} + +/** + * List of accepted placements to use as values of the `placement` option.<br /> + * Valid placements are: + * - `auto` + * - `top` + * - `right` + * - `bottom` + * - `left` + * + * Each placement can have a variation from this list: + * - `-start` + * - `-end` + * + * Variations are interpreted easily if you think of them as the left to right + * written languages. Horizontally (`top` and `bottom`), `start` is left and `end` + * is right.<br /> + * Vertically (`left` and `right`), `start` is top and `end` is bottom. + * + * Some valid examples are: + * - `top-end` (on top of reference, right aligned) + * - `right-start` (on right of reference, top aligned) + * - `bottom` (on bottom, centered) + * - `auto-end` (on the side with more space available, alignment depends by placement) + * + * @static + * @type {Array} + * @enum {String} + * @readonly + * @method placements + * @memberof Popper + */ +var placements = ['auto-start', 'auto', 'auto-end', 'top-start', 'top', 'top-end', 'right-start', 'right', 'right-end', 'bottom-end', 'bottom', 'bottom-start', 'left-end', 'left', 'left-start']; + +// Get rid of `auto` `auto-start` and `auto-end` +var validPlacements = placements.slice(3); + +/** + * Given an initial placement, returns all the subsequent placements + * clockwise (or counter-clockwise). + * + * @method + * @memberof Popper.Utils + * @argument {String} placement - A valid placement (it accepts variations) + * @argument {Boolean} counter - Set to true to walk the placements counterclockwise + * @returns {Array} placements including their variations + */ +function clockwise(placement) { + var counter = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + + var index = validPlacements.indexOf(placement); + var arr = validPlacements.slice(index + 1).concat(validPlacements.slice(0, index)); + return counter ? arr.reverse() : arr; +} + +var BEHAVIORS = { + FLIP: 'flip', + CLOCKWISE: 'clockwise', + COUNTERCLOCKWISE: 'counterclockwise' +}; + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function flip(data, options) { + // if `inner` modifier is enabled, we can't use the `flip` modifier + if (isModifierEnabled(data.instance.modifiers, 'inner')) { + return data; + } + + if (data.flipped && data.placement === data.originalPlacement) { + // seems like flip is trying to loop, probably there's not enough space on any of the flippable sides + return data; + } + + var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, options.boundariesElement, data.positionFixed); + + var placement = data.placement.split('-')[0]; + var placementOpposite = getOppositePlacement(placement); + var variation = data.placement.split('-')[1] || ''; + + var flipOrder = []; + + switch (options.behavior) { + case BEHAVIORS.FLIP: + flipOrder = [placement, placementOpposite]; + break; + case BEHAVIORS.CLOCKWISE: + flipOrder = clockwise(placement); + break; + case BEHAVIORS.COUNTERCLOCKWISE: + flipOrder = clockwise(placement, true); + break; + default: + flipOrder = options.behavior; + } + + flipOrder.forEach(function (step, index) { + if (placement !== step || flipOrder.length === index + 1) { + return data; + } + + placement = data.placement.split('-')[0]; + placementOpposite = getOppositePlacement(placement); + + var popperOffsets = data.offsets.popper; + var refOffsets = data.offsets.reference; + + // using floor because the reference offsets may contain decimals we are not going to consider here + var floor = Math.floor; + var overlapsRef = placement === 'left' && floor(popperOffsets.right) > floor(refOffsets.left) || placement === 'right' && floor(popperOffsets.left) < floor(refOffsets.right) || placement === 'top' && floor(popperOffsets.bottom) > floor(refOffsets.top) || placement === 'bottom' && floor(popperOffsets.top) < floor(refOffsets.bottom); + + var overflowsLeft = floor(popperOffsets.left) < floor(boundaries.left); + var overflowsRight = floor(popperOffsets.right) > floor(boundaries.right); + var overflowsTop = floor(popperOffsets.top) < floor(boundaries.top); + var overflowsBottom = floor(popperOffsets.bottom) > floor(boundaries.bottom); + + var overflowsBoundaries = placement === 'left' && overflowsLeft || placement === 'right' && overflowsRight || placement === 'top' && overflowsTop || placement === 'bottom' && overflowsBottom; + + // flip the variation if required + var isVertical = ['top', 'bottom'].indexOf(placement) !== -1; + var flippedVariation = !!options.flipVariations && (isVertical && variation === 'start' && overflowsLeft || isVertical && variation === 'end' && overflowsRight || !isVertical && variation === 'start' && overflowsTop || !isVertical && variation === 'end' && overflowsBottom); + + if (overlapsRef || overflowsBoundaries || flippedVariation) { + // this boolean to detect any flip loop + data.flipped = true; + + if (overlapsRef || overflowsBoundaries) { + placement = flipOrder[index + 1]; + } + + if (flippedVariation) { + variation = getOppositeVariation(variation); + } + + data.placement = placement + (variation ? '-' + variation : ''); + + // this object contains `position`, we want to preserve it along with + // any additional property we may add in the future + data.offsets.popper = _extends({}, data.offsets.popper, getPopperOffsets(data.instance.popper, data.offsets.reference, data.placement)); + + data = runModifiers(data.instance.modifiers, data, 'flip'); + } + }); + return data; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function keepTogether(data) { + var _data$offsets = data.offsets, + popper = _data$offsets.popper, + reference = _data$offsets.reference; + + var placement = data.placement.split('-')[0]; + var floor = Math.floor; + var isVertical = ['top', 'bottom'].indexOf(placement) !== -1; + var side = isVertical ? 'right' : 'bottom'; + var opSide = isVertical ? 'left' : 'top'; + var measurement = isVertical ? 'width' : 'height'; + + if (popper[side] < floor(reference[opSide])) { + data.offsets.popper[opSide] = floor(reference[opSide]) - popper[measurement]; + } + if (popper[opSide] > floor(reference[side])) { + data.offsets.popper[opSide] = floor(reference[side]); + } + + return data; +} + +/** + * Converts a string containing value + unit into a px value number + * @function + * @memberof {modifiers~offset} + * @private + * @argument {String} str - Value + unit string + * @argument {String} measurement - `height` or `width` + * @argument {Object} popperOffsets + * @argument {Object} referenceOffsets + * @returns {Number|String} + * Value in pixels, or original string if no values were extracted + */ +function toValue(str, measurement, popperOffsets, referenceOffsets) { + // separate value from unit + var split = str.match(/((?:\-|\+)?\d*\.?\d*)(.*)/); + var value = +split[1]; + var unit = split[2]; + + // If it's not a number it's an operator, I guess + if (!value) { + return str; + } + + if (unit.indexOf('%') === 0) { + var element = void 0; + switch (unit) { + case '%p': + element = popperOffsets; + break; + case '%': + case '%r': + default: + element = referenceOffsets; + } + + var rect = getClientRect(element); + return rect[measurement] / 100 * value; + } else if (unit === 'vh' || unit === 'vw') { + // if is a vh or vw, we calculate the size based on the viewport + var size = void 0; + if (unit === 'vh') { + size = Math.max(document.documentElement.clientHeight, window.innerHeight || 0); + } else { + size = Math.max(document.documentElement.clientWidth, window.innerWidth || 0); + } + return size / 100 * value; + } else { + // if is an explicit pixel unit, we get rid of the unit and keep the value + // if is an implicit unit, it's px, and we return just the value + return value; + } +} + +/** + * Parse an `offset` string to extrapolate `x` and `y` numeric offsets. + * @function + * @memberof {modifiers~offset} + * @private + * @argument {String} offset + * @argument {Object} popperOffsets + * @argument {Object} referenceOffsets + * @argument {String} basePlacement + * @returns {Array} a two cells array with x and y offsets in numbers + */ +function parseOffset(offset, popperOffsets, referenceOffsets, basePlacement) { + var offsets = [0, 0]; + + // Use height if placement is left or right and index is 0 otherwise use width + // in this way the first offset will use an axis and the second one + // will use the other one + var useHeight = ['right', 'left'].indexOf(basePlacement) !== -1; + + // Split the offset string to obtain a list of values and operands + // The regex addresses values with the plus or minus sign in front (+10, -20, etc) + var fragments = offset.split(/(\+|\-)/).map(function (frag) { + return frag.trim(); + }); + + // Detect if the offset string contains a pair of values or a single one + // they could be separated by comma or space + var divider = fragments.indexOf(find(fragments, function (frag) { + return frag.search(/,|\s/) !== -1; + })); + + if (fragments[divider] && fragments[divider].indexOf(',') === -1) { + console.warn('Offsets separated by white space(s) are deprecated, use a comma (,) instead.'); + } + + // If divider is found, we divide the list of values and operands to divide + // them by ofset X and Y. + var splitRegex = /\s*,\s*|\s+/; + var ops = divider !== -1 ? [fragments.slice(0, divider).concat([fragments[divider].split(splitRegex)[0]]), [fragments[divider].split(splitRegex)[1]].concat(fragments.slice(divider + 1))] : [fragments]; + + // Convert the values with units to absolute pixels to allow our computations + ops = ops.map(function (op, index) { + // Most of the units rely on the orientation of the popper + var measurement = (index === 1 ? !useHeight : useHeight) ? 'height' : 'width'; + var mergeWithPrevious = false; + return op + // This aggregates any `+` or `-` sign that aren't considered operators + // e.g.: 10 + +5 => [10, +, +5] + .reduce(function (a, b) { + if (a[a.length - 1] === '' && ['+', '-'].indexOf(b) !== -1) { + a[a.length - 1] = b; + mergeWithPrevious = true; + return a; + } else if (mergeWithPrevious) { + a[a.length - 1] += b; + mergeWithPrevious = false; + return a; + } else { + return a.concat(b); + } + }, []) + // Here we convert the string values into number values (in px) + .map(function (str) { + return toValue(str, measurement, popperOffsets, referenceOffsets); + }); + }); + + // Loop trough the offsets arrays and execute the operations + ops.forEach(function (op, index) { + op.forEach(function (frag, index2) { + if (isNumeric(frag)) { + offsets[index] += frag * (op[index2 - 1] === '-' ? -1 : 1); + } + }); + }); + return offsets; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @argument {Number|String} options.offset=0 + * The offset value as described in the modifier description + * @returns {Object} The data object, properly modified + */ +function offset(data, _ref) { + var offset = _ref.offset; + var placement = data.placement, + _data$offsets = data.offsets, + popper = _data$offsets.popper, + reference = _data$offsets.reference; + + var basePlacement = placement.split('-')[0]; + + var offsets = void 0; + if (isNumeric(+offset)) { + offsets = [+offset, 0]; + } else { + offsets = parseOffset(offset, popper, reference, basePlacement); + } + + if (basePlacement === 'left') { + popper.top += offsets[0]; + popper.left -= offsets[1]; + } else if (basePlacement === 'right') { + popper.top += offsets[0]; + popper.left += offsets[1]; + } else if (basePlacement === 'top') { + popper.left += offsets[0]; + popper.top -= offsets[1]; + } else if (basePlacement === 'bottom') { + popper.left += offsets[0]; + popper.top += offsets[1]; + } + + data.popper = popper; + return data; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by `update` method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function preventOverflow(data, options) { + var boundariesElement = options.boundariesElement || getOffsetParent(data.instance.popper); + + // If offsetParent is the reference element, we really want to + // go one step up and use the next offsetParent as reference to + // avoid to make this modifier completely useless and look like broken + if (data.instance.reference === boundariesElement) { + boundariesElement = getOffsetParent(boundariesElement); + } + + // NOTE: DOM access here + // resets the popper's position so that the document size can be calculated excluding + // the size of the popper element itself + var transformProp = getSupportedPropertyName('transform'); + var popperStyles = data.instance.popper.style; // assignment to help minification + var top = popperStyles.top, + left = popperStyles.left, + transform = popperStyles[transformProp]; + + popperStyles.top = ''; + popperStyles.left = ''; + popperStyles[transformProp] = ''; + + var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, boundariesElement, data.positionFixed); + + // NOTE: DOM access here + // restores the original style properties after the offsets have been computed + popperStyles.top = top; + popperStyles.left = left; + popperStyles[transformProp] = transform; + + options.boundaries = boundaries; + + var order = options.priority; + var popper = data.offsets.popper; + + var check = { + primary: function primary(placement) { + var value = popper[placement]; + if (popper[placement] < boundaries[placement] && !options.escapeWithReference) { + value = Math.max(popper[placement], boundaries[placement]); + } + return defineProperty({}, placement, value); + }, + secondary: function secondary(placement) { + var mainSide = placement === 'right' ? 'left' : 'top'; + var value = popper[mainSide]; + if (popper[placement] > boundaries[placement] && !options.escapeWithReference) { + value = Math.min(popper[mainSide], boundaries[placement] - (placement === 'right' ? popper.width : popper.height)); + } + return defineProperty({}, mainSide, value); + } + }; + + order.forEach(function (placement) { + var side = ['left', 'top'].indexOf(placement) !== -1 ? 'primary' : 'secondary'; + popper = _extends({}, popper, check[side](placement)); + }); + + data.offsets.popper = popper; + + return data; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by `update` method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function shift(data) { + var placement = data.placement; + var basePlacement = placement.split('-')[0]; + var shiftvariation = placement.split('-')[1]; + + // if shift shiftvariation is specified, run the modifier + if (shiftvariation) { + var _data$offsets = data.offsets, + reference = _data$offsets.reference, + popper = _data$offsets.popper; + + var isVertical = ['bottom', 'top'].indexOf(basePlacement) !== -1; + var side = isVertical ? 'left' : 'top'; + var measurement = isVertical ? 'width' : 'height'; + + var shiftOffsets = { + start: defineProperty({}, side, reference[side]), + end: defineProperty({}, side, reference[side] + reference[measurement] - popper[measurement]) + }; + + data.offsets.popper = _extends({}, popper, shiftOffsets[shiftvariation]); + } + + return data; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function hide(data) { + if (!isModifierRequired(data.instance.modifiers, 'hide', 'preventOverflow')) { + return data; + } + + var refRect = data.offsets.reference; + var bound = find(data.instance.modifiers, function (modifier) { + return modifier.name === 'preventOverflow'; + }).boundaries; + + if (refRect.bottom < bound.top || refRect.left > bound.right || refRect.top > bound.bottom || refRect.right < bound.left) { + // Avoid unnecessary DOM access if visibility hasn't changed + if (data.hide === true) { + return data; + } + + data.hide = true; + data.attributes['x-out-of-boundaries'] = ''; + } else { + // Avoid unnecessary DOM access if visibility hasn't changed + if (data.hide === false) { + return data; + } + + data.hide = false; + data.attributes['x-out-of-boundaries'] = false; + } + + return data; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by `update` method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function inner(data) { + var placement = data.placement; + var basePlacement = placement.split('-')[0]; + var _data$offsets = data.offsets, + popper = _data$offsets.popper, + reference = _data$offsets.reference; + + var isHoriz = ['left', 'right'].indexOf(basePlacement) !== -1; + + var subtractLength = ['top', 'left'].indexOf(basePlacement) === -1; + + popper[isHoriz ? 'left' : 'top'] = reference[basePlacement] - (subtractLength ? popper[isHoriz ? 'width' : 'height'] : 0); + + data.placement = getOppositePlacement(placement); + data.offsets.popper = getClientRect(popper); + + return data; +} + +/** + * Modifier function, each modifier can have a function of this type assigned + * to its `fn` property.<br /> + * These functions will be called on each update, this means that you must + * make sure they are performant enough to avoid performance bottlenecks. + * + * @function ModifierFn + * @argument {dataObject} data - The data object generated by `update` method + * @argument {Object} options - Modifiers configuration and options + * @returns {dataObject} The data object, properly modified + */ + +/** + * Modifiers are plugins used to alter the behavior of your poppers.<br /> + * Popper.js uses a set of 9 modifiers to provide all the basic functionalities + * needed by the library. + * + * Usually you don't want to override the `order`, `fn` and `onLoad` props. + * All the other properties are configurations that could be tweaked. + * @namespace modifiers + */ +var modifiers = { + /** + * Modifier used to shift the popper on the start or end of its reference + * element.<br /> + * It will read the variation of the `placement` property.<br /> + * It can be one either `-end` or `-start`. + * @memberof modifiers + * @inner + */ + shift: { + /** @prop {number} order=100 - Index used to define the order of execution */ + order: 100, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: shift + }, + + /** + * The `offset` modifier can shift your popper on both its axis. + * + * It accepts the following units: + * - `px` or unit-less, interpreted as pixels + * - `%` or `%r`, percentage relative to the length of the reference element + * - `%p`, percentage relative to the length of the popper element + * - `vw`, CSS viewport width unit + * - `vh`, CSS viewport height unit + * + * For length is intended the main axis relative to the placement of the popper.<br /> + * This means that if the placement is `top` or `bottom`, the length will be the + * `width`. In case of `left` or `right`, it will be the `height`. + * + * You can provide a single value (as `Number` or `String`), or a pair of values + * as `String` divided by a comma or one (or more) white spaces.<br /> + * The latter is a deprecated method because it leads to confusion and will be + * removed in v2.<br /> + * Additionally, it accepts additions and subtractions between different units. + * Note that multiplications and divisions aren't supported. + * + * Valid examples are: + * ``` + * 10 + * '10%' + * '10, 10' + * '10%, 10' + * '10 + 10%' + * '10 - 5vh + 3%' + * '-10px + 5vh, 5px - 6%' + * ``` + * > **NB**: If you desire to apply offsets to your poppers in a way that may make them overlap + * > with their reference element, unfortunately, you will have to disable the `flip` modifier. + * > You can read more on this at this [issue](https://github.com/FezVrasta/popper.js/issues/373). + * + * @memberof modifiers + * @inner + */ + offset: { + /** @prop {number} order=200 - Index used to define the order of execution */ + order: 200, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: offset, + /** @prop {Number|String} offset=0 + * The offset value as described in the modifier description + */ + offset: 0 + }, + + /** + * Modifier used to prevent the popper from being positioned outside the boundary. + * + * A scenario exists where the reference itself is not within the boundaries.<br /> + * We can say it has "escaped the boundaries" — or just "escaped".<br /> + * In this case we need to decide whether the popper should either: + * + * - detach from the reference and remain "trapped" in the boundaries, or + * - if it should ignore the boundary and "escape with its reference" + * + * When `escapeWithReference` is set to`true` and reference is completely + * outside its boundaries, the popper will overflow (or completely leave) + * the boundaries in order to remain attached to the edge of the reference. + * + * @memberof modifiers + * @inner + */ + preventOverflow: { + /** @prop {number} order=300 - Index used to define the order of execution */ + order: 300, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: preventOverflow, + /** + * @prop {Array} [priority=['left','right','top','bottom']] + * Popper will try to prevent overflow following these priorities by default, + * then, it could overflow on the left and on top of the `boundariesElement` + */ + priority: ['left', 'right', 'top', 'bottom'], + /** + * @prop {number} padding=5 + * Amount of pixel used to define a minimum distance between the boundaries + * and the popper. This makes sure the popper always has a little padding + * between the edges of its container + */ + padding: 5, + /** + * @prop {String|HTMLElement} boundariesElement='scrollParent' + * Boundaries used by the modifier. Can be `scrollParent`, `window`, + * `viewport` or any DOM element. + */ + boundariesElement: 'scrollParent' + }, + + /** + * Modifier used to make sure the reference and its popper stay near each other + * without leaving any gap between the two. Especially useful when the arrow is + * enabled and you want to ensure that it points to its reference element. + * It cares only about the first axis. You can still have poppers with margin + * between the popper and its reference element. + * @memberof modifiers + * @inner + */ + keepTogether: { + /** @prop {number} order=400 - Index used to define the order of execution */ + order: 400, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: keepTogether + }, + + /** + * This modifier is used to move the `arrowElement` of the popper to make + * sure it is positioned between the reference element and its popper element. + * It will read the outer size of the `arrowElement` node to detect how many + * pixels of conjunction are needed. + * + * It has no effect if no `arrowElement` is provided. + * @memberof modifiers + * @inner + */ + arrow: { + /** @prop {number} order=500 - Index used to define the order of execution */ + order: 500, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: arrow, + /** @prop {String|HTMLElement} element='[x-arrow]' - Selector or node used as arrow */ + element: '[x-arrow]' + }, + + /** + * Modifier used to flip the popper's placement when it starts to overlap its + * reference element. + * + * Requires the `preventOverflow` modifier before it in order to work. + * + * **NOTE:** this modifier will interrupt the current update cycle and will + * restart it if it detects the need to flip the placement. + * @memberof modifiers + * @inner + */ + flip: { + /** @prop {number} order=600 - Index used to define the order of execution */ + order: 600, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: flip, + /** + * @prop {String|Array} behavior='flip' + * The behavior used to change the popper's placement. It can be one of + * `flip`, `clockwise`, `counterclockwise` or an array with a list of valid + * placements (with optional variations) + */ + behavior: 'flip', + /** + * @prop {number} padding=5 + * The popper will flip if it hits the edges of the `boundariesElement` + */ + padding: 5, + /** + * @prop {String|HTMLElement} boundariesElement='viewport' + * The element which will define the boundaries of the popper position. + * The popper will never be placed outside of the defined boundaries + * (except if `keepTogether` is enabled) + */ + boundariesElement: 'viewport' + }, + + /** + * Modifier used to make the popper flow toward the inner of the reference element. + * By default, when this modifier is disabled, the popper will be placed outside + * the reference element. + * @memberof modifiers + * @inner + */ + inner: { + /** @prop {number} order=700 - Index used to define the order of execution */ + order: 700, + /** @prop {Boolean} enabled=false - Whether the modifier is enabled or not */ + enabled: false, + /** @prop {ModifierFn} */ + fn: inner + }, + + /** + * Modifier used to hide the popper when its reference element is outside of the + * popper boundaries. It will set a `x-out-of-boundaries` attribute which can + * be used to hide with a CSS selector the popper when its reference is + * out of boundaries. + * + * Requires the `preventOverflow` modifier before it in order to work. + * @memberof modifiers + * @inner + */ + hide: { + /** @prop {number} order=800 - Index used to define the order of execution */ + order: 800, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: hide + }, + + /** + * Computes the style that will be applied to the popper element to gets + * properly positioned. + * + * Note that this modifier will not touch the DOM, it just prepares the styles + * so that `applyStyle` modifier can apply it. This separation is useful + * in case you need to replace `applyStyle` with a custom implementation. + * + * This modifier has `850` as `order` value to maintain backward compatibility + * with previous versions of Popper.js. Expect the modifiers ordering method + * to change in future major versions of the library. + * + * @memberof modifiers + * @inner + */ + computeStyle: { + /** @prop {number} order=850 - Index used to define the order of execution */ + order: 850, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: computeStyle, + /** + * @prop {Boolean} gpuAcceleration=true + * If true, it uses the CSS 3D transformation to position the popper. + * Otherwise, it will use the `top` and `left` properties + */ + gpuAcceleration: true, + /** + * @prop {string} [x='bottom'] + * Where to anchor the X axis (`bottom` or `top`). AKA X offset origin. + * Change this if your popper should grow in a direction different from `bottom` + */ + x: 'bottom', + /** + * @prop {string} [x='left'] + * Where to anchor the Y axis (`left` or `right`). AKA Y offset origin. + * Change this if your popper should grow in a direction different from `right` + */ + y: 'right' + }, + + /** + * Applies the computed styles to the popper element. + * + * All the DOM manipulations are limited to this modifier. This is useful in case + * you want to integrate Popper.js inside a framework or view library and you + * want to delegate all the DOM manipulations to it. + * + * Note that if you disable this modifier, you must make sure the popper element + * has its position set to `absolute` before Popper.js can do its work! + * + * Just disable this modifier and define your own to achieve the desired effect. + * + * @memberof modifiers + * @inner + */ + applyStyle: { + /** @prop {number} order=900 - Index used to define the order of execution */ + order: 900, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: applyStyle, + /** @prop {Function} */ + onLoad: applyStyleOnLoad, + /** + * @deprecated since version 1.10.0, the property moved to `computeStyle` modifier + * @prop {Boolean} gpuAcceleration=true + * If true, it uses the CSS 3D transformation to position the popper. + * Otherwise, it will use the `top` and `left` properties + */ + gpuAcceleration: undefined + } +}; + +/** + * The `dataObject` is an object containing all the information used by Popper.js. + * This object is passed to modifiers and to the `onCreate` and `onUpdate` callbacks. + * @name dataObject + * @property {Object} data.instance The Popper.js instance + * @property {String} data.placement Placement applied to popper + * @property {String} data.originalPlacement Placement originally defined on init + * @property {Boolean} data.flipped True if popper has been flipped by flip modifier + * @property {Boolean} data.hide True if the reference element is out of boundaries, useful to know when to hide the popper + * @property {HTMLElement} data.arrowElement Node used as arrow by arrow modifier + * @property {Object} data.styles Any CSS property defined here will be applied to the popper. It expects the JavaScript nomenclature (eg. `marginBottom`) + * @property {Object} data.arrowStyles Any CSS property defined here will be applied to the popper arrow. It expects the JavaScript nomenclature (eg. `marginBottom`) + * @property {Object} data.boundaries Offsets of the popper boundaries + * @property {Object} data.offsets The measurements of popper, reference and arrow elements + * @property {Object} data.offsets.popper `top`, `left`, `width`, `height` values + * @property {Object} data.offsets.reference `top`, `left`, `width`, `height` values + * @property {Object} data.offsets.arrow] `top` and `left` offsets, only one of them will be different from 0 + */ + +/** + * Default options provided to Popper.js constructor.<br /> + * These can be overridden using the `options` argument of Popper.js.<br /> + * To override an option, simply pass an object with the same + * structure of the `options` object, as the 3rd argument. For example: + * ``` + * new Popper(ref, pop, { + * modifiers: { + * preventOverflow: { enabled: false } + * } + * }) + * ``` + * @type {Object} + * @static + * @memberof Popper + */ +var Defaults = { + /** + * Popper's placement. + * @prop {Popper.placements} placement='bottom' + */ + placement: 'bottom', + + /** + * Set this to true if you want popper to position it self in 'fixed' mode + * @prop {Boolean} positionFixed=false + */ + positionFixed: false, + + /** + * Whether events (resize, scroll) are initially enabled. + * @prop {Boolean} eventsEnabled=true + */ + eventsEnabled: true, + + /** + * Set to true if you want to automatically remove the popper when + * you call the `destroy` method. + * @prop {Boolean} removeOnDestroy=false + */ + removeOnDestroy: false, + + /** + * Callback called when the popper is created.<br /> + * By default, it is set to no-op.<br /> + * Access Popper.js instance with `data.instance`. + * @prop {onCreate} + */ + onCreate: function onCreate() {}, + + /** + * Callback called when the popper is updated. This callback is not called + * on the initialization/creation of the popper, but only on subsequent + * updates.<br /> + * By default, it is set to no-op.<br /> + * Access Popper.js instance with `data.instance`. + * @prop {onUpdate} + */ + onUpdate: function onUpdate() {}, + + /** + * List of modifiers used to modify the offsets before they are applied to the popper. + * They provide most of the functionalities of Popper.js. + * @prop {modifiers} + */ + modifiers: modifiers +}; + +/** + * @callback onCreate + * @param {dataObject} data + */ + +/** + * @callback onUpdate + * @param {dataObject} data + */ + +// Utils +// Methods +var Popper = function () { + /** + * Creates a new Popper.js instance. + * @class Popper + * @param {HTMLElement|referenceObject} reference - The reference element used to position the popper + * @param {HTMLElement} popper - The HTML element used as the popper + * @param {Object} options - Your custom options to override the ones defined in [Defaults](#defaults) + * @return {Object} instance - The generated Popper.js instance + */ + function Popper(reference, popper) { + var _this = this; + + var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {}; + classCallCheck(this, Popper); + + this.scheduleUpdate = function () { + return requestAnimationFrame(_this.update); + }; + + // make update() debounced, so that it only runs at most once-per-tick + this.update = debounce(this.update.bind(this)); + + // with {} we create a new object with the options inside it + this.options = _extends({}, Popper.Defaults, options); + + // init state + this.state = { + isDestroyed: false, + isCreated: false, + scrollParents: [] + }; + + // get reference and popper elements (allow jQuery wrappers) + this.reference = reference && reference.jquery ? reference[0] : reference; + this.popper = popper && popper.jquery ? popper[0] : popper; + + // Deep merge modifiers options + this.options.modifiers = {}; + Object.keys(_extends({}, Popper.Defaults.modifiers, options.modifiers)).forEach(function (name) { + _this.options.modifiers[name] = _extends({}, Popper.Defaults.modifiers[name] || {}, options.modifiers ? options.modifiers[name] : {}); + }); + + // Refactoring modifiers' list (Object => Array) + this.modifiers = Object.keys(this.options.modifiers).map(function (name) { + return _extends({ + name: name + }, _this.options.modifiers[name]); + }) + // sort the modifiers by order + .sort(function (a, b) { + return a.order - b.order; + }); + + // modifiers have the ability to execute arbitrary code when Popper.js get inited + // such code is executed in the same order of its modifier + // they could add new properties to their options configuration + // BE AWARE: don't add options to `options.modifiers.name` but to `modifierOptions`! + this.modifiers.forEach(function (modifierOptions) { + if (modifierOptions.enabled && isFunction(modifierOptions.onLoad)) { + modifierOptions.onLoad(_this.reference, _this.popper, _this.options, modifierOptions, _this.state); + } + }); + + // fire the first update to position the popper in the right place + this.update(); + + var eventsEnabled = this.options.eventsEnabled; + if (eventsEnabled) { + // setup event listeners, they will take care of update the position in specific situations + this.enableEventListeners(); + } + + this.state.eventsEnabled = eventsEnabled; + } + + // We can't use class properties because they don't get listed in the + // class prototype and break stuff like Sinon stubs + + + createClass(Popper, [{ + key: 'update', + value: function update$$1() { + return update.call(this); + } + }, { + key: 'destroy', + value: function destroy$$1() { + return destroy.call(this); + } + }, { + key: 'enableEventListeners', + value: function enableEventListeners$$1() { + return enableEventListeners.call(this); + } + }, { + key: 'disableEventListeners', + value: function disableEventListeners$$1() { + return disableEventListeners.call(this); + } + + /** + * Schedules an update. It will run on the next UI update available. + * @method scheduleUpdate + * @memberof Popper + */ + + + /** + * Collection of utilities useful when writing custom modifiers. + * Starting from version 1.7, this method is available only if you + * include `popper-utils.js` before `popper.js`. + * + * **DEPRECATION**: This way to access PopperUtils is deprecated + * and will be removed in v2! Use the PopperUtils module directly instead. + * Due to the high instability of the methods contained in Utils, we can't + * guarantee them to follow semver. Use them at your own risk! + * @static + * @private + * @type {Object} + * @deprecated since version 1.8 + * @member Utils + * @memberof Popper + */ + + }]); + return Popper; +}(); + +/** + * The `referenceObject` is an object that provides an interface compatible with Popper.js + * and lets you use it as replacement of a real DOM node.<br /> + * You can use this method to position a popper relatively to a set of coordinates + * in case you don't have a DOM node to use as reference. + * + * ``` + * new Popper(referenceObject, popperNode); + * ``` + * + * NB: This feature isn't supported in Internet Explorer 10. + * @name referenceObject + * @property {Function} data.getBoundingClientRect + * A function that returns a set of coordinates compatible with the native `getBoundingClientRect` method. + * @property {number} data.clientWidth + * An ES6 getter that will return the width of the virtual reference element. + * @property {number} data.clientHeight + * An ES6 getter that will return the height of the virtual reference element. + */ + + +Popper.Utils = (typeof window !== 'undefined' ? window : global).PopperUtils; +Popper.placements = placements; +Popper.Defaults = Defaults; + +return Popper; + +}))); +//# sourceMappingURL=popper.js.map diff --git a/js/popper.min.js b/js/popper.min.js new file mode 100644 index 0000000..1e71598 --- /dev/null +++ b/js/popper.min.js @@ -0,0 +1,5 @@ +/* + Copyright (C) Federico Zivolo 2018 + Distributed under the MIT License (license terms are at http://opensource.org/licenses/MIT). + */(function(e,t){'object'==typeof exports&&'undefined'!=typeof module?module.exports=t():'function'==typeof define&&define.amd?define(t):e.Popper=t()})(this,function(){'use strict';function e(e){return e&&'[object Function]'==={}.toString.call(e)}function t(e,t){if(1!==e.nodeType)return[];var o=getComputedStyle(e,null);return t?o[t]:o}function o(e){return'HTML'===e.nodeName?e:e.parentNode||e.host}function n(e){if(!e)return document.body;switch(e.nodeName){case'HTML':case'BODY':return e.ownerDocument.body;case'#document':return e.body;}var i=t(e),r=i.overflow,p=i.overflowX,s=i.overflowY;return /(auto|scroll|overlay)/.test(r+s+p)?e:n(o(e))}function r(e){return 11===e?re:10===e?pe:re||pe}function p(e){if(!e)return document.documentElement;for(var o=r(10)?document.body:null,n=e.offsetParent;n===o&&e.nextElementSibling;)n=(e=e.nextElementSibling).offsetParent;var i=n&&n.nodeName;return i&&'BODY'!==i&&'HTML'!==i?-1!==['TD','TABLE'].indexOf(n.nodeName)&&'static'===t(n,'position')?p(n):n:e?e.ownerDocument.documentElement:document.documentElement}function s(e){var t=e.nodeName;return'BODY'!==t&&('HTML'===t||p(e.firstElementChild)===e)}function d(e){return null===e.parentNode?e:d(e.parentNode)}function a(e,t){if(!e||!e.nodeType||!t||!t.nodeType)return document.documentElement;var o=e.compareDocumentPosition(t)&Node.DOCUMENT_POSITION_FOLLOWING,n=o?e:t,i=o?t:e,r=document.createRange();r.setStart(n,0),r.setEnd(i,0);var l=r.commonAncestorContainer;if(e!==l&&t!==l||n.contains(i))return s(l)?l:p(l);var f=d(e);return f.host?a(f.host,t):a(e,d(t).host)}function l(e){var t=1<arguments.length&&void 0!==arguments[1]?arguments[1]:'top',o='top'===t?'scrollTop':'scrollLeft',n=e.nodeName;if('BODY'===n||'HTML'===n){var i=e.ownerDocument.documentElement,r=e.ownerDocument.scrollingElement||i;return r[o]}return e[o]}function f(e,t){var o=2<arguments.length&&void 0!==arguments[2]&&arguments[2],n=l(t,'top'),i=l(t,'left'),r=o?-1:1;return e.top+=n*r,e.bottom+=n*r,e.left+=i*r,e.right+=i*r,e}function m(e,t){var o='x'===t?'Left':'Top',n='Left'==o?'Right':'Bottom';return parseFloat(e['border'+o+'Width'],10)+parseFloat(e['border'+n+'Width'],10)}function h(e,t,o,n){return J(t['offset'+e],t['scroll'+e],o['client'+e],o['offset'+e],o['scroll'+e],r(10)?parseInt(o['offset'+e])+parseInt(n['margin'+('Height'===e?'Top':'Left')])+parseInt(n['margin'+('Height'===e?'Bottom':'Right')]):0)}function c(e){var t=e.body,o=e.documentElement,n=r(10)&&getComputedStyle(o);return{height:h('Height',t,o,n),width:h('Width',t,o,n)}}function g(e){return le({},e,{right:e.left+e.width,bottom:e.top+e.height})}function u(e){var o={};try{if(r(10)){o=e.getBoundingClientRect();var n=l(e,'top'),i=l(e,'left');o.top+=n,o.left+=i,o.bottom+=n,o.right+=i}else o=e.getBoundingClientRect()}catch(t){}var p={left:o.left,top:o.top,width:o.right-o.left,height:o.bottom-o.top},s='HTML'===e.nodeName?c(e.ownerDocument):{},d=s.width||e.clientWidth||p.right-p.left,a=s.height||e.clientHeight||p.bottom-p.top,f=e.offsetWidth-d,h=e.offsetHeight-a;if(f||h){var u=t(e);f-=m(u,'x'),h-=m(u,'y'),p.width-=f,p.height-=h}return g(p)}function b(e,o){var i=2<arguments.length&&void 0!==arguments[2]&&arguments[2],p=r(10),s='HTML'===o.nodeName,d=u(e),a=u(o),l=n(e),m=t(o),h=parseFloat(m.borderTopWidth,10),c=parseFloat(m.borderLeftWidth,10);i&&s&&(a.top=J(a.top,0),a.left=J(a.left,0));var b=g({top:d.top-a.top-h,left:d.left-a.left-c,width:d.width,height:d.height});if(b.marginTop=0,b.marginLeft=0,!p&&s){var y=parseFloat(m.marginTop,10),w=parseFloat(m.marginLeft,10);b.top-=h-y,b.bottom-=h-y,b.left-=c-w,b.right-=c-w,b.marginTop=y,b.marginLeft=w}return(p&&!i?o.contains(l):o===l&&'BODY'!==l.nodeName)&&(b=f(b,o)),b}function y(e){var t=1<arguments.length&&void 0!==arguments[1]&&arguments[1],o=e.ownerDocument.documentElement,n=b(e,o),i=J(o.clientWidth,window.innerWidth||0),r=J(o.clientHeight,window.innerHeight||0),p=t?0:l(o),s=t?0:l(o,'left'),d={top:p-n.top+n.marginTop,left:s-n.left+n.marginLeft,width:i,height:r};return g(d)}function w(e){var n=e.nodeName;return'BODY'===n||'HTML'===n?!1:'fixed'===t(e,'position')||w(o(e))}function E(e){if(!e||!e.parentElement||r())return document.documentElement;for(var o=e.parentElement;o&&'none'===t(o,'transform');)o=o.parentElement;return o||document.documentElement}function v(e,t,i,r){var p=4<arguments.length&&void 0!==arguments[4]&&arguments[4],s={top:0,left:0},d=p?E(e):a(e,t);if('viewport'===r)s=y(d,p);else{var l;'scrollParent'===r?(l=n(o(t)),'BODY'===l.nodeName&&(l=e.ownerDocument.documentElement)):'window'===r?l=e.ownerDocument.documentElement:l=r;var f=b(l,d,p);if('HTML'===l.nodeName&&!w(d)){var m=c(e.ownerDocument),h=m.height,g=m.width;s.top+=f.top-f.marginTop,s.bottom=h+f.top,s.left+=f.left-f.marginLeft,s.right=g+f.left}else s=f}i=i||0;var u='number'==typeof i;return s.left+=u?i:i.left||0,s.top+=u?i:i.top||0,s.right-=u?i:i.right||0,s.bottom-=u?i:i.bottom||0,s}function x(e){var t=e.width,o=e.height;return t*o}function O(e,t,o,n,i){var r=5<arguments.length&&void 0!==arguments[5]?arguments[5]:0;if(-1===e.indexOf('auto'))return e;var p=v(o,n,r,i),s={top:{width:p.width,height:t.top-p.top},right:{width:p.right-t.right,height:p.height},bottom:{width:p.width,height:p.bottom-t.bottom},left:{width:t.left-p.left,height:p.height}},d=Object.keys(s).map(function(e){return le({key:e},s[e],{area:x(s[e])})}).sort(function(e,t){return t.area-e.area}),a=d.filter(function(e){var t=e.width,n=e.height;return t>=o.clientWidth&&n>=o.clientHeight}),l=0<a.length?a[0].key:d[0].key,f=e.split('-')[1];return l+(f?'-'+f:'')}function L(e,t,o){var n=3<arguments.length&&void 0!==arguments[3]?arguments[3]:null,i=n?E(t):a(t,o);return b(o,i,n)}function S(e){var t=getComputedStyle(e),o=parseFloat(t.marginTop)+parseFloat(t.marginBottom),n=parseFloat(t.marginLeft)+parseFloat(t.marginRight),i={width:e.offsetWidth+n,height:e.offsetHeight+o};return i}function T(e){var t={left:'right',right:'left',bottom:'top',top:'bottom'};return e.replace(/left|right|bottom|top/g,function(e){return t[e]})}function D(e,t,o){o=o.split('-')[0];var n=S(e),i={width:n.width,height:n.height},r=-1!==['right','left'].indexOf(o),p=r?'top':'left',s=r?'left':'top',d=r?'height':'width',a=r?'width':'height';return i[p]=t[p]+t[d]/2-n[d]/2,i[s]=o===s?t[s]-n[a]:t[T(s)],i}function C(e,t){return Array.prototype.find?e.find(t):e.filter(t)[0]}function N(e,t,o){if(Array.prototype.findIndex)return e.findIndex(function(e){return e[t]===o});var n=C(e,function(e){return e[t]===o});return e.indexOf(n)}function P(t,o,n){var i=void 0===n?t:t.slice(0,N(t,'name',n));return i.forEach(function(t){t['function']&&console.warn('`modifier.function` is deprecated, use `modifier.fn`!');var n=t['function']||t.fn;t.enabled&&e(n)&&(o.offsets.popper=g(o.offsets.popper),o.offsets.reference=g(o.offsets.reference),o=n(o,t))}),o}function k(){if(!this.state.isDestroyed){var e={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};e.offsets.reference=L(this.state,this.popper,this.reference,this.options.positionFixed),e.placement=O(this.options.placement,e.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),e.originalPlacement=e.placement,e.positionFixed=this.options.positionFixed,e.offsets.popper=D(this.popper,e.offsets.reference,e.placement),e.offsets.popper.position=this.options.positionFixed?'fixed':'absolute',e=P(this.modifiers,e),this.state.isCreated?this.options.onUpdate(e):(this.state.isCreated=!0,this.options.onCreate(e))}}function W(e,t){return e.some(function(e){var o=e.name,n=e.enabled;return n&&o===t})}function H(e){for(var t=[!1,'ms','Webkit','Moz','O'],o=e.charAt(0).toUpperCase()+e.slice(1),n=0;n<t.length;n++){var i=t[n],r=i?''+i+o:e;if('undefined'!=typeof document.body.style[r])return r}return null}function B(){return this.state.isDestroyed=!0,W(this.modifiers,'applyStyle')&&(this.popper.removeAttribute('x-placement'),this.popper.style.position='',this.popper.style.top='',this.popper.style.left='',this.popper.style.right='',this.popper.style.bottom='',this.popper.style.willChange='',this.popper.style[H('transform')]=''),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}function A(e){var t=e.ownerDocument;return t?t.defaultView:window}function M(e,t,o,i){var r='BODY'===e.nodeName,p=r?e.ownerDocument.defaultView:e;p.addEventListener(t,o,{passive:!0}),r||M(n(p.parentNode),t,o,i),i.push(p)}function F(e,t,o,i){o.updateBound=i,A(e).addEventListener('resize',o.updateBound,{passive:!0});var r=n(e);return M(r,'scroll',o.updateBound,o.scrollParents),o.scrollElement=r,o.eventsEnabled=!0,o}function I(){this.state.eventsEnabled||(this.state=F(this.reference,this.options,this.state,this.scheduleUpdate))}function R(e,t){return A(e).removeEventListener('resize',t.updateBound),t.scrollParents.forEach(function(e){e.removeEventListener('scroll',t.updateBound)}),t.updateBound=null,t.scrollParents=[],t.scrollElement=null,t.eventsEnabled=!1,t}function U(){this.state.eventsEnabled&&(cancelAnimationFrame(this.scheduleUpdate),this.state=R(this.reference,this.state))}function Y(e){return''!==e&&!isNaN(parseFloat(e))&&isFinite(e)}function j(e,t){Object.keys(t).forEach(function(o){var n='';-1!==['width','height','top','right','bottom','left'].indexOf(o)&&Y(t[o])&&(n='px'),e.style[o]=t[o]+n})}function K(e,t){Object.keys(t).forEach(function(o){var n=t[o];!1===n?e.removeAttribute(o):e.setAttribute(o,t[o])})}function q(e,t,o){var n=C(e,function(e){var o=e.name;return o===t}),i=!!n&&e.some(function(e){return e.name===o&&e.enabled&&e.order<n.order});if(!i){var r='`'+t+'`';console.warn('`'+o+'`'+' modifier is required by '+r+' modifier in order to work, be sure to include it before '+r+'!')}return i}function G(e){return'end'===e?'start':'start'===e?'end':e}function V(e){var t=1<arguments.length&&void 0!==arguments[1]&&arguments[1],o=me.indexOf(e),n=me.slice(o+1).concat(me.slice(0,o));return t?n.reverse():n}function z(e,t,o,n){var i=e.match(/((?:\-|\+)?\d*\.?\d*)(.*)/),r=+i[1],p=i[2];if(!r)return e;if(0===p.indexOf('%')){var s;switch(p){case'%p':s=o;break;case'%':case'%r':default:s=n;}var d=g(s);return d[t]/100*r}if('vh'===p||'vw'===p){var a;return a='vh'===p?J(document.documentElement.clientHeight,window.innerHeight||0):J(document.documentElement.clientWidth,window.innerWidth||0),a/100*r}return r}function _(e,t,o,n){var i=[0,0],r=-1!==['right','left'].indexOf(n),p=e.split(/(\+|\-)/).map(function(e){return e.trim()}),s=p.indexOf(C(p,function(e){return-1!==e.search(/,|\s/)}));p[s]&&-1===p[s].indexOf(',')&&console.warn('Offsets separated by white space(s) are deprecated, use a comma (,) instead.');var d=/\s*,\s*|\s+/,a=-1===s?[p]:[p.slice(0,s).concat([p[s].split(d)[0]]),[p[s].split(d)[1]].concat(p.slice(s+1))];return a=a.map(function(e,n){var i=(1===n?!r:r)?'height':'width',p=!1;return e.reduce(function(e,t){return''===e[e.length-1]&&-1!==['+','-'].indexOf(t)?(e[e.length-1]=t,p=!0,e):p?(e[e.length-1]+=t,p=!1,e):e.concat(t)},[]).map(function(e){return z(e,i,t,o)})}),a.forEach(function(e,t){e.forEach(function(o,n){Y(o)&&(i[t]+=o*('-'===e[n-1]?-1:1))})}),i}function X(e,t){var o,n=t.offset,i=e.placement,r=e.offsets,p=r.popper,s=r.reference,d=i.split('-')[0];return o=Y(+n)?[+n,0]:_(n,p,s,d),'left'===d?(p.top+=o[0],p.left-=o[1]):'right'===d?(p.top+=o[0],p.left+=o[1]):'top'===d?(p.left+=o[0],p.top-=o[1]):'bottom'===d&&(p.left+=o[0],p.top+=o[1]),e.popper=p,e}for(var Q=Math.min,Z=Math.round,$=Math.floor,J=Math.max,ee='undefined'!=typeof window&&'undefined'!=typeof document,te=['Edge','Trident','Firefox'],oe=0,ne=0;ne<te.length;ne+=1)if(ee&&0<=navigator.userAgent.indexOf(te[ne])){oe=1;break}var i=ee&&window.Promise,ie=i?function(e){var t=!1;return function(){t||(t=!0,window.Promise.resolve().then(function(){t=!1,e()}))}}:function(e){var t=!1;return function(){t||(t=!0,setTimeout(function(){t=!1,e()},oe))}},re=ee&&!!(window.MSInputMethodContext&&document.documentMode),pe=ee&&/MSIE 10/.test(navigator.userAgent),se=function(e,t){if(!(e instanceof t))throw new TypeError('Cannot call a class as a function')},de=function(){function e(e,t){for(var o,n=0;n<t.length;n++)o=t[n],o.enumerable=o.enumerable||!1,o.configurable=!0,'value'in o&&(o.writable=!0),Object.defineProperty(e,o.key,o)}return function(t,o,n){return o&&e(t.prototype,o),n&&e(t,n),t}}(),ae=function(e,t,o){return t in e?Object.defineProperty(e,t,{value:o,enumerable:!0,configurable:!0,writable:!0}):e[t]=o,e},le=Object.assign||function(e){for(var t,o=1;o<arguments.length;o++)for(var n in t=arguments[o],t)Object.prototype.hasOwnProperty.call(t,n)&&(e[n]=t[n]);return e},fe=['auto-start','auto','auto-end','top-start','top','top-end','right-start','right','right-end','bottom-end','bottom','bottom-start','left-end','left','left-start'],me=fe.slice(3),he={FLIP:'flip',CLOCKWISE:'clockwise',COUNTERCLOCKWISE:'counterclockwise'},ce=function(){function t(o,n){var i=this,r=2<arguments.length&&void 0!==arguments[2]?arguments[2]:{};se(this,t),this.scheduleUpdate=function(){return requestAnimationFrame(i.update)},this.update=ie(this.update.bind(this)),this.options=le({},t.Defaults,r),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=o&&o.jquery?o[0]:o,this.popper=n&&n.jquery?n[0]:n,this.options.modifiers={},Object.keys(le({},t.Defaults.modifiers,r.modifiers)).forEach(function(e){i.options.modifiers[e]=le({},t.Defaults.modifiers[e]||{},r.modifiers?r.modifiers[e]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(e){return le({name:e},i.options.modifiers[e])}).sort(function(e,t){return e.order-t.order}),this.modifiers.forEach(function(t){t.enabled&&e(t.onLoad)&&t.onLoad(i.reference,i.popper,i.options,t,i.state)}),this.update();var p=this.options.eventsEnabled;p&&this.enableEventListeners(),this.state.eventsEnabled=p}return de(t,[{key:'update',value:function(){return k.call(this)}},{key:'destroy',value:function(){return B.call(this)}},{key:'enableEventListeners',value:function(){return I.call(this)}},{key:'disableEventListeners',value:function(){return U.call(this)}}]),t}();return ce.Utils=('undefined'==typeof window?global:window).PopperUtils,ce.placements=fe,ce.Defaults={placement:'bottom',positionFixed:!1,eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(e){var t=e.placement,o=t.split('-')[0],n=t.split('-')[1];if(n){var i=e.offsets,r=i.reference,p=i.popper,s=-1!==['bottom','top'].indexOf(o),d=s?'left':'top',a=s?'width':'height',l={start:ae({},d,r[d]),end:ae({},d,r[d]+r[a]-p[a])};e.offsets.popper=le({},p,l[n])}return e}},offset:{order:200,enabled:!0,fn:X,offset:0},preventOverflow:{order:300,enabled:!0,fn:function(e,t){var o=t.boundariesElement||p(e.instance.popper);e.instance.reference===o&&(o=p(o));var n=H('transform'),i=e.instance.popper.style,r=i.top,s=i.left,d=i[n];i.top='',i.left='',i[n]='';var a=v(e.instance.popper,e.instance.reference,t.padding,o,e.positionFixed);i.top=r,i.left=s,i[n]=d,t.boundaries=a;var l=t.priority,f=e.offsets.popper,m={primary:function(e){var o=f[e];return f[e]<a[e]&&!t.escapeWithReference&&(o=J(f[e],a[e])),ae({},e,o)},secondary:function(e){var o='right'===e?'left':'top',n=f[o];return f[e]>a[e]&&!t.escapeWithReference&&(n=Q(f[o],a[e]-('right'===e?f.width:f.height))),ae({},o,n)}};return l.forEach(function(e){var t=-1===['left','top'].indexOf(e)?'secondary':'primary';f=le({},f,m[t](e))}),e.offsets.popper=f,e},priority:['left','right','top','bottom'],padding:5,boundariesElement:'scrollParent'},keepTogether:{order:400,enabled:!0,fn:function(e){var t=e.offsets,o=t.popper,n=t.reference,i=e.placement.split('-')[0],r=$,p=-1!==['top','bottom'].indexOf(i),s=p?'right':'bottom',d=p?'left':'top',a=p?'width':'height';return o[s]<r(n[d])&&(e.offsets.popper[d]=r(n[d])-o[a]),o[d]>r(n[s])&&(e.offsets.popper[d]=r(n[s])),e}},arrow:{order:500,enabled:!0,fn:function(e,o){var n;if(!q(e.instance.modifiers,'arrow','keepTogether'))return e;var i=o.element;if('string'==typeof i){if(i=e.instance.popper.querySelector(i),!i)return e;}else if(!e.instance.popper.contains(i))return console.warn('WARNING: `arrow.element` must be child of its popper element!'),e;var r=e.placement.split('-')[0],p=e.offsets,s=p.popper,d=p.reference,a=-1!==['left','right'].indexOf(r),l=a?'height':'width',f=a?'Top':'Left',m=f.toLowerCase(),h=a?'left':'top',c=a?'bottom':'right',u=S(i)[l];d[c]-u<s[m]&&(e.offsets.popper[m]-=s[m]-(d[c]-u)),d[m]+u>s[c]&&(e.offsets.popper[m]+=d[m]+u-s[c]),e.offsets.popper=g(e.offsets.popper);var b=d[m]+d[l]/2-u/2,y=t(e.instance.popper),w=parseFloat(y['margin'+f],10),E=parseFloat(y['border'+f+'Width'],10),v=b-e.offsets.popper[m]-w-E;return v=J(Q(s[l]-u,v),0),e.arrowElement=i,e.offsets.arrow=(n={},ae(n,m,Z(v)),ae(n,h,''),n),e},element:'[x-arrow]'},flip:{order:600,enabled:!0,fn:function(e,t){if(W(e.instance.modifiers,'inner'))return e;if(e.flipped&&e.placement===e.originalPlacement)return e;var o=v(e.instance.popper,e.instance.reference,t.padding,t.boundariesElement,e.positionFixed),n=e.placement.split('-')[0],i=T(n),r=e.placement.split('-')[1]||'',p=[];switch(t.behavior){case he.FLIP:p=[n,i];break;case he.CLOCKWISE:p=V(n);break;case he.COUNTERCLOCKWISE:p=V(n,!0);break;default:p=t.behavior;}return p.forEach(function(s,d){if(n!==s||p.length===d+1)return e;n=e.placement.split('-')[0],i=T(n);var a=e.offsets.popper,l=e.offsets.reference,f=$,m='left'===n&&f(a.right)>f(l.left)||'right'===n&&f(a.left)<f(l.right)||'top'===n&&f(a.bottom)>f(l.top)||'bottom'===n&&f(a.top)<f(l.bottom),h=f(a.left)<f(o.left),c=f(a.right)>f(o.right),g=f(a.top)<f(o.top),u=f(a.bottom)>f(o.bottom),b='left'===n&&h||'right'===n&&c||'top'===n&&g||'bottom'===n&&u,y=-1!==['top','bottom'].indexOf(n),w=!!t.flipVariations&&(y&&'start'===r&&h||y&&'end'===r&&c||!y&&'start'===r&&g||!y&&'end'===r&&u);(m||b||w)&&(e.flipped=!0,(m||b)&&(n=p[d+1]),w&&(r=G(r)),e.placement=n+(r?'-'+r:''),e.offsets.popper=le({},e.offsets.popper,D(e.instance.popper,e.offsets.reference,e.placement)),e=P(e.instance.modifiers,e,'flip'))}),e},behavior:'flip',padding:5,boundariesElement:'viewport'},inner:{order:700,enabled:!1,fn:function(e){var t=e.placement,o=t.split('-')[0],n=e.offsets,i=n.popper,r=n.reference,p=-1!==['left','right'].indexOf(o),s=-1===['top','left'].indexOf(o);return i[p?'left':'top']=r[o]-(s?i[p?'width':'height']:0),e.placement=T(t),e.offsets.popper=g(i),e}},hide:{order:800,enabled:!0,fn:function(e){if(!q(e.instance.modifiers,'hide','preventOverflow'))return e;var t=e.offsets.reference,o=C(e.instance.modifiers,function(e){return'preventOverflow'===e.name}).boundaries;if(t.bottom<o.top||t.left>o.right||t.top>o.bottom||t.right<o.left){if(!0===e.hide)return e;e.hide=!0,e.attributes['x-out-of-boundaries']=''}else{if(!1===e.hide)return e;e.hide=!1,e.attributes['x-out-of-boundaries']=!1}return e}},computeStyle:{order:850,enabled:!0,fn:function(e,t){var o=t.x,n=t.y,i=e.offsets.popper,r=C(e.instance.modifiers,function(e){return'applyStyle'===e.name}).gpuAcceleration;void 0!==r&&console.warn('WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!');var s,d,a=void 0===r?t.gpuAcceleration:r,l=p(e.instance.popper),f=u(l),m={position:i.position},h={left:$(i.left),top:Z(i.top),bottom:Z(i.bottom),right:$(i.right)},c='bottom'===o?'top':'bottom',g='right'===n?'left':'right',b=H('transform');if(d='bottom'==c?'HTML'===l.nodeName?-l.clientHeight+h.bottom:-f.height+h.bottom:h.top,s='right'==g?'HTML'===l.nodeName?-l.clientWidth+h.right:-f.width+h.right:h.left,a&&b)m[b]='translate3d('+s+'px, '+d+'px, 0)',m[c]=0,m[g]=0,m.willChange='transform';else{var y='bottom'==c?-1:1,w='right'==g?-1:1;m[c]=d*y,m[g]=s*w,m.willChange=c+', '+g}var E={"x-placement":e.placement};return e.attributes=le({},E,e.attributes),e.styles=le({},m,e.styles),e.arrowStyles=le({},e.offsets.arrow,e.arrowStyles),e},gpuAcceleration:!0,x:'bottom',y:'right'},applyStyle:{order:900,enabled:!0,fn:function(e){return j(e.instance.popper,e.styles),K(e.instance.popper,e.attributes),e.arrowElement&&Object.keys(e.arrowStyles).length&&j(e.arrowElement,e.arrowStyles),e},onLoad:function(e,t,o,n,i){var r=L(i,t,e,o.positionFixed),p=O(o.placement,r,t,e,o.modifiers.flip.boundariesElement,o.modifiers.flip.padding);return t.setAttribute('x-placement',p),j(t,{position:o.positionFixed?'fixed':'absolute'}),o},gpuAcceleration:void 0}}},ce}); +//# sourceMappingURL=popper.min.js.map diff --git a/js/theme.js b/js/theme.js new file mode 100644 index 0000000..6dd998c --- /dev/null +++ b/js/theme.js @@ -0,0 +1,6540 @@ +/*! + * Bootstrap v4.1.3 (https://getbootstrap.com/) + * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + */ +(function (global, factory) { + typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports, require('jquery')) : + typeof define === 'function' && define.amd ? define(['exports', 'jquery'], factory) : + (factory((global.bootstrap = {}),global.jQuery)); +}(this, (function (exports,$) { 'use strict'; + + $ = $ && $.hasOwnProperty('default') ? $['default'] : $; + + function _defineProperties(target, props) { + for (var i = 0; i < props.length; i++) { + var descriptor = props[i]; + descriptor.enumerable = descriptor.enumerable || false; + descriptor.configurable = true; + if ("value" in descriptor) descriptor.writable = true; + Object.defineProperty(target, descriptor.key, descriptor); + } + } + + function _createClass(Constructor, protoProps, staticProps) { + if (protoProps) _defineProperties(Constructor.prototype, protoProps); + if (staticProps) _defineProperties(Constructor, staticProps); + return Constructor; + } + + function _defineProperty(obj, key, value) { + if (key in obj) { + Object.defineProperty(obj, key, { + value: value, + enumerable: true, + configurable: true, + writable: true + }); + } else { + obj[key] = value; + } + + return obj; + } + + function _objectSpread(target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i] != null ? arguments[i] : {}; + var ownKeys = Object.keys(source); + + if (typeof Object.getOwnPropertySymbols === 'function') { + ownKeys = ownKeys.concat(Object.getOwnPropertySymbols(source).filter(function (sym) { + return Object.getOwnPropertyDescriptor(source, sym).enumerable; + })); + } + + ownKeys.forEach(function (key) { + _defineProperty(target, key, source[key]); + }); + } + + return target; + } + + function _inheritsLoose(subClass, superClass) { + subClass.prototype = Object.create(superClass.prototype); + subClass.prototype.constructor = subClass; + subClass.__proto__ = superClass; + } + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v4.1.3): util.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + + var Util = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Private TransitionEnd Helpers + * ------------------------------------------------------------------------ + */ + var TRANSITION_END = 'transitionend'; + var MAX_UID = 1000000; + var MILLISECONDS_MULTIPLIER = 1000; // Shoutout AngusCroll (https://goo.gl/pxwQGp) + + function toType(obj) { + return {}.toString.call(obj).match(/\s([a-z]+)/i)[1].toLowerCase(); + } + + function getSpecialTransitionEndEvent() { + return { + bindType: TRANSITION_END, + delegateType: TRANSITION_END, + handle: function handle(event) { + if ($$$1(event.target).is(this)) { + return event.handleObj.handler.apply(this, arguments); // eslint-disable-line prefer-rest-params + } + + return undefined; // eslint-disable-line no-undefined + } + }; + } + + function transitionEndEmulator(duration) { + var _this = this; + + var called = false; + $$$1(this).one(Util.TRANSITION_END, function () { + called = true; + }); + setTimeout(function () { + if (!called) { + Util.triggerTransitionEnd(_this); + } + }, duration); + return this; + } + + function setTransitionEndSupport() { + $$$1.fn.emulateTransitionEnd = transitionEndEmulator; + $$$1.event.special[Util.TRANSITION_END] = getSpecialTransitionEndEvent(); + } + /** + * -------------------------------------------------------------------------- + * Public Util Api + * -------------------------------------------------------------------------- + */ + + + var Util = { + TRANSITION_END: 'bsTransitionEnd', + getUID: function getUID(prefix) { + do { + // eslint-disable-next-line no-bitwise + prefix += ~~(Math.random() * MAX_UID); // "~~" acts like a faster Math.floor() here + } while (document.getElementById(prefix)); + + return prefix; + }, + getSelectorFromElement: function getSelectorFromElement(element) { + var selector = element.getAttribute('data-target'); + + if (!selector || selector === '#') { + selector = element.getAttribute('href') || ''; + } + + try { + return document.querySelector(selector) ? selector : null; + } catch (err) { + return null; + } + }, + getTransitionDurationFromElement: function getTransitionDurationFromElement(element) { + if (!element) { + return 0; + } // Get transition-duration of the element + + + var transitionDuration = $$$1(element).css('transition-duration'); + var floatTransitionDuration = parseFloat(transitionDuration); // Return 0 if element or transition duration is not found + + if (!floatTransitionDuration) { + return 0; + } // If multiple durations are defined, take the first + + + transitionDuration = transitionDuration.split(',')[0]; + return parseFloat(transitionDuration) * MILLISECONDS_MULTIPLIER; + }, + reflow: function reflow(element) { + return element.offsetHeight; + }, + triggerTransitionEnd: function triggerTransitionEnd(element) { + $$$1(element).trigger(TRANSITION_END); + }, + // TODO: Remove in v5 + supportsTransitionEnd: function supportsTransitionEnd() { + return Boolean(TRANSITION_END); + }, + isElement: function isElement(obj) { + return (obj[0] || obj).nodeType; + }, + typeCheckConfig: function typeCheckConfig(componentName, config, configTypes) { + for (var property in configTypes) { + if (Object.prototype.hasOwnProperty.call(configTypes, property)) { + var expectedTypes = configTypes[property]; + var value = config[property]; + var valueType = value && Util.isElement(value) ? 'element' : toType(value); + + if (!new RegExp(expectedTypes).test(valueType)) { + throw new Error(componentName.toUpperCase() + ": " + ("Option \"" + property + "\" provided type \"" + valueType + "\" ") + ("but expected type \"" + expectedTypes + "\".")); + } + } + } + } + }; + setTransitionEndSupport(); + return Util; + }($); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v4.1.3): alert.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + + var Alert = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'alert'; + var VERSION = '4.1.3'; + var DATA_KEY = 'bs.alert'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var Selector = { + DISMISS: '[data-dismiss="alert"]' + }; + var Event = { + CLOSE: "close" + EVENT_KEY, + CLOSED: "closed" + EVENT_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + ALERT: 'alert', + FADE: 'fade', + SHOW: 'show' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Alert = + /*#__PURE__*/ + function () { + function Alert(element) { + this._element = element; + } // Getters + + + var _proto = Alert.prototype; + + // Public + _proto.close = function close(element) { + var rootElement = this._element; + + if (element) { + rootElement = this._getRootElement(element); + } + + var customEvent = this._triggerCloseEvent(rootElement); + + if (customEvent.isDefaultPrevented()) { + return; + } + + this._removeElement(rootElement); + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + this._element = null; + }; // Private + + + _proto._getRootElement = function _getRootElement(element) { + var selector = Util.getSelectorFromElement(element); + var parent = false; + + if (selector) { + parent = document.querySelector(selector); + } + + if (!parent) { + parent = $$$1(element).closest("." + ClassName.ALERT)[0]; + } + + return parent; + }; + + _proto._triggerCloseEvent = function _triggerCloseEvent(element) { + var closeEvent = $$$1.Event(Event.CLOSE); + $$$1(element).trigger(closeEvent); + return closeEvent; + }; + + _proto._removeElement = function _removeElement(element) { + var _this = this; + + $$$1(element).removeClass(ClassName.SHOW); + + if (!$$$1(element).hasClass(ClassName.FADE)) { + this._destroyElement(element); + + return; + } + + var transitionDuration = Util.getTransitionDurationFromElement(element); + $$$1(element).one(Util.TRANSITION_END, function (event) { + return _this._destroyElement(element, event); + }).emulateTransitionEnd(transitionDuration); + }; + + _proto._destroyElement = function _destroyElement(element) { + $$$1(element).detach().trigger(Event.CLOSED).remove(); + }; // Static + + + Alert._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var $element = $$$1(this); + var data = $element.data(DATA_KEY); + + if (!data) { + data = new Alert(this); + $element.data(DATA_KEY, data); + } + + if (config === 'close') { + data[config](this); + } + }); + }; + + Alert._handleDismiss = function _handleDismiss(alertInstance) { + return function (event) { + if (event) { + event.preventDefault(); + } + + alertInstance.close(this); + }; + }; + + _createClass(Alert, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }]); + + return Alert; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DISMISS, Alert._handleDismiss(new Alert())); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Alert._jQueryInterface; + $$$1.fn[NAME].Constructor = Alert; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Alert._jQueryInterface; + }; + + return Alert; + }($); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v4.1.3): button.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + + var Button = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'button'; + var VERSION = '4.1.3'; + var DATA_KEY = 'bs.button'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var ClassName = { + ACTIVE: 'active', + BUTTON: 'btn', + FOCUS: 'focus' + }; + var Selector = { + DATA_TOGGLE_CARROT: '[data-toggle^="button"]', + DATA_TOGGLE: '[data-toggle="buttons"]', + INPUT: 'input', + ACTIVE: '.active', + BUTTON: '.btn' + }; + var Event = { + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY, + FOCUS_BLUR_DATA_API: "focus" + EVENT_KEY + DATA_API_KEY + " " + ("blur" + EVENT_KEY + DATA_API_KEY) + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Button = + /*#__PURE__*/ + function () { + function Button(element) { + this._element = element; + } // Getters + + + var _proto = Button.prototype; + + // Public + _proto.toggle = function toggle() { + var triggerChangeEvent = true; + var addAriaPressed = true; + var rootElement = $$$1(this._element).closest(Selector.DATA_TOGGLE)[0]; + + if (rootElement) { + var input = this._element.querySelector(Selector.INPUT); + + if (input) { + if (input.type === 'radio') { + if (input.checked && this._element.classList.contains(ClassName.ACTIVE)) { + triggerChangeEvent = false; + } else { + var activeElement = rootElement.querySelector(Selector.ACTIVE); + + if (activeElement) { + $$$1(activeElement).removeClass(ClassName.ACTIVE); + } + } + } + + if (triggerChangeEvent) { + if (input.hasAttribute('disabled') || rootElement.hasAttribute('disabled') || input.classList.contains('disabled') || rootElement.classList.contains('disabled')) { + return; + } + + input.checked = !this._element.classList.contains(ClassName.ACTIVE); + $$$1(input).trigger('change'); + } + + input.focus(); + addAriaPressed = false; + } + } + + if (addAriaPressed) { + this._element.setAttribute('aria-pressed', !this._element.classList.contains(ClassName.ACTIVE)); + } + + if (triggerChangeEvent) { + $$$1(this._element).toggleClass(ClassName.ACTIVE); + } + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + this._element = null; + }; // Static + + + Button._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + if (!data) { + data = new Button(this); + $$$1(this).data(DATA_KEY, data); + } + + if (config === 'toggle') { + data[config](); + } + }); + }; + + _createClass(Button, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }]); + + return Button; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) { + event.preventDefault(); + var button = event.target; + + if (!$$$1(button).hasClass(ClassName.BUTTON)) { + button = $$$1(button).closest(Selector.BUTTON); + } + + Button._jQueryInterface.call($$$1(button), 'toggle'); + }).on(Event.FOCUS_BLUR_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) { + var button = $$$1(event.target).closest(Selector.BUTTON)[0]; + $$$1(button).toggleClass(ClassName.FOCUS, /^focus(in)?$/.test(event.type)); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Button._jQueryInterface; + $$$1.fn[NAME].Constructor = Button; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Button._jQueryInterface; + }; + + return Button; + }($); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v4.1.3): carousel.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + + var Carousel = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'carousel'; + var VERSION = '4.1.3'; + var DATA_KEY = 'bs.carousel'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var ARROW_LEFT_KEYCODE = 37; // KeyboardEvent.which value for left arrow key + + var ARROW_RIGHT_KEYCODE = 39; // KeyboardEvent.which value for right arrow key + + var TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch + + var Default = { + interval: 5000, + keyboard: true, + slide: false, + pause: 'hover', + wrap: true + }; + var DefaultType = { + interval: '(number|boolean)', + keyboard: 'boolean', + slide: '(boolean|string)', + pause: '(string|boolean)', + wrap: 'boolean' + }; + var Direction = { + NEXT: 'next', + PREV: 'prev', + LEFT: 'left', + RIGHT: 'right' + }; + var Event = { + SLIDE: "slide" + EVENT_KEY, + SLID: "slid" + EVENT_KEY, + KEYDOWN: "keydown" + EVENT_KEY, + MOUSEENTER: "mouseenter" + EVENT_KEY, + MOUSELEAVE: "mouseleave" + EVENT_KEY, + TOUCHEND: "touchend" + EVENT_KEY, + LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + CAROUSEL: 'carousel', + ACTIVE: 'active', + SLIDE: 'slide', + RIGHT: 'carousel-item-right', + LEFT: 'carousel-item-left', + NEXT: 'carousel-item-next', + PREV: 'carousel-item-prev', + ITEM: 'carousel-item' + }; + var Selector = { + ACTIVE: '.active', + ACTIVE_ITEM: '.active.carousel-item', + ITEM: '.carousel-item', + NEXT_PREV: '.carousel-item-next, .carousel-item-prev', + INDICATORS: '.carousel-indicators', + DATA_SLIDE: '[data-slide], [data-slide-to]', + DATA_RIDE: '[data-ride="carousel"]' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Carousel = + /*#__PURE__*/ + function () { + function Carousel(element, config) { + this._items = null; + this._interval = null; + this._activeElement = null; + this._isPaused = false; + this._isSliding = false; + this.touchTimeout = null; + this._config = this._getConfig(config); + this._element = $$$1(element)[0]; + this._indicatorsElement = this._element.querySelector(Selector.INDICATORS); + + this._addEventListeners(); + } // Getters + + + var _proto = Carousel.prototype; + + // Public + _proto.next = function next() { + if (!this._isSliding) { + this._slide(Direction.NEXT); + } + }; + + _proto.nextWhenVisible = function nextWhenVisible() { + // Don't call next when the page isn't visible + // or the carousel or its parent isn't visible + if (!document.hidden && $$$1(this._element).is(':visible') && $$$1(this._element).css('visibility') !== 'hidden') { + this.next(); + } + }; + + _proto.prev = function prev() { + if (!this._isSliding) { + this._slide(Direction.PREV); + } + }; + + _proto.pause = function pause(event) { + if (!event) { + this._isPaused = true; + } + + if (this._element.querySelector(Selector.NEXT_PREV)) { + Util.triggerTransitionEnd(this._element); + this.cycle(true); + } + + clearInterval(this._interval); + this._interval = null; + }; + + _proto.cycle = function cycle(event) { + if (!event) { + this._isPaused = false; + } + + if (this._interval) { + clearInterval(this._interval); + this._interval = null; + } + + if (this._config.interval && !this._isPaused) { + this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval); + } + }; + + _proto.to = function to(index) { + var _this = this; + + this._activeElement = this._element.querySelector(Selector.ACTIVE_ITEM); + + var activeIndex = this._getItemIndex(this._activeElement); + + if (index > this._items.length - 1 || index < 0) { + return; + } + + if (this._isSliding) { + $$$1(this._element).one(Event.SLID, function () { + return _this.to(index); + }); + return; + } + + if (activeIndex === index) { + this.pause(); + this.cycle(); + return; + } + + var direction = index > activeIndex ? Direction.NEXT : Direction.PREV; + + this._slide(direction, this._items[index]); + }; + + _proto.dispose = function dispose() { + $$$1(this._element).off(EVENT_KEY); + $$$1.removeData(this._element, DATA_KEY); + this._items = null; + this._config = null; + this._element = null; + this._interval = null; + this._isPaused = null; + this._isSliding = null; + this._activeElement = null; + this._indicatorsElement = null; + }; // Private + + + _proto._getConfig = function _getConfig(config) { + config = _objectSpread({}, Default, config); + Util.typeCheckConfig(NAME, config, DefaultType); + return config; + }; + + _proto._addEventListeners = function _addEventListeners() { + var _this2 = this; + + if (this._config.keyboard) { + $$$1(this._element).on(Event.KEYDOWN, function (event) { + return _this2._keydown(event); + }); + } + + if (this._config.pause === 'hover') { + $$$1(this._element).on(Event.MOUSEENTER, function (event) { + return _this2.pause(event); + }).on(Event.MOUSELEAVE, function (event) { + return _this2.cycle(event); + }); + + if ('ontouchstart' in document.documentElement) { + // If it's a touch-enabled device, mouseenter/leave are fired as + // part of the mouse compatibility events on first tap - the carousel + // would stop cycling until user tapped out of it; + // here, we listen for touchend, explicitly pause the carousel + // (as if it's the second time we tap on it, mouseenter compat event + // is NOT fired) and after a timeout (to allow for mouse compatibility + // events to fire) we explicitly restart cycling + $$$1(this._element).on(Event.TOUCHEND, function () { + _this2.pause(); + + if (_this2.touchTimeout) { + clearTimeout(_this2.touchTimeout); + } + + _this2.touchTimeout = setTimeout(function (event) { + return _this2.cycle(event); + }, TOUCHEVENT_COMPAT_WAIT + _this2._config.interval); + }); + } + } + }; + + _proto._keydown = function _keydown(event) { + if (/input|textarea/i.test(event.target.tagName)) { + return; + } + + switch (event.which) { + case ARROW_LEFT_KEYCODE: + event.preventDefault(); + this.prev(); + break; + + case ARROW_RIGHT_KEYCODE: + event.preventDefault(); + this.next(); + break; + + default: + } + }; + + _proto._getItemIndex = function _getItemIndex(element) { + this._items = element && element.parentNode ? [].slice.call(element.parentNode.querySelectorAll(Selector.ITEM)) : []; + return this._items.indexOf(element); + }; + + _proto._getItemByDirection = function _getItemByDirection(direction, activeElement) { + var isNextDirection = direction === Direction.NEXT; + var isPrevDirection = direction === Direction.PREV; + + var activeIndex = this._getItemIndex(activeElement); + + var lastItemIndex = this._items.length - 1; + var isGoingToWrap = isPrevDirection && activeIndex === 0 || isNextDirection && activeIndex === lastItemIndex; + + if (isGoingToWrap && !this._config.wrap) { + return activeElement; + } + + var delta = direction === Direction.PREV ? -1 : 1; + var itemIndex = (activeIndex + delta) % this._items.length; + return itemIndex === -1 ? this._items[this._items.length - 1] : this._items[itemIndex]; + }; + + _proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) { + var targetIndex = this._getItemIndex(relatedTarget); + + var fromIndex = this._getItemIndex(this._element.querySelector(Selector.ACTIVE_ITEM)); + + var slideEvent = $$$1.Event(Event.SLIDE, { + relatedTarget: relatedTarget, + direction: eventDirectionName, + from: fromIndex, + to: targetIndex + }); + $$$1(this._element).trigger(slideEvent); + return slideEvent; + }; + + _proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) { + if (this._indicatorsElement) { + var indicators = [].slice.call(this._indicatorsElement.querySelectorAll(Selector.ACTIVE)); + $$$1(indicators).removeClass(ClassName.ACTIVE); + + var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)]; + + if (nextIndicator) { + $$$1(nextIndicator).addClass(ClassName.ACTIVE); + } + } + }; + + _proto._slide = function _slide(direction, element) { + var _this3 = this; + + var activeElement = this._element.querySelector(Selector.ACTIVE_ITEM); + + var activeElementIndex = this._getItemIndex(activeElement); + + var nextElement = element || activeElement && this._getItemByDirection(direction, activeElement); + + var nextElementIndex = this._getItemIndex(nextElement); + + var isCycling = Boolean(this._interval); + var directionalClassName; + var orderClassName; + var eventDirectionName; + + if (direction === Direction.NEXT) { + directionalClassName = ClassName.LEFT; + orderClassName = ClassName.NEXT; + eventDirectionName = Direction.LEFT; + } else { + directionalClassName = ClassName.RIGHT; + orderClassName = ClassName.PREV; + eventDirectionName = Direction.RIGHT; + } + + if (nextElement && $$$1(nextElement).hasClass(ClassName.ACTIVE)) { + this._isSliding = false; + return; + } + + var slideEvent = this._triggerSlideEvent(nextElement, eventDirectionName); + + if (slideEvent.isDefaultPrevented()) { + return; + } + + if (!activeElement || !nextElement) { + // Some weirdness is happening, so we bail + return; + } + + this._isSliding = true; + + if (isCycling) { + this.pause(); + } + + this._setActiveIndicatorElement(nextElement); + + var slidEvent = $$$1.Event(Event.SLID, { + relatedTarget: nextElement, + direction: eventDirectionName, + from: activeElementIndex, + to: nextElementIndex + }); + + if ($$$1(this._element).hasClass(ClassName.SLIDE)) { + $$$1(nextElement).addClass(orderClassName); + Util.reflow(nextElement); + $$$1(activeElement).addClass(directionalClassName); + $$$1(nextElement).addClass(directionalClassName); + var transitionDuration = Util.getTransitionDurationFromElement(activeElement); + $$$1(activeElement).one(Util.TRANSITION_END, function () { + $$$1(nextElement).removeClass(directionalClassName + " " + orderClassName).addClass(ClassName.ACTIVE); + $$$1(activeElement).removeClass(ClassName.ACTIVE + " " + orderClassName + " " + directionalClassName); + _this3._isSliding = false; + setTimeout(function () { + return $$$1(_this3._element).trigger(slidEvent); + }, 0); + }).emulateTransitionEnd(transitionDuration); + } else { + $$$1(activeElement).removeClass(ClassName.ACTIVE); + $$$1(nextElement).addClass(ClassName.ACTIVE); + this._isSliding = false; + $$$1(this._element).trigger(slidEvent); + } + + if (isCycling) { + this.cycle(); + } + }; // Static + + + Carousel._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = _objectSpread({}, Default, $$$1(this).data()); + + if (typeof config === 'object') { + _config = _objectSpread({}, _config, config); + } + + var action = typeof config === 'string' ? config : _config.slide; + + if (!data) { + data = new Carousel(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'number') { + data.to(config); + } else if (typeof action === 'string') { + if (typeof data[action] === 'undefined') { + throw new TypeError("No method named \"" + action + "\""); + } + + data[action](); + } else if (_config.interval) { + data.pause(); + data.cycle(); + } + }); + }; + + Carousel._dataApiClickHandler = function _dataApiClickHandler(event) { + var selector = Util.getSelectorFromElement(this); + + if (!selector) { + return; + } + + var target = $$$1(selector)[0]; + + if (!target || !$$$1(target).hasClass(ClassName.CAROUSEL)) { + return; + } + + var config = _objectSpread({}, $$$1(target).data(), $$$1(this).data()); + + var slideIndex = this.getAttribute('data-slide-to'); + + if (slideIndex) { + config.interval = false; + } + + Carousel._jQueryInterface.call($$$1(target), config); + + if (slideIndex) { + $$$1(target).data(DATA_KEY).to(slideIndex); + } + + event.preventDefault(); + }; + + _createClass(Carousel, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }]); + + return Carousel; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_SLIDE, Carousel._dataApiClickHandler); + $$$1(window).on(Event.LOAD_DATA_API, function () { + var carousels = [].slice.call(document.querySelectorAll(Selector.DATA_RIDE)); + + for (var i = 0, len = carousels.length; i < len; i++) { + var $carousel = $$$1(carousels[i]); + + Carousel._jQueryInterface.call($carousel, $carousel.data()); + } + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Carousel._jQueryInterface; + $$$1.fn[NAME].Constructor = Carousel; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Carousel._jQueryInterface; + }; + + return Carousel; + }($); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v4.1.3): collapse.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + + var Collapse = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'collapse'; + var VERSION = '4.1.3'; + var DATA_KEY = 'bs.collapse'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var Default = { + toggle: true, + parent: '' + }; + var DefaultType = { + toggle: 'boolean', + parent: '(string|element)' + }; + var Event = { + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + SHOW: 'show', + COLLAPSE: 'collapse', + COLLAPSING: 'collapsing', + COLLAPSED: 'collapsed' + }; + var Dimension = { + WIDTH: 'width', + HEIGHT: 'height' + }; + var Selector = { + ACTIVES: '.show, .collapsing', + DATA_TOGGLE: '[data-toggle="collapse"]' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Collapse = + /*#__PURE__*/ + function () { + function Collapse(element, config) { + this._isTransitioning = false; + this._element = element; + this._config = this._getConfig(config); + this._triggerArray = $$$1.makeArray(document.querySelectorAll("[data-toggle=\"collapse\"][href=\"#" + element.id + "\"]," + ("[data-toggle=\"collapse\"][data-target=\"#" + element.id + "\"]"))); + var toggleList = [].slice.call(document.querySelectorAll(Selector.DATA_TOGGLE)); + + for (var i = 0, len = toggleList.length; i < len; i++) { + var elem = toggleList[i]; + var selector = Util.getSelectorFromElement(elem); + var filterElement = [].slice.call(document.querySelectorAll(selector)).filter(function (foundElem) { + return foundElem === element; + }); + + if (selector !== null && filterElement.length > 0) { + this._selector = selector; + + this._triggerArray.push(elem); + } + } + + this._parent = this._config.parent ? this._getParent() : null; + + if (!this._config.parent) { + this._addAriaAndCollapsedClass(this._element, this._triggerArray); + } + + if (this._config.toggle) { + this.toggle(); + } + } // Getters + + + var _proto = Collapse.prototype; + + // Public + _proto.toggle = function toggle() { + if ($$$1(this._element).hasClass(ClassName.SHOW)) { + this.hide(); + } else { + this.show(); + } + }; + + _proto.show = function show() { + var _this = this; + + if (this._isTransitioning || $$$1(this._element).hasClass(ClassName.SHOW)) { + return; + } + + var actives; + var activesData; + + if (this._parent) { + actives = [].slice.call(this._parent.querySelectorAll(Selector.ACTIVES)).filter(function (elem) { + return elem.getAttribute('data-parent') === _this._config.parent; + }); + + if (actives.length === 0) { + actives = null; + } + } + + if (actives) { + activesData = $$$1(actives).not(this._selector).data(DATA_KEY); + + if (activesData && activesData._isTransitioning) { + return; + } + } + + var startEvent = $$$1.Event(Event.SHOW); + $$$1(this._element).trigger(startEvent); + + if (startEvent.isDefaultPrevented()) { + return; + } + + if (actives) { + Collapse._jQueryInterface.call($$$1(actives).not(this._selector), 'hide'); + + if (!activesData) { + $$$1(actives).data(DATA_KEY, null); + } + } + + var dimension = this._getDimension(); + + $$$1(this._element).removeClass(ClassName.COLLAPSE).addClass(ClassName.COLLAPSING); + this._element.style[dimension] = 0; + + if (this._triggerArray.length) { + $$$1(this._triggerArray).removeClass(ClassName.COLLAPSED).attr('aria-expanded', true); + } + + this.setTransitioning(true); + + var complete = function complete() { + $$$1(_this._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).addClass(ClassName.SHOW); + _this._element.style[dimension] = ''; + + _this.setTransitioning(false); + + $$$1(_this._element).trigger(Event.SHOWN); + }; + + var capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1); + var scrollSize = "scroll" + capitalizedDimension; + var transitionDuration = Util.getTransitionDurationFromElement(this._element); + $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration); + this._element.style[dimension] = this._element[scrollSize] + "px"; + }; + + _proto.hide = function hide() { + var _this2 = this; + + if (this._isTransitioning || !$$$1(this._element).hasClass(ClassName.SHOW)) { + return; + } + + var startEvent = $$$1.Event(Event.HIDE); + $$$1(this._element).trigger(startEvent); + + if (startEvent.isDefaultPrevented()) { + return; + } + + var dimension = this._getDimension(); + + this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px"; + Util.reflow(this._element); + $$$1(this._element).addClass(ClassName.COLLAPSING).removeClass(ClassName.COLLAPSE).removeClass(ClassName.SHOW); + var triggerArrayLength = this._triggerArray.length; + + if (triggerArrayLength > 0) { + for (var i = 0; i < triggerArrayLength; i++) { + var trigger = this._triggerArray[i]; + var selector = Util.getSelectorFromElement(trigger); + + if (selector !== null) { + var $elem = $$$1([].slice.call(document.querySelectorAll(selector))); + + if (!$elem.hasClass(ClassName.SHOW)) { + $$$1(trigger).addClass(ClassName.COLLAPSED).attr('aria-expanded', false); + } + } + } + } + + this.setTransitioning(true); + + var complete = function complete() { + _this2.setTransitioning(false); + + $$$1(_this2._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).trigger(Event.HIDDEN); + }; + + this._element.style[dimension] = ''; + var transitionDuration = Util.getTransitionDurationFromElement(this._element); + $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration); + }; + + _proto.setTransitioning = function setTransitioning(isTransitioning) { + this._isTransitioning = isTransitioning; + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + this._config = null; + this._parent = null; + this._element = null; + this._triggerArray = null; + this._isTransitioning = null; + }; // Private + + + _proto._getConfig = function _getConfig(config) { + config = _objectSpread({}, Default, config); + config.toggle = Boolean(config.toggle); // Coerce string values + + Util.typeCheckConfig(NAME, config, DefaultType); + return config; + }; + + _proto._getDimension = function _getDimension() { + var hasWidth = $$$1(this._element).hasClass(Dimension.WIDTH); + return hasWidth ? Dimension.WIDTH : Dimension.HEIGHT; + }; + + _proto._getParent = function _getParent() { + var _this3 = this; + + var parent = null; + + if (Util.isElement(this._config.parent)) { + parent = this._config.parent; // It's a jQuery object + + if (typeof this._config.parent.jquery !== 'undefined') { + parent = this._config.parent[0]; + } + } else { + parent = document.querySelector(this._config.parent); + } + + var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]"; + var children = [].slice.call(parent.querySelectorAll(selector)); + $$$1(children).each(function (i, element) { + _this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]); + }); + return parent; + }; + + _proto._addAriaAndCollapsedClass = function _addAriaAndCollapsedClass(element, triggerArray) { + if (element) { + var isOpen = $$$1(element).hasClass(ClassName.SHOW); + + if (triggerArray.length) { + $$$1(triggerArray).toggleClass(ClassName.COLLAPSED, !isOpen).attr('aria-expanded', isOpen); + } + } + }; // Static + + + Collapse._getTargetFromElement = function _getTargetFromElement(element) { + var selector = Util.getSelectorFromElement(element); + return selector ? document.querySelector(selector) : null; + }; + + Collapse._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var $this = $$$1(this); + var data = $this.data(DATA_KEY); + + var _config = _objectSpread({}, Default, $this.data(), typeof config === 'object' && config ? config : {}); + + if (!data && _config.toggle && /show|hide/.test(config)) { + _config.toggle = false; + } + + if (!data) { + data = new Collapse(this, _config); + $this.data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + _createClass(Collapse, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }]); + + return Collapse; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) { + // preventDefault only for <a> elements (which change the URL) not inside the collapsible element + if (event.currentTarget.tagName === 'A') { + event.preventDefault(); + } + + var $trigger = $$$1(this); + var selector = Util.getSelectorFromElement(this); + var selectors = [].slice.call(document.querySelectorAll(selector)); + $$$1(selectors).each(function () { + var $target = $$$1(this); + var data = $target.data(DATA_KEY); + var config = data ? 'toggle' : $trigger.data(); + + Collapse._jQueryInterface.call($target, config); + }); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Collapse._jQueryInterface; + $$$1.fn[NAME].Constructor = Collapse; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Collapse._jQueryInterface; + }; + + return Collapse; + }($); + + /**! + * @fileOverview Kickass library to create and place poppers near their reference elements. + * @version 1.14.3 + * @license + * Copyright (c) 2016 Federico Zivolo and contributors + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in all + * copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE + * SOFTWARE. + */ + var isBrowser = typeof window !== 'undefined' && typeof document !== 'undefined'; + + var longerTimeoutBrowsers = ['Edge', 'Trident', 'Firefox']; + var timeoutDuration = 0; + for (var i = 0; i < longerTimeoutBrowsers.length; i += 1) { + if (isBrowser && navigator.userAgent.indexOf(longerTimeoutBrowsers[i]) >= 0) { + timeoutDuration = 1; + break; + } + } + + function microtaskDebounce(fn) { + var called = false; + return function () { + if (called) { + return; + } + called = true; + window.Promise.resolve().then(function () { + called = false; + fn(); + }); + }; + } + + function taskDebounce(fn) { + var scheduled = false; + return function () { + if (!scheduled) { + scheduled = true; + setTimeout(function () { + scheduled = false; + fn(); + }, timeoutDuration); + } + }; + } + + var supportsMicroTasks = isBrowser && window.Promise; + + /** + * Create a debounced version of a method, that's asynchronously deferred + * but called in the minimum time possible. + * + * @method + * @memberof Popper.Utils + * @argument {Function} fn + * @returns {Function} + */ + var debounce = supportsMicroTasks ? microtaskDebounce : taskDebounce; + + /** + * Check if the given variable is a function + * @method + * @memberof Popper.Utils + * @argument {Any} functionToCheck - variable to check + * @returns {Boolean} answer to: is a function? + */ + function isFunction(functionToCheck) { + var getType = {}; + return functionToCheck && getType.toString.call(functionToCheck) === '[object Function]'; + } + + /** + * Get CSS computed property of the given element + * @method + * @memberof Popper.Utils + * @argument {Eement} element + * @argument {String} property + */ + function getStyleComputedProperty(element, property) { + if (element.nodeType !== 1) { + return []; + } + // NOTE: 1 DOM access here + var css = getComputedStyle(element, null); + return property ? css[property] : css; + } + + /** + * Returns the parentNode or the host of the element + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @returns {Element} parent + */ + function getParentNode(element) { + if (element.nodeName === 'HTML') { + return element; + } + return element.parentNode || element.host; + } + + /** + * Returns the scrolling parent of the given element + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @returns {Element} scroll parent + */ + function getScrollParent(element) { + // Return body, `getScroll` will take care to get the correct `scrollTop` from it + if (!element) { + return document.body; + } + + switch (element.nodeName) { + case 'HTML': + case 'BODY': + return element.ownerDocument.body; + case '#document': + return element.body; + } + + // Firefox want us to check `-x` and `-y` variations as well + + var _getStyleComputedProp = getStyleComputedProperty(element), + overflow = _getStyleComputedProp.overflow, + overflowX = _getStyleComputedProp.overflowX, + overflowY = _getStyleComputedProp.overflowY; + + if (/(auto|scroll|overlay)/.test(overflow + overflowY + overflowX)) { + return element; + } + + return getScrollParent(getParentNode(element)); + } + + var isIE11 = isBrowser && !!(window.MSInputMethodContext && document.documentMode); + var isIE10 = isBrowser && /MSIE 10/.test(navigator.userAgent); + + /** + * Determines if the browser is Internet Explorer + * @method + * @memberof Popper.Utils + * @param {Number} version to check + * @returns {Boolean} isIE + */ + function isIE(version) { + if (version === 11) { + return isIE11; + } + if (version === 10) { + return isIE10; + } + return isIE11 || isIE10; + } + + /** + * Returns the offset parent of the given element + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @returns {Element} offset parent + */ + function getOffsetParent(element) { + if (!element) { + return document.documentElement; + } + + var noOffsetParent = isIE(10) ? document.body : null; + + // NOTE: 1 DOM access here + var offsetParent = element.offsetParent; + // Skip hidden elements which don't have an offsetParent + while (offsetParent === noOffsetParent && element.nextElementSibling) { + offsetParent = (element = element.nextElementSibling).offsetParent; + } + + var nodeName = offsetParent && offsetParent.nodeName; + + if (!nodeName || nodeName === 'BODY' || nodeName === 'HTML') { + return element ? element.ownerDocument.documentElement : document.documentElement; + } + + // .offsetParent will return the closest TD or TABLE in case + // no offsetParent is present, I hate this job... + if (['TD', 'TABLE'].indexOf(offsetParent.nodeName) !== -1 && getStyleComputedProperty(offsetParent, 'position') === 'static') { + return getOffsetParent(offsetParent); + } + + return offsetParent; + } + + function isOffsetContainer(element) { + var nodeName = element.nodeName; + + if (nodeName === 'BODY') { + return false; + } + return nodeName === 'HTML' || getOffsetParent(element.firstElementChild) === element; + } + + /** + * Finds the root node (document, shadowDOM root) of the given element + * @method + * @memberof Popper.Utils + * @argument {Element} node + * @returns {Element} root node + */ + function getRoot(node) { + if (node.parentNode !== null) { + return getRoot(node.parentNode); + } + + return node; + } + + /** + * Finds the offset parent common to the two provided nodes + * @method + * @memberof Popper.Utils + * @argument {Element} element1 + * @argument {Element} element2 + * @returns {Element} common offset parent + */ + function findCommonOffsetParent(element1, element2) { + // This check is needed to avoid errors in case one of the elements isn't defined for any reason + if (!element1 || !element1.nodeType || !element2 || !element2.nodeType) { + return document.documentElement; + } + + // Here we make sure to give as "start" the element that comes first in the DOM + var order = element1.compareDocumentPosition(element2) & Node.DOCUMENT_POSITION_FOLLOWING; + var start = order ? element1 : element2; + var end = order ? element2 : element1; + + // Get common ancestor container + var range = document.createRange(); + range.setStart(start, 0); + range.setEnd(end, 0); + var commonAncestorContainer = range.commonAncestorContainer; + + // Both nodes are inside #document + + if (element1 !== commonAncestorContainer && element2 !== commonAncestorContainer || start.contains(end)) { + if (isOffsetContainer(commonAncestorContainer)) { + return commonAncestorContainer; + } + + return getOffsetParent(commonAncestorContainer); + } + + // one of the nodes is inside shadowDOM, find which one + var element1root = getRoot(element1); + if (element1root.host) { + return findCommonOffsetParent(element1root.host, element2); + } else { + return findCommonOffsetParent(element1, getRoot(element2).host); + } + } + + /** + * Gets the scroll value of the given element in the given side (top and left) + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @argument {String} side `top` or `left` + * @returns {number} amount of scrolled pixels + */ + function getScroll(element) { + var side = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'top'; + + var upperSide = side === 'top' ? 'scrollTop' : 'scrollLeft'; + var nodeName = element.nodeName; + + if (nodeName === 'BODY' || nodeName === 'HTML') { + var html = element.ownerDocument.documentElement; + var scrollingElement = element.ownerDocument.scrollingElement || html; + return scrollingElement[upperSide]; + } + + return element[upperSide]; + } + + /* + * Sum or subtract the element scroll values (left and top) from a given rect object + * @method + * @memberof Popper.Utils + * @param {Object} rect - Rect object you want to change + * @param {HTMLElement} element - The element from the function reads the scroll values + * @param {Boolean} subtract - set to true if you want to subtract the scroll values + * @return {Object} rect - The modifier rect object + */ + function includeScroll(rect, element) { + var subtract = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; + + var scrollTop = getScroll(element, 'top'); + var scrollLeft = getScroll(element, 'left'); + var modifier = subtract ? -1 : 1; + rect.top += scrollTop * modifier; + rect.bottom += scrollTop * modifier; + rect.left += scrollLeft * modifier; + rect.right += scrollLeft * modifier; + return rect; + } + + /* + * Helper to detect borders of a given element + * @method + * @memberof Popper.Utils + * @param {CSSStyleDeclaration} styles + * Result of `getStyleComputedProperty` on the given element + * @param {String} axis - `x` or `y` + * @return {number} borders - The borders size of the given axis + */ + + function getBordersSize(styles, axis) { + var sideA = axis === 'x' ? 'Left' : 'Top'; + var sideB = sideA === 'Left' ? 'Right' : 'Bottom'; + + return parseFloat(styles['border' + sideA + 'Width'], 10) + parseFloat(styles['border' + sideB + 'Width'], 10); + } + + function getSize(axis, body, html, computedStyle) { + return Math.max(body['offset' + axis], body['scroll' + axis], html['client' + axis], html['offset' + axis], html['scroll' + axis], isIE(10) ? html['offset' + axis] + computedStyle['margin' + (axis === 'Height' ? 'Top' : 'Left')] + computedStyle['margin' + (axis === 'Height' ? 'Bottom' : 'Right')] : 0); + } + + function getWindowSizes() { + var body = document.body; + var html = document.documentElement; + var computedStyle = isIE(10) && getComputedStyle(html); + + return { + height: getSize('Height', body, html, computedStyle), + width: getSize('Width', body, html, computedStyle) + }; + } + + var classCallCheck = function (instance, Constructor) { + if (!(instance instanceof Constructor)) { + throw new TypeError("Cannot call a class as a function"); + } + }; + + var createClass = function () { + function defineProperties(target, props) { + for (var i = 0; i < props.length; i++) { + var descriptor = props[i]; + descriptor.enumerable = descriptor.enumerable || false; + descriptor.configurable = true; + if ("value" in descriptor) descriptor.writable = true; + Object.defineProperty(target, descriptor.key, descriptor); + } + } + + return function (Constructor, protoProps, staticProps) { + if (protoProps) defineProperties(Constructor.prototype, protoProps); + if (staticProps) defineProperties(Constructor, staticProps); + return Constructor; + }; + }(); + + + + + + var defineProperty = function (obj, key, value) { + if (key in obj) { + Object.defineProperty(obj, key, { + value: value, + enumerable: true, + configurable: true, + writable: true + }); + } else { + obj[key] = value; + } + + return obj; + }; + + var _extends = Object.assign || function (target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i]; + + for (var key in source) { + if (Object.prototype.hasOwnProperty.call(source, key)) { + target[key] = source[key]; + } + } + } + + return target; + }; + + /** + * Given element offsets, generate an output similar to getBoundingClientRect + * @method + * @memberof Popper.Utils + * @argument {Object} offsets + * @returns {Object} ClientRect like output + */ + function getClientRect(offsets) { + return _extends({}, offsets, { + right: offsets.left + offsets.width, + bottom: offsets.top + offsets.height + }); + } + + /** + * Get bounding client rect of given element + * @method + * @memberof Popper.Utils + * @param {HTMLElement} element + * @return {Object} client rect + */ + function getBoundingClientRect(element) { + var rect = {}; + + // IE10 10 FIX: Please, don't ask, the element isn't + // considered in DOM in some circumstances... + // This isn't reproducible in IE10 compatibility mode of IE11 + try { + if (isIE(10)) { + rect = element.getBoundingClientRect(); + var scrollTop = getScroll(element, 'top'); + var scrollLeft = getScroll(element, 'left'); + rect.top += scrollTop; + rect.left += scrollLeft; + rect.bottom += scrollTop; + rect.right += scrollLeft; + } else { + rect = element.getBoundingClientRect(); + } + } catch (e) {} + + var result = { + left: rect.left, + top: rect.top, + width: rect.right - rect.left, + height: rect.bottom - rect.top + }; + + // subtract scrollbar size from sizes + var sizes = element.nodeName === 'HTML' ? getWindowSizes() : {}; + var width = sizes.width || element.clientWidth || result.right - result.left; + var height = sizes.height || element.clientHeight || result.bottom - result.top; + + var horizScrollbar = element.offsetWidth - width; + var vertScrollbar = element.offsetHeight - height; + + // if an hypothetical scrollbar is detected, we must be sure it's not a `border` + // we make this check conditional for performance reasons + if (horizScrollbar || vertScrollbar) { + var styles = getStyleComputedProperty(element); + horizScrollbar -= getBordersSize(styles, 'x'); + vertScrollbar -= getBordersSize(styles, 'y'); + + result.width -= horizScrollbar; + result.height -= vertScrollbar; + } + + return getClientRect(result); + } + + function getOffsetRectRelativeToArbitraryNode(children, parent) { + var fixedPosition = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; + + var isIE10 = isIE(10); + var isHTML = parent.nodeName === 'HTML'; + var childrenRect = getBoundingClientRect(children); + var parentRect = getBoundingClientRect(parent); + var scrollParent = getScrollParent(children); + + var styles = getStyleComputedProperty(parent); + var borderTopWidth = parseFloat(styles.borderTopWidth, 10); + var borderLeftWidth = parseFloat(styles.borderLeftWidth, 10); + + // In cases where the parent is fixed, we must ignore negative scroll in offset calc + if (fixedPosition && parent.nodeName === 'HTML') { + parentRect.top = Math.max(parentRect.top, 0); + parentRect.left = Math.max(parentRect.left, 0); + } + var offsets = getClientRect({ + top: childrenRect.top - parentRect.top - borderTopWidth, + left: childrenRect.left - parentRect.left - borderLeftWidth, + width: childrenRect.width, + height: childrenRect.height + }); + offsets.marginTop = 0; + offsets.marginLeft = 0; + + // Subtract margins of documentElement in case it's being used as parent + // we do this only on HTML because it's the only element that behaves + // differently when margins are applied to it. The margins are included in + // the box of the documentElement, in the other cases not. + if (!isIE10 && isHTML) { + var marginTop = parseFloat(styles.marginTop, 10); + var marginLeft = parseFloat(styles.marginLeft, 10); + + offsets.top -= borderTopWidth - marginTop; + offsets.bottom -= borderTopWidth - marginTop; + offsets.left -= borderLeftWidth - marginLeft; + offsets.right -= borderLeftWidth - marginLeft; + + // Attach marginTop and marginLeft because in some circumstances we may need them + offsets.marginTop = marginTop; + offsets.marginLeft = marginLeft; + } + + if (isIE10 && !fixedPosition ? parent.contains(scrollParent) : parent === scrollParent && scrollParent.nodeName !== 'BODY') { + offsets = includeScroll(offsets, parent); + } + + return offsets; + } + + function getViewportOffsetRectRelativeToArtbitraryNode(element) { + var excludeScroll = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + + var html = element.ownerDocument.documentElement; + var relativeOffset = getOffsetRectRelativeToArbitraryNode(element, html); + var width = Math.max(html.clientWidth, window.innerWidth || 0); + var height = Math.max(html.clientHeight, window.innerHeight || 0); + + var scrollTop = !excludeScroll ? getScroll(html) : 0; + var scrollLeft = !excludeScroll ? getScroll(html, 'left') : 0; + + var offset = { + top: scrollTop - relativeOffset.top + relativeOffset.marginTop, + left: scrollLeft - relativeOffset.left + relativeOffset.marginLeft, + width: width, + height: height + }; + + return getClientRect(offset); + } + + /** + * Check if the given element is fixed or is inside a fixed parent + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @argument {Element} customContainer + * @returns {Boolean} answer to "isFixed?" + */ + function isFixed(element) { + var nodeName = element.nodeName; + if (nodeName === 'BODY' || nodeName === 'HTML') { + return false; + } + if (getStyleComputedProperty(element, 'position') === 'fixed') { + return true; + } + return isFixed(getParentNode(element)); + } + + /** + * Finds the first parent of an element that has a transformed property defined + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @returns {Element} first transformed parent or documentElement + */ + + function getFixedPositionOffsetParent(element) { + // This check is needed to avoid errors in case one of the elements isn't defined for any reason + if (!element || !element.parentElement || isIE()) { + return document.documentElement; + } + var el = element.parentElement; + while (el && getStyleComputedProperty(el, 'transform') === 'none') { + el = el.parentElement; + } + return el || document.documentElement; + } + + /** + * Computed the boundaries limits and return them + * @method + * @memberof Popper.Utils + * @param {HTMLElement} popper + * @param {HTMLElement} reference + * @param {number} padding + * @param {HTMLElement} boundariesElement - Element used to define the boundaries + * @param {Boolean} fixedPosition - Is in fixed position mode + * @returns {Object} Coordinates of the boundaries + */ + function getBoundaries(popper, reference, padding, boundariesElement) { + var fixedPosition = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : false; + + // NOTE: 1 DOM access here + + var boundaries = { top: 0, left: 0 }; + var offsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference); + + // Handle viewport case + if (boundariesElement === 'viewport') { + boundaries = getViewportOffsetRectRelativeToArtbitraryNode(offsetParent, fixedPosition); + } else { + // Handle other cases based on DOM element used as boundaries + var boundariesNode = void 0; + if (boundariesElement === 'scrollParent') { + boundariesNode = getScrollParent(getParentNode(reference)); + if (boundariesNode.nodeName === 'BODY') { + boundariesNode = popper.ownerDocument.documentElement; + } + } else if (boundariesElement === 'window') { + boundariesNode = popper.ownerDocument.documentElement; + } else { + boundariesNode = boundariesElement; + } + + var offsets = getOffsetRectRelativeToArbitraryNode(boundariesNode, offsetParent, fixedPosition); + + // In case of HTML, we need a different computation + if (boundariesNode.nodeName === 'HTML' && !isFixed(offsetParent)) { + var _getWindowSizes = getWindowSizes(), + height = _getWindowSizes.height, + width = _getWindowSizes.width; + + boundaries.top += offsets.top - offsets.marginTop; + boundaries.bottom = height + offsets.top; + boundaries.left += offsets.left - offsets.marginLeft; + boundaries.right = width + offsets.left; + } else { + // for all the other DOM elements, this one is good + boundaries = offsets; + } + } + + // Add paddings + boundaries.left += padding; + boundaries.top += padding; + boundaries.right -= padding; + boundaries.bottom -= padding; + + return boundaries; + } + + function getArea(_ref) { + var width = _ref.width, + height = _ref.height; + + return width * height; + } + + /** + * Utility used to transform the `auto` placement to the placement with more + * available space. + * @method + * @memberof Popper.Utils + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ + function computeAutoPlacement(placement, refRect, popper, reference, boundariesElement) { + var padding = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : 0; + + if (placement.indexOf('auto') === -1) { + return placement; + } + + var boundaries = getBoundaries(popper, reference, padding, boundariesElement); + + var rects = { + top: { + width: boundaries.width, + height: refRect.top - boundaries.top + }, + right: { + width: boundaries.right - refRect.right, + height: boundaries.height + }, + bottom: { + width: boundaries.width, + height: boundaries.bottom - refRect.bottom + }, + left: { + width: refRect.left - boundaries.left, + height: boundaries.height + } + }; + + var sortedAreas = Object.keys(rects).map(function (key) { + return _extends({ + key: key + }, rects[key], { + area: getArea(rects[key]) + }); + }).sort(function (a, b) { + return b.area - a.area; + }); + + var filteredAreas = sortedAreas.filter(function (_ref2) { + var width = _ref2.width, + height = _ref2.height; + return width >= popper.clientWidth && height >= popper.clientHeight; + }); + + var computedPlacement = filteredAreas.length > 0 ? filteredAreas[0].key : sortedAreas[0].key; + + var variation = placement.split('-')[1]; + + return computedPlacement + (variation ? '-' + variation : ''); + } + + /** + * Get offsets to the reference element + * @method + * @memberof Popper.Utils + * @param {Object} state + * @param {Element} popper - the popper element + * @param {Element} reference - the reference element (the popper will be relative to this) + * @param {Element} fixedPosition - is in fixed position mode + * @returns {Object} An object containing the offsets which will be applied to the popper + */ + function getReferenceOffsets(state, popper, reference) { + var fixedPosition = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : null; + + var commonOffsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference); + return getOffsetRectRelativeToArbitraryNode(reference, commonOffsetParent, fixedPosition); + } + + /** + * Get the outer sizes of the given element (offset size + margins) + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @returns {Object} object containing width and height properties + */ + function getOuterSizes(element) { + var styles = getComputedStyle(element); + var x = parseFloat(styles.marginTop) + parseFloat(styles.marginBottom); + var y = parseFloat(styles.marginLeft) + parseFloat(styles.marginRight); + var result = { + width: element.offsetWidth + y, + height: element.offsetHeight + x + }; + return result; + } + + /** + * Get the opposite placement of the given one + * @method + * @memberof Popper.Utils + * @argument {String} placement + * @returns {String} flipped placement + */ + function getOppositePlacement(placement) { + var hash = { left: 'right', right: 'left', bottom: 'top', top: 'bottom' }; + return placement.replace(/left|right|bottom|top/g, function (matched) { + return hash[matched]; + }); + } + + /** + * Get offsets to the popper + * @method + * @memberof Popper.Utils + * @param {Object} position - CSS position the Popper will get applied + * @param {HTMLElement} popper - the popper element + * @param {Object} referenceOffsets - the reference offsets (the popper will be relative to this) + * @param {String} placement - one of the valid placement options + * @returns {Object} popperOffsets - An object containing the offsets which will be applied to the popper + */ + function getPopperOffsets(popper, referenceOffsets, placement) { + placement = placement.split('-')[0]; + + // Get popper node sizes + var popperRect = getOuterSizes(popper); + + // Add position, width and height to our offsets object + var popperOffsets = { + width: popperRect.width, + height: popperRect.height + }; + + // depending by the popper placement we have to compute its offsets slightly differently + var isHoriz = ['right', 'left'].indexOf(placement) !== -1; + var mainSide = isHoriz ? 'top' : 'left'; + var secondarySide = isHoriz ? 'left' : 'top'; + var measurement = isHoriz ? 'height' : 'width'; + var secondaryMeasurement = !isHoriz ? 'height' : 'width'; + + popperOffsets[mainSide] = referenceOffsets[mainSide] + referenceOffsets[measurement] / 2 - popperRect[measurement] / 2; + if (placement === secondarySide) { + popperOffsets[secondarySide] = referenceOffsets[secondarySide] - popperRect[secondaryMeasurement]; + } else { + popperOffsets[secondarySide] = referenceOffsets[getOppositePlacement(secondarySide)]; + } + + return popperOffsets; + } + + /** + * Mimics the `find` method of Array + * @method + * @memberof Popper.Utils + * @argument {Array} arr + * @argument prop + * @argument value + * @returns index or -1 + */ + function find(arr, check) { + // use native find if supported + if (Array.prototype.find) { + return arr.find(check); + } + + // use `filter` to obtain the same behavior of `find` + return arr.filter(check)[0]; + } + + /** + * Return the index of the matching object + * @method + * @memberof Popper.Utils + * @argument {Array} arr + * @argument prop + * @argument value + * @returns index or -1 + */ + function findIndex(arr, prop, value) { + // use native findIndex if supported + if (Array.prototype.findIndex) { + return arr.findIndex(function (cur) { + return cur[prop] === value; + }); + } + + // use `find` + `indexOf` if `findIndex` isn't supported + var match = find(arr, function (obj) { + return obj[prop] === value; + }); + return arr.indexOf(match); + } + + /** + * Loop trough the list of modifiers and run them in order, + * each of them will then edit the data object. + * @method + * @memberof Popper.Utils + * @param {dataObject} data + * @param {Array} modifiers + * @param {String} ends - Optional modifier name used as stopper + * @returns {dataObject} + */ + function runModifiers(modifiers, data, ends) { + var modifiersToRun = ends === undefined ? modifiers : modifiers.slice(0, findIndex(modifiers, 'name', ends)); + + modifiersToRun.forEach(function (modifier) { + if (modifier['function']) { + // eslint-disable-line dot-notation + console.warn('`modifier.function` is deprecated, use `modifier.fn`!'); + } + var fn = modifier['function'] || modifier.fn; // eslint-disable-line dot-notation + if (modifier.enabled && isFunction(fn)) { + // Add properties to offsets to make them a complete clientRect object + // we do this before each modifier to make sure the previous one doesn't + // mess with these values + data.offsets.popper = getClientRect(data.offsets.popper); + data.offsets.reference = getClientRect(data.offsets.reference); + + data = fn(data, modifier); + } + }); + + return data; + } + + /** + * Updates the position of the popper, computing the new offsets and applying + * the new style.<br /> + * Prefer `scheduleUpdate` over `update` because of performance reasons. + * @method + * @memberof Popper + */ + function update() { + // if popper is destroyed, don't perform any further update + if (this.state.isDestroyed) { + return; + } + + var data = { + instance: this, + styles: {}, + arrowStyles: {}, + attributes: {}, + flipped: false, + offsets: {} + }; + + // compute reference element offsets + data.offsets.reference = getReferenceOffsets(this.state, this.popper, this.reference, this.options.positionFixed); + + // compute auto placement, store placement inside the data object, + // modifiers will be able to edit `placement` if needed + // and refer to originalPlacement to know the original value + data.placement = computeAutoPlacement(this.options.placement, data.offsets.reference, this.popper, this.reference, this.options.modifiers.flip.boundariesElement, this.options.modifiers.flip.padding); + + // store the computed placement inside `originalPlacement` + data.originalPlacement = data.placement; + + data.positionFixed = this.options.positionFixed; + + // compute the popper offsets + data.offsets.popper = getPopperOffsets(this.popper, data.offsets.reference, data.placement); + + data.offsets.popper.position = this.options.positionFixed ? 'fixed' : 'absolute'; + + // run the modifiers + data = runModifiers(this.modifiers, data); + + // the first `update` will call `onCreate` callback + // the other ones will call `onUpdate` callback + if (!this.state.isCreated) { + this.state.isCreated = true; + this.options.onCreate(data); + } else { + this.options.onUpdate(data); + } + } + + /** + * Helper used to know if the given modifier is enabled. + * @method + * @memberof Popper.Utils + * @returns {Boolean} + */ + function isModifierEnabled(modifiers, modifierName) { + return modifiers.some(function (_ref) { + var name = _ref.name, + enabled = _ref.enabled; + return enabled && name === modifierName; + }); + } + + /** + * Get the prefixed supported property name + * @method + * @memberof Popper.Utils + * @argument {String} property (camelCase) + * @returns {String} prefixed property (camelCase or PascalCase, depending on the vendor prefix) + */ + function getSupportedPropertyName(property) { + var prefixes = [false, 'ms', 'Webkit', 'Moz', 'O']; + var upperProp = property.charAt(0).toUpperCase() + property.slice(1); + + for (var i = 0; i < prefixes.length; i++) { + var prefix = prefixes[i]; + var toCheck = prefix ? '' + prefix + upperProp : property; + if (typeof document.body.style[toCheck] !== 'undefined') { + return toCheck; + } + } + return null; + } + + /** + * Destroy the popper + * @method + * @memberof Popper + */ + function destroy() { + this.state.isDestroyed = true; + + // touch DOM only if `applyStyle` modifier is enabled + if (isModifierEnabled(this.modifiers, 'applyStyle')) { + this.popper.removeAttribute('x-placement'); + this.popper.style.position = ''; + this.popper.style.top = ''; + this.popper.style.left = ''; + this.popper.style.right = ''; + this.popper.style.bottom = ''; + this.popper.style.willChange = ''; + this.popper.style[getSupportedPropertyName('transform')] = ''; + } + + this.disableEventListeners(); + + // remove the popper if user explicity asked for the deletion on destroy + // do not use `remove` because IE11 doesn't support it + if (this.options.removeOnDestroy) { + this.popper.parentNode.removeChild(this.popper); + } + return this; + } + + /** + * Get the window associated with the element + * @argument {Element} element + * @returns {Window} + */ + function getWindow(element) { + var ownerDocument = element.ownerDocument; + return ownerDocument ? ownerDocument.defaultView : window; + } + + function attachToScrollParents(scrollParent, event, callback, scrollParents) { + var isBody = scrollParent.nodeName === 'BODY'; + var target = isBody ? scrollParent.ownerDocument.defaultView : scrollParent; + target.addEventListener(event, callback, { passive: true }); + + if (!isBody) { + attachToScrollParents(getScrollParent(target.parentNode), event, callback, scrollParents); + } + scrollParents.push(target); + } + + /** + * Setup needed event listeners used to update the popper position + * @method + * @memberof Popper.Utils + * @private + */ + function setupEventListeners(reference, options, state, updateBound) { + // Resize event listener on window + state.updateBound = updateBound; + getWindow(reference).addEventListener('resize', state.updateBound, { passive: true }); + + // Scroll event listener on scroll parents + var scrollElement = getScrollParent(reference); + attachToScrollParents(scrollElement, 'scroll', state.updateBound, state.scrollParents); + state.scrollElement = scrollElement; + state.eventsEnabled = true; + + return state; + } + + /** + * It will add resize/scroll events and start recalculating + * position of the popper element when they are triggered. + * @method + * @memberof Popper + */ + function enableEventListeners() { + if (!this.state.eventsEnabled) { + this.state = setupEventListeners(this.reference, this.options, this.state, this.scheduleUpdate); + } + } + + /** + * Remove event listeners used to update the popper position + * @method + * @memberof Popper.Utils + * @private + */ + function removeEventListeners(reference, state) { + // Remove resize event listener on window + getWindow(reference).removeEventListener('resize', state.updateBound); + + // Remove scroll event listener on scroll parents + state.scrollParents.forEach(function (target) { + target.removeEventListener('scroll', state.updateBound); + }); + + // Reset state + state.updateBound = null; + state.scrollParents = []; + state.scrollElement = null; + state.eventsEnabled = false; + return state; + } + + /** + * It will remove resize/scroll events and won't recalculate popper position + * when they are triggered. It also won't trigger onUpdate callback anymore, + * unless you call `update` method manually. + * @method + * @memberof Popper + */ + function disableEventListeners() { + if (this.state.eventsEnabled) { + cancelAnimationFrame(this.scheduleUpdate); + this.state = removeEventListeners(this.reference, this.state); + } + } + + /** + * Tells if a given input is a number + * @method + * @memberof Popper.Utils + * @param {*} input to check + * @return {Boolean} + */ + function isNumeric(n) { + return n !== '' && !isNaN(parseFloat(n)) && isFinite(n); + } + + /** + * Set the style to the given popper + * @method + * @memberof Popper.Utils + * @argument {Element} element - Element to apply the style to + * @argument {Object} styles + * Object with a list of properties and values which will be applied to the element + */ + function setStyles(element, styles) { + Object.keys(styles).forEach(function (prop) { + var unit = ''; + // add unit if the value is numeric and is one of the following + if (['width', 'height', 'top', 'right', 'bottom', 'left'].indexOf(prop) !== -1 && isNumeric(styles[prop])) { + unit = 'px'; + } + element.style[prop] = styles[prop] + unit; + }); + } + + /** + * Set the attributes to the given popper + * @method + * @memberof Popper.Utils + * @argument {Element} element - Element to apply the attributes to + * @argument {Object} styles + * Object with a list of properties and values which will be applied to the element + */ + function setAttributes(element, attributes) { + Object.keys(attributes).forEach(function (prop) { + var value = attributes[prop]; + if (value !== false) { + element.setAttribute(prop, attributes[prop]); + } else { + element.removeAttribute(prop); + } + }); + } + + /** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by `update` method + * @argument {Object} data.styles - List of style properties - values to apply to popper element + * @argument {Object} data.attributes - List of attribute properties - values to apply to popper element + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The same data object + */ + function applyStyle(data) { + // any property present in `data.styles` will be applied to the popper, + // in this way we can make the 3rd party modifiers add custom styles to it + // Be aware, modifiers could override the properties defined in the previous + // lines of this modifier! + setStyles(data.instance.popper, data.styles); + + // any property present in `data.attributes` will be applied to the popper, + // they will be set as HTML attributes of the element + setAttributes(data.instance.popper, data.attributes); + + // if arrowElement is defined and arrowStyles has some properties + if (data.arrowElement && Object.keys(data.arrowStyles).length) { + setStyles(data.arrowElement, data.arrowStyles); + } + + return data; + } + + /** + * Set the x-placement attribute before everything else because it could be used + * to add margins to the popper margins needs to be calculated to get the + * correct popper offsets. + * @method + * @memberof Popper.modifiers + * @param {HTMLElement} reference - The reference element used to position the popper + * @param {HTMLElement} popper - The HTML element used as popper + * @param {Object} options - Popper.js options + */ + function applyStyleOnLoad(reference, popper, options, modifierOptions, state) { + // compute reference element offsets + var referenceOffsets = getReferenceOffsets(state, popper, reference, options.positionFixed); + + // compute auto placement, store placement inside the data object, + // modifiers will be able to edit `placement` if needed + // and refer to originalPlacement to know the original value + var placement = computeAutoPlacement(options.placement, referenceOffsets, popper, reference, options.modifiers.flip.boundariesElement, options.modifiers.flip.padding); + + popper.setAttribute('x-placement', placement); + + // Apply `position` to popper before anything else because + // without the position applied we can't guarantee correct computations + setStyles(popper, { position: options.positionFixed ? 'fixed' : 'absolute' }); + + return options; + } + + /** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by `update` method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ + function computeStyle(data, options) { + var x = options.x, + y = options.y; + var popper = data.offsets.popper; + + // Remove this legacy support in Popper.js v2 + + var legacyGpuAccelerationOption = find(data.instance.modifiers, function (modifier) { + return modifier.name === 'applyStyle'; + }).gpuAcceleration; + if (legacyGpuAccelerationOption !== undefined) { + console.warn('WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!'); + } + var gpuAcceleration = legacyGpuAccelerationOption !== undefined ? legacyGpuAccelerationOption : options.gpuAcceleration; + + var offsetParent = getOffsetParent(data.instance.popper); + var offsetParentRect = getBoundingClientRect(offsetParent); + + // Styles + var styles = { + position: popper.position + }; + + // Avoid blurry text by using full pixel integers. + // For pixel-perfect positioning, top/bottom prefers rounded + // values, while left/right prefers floored values. + var offsets = { + left: Math.floor(popper.left), + top: Math.round(popper.top), + bottom: Math.round(popper.bottom), + right: Math.floor(popper.right) + }; + + var sideA = x === 'bottom' ? 'top' : 'bottom'; + var sideB = y === 'right' ? 'left' : 'right'; + + // if gpuAcceleration is set to `true` and transform is supported, + // we use `translate3d` to apply the position to the popper we + // automatically use the supported prefixed version if needed + var prefixedProperty = getSupportedPropertyName('transform'); + + // now, let's make a step back and look at this code closely (wtf?) + // If the content of the popper grows once it's been positioned, it + // may happen that the popper gets misplaced because of the new content + // overflowing its reference element + // To avoid this problem, we provide two options (x and y), which allow + // the consumer to define the offset origin. + // If we position a popper on top of a reference element, we can set + // `x` to `top` to make the popper grow towards its top instead of + // its bottom. + var left = void 0, + top = void 0; + if (sideA === 'bottom') { + top = -offsetParentRect.height + offsets.bottom; + } else { + top = offsets.top; + } + if (sideB === 'right') { + left = -offsetParentRect.width + offsets.right; + } else { + left = offsets.left; + } + if (gpuAcceleration && prefixedProperty) { + styles[prefixedProperty] = 'translate3d(' + left + 'px, ' + top + 'px, 0)'; + styles[sideA] = 0; + styles[sideB] = 0; + styles.willChange = 'transform'; + } else { + // othwerise, we use the standard `top`, `left`, `bottom` and `right` properties + var invertTop = sideA === 'bottom' ? -1 : 1; + var invertLeft = sideB === 'right' ? -1 : 1; + styles[sideA] = top * invertTop; + styles[sideB] = left * invertLeft; + styles.willChange = sideA + ', ' + sideB; + } + + // Attributes + var attributes = { + 'x-placement': data.placement + }; + + // Update `data` attributes, styles and arrowStyles + data.attributes = _extends({}, attributes, data.attributes); + data.styles = _extends({}, styles, data.styles); + data.arrowStyles = _extends({}, data.offsets.arrow, data.arrowStyles); + + return data; + } + + /** + * Helper used to know if the given modifier depends from another one.<br /> + * It checks if the needed modifier is listed and enabled. + * @method + * @memberof Popper.Utils + * @param {Array} modifiers - list of modifiers + * @param {String} requestingName - name of requesting modifier + * @param {String} requestedName - name of requested modifier + * @returns {Boolean} + */ + function isModifierRequired(modifiers, requestingName, requestedName) { + var requesting = find(modifiers, function (_ref) { + var name = _ref.name; + return name === requestingName; + }); + + var isRequired = !!requesting && modifiers.some(function (modifier) { + return modifier.name === requestedName && modifier.enabled && modifier.order < requesting.order; + }); + + if (!isRequired) { + var _requesting = '`' + requestingName + '`'; + var requested = '`' + requestedName + '`'; + console.warn(requested + ' modifier is required by ' + _requesting + ' modifier in order to work, be sure to include it before ' + _requesting + '!'); + } + return isRequired; + } + + /** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ + function arrow(data, options) { + var _data$offsets$arrow; + + // arrow depends on keepTogether in order to work + if (!isModifierRequired(data.instance.modifiers, 'arrow', 'keepTogether')) { + return data; + } + + var arrowElement = options.element; + + // if arrowElement is a string, suppose it's a CSS selector + if (typeof arrowElement === 'string') { + arrowElement = data.instance.popper.querySelector(arrowElement); + + // if arrowElement is not found, don't run the modifier + if (!arrowElement) { + return data; + } + } else { + // if the arrowElement isn't a query selector we must check that the + // provided DOM node is child of its popper node + if (!data.instance.popper.contains(arrowElement)) { + console.warn('WARNING: `arrow.element` must be child of its popper element!'); + return data; + } + } + + var placement = data.placement.split('-')[0]; + var _data$offsets = data.offsets, + popper = _data$offsets.popper, + reference = _data$offsets.reference; + + var isVertical = ['left', 'right'].indexOf(placement) !== -1; + + var len = isVertical ? 'height' : 'width'; + var sideCapitalized = isVertical ? 'Top' : 'Left'; + var side = sideCapitalized.toLowerCase(); + var altSide = isVertical ? 'left' : 'top'; + var opSide = isVertical ? 'bottom' : 'right'; + var arrowElementSize = getOuterSizes(arrowElement)[len]; + + // + // extends keepTogether behavior making sure the popper and its + // reference have enough pixels in conjuction + // + + // top/left side + if (reference[opSide] - arrowElementSize < popper[side]) { + data.offsets.popper[side] -= popper[side] - (reference[opSide] - arrowElementSize); + } + // bottom/right side + if (reference[side] + arrowElementSize > popper[opSide]) { + data.offsets.popper[side] += reference[side] + arrowElementSize - popper[opSide]; + } + data.offsets.popper = getClientRect(data.offsets.popper); + + // compute center of the popper + var center = reference[side] + reference[len] / 2 - arrowElementSize / 2; + + // Compute the sideValue using the updated popper offsets + // take popper margin in account because we don't have this info available + var css = getStyleComputedProperty(data.instance.popper); + var popperMarginSide = parseFloat(css['margin' + sideCapitalized], 10); + var popperBorderSide = parseFloat(css['border' + sideCapitalized + 'Width'], 10); + var sideValue = center - data.offsets.popper[side] - popperMarginSide - popperBorderSide; + + // prevent arrowElement from being placed not contiguously to its popper + sideValue = Math.max(Math.min(popper[len] - arrowElementSize, sideValue), 0); + + data.arrowElement = arrowElement; + data.offsets.arrow = (_data$offsets$arrow = {}, defineProperty(_data$offsets$arrow, side, Math.round(sideValue)), defineProperty(_data$offsets$arrow, altSide, ''), _data$offsets$arrow); + + return data; + } + + /** + * Get the opposite placement variation of the given one + * @method + * @memberof Popper.Utils + * @argument {String} placement variation + * @returns {String} flipped placement variation + */ + function getOppositeVariation(variation) { + if (variation === 'end') { + return 'start'; + } else if (variation === 'start') { + return 'end'; + } + return variation; + } + + /** + * List of accepted placements to use as values of the `placement` option.<br /> + * Valid placements are: + * - `auto` + * - `top` + * - `right` + * - `bottom` + * - `left` + * + * Each placement can have a variation from this list: + * - `-start` + * - `-end` + * + * Variations are interpreted easily if you think of them as the left to right + * written languages. Horizontally (`top` and `bottom`), `start` is left and `end` + * is right.<br /> + * Vertically (`left` and `right`), `start` is top and `end` is bottom. + * + * Some valid examples are: + * - `top-end` (on top of reference, right aligned) + * - `right-start` (on right of reference, top aligned) + * - `bottom` (on bottom, centered) + * - `auto-right` (on the side with more space available, alignment depends by placement) + * + * @static + * @type {Array} + * @enum {String} + * @readonly + * @method placements + * @memberof Popper + */ + var placements = ['auto-start', 'auto', 'auto-end', 'top-start', 'top', 'top-end', 'right-start', 'right', 'right-end', 'bottom-end', 'bottom', 'bottom-start', 'left-end', 'left', 'left-start']; + + // Get rid of `auto` `auto-start` and `auto-end` + var validPlacements = placements.slice(3); + + /** + * Given an initial placement, returns all the subsequent placements + * clockwise (or counter-clockwise). + * + * @method + * @memberof Popper.Utils + * @argument {String} placement - A valid placement (it accepts variations) + * @argument {Boolean} counter - Set to true to walk the placements counterclockwise + * @returns {Array} placements including their variations + */ + function clockwise(placement) { + var counter = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + + var index = validPlacements.indexOf(placement); + var arr = validPlacements.slice(index + 1).concat(validPlacements.slice(0, index)); + return counter ? arr.reverse() : arr; + } + + var BEHAVIORS = { + FLIP: 'flip', + CLOCKWISE: 'clockwise', + COUNTERCLOCKWISE: 'counterclockwise' + }; + + /** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ + function flip(data, options) { + // if `inner` modifier is enabled, we can't use the `flip` modifier + if (isModifierEnabled(data.instance.modifiers, 'inner')) { + return data; + } + + if (data.flipped && data.placement === data.originalPlacement) { + // seems like flip is trying to loop, probably there's not enough space on any of the flippable sides + return data; + } + + var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, options.boundariesElement, data.positionFixed); + + var placement = data.placement.split('-')[0]; + var placementOpposite = getOppositePlacement(placement); + var variation = data.placement.split('-')[1] || ''; + + var flipOrder = []; + + switch (options.behavior) { + case BEHAVIORS.FLIP: + flipOrder = [placement, placementOpposite]; + break; + case BEHAVIORS.CLOCKWISE: + flipOrder = clockwise(placement); + break; + case BEHAVIORS.COUNTERCLOCKWISE: + flipOrder = clockwise(placement, true); + break; + default: + flipOrder = options.behavior; + } + + flipOrder.forEach(function (step, index) { + if (placement !== step || flipOrder.length === index + 1) { + return data; + } + + placement = data.placement.split('-')[0]; + placementOpposite = getOppositePlacement(placement); + + var popperOffsets = data.offsets.popper; + var refOffsets = data.offsets.reference; + + // using floor because the reference offsets may contain decimals we are not going to consider here + var floor = Math.floor; + var overlapsRef = placement === 'left' && floor(popperOffsets.right) > floor(refOffsets.left) || placement === 'right' && floor(popperOffsets.left) < floor(refOffsets.right) || placement === 'top' && floor(popperOffsets.bottom) > floor(refOffsets.top) || placement === 'bottom' && floor(popperOffsets.top) < floor(refOffsets.bottom); + + var overflowsLeft = floor(popperOffsets.left) < floor(boundaries.left); + var overflowsRight = floor(popperOffsets.right) > floor(boundaries.right); + var overflowsTop = floor(popperOffsets.top) < floor(boundaries.top); + var overflowsBottom = floor(popperOffsets.bottom) > floor(boundaries.bottom); + + var overflowsBoundaries = placement === 'left' && overflowsLeft || placement === 'right' && overflowsRight || placement === 'top' && overflowsTop || placement === 'bottom' && overflowsBottom; + + // flip the variation if required + var isVertical = ['top', 'bottom'].indexOf(placement) !== -1; + var flippedVariation = !!options.flipVariations && (isVertical && variation === 'start' && overflowsLeft || isVertical && variation === 'end' && overflowsRight || !isVertical && variation === 'start' && overflowsTop || !isVertical && variation === 'end' && overflowsBottom); + + if (overlapsRef || overflowsBoundaries || flippedVariation) { + // this boolean to detect any flip loop + data.flipped = true; + + if (overlapsRef || overflowsBoundaries) { + placement = flipOrder[index + 1]; + } + + if (flippedVariation) { + variation = getOppositeVariation(variation); + } + + data.placement = placement + (variation ? '-' + variation : ''); + + // this object contains `position`, we want to preserve it along with + // any additional property we may add in the future + data.offsets.popper = _extends({}, data.offsets.popper, getPopperOffsets(data.instance.popper, data.offsets.reference, data.placement)); + + data = runModifiers(data.instance.modifiers, data, 'flip'); + } + }); + return data; + } + + /** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ + function keepTogether(data) { + var _data$offsets = data.offsets, + popper = _data$offsets.popper, + reference = _data$offsets.reference; + + var placement = data.placement.split('-')[0]; + var floor = Math.floor; + var isVertical = ['top', 'bottom'].indexOf(placement) !== -1; + var side = isVertical ? 'right' : 'bottom'; + var opSide = isVertical ? 'left' : 'top'; + var measurement = isVertical ? 'width' : 'height'; + + if (popper[side] < floor(reference[opSide])) { + data.offsets.popper[opSide] = floor(reference[opSide]) - popper[measurement]; + } + if (popper[opSide] > floor(reference[side])) { + data.offsets.popper[opSide] = floor(reference[side]); + } + + return data; + } + + /** + * Converts a string containing value + unit into a px value number + * @function + * @memberof {modifiers~offset} + * @private + * @argument {String} str - Value + unit string + * @argument {String} measurement - `height` or `width` + * @argument {Object} popperOffsets + * @argument {Object} referenceOffsets + * @returns {Number|String} + * Value in pixels, or original string if no values were extracted + */ + function toValue(str, measurement, popperOffsets, referenceOffsets) { + // separate value from unit + var split = str.match(/((?:\-|\+)?\d*\.?\d*)(.*)/); + var value = +split[1]; + var unit = split[2]; + + // If it's not a number it's an operator, I guess + if (!value) { + return str; + } + + if (unit.indexOf('%') === 0) { + var element = void 0; + switch (unit) { + case '%p': + element = popperOffsets; + break; + case '%': + case '%r': + default: + element = referenceOffsets; + } + + var rect = getClientRect(element); + return rect[measurement] / 100 * value; + } else if (unit === 'vh' || unit === 'vw') { + // if is a vh or vw, we calculate the size based on the viewport + var size = void 0; + if (unit === 'vh') { + size = Math.max(document.documentElement.clientHeight, window.innerHeight || 0); + } else { + size = Math.max(document.documentElement.clientWidth, window.innerWidth || 0); + } + return size / 100 * value; + } else { + // if is an explicit pixel unit, we get rid of the unit and keep the value + // if is an implicit unit, it's px, and we return just the value + return value; + } + } + + /** + * Parse an `offset` string to extrapolate `x` and `y` numeric offsets. + * @function + * @memberof {modifiers~offset} + * @private + * @argument {String} offset + * @argument {Object} popperOffsets + * @argument {Object} referenceOffsets + * @argument {String} basePlacement + * @returns {Array} a two cells array with x and y offsets in numbers + */ + function parseOffset(offset, popperOffsets, referenceOffsets, basePlacement) { + var offsets = [0, 0]; + + // Use height if placement is left or right and index is 0 otherwise use width + // in this way the first offset will use an axis and the second one + // will use the other one + var useHeight = ['right', 'left'].indexOf(basePlacement) !== -1; + + // Split the offset string to obtain a list of values and operands + // The regex addresses values with the plus or minus sign in front (+10, -20, etc) + var fragments = offset.split(/(\+|\-)/).map(function (frag) { + return frag.trim(); + }); + + // Detect if the offset string contains a pair of values or a single one + // they could be separated by comma or space + var divider = fragments.indexOf(find(fragments, function (frag) { + return frag.search(/,|\s/) !== -1; + })); + + if (fragments[divider] && fragments[divider].indexOf(',') === -1) { + console.warn('Offsets separated by white space(s) are deprecated, use a comma (,) instead.'); + } + + // If divider is found, we divide the list of values and operands to divide + // them by ofset X and Y. + var splitRegex = /\s*,\s*|\s+/; + var ops = divider !== -1 ? [fragments.slice(0, divider).concat([fragments[divider].split(splitRegex)[0]]), [fragments[divider].split(splitRegex)[1]].concat(fragments.slice(divider + 1))] : [fragments]; + + // Convert the values with units to absolute pixels to allow our computations + ops = ops.map(function (op, index) { + // Most of the units rely on the orientation of the popper + var measurement = (index === 1 ? !useHeight : useHeight) ? 'height' : 'width'; + var mergeWithPrevious = false; + return op + // This aggregates any `+` or `-` sign that aren't considered operators + // e.g.: 10 + +5 => [10, +, +5] + .reduce(function (a, b) { + if (a[a.length - 1] === '' && ['+', '-'].indexOf(b) !== -1) { + a[a.length - 1] = b; + mergeWithPrevious = true; + return a; + } else if (mergeWithPrevious) { + a[a.length - 1] += b; + mergeWithPrevious = false; + return a; + } else { + return a.concat(b); + } + }, []) + // Here we convert the string values into number values (in px) + .map(function (str) { + return toValue(str, measurement, popperOffsets, referenceOffsets); + }); + }); + + // Loop trough the offsets arrays and execute the operations + ops.forEach(function (op, index) { + op.forEach(function (frag, index2) { + if (isNumeric(frag)) { + offsets[index] += frag * (op[index2 - 1] === '-' ? -1 : 1); + } + }); + }); + return offsets; + } + + /** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @argument {Number|String} options.offset=0 + * The offset value as described in the modifier description + * @returns {Object} The data object, properly modified + */ + function offset(data, _ref) { + var offset = _ref.offset; + var placement = data.placement, + _data$offsets = data.offsets, + popper = _data$offsets.popper, + reference = _data$offsets.reference; + + var basePlacement = placement.split('-')[0]; + + var offsets = void 0; + if (isNumeric(+offset)) { + offsets = [+offset, 0]; + } else { + offsets = parseOffset(offset, popper, reference, basePlacement); + } + + if (basePlacement === 'left') { + popper.top += offsets[0]; + popper.left -= offsets[1]; + } else if (basePlacement === 'right') { + popper.top += offsets[0]; + popper.left += offsets[1]; + } else if (basePlacement === 'top') { + popper.left += offsets[0]; + popper.top -= offsets[1]; + } else if (basePlacement === 'bottom') { + popper.left += offsets[0]; + popper.top += offsets[1]; + } + + data.popper = popper; + return data; + } + + /** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by `update` method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ + function preventOverflow(data, options) { + var boundariesElement = options.boundariesElement || getOffsetParent(data.instance.popper); + + // If offsetParent is the reference element, we really want to + // go one step up and use the next offsetParent as reference to + // avoid to make this modifier completely useless and look like broken + if (data.instance.reference === boundariesElement) { + boundariesElement = getOffsetParent(boundariesElement); + } + + // NOTE: DOM access here + // resets the popper's position so that the document size can be calculated excluding + // the size of the popper element itself + var transformProp = getSupportedPropertyName('transform'); + var popperStyles = data.instance.popper.style; // assignment to help minification + var top = popperStyles.top, + left = popperStyles.left, + transform = popperStyles[transformProp]; + + popperStyles.top = ''; + popperStyles.left = ''; + popperStyles[transformProp] = ''; + + var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, boundariesElement, data.positionFixed); + + // NOTE: DOM access here + // restores the original style properties after the offsets have been computed + popperStyles.top = top; + popperStyles.left = left; + popperStyles[transformProp] = transform; + + options.boundaries = boundaries; + + var order = options.priority; + var popper = data.offsets.popper; + + var check = { + primary: function primary(placement) { + var value = popper[placement]; + if (popper[placement] < boundaries[placement] && !options.escapeWithReference) { + value = Math.max(popper[placement], boundaries[placement]); + } + return defineProperty({}, placement, value); + }, + secondary: function secondary(placement) { + var mainSide = placement === 'right' ? 'left' : 'top'; + var value = popper[mainSide]; + if (popper[placement] > boundaries[placement] && !options.escapeWithReference) { + value = Math.min(popper[mainSide], boundaries[placement] - (placement === 'right' ? popper.width : popper.height)); + } + return defineProperty({}, mainSide, value); + } + }; + + order.forEach(function (placement) { + var side = ['left', 'top'].indexOf(placement) !== -1 ? 'primary' : 'secondary'; + popper = _extends({}, popper, check[side](placement)); + }); + + data.offsets.popper = popper; + + return data; + } + + /** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by `update` method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ + function shift(data) { + var placement = data.placement; + var basePlacement = placement.split('-')[0]; + var shiftvariation = placement.split('-')[1]; + + // if shift shiftvariation is specified, run the modifier + if (shiftvariation) { + var _data$offsets = data.offsets, + reference = _data$offsets.reference, + popper = _data$offsets.popper; + + var isVertical = ['bottom', 'top'].indexOf(basePlacement) !== -1; + var side = isVertical ? 'left' : 'top'; + var measurement = isVertical ? 'width' : 'height'; + + var shiftOffsets = { + start: defineProperty({}, side, reference[side]), + end: defineProperty({}, side, reference[side] + reference[measurement] - popper[measurement]) + }; + + data.offsets.popper = _extends({}, popper, shiftOffsets[shiftvariation]); + } + + return data; + } + + /** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ + function hide(data) { + if (!isModifierRequired(data.instance.modifiers, 'hide', 'preventOverflow')) { + return data; + } + + var refRect = data.offsets.reference; + var bound = find(data.instance.modifiers, function (modifier) { + return modifier.name === 'preventOverflow'; + }).boundaries; + + if (refRect.bottom < bound.top || refRect.left > bound.right || refRect.top > bound.bottom || refRect.right < bound.left) { + // Avoid unnecessary DOM access if visibility hasn't changed + if (data.hide === true) { + return data; + } + + data.hide = true; + data.attributes['x-out-of-boundaries'] = ''; + } else { + // Avoid unnecessary DOM access if visibility hasn't changed + if (data.hide === false) { + return data; + } + + data.hide = false; + data.attributes['x-out-of-boundaries'] = false; + } + + return data; + } + + /** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by `update` method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ + function inner(data) { + var placement = data.placement; + var basePlacement = placement.split('-')[0]; + var _data$offsets = data.offsets, + popper = _data$offsets.popper, + reference = _data$offsets.reference; + + var isHoriz = ['left', 'right'].indexOf(basePlacement) !== -1; + + var subtractLength = ['top', 'left'].indexOf(basePlacement) === -1; + + popper[isHoriz ? 'left' : 'top'] = reference[basePlacement] - (subtractLength ? popper[isHoriz ? 'width' : 'height'] : 0); + + data.placement = getOppositePlacement(placement); + data.offsets.popper = getClientRect(popper); + + return data; + } + + /** + * Modifier function, each modifier can have a function of this type assigned + * to its `fn` property.<br /> + * These functions will be called on each update, this means that you must + * make sure they are performant enough to avoid performance bottlenecks. + * + * @function ModifierFn + * @argument {dataObject} data - The data object generated by `update` method + * @argument {Object} options - Modifiers configuration and options + * @returns {dataObject} The data object, properly modified + */ + + /** + * Modifiers are plugins used to alter the behavior of your poppers.<br /> + * Popper.js uses a set of 9 modifiers to provide all the basic functionalities + * needed by the library. + * + * Usually you don't want to override the `order`, `fn` and `onLoad` props. + * All the other properties are configurations that could be tweaked. + * @namespace modifiers + */ + var modifiers = { + /** + * Modifier used to shift the popper on the start or end of its reference + * element.<br /> + * It will read the variation of the `placement` property.<br /> + * It can be one either `-end` or `-start`. + * @memberof modifiers + * @inner + */ + shift: { + /** @prop {number} order=100 - Index used to define the order of execution */ + order: 100, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: shift + }, + + /** + * The `offset` modifier can shift your popper on both its axis. + * + * It accepts the following units: + * - `px` or unitless, interpreted as pixels + * - `%` or `%r`, percentage relative to the length of the reference element + * - `%p`, percentage relative to the length of the popper element + * - `vw`, CSS viewport width unit + * - `vh`, CSS viewport height unit + * + * For length is intended the main axis relative to the placement of the popper.<br /> + * This means that if the placement is `top` or `bottom`, the length will be the + * `width`. In case of `left` or `right`, it will be the height. + * + * You can provide a single value (as `Number` or `String`), or a pair of values + * as `String` divided by a comma or one (or more) white spaces.<br /> + * The latter is a deprecated method because it leads to confusion and will be + * removed in v2.<br /> + * Additionally, it accepts additions and subtractions between different units. + * Note that multiplications and divisions aren't supported. + * + * Valid examples are: + * ``` + * 10 + * '10%' + * '10, 10' + * '10%, 10' + * '10 + 10%' + * '10 - 5vh + 3%' + * '-10px + 5vh, 5px - 6%' + * ``` + * > **NB**: If you desire to apply offsets to your poppers in a way that may make them overlap + * > with their reference element, unfortunately, you will have to disable the `flip` modifier. + * > More on this [reading this issue](https://github.com/FezVrasta/popper.js/issues/373) + * + * @memberof modifiers + * @inner + */ + offset: { + /** @prop {number} order=200 - Index used to define the order of execution */ + order: 200, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: offset, + /** @prop {Number|String} offset=0 + * The offset value as described in the modifier description + */ + offset: 0 + }, + + /** + * Modifier used to prevent the popper from being positioned outside the boundary. + * + * An scenario exists where the reference itself is not within the boundaries.<br /> + * We can say it has "escaped the boundaries" — or just "escaped".<br /> + * In this case we need to decide whether the popper should either: + * + * - detach from the reference and remain "trapped" in the boundaries, or + * - if it should ignore the boundary and "escape with its reference" + * + * When `escapeWithReference` is set to`true` and reference is completely + * outside its boundaries, the popper will overflow (or completely leave) + * the boundaries in order to remain attached to the edge of the reference. + * + * @memberof modifiers + * @inner + */ + preventOverflow: { + /** @prop {number} order=300 - Index used to define the order of execution */ + order: 300, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: preventOverflow, + /** + * @prop {Array} [priority=['left','right','top','bottom']] + * Popper will try to prevent overflow following these priorities by default, + * then, it could overflow on the left and on top of the `boundariesElement` + */ + priority: ['left', 'right', 'top', 'bottom'], + /** + * @prop {number} padding=5 + * Amount of pixel used to define a minimum distance between the boundaries + * and the popper this makes sure the popper has always a little padding + * between the edges of its container + */ + padding: 5, + /** + * @prop {String|HTMLElement} boundariesElement='scrollParent' + * Boundaries used by the modifier, can be `scrollParent`, `window`, + * `viewport` or any DOM element. + */ + boundariesElement: 'scrollParent' + }, + + /** + * Modifier used to make sure the reference and its popper stay near eachothers + * without leaving any gap between the two. Expecially useful when the arrow is + * enabled and you want to assure it to point to its reference element. + * It cares only about the first axis, you can still have poppers with margin + * between the popper and its reference element. + * @memberof modifiers + * @inner + */ + keepTogether: { + /** @prop {number} order=400 - Index used to define the order of execution */ + order: 400, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: keepTogether + }, + + /** + * This modifier is used to move the `arrowElement` of the popper to make + * sure it is positioned between the reference element and its popper element. + * It will read the outer size of the `arrowElement` node to detect how many + * pixels of conjuction are needed. + * + * It has no effect if no `arrowElement` is provided. + * @memberof modifiers + * @inner + */ + arrow: { + /** @prop {number} order=500 - Index used to define the order of execution */ + order: 500, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: arrow, + /** @prop {String|HTMLElement} element='[x-arrow]' - Selector or node used as arrow */ + element: '[x-arrow]' + }, + + /** + * Modifier used to flip the popper's placement when it starts to overlap its + * reference element. + * + * Requires the `preventOverflow` modifier before it in order to work. + * + * **NOTE:** this modifier will interrupt the current update cycle and will + * restart it if it detects the need to flip the placement. + * @memberof modifiers + * @inner + */ + flip: { + /** @prop {number} order=600 - Index used to define the order of execution */ + order: 600, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: flip, + /** + * @prop {String|Array} behavior='flip' + * The behavior used to change the popper's placement. It can be one of + * `flip`, `clockwise`, `counterclockwise` or an array with a list of valid + * placements (with optional variations). + */ + behavior: 'flip', + /** + * @prop {number} padding=5 + * The popper will flip if it hits the edges of the `boundariesElement` + */ + padding: 5, + /** + * @prop {String|HTMLElement} boundariesElement='viewport' + * The element which will define the boundaries of the popper position, + * the popper will never be placed outside of the defined boundaries + * (except if keepTogether is enabled) + */ + boundariesElement: 'viewport' + }, + + /** + * Modifier used to make the popper flow toward the inner of the reference element. + * By default, when this modifier is disabled, the popper will be placed outside + * the reference element. + * @memberof modifiers + * @inner + */ + inner: { + /** @prop {number} order=700 - Index used to define the order of execution */ + order: 700, + /** @prop {Boolean} enabled=false - Whether the modifier is enabled or not */ + enabled: false, + /** @prop {ModifierFn} */ + fn: inner + }, + + /** + * Modifier used to hide the popper when its reference element is outside of the + * popper boundaries. It will set a `x-out-of-boundaries` attribute which can + * be used to hide with a CSS selector the popper when its reference is + * out of boundaries. + * + * Requires the `preventOverflow` modifier before it in order to work. + * @memberof modifiers + * @inner + */ + hide: { + /** @prop {number} order=800 - Index used to define the order of execution */ + order: 800, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: hide + }, + + /** + * Computes the style that will be applied to the popper element to gets + * properly positioned. + * + * Note that this modifier will not touch the DOM, it just prepares the styles + * so that `applyStyle` modifier can apply it. This separation is useful + * in case you need to replace `applyStyle` with a custom implementation. + * + * This modifier has `850` as `order` value to maintain backward compatibility + * with previous versions of Popper.js. Expect the modifiers ordering method + * to change in future major versions of the library. + * + * @memberof modifiers + * @inner + */ + computeStyle: { + /** @prop {number} order=850 - Index used to define the order of execution */ + order: 850, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: computeStyle, + /** + * @prop {Boolean} gpuAcceleration=true + * If true, it uses the CSS 3d transformation to position the popper. + * Otherwise, it will use the `top` and `left` properties. + */ + gpuAcceleration: true, + /** + * @prop {string} [x='bottom'] + * Where to anchor the X axis (`bottom` or `top`). AKA X offset origin. + * Change this if your popper should grow in a direction different from `bottom` + */ + x: 'bottom', + /** + * @prop {string} [x='left'] + * Where to anchor the Y axis (`left` or `right`). AKA Y offset origin. + * Change this if your popper should grow in a direction different from `right` + */ + y: 'right' + }, + + /** + * Applies the computed styles to the popper element. + * + * All the DOM manipulations are limited to this modifier. This is useful in case + * you want to integrate Popper.js inside a framework or view library and you + * want to delegate all the DOM manipulations to it. + * + * Note that if you disable this modifier, you must make sure the popper element + * has its position set to `absolute` before Popper.js can do its work! + * + * Just disable this modifier and define you own to achieve the desired effect. + * + * @memberof modifiers + * @inner + */ + applyStyle: { + /** @prop {number} order=900 - Index used to define the order of execution */ + order: 900, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: applyStyle, + /** @prop {Function} */ + onLoad: applyStyleOnLoad, + /** + * @deprecated since version 1.10.0, the property moved to `computeStyle` modifier + * @prop {Boolean} gpuAcceleration=true + * If true, it uses the CSS 3d transformation to position the popper. + * Otherwise, it will use the `top` and `left` properties. + */ + gpuAcceleration: undefined + } + }; + + /** + * The `dataObject` is an object containing all the informations used by Popper.js + * this object get passed to modifiers and to the `onCreate` and `onUpdate` callbacks. + * @name dataObject + * @property {Object} data.instance The Popper.js instance + * @property {String} data.placement Placement applied to popper + * @property {String} data.originalPlacement Placement originally defined on init + * @property {Boolean} data.flipped True if popper has been flipped by flip modifier + * @property {Boolean} data.hide True if the reference element is out of boundaries, useful to know when to hide the popper. + * @property {HTMLElement} data.arrowElement Node used as arrow by arrow modifier + * @property {Object} data.styles Any CSS property defined here will be applied to the popper, it expects the JavaScript nomenclature (eg. `marginBottom`) + * @property {Object} data.arrowStyles Any CSS property defined here will be applied to the popper arrow, it expects the JavaScript nomenclature (eg. `marginBottom`) + * @property {Object} data.boundaries Offsets of the popper boundaries + * @property {Object} data.offsets The measurements of popper, reference and arrow elements. + * @property {Object} data.offsets.popper `top`, `left`, `width`, `height` values + * @property {Object} data.offsets.reference `top`, `left`, `width`, `height` values + * @property {Object} data.offsets.arrow] `top` and `left` offsets, only one of them will be different from 0 + */ + + /** + * Default options provided to Popper.js constructor.<br /> + * These can be overriden using the `options` argument of Popper.js.<br /> + * To override an option, simply pass as 3rd argument an object with the same + * structure of this object, example: + * ``` + * new Popper(ref, pop, { + * modifiers: { + * preventOverflow: { enabled: false } + * } + * }) + * ``` + * @type {Object} + * @static + * @memberof Popper + */ + var Defaults = { + /** + * Popper's placement + * @prop {Popper.placements} placement='bottom' + */ + placement: 'bottom', + + /** + * Set this to true if you want popper to position it self in 'fixed' mode + * @prop {Boolean} positionFixed=false + */ + positionFixed: false, + + /** + * Whether events (resize, scroll) are initially enabled + * @prop {Boolean} eventsEnabled=true + */ + eventsEnabled: true, + + /** + * Set to true if you want to automatically remove the popper when + * you call the `destroy` method. + * @prop {Boolean} removeOnDestroy=false + */ + removeOnDestroy: false, + + /** + * Callback called when the popper is created.<br /> + * By default, is set to no-op.<br /> + * Access Popper.js instance with `data.instance`. + * @prop {onCreate} + */ + onCreate: function onCreate() {}, + + /** + * Callback called when the popper is updated, this callback is not called + * on the initialization/creation of the popper, but only on subsequent + * updates.<br /> + * By default, is set to no-op.<br /> + * Access Popper.js instance with `data.instance`. + * @prop {onUpdate} + */ + onUpdate: function onUpdate() {}, + + /** + * List of modifiers used to modify the offsets before they are applied to the popper. + * They provide most of the functionalities of Popper.js + * @prop {modifiers} + */ + modifiers: modifiers + }; + + /** + * @callback onCreate + * @param {dataObject} data + */ + + /** + * @callback onUpdate + * @param {dataObject} data + */ + + // Utils + // Methods + var Popper = function () { + /** + * Create a new Popper.js instance + * @class Popper + * @param {HTMLElement|referenceObject} reference - The reference element used to position the popper + * @param {HTMLElement} popper - The HTML element used as popper. + * @param {Object} options - Your custom options to override the ones defined in [Defaults](#defaults) + * @return {Object} instance - The generated Popper.js instance + */ + function Popper(reference, popper) { + var _this = this; + + var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {}; + classCallCheck(this, Popper); + + this.scheduleUpdate = function () { + return requestAnimationFrame(_this.update); + }; + + // make update() debounced, so that it only runs at most once-per-tick + this.update = debounce(this.update.bind(this)); + + // with {} we create a new object with the options inside it + this.options = _extends({}, Popper.Defaults, options); + + // init state + this.state = { + isDestroyed: false, + isCreated: false, + scrollParents: [] + }; + + // get reference and popper elements (allow jQuery wrappers) + this.reference = reference && reference.jquery ? reference[0] : reference; + this.popper = popper && popper.jquery ? popper[0] : popper; + + // Deep merge modifiers options + this.options.modifiers = {}; + Object.keys(_extends({}, Popper.Defaults.modifiers, options.modifiers)).forEach(function (name) { + _this.options.modifiers[name] = _extends({}, Popper.Defaults.modifiers[name] || {}, options.modifiers ? options.modifiers[name] : {}); + }); + + // Refactoring modifiers' list (Object => Array) + this.modifiers = Object.keys(this.options.modifiers).map(function (name) { + return _extends({ + name: name + }, _this.options.modifiers[name]); + }) + // sort the modifiers by order + .sort(function (a, b) { + return a.order - b.order; + }); + + // modifiers have the ability to execute arbitrary code when Popper.js get inited + // such code is executed in the same order of its modifier + // they could add new properties to their options configuration + // BE AWARE: don't add options to `options.modifiers.name` but to `modifierOptions`! + this.modifiers.forEach(function (modifierOptions) { + if (modifierOptions.enabled && isFunction(modifierOptions.onLoad)) { + modifierOptions.onLoad(_this.reference, _this.popper, _this.options, modifierOptions, _this.state); + } + }); + + // fire the first update to position the popper in the right place + this.update(); + + var eventsEnabled = this.options.eventsEnabled; + if (eventsEnabled) { + // setup event listeners, they will take care of update the position in specific situations + this.enableEventListeners(); + } + + this.state.eventsEnabled = eventsEnabled; + } + + // We can't use class properties because they don't get listed in the + // class prototype and break stuff like Sinon stubs + + + createClass(Popper, [{ + key: 'update', + value: function update$$1() { + return update.call(this); + } + }, { + key: 'destroy', + value: function destroy$$1() { + return destroy.call(this); + } + }, { + key: 'enableEventListeners', + value: function enableEventListeners$$1() { + return enableEventListeners.call(this); + } + }, { + key: 'disableEventListeners', + value: function disableEventListeners$$1() { + return disableEventListeners.call(this); + } + + /** + * Schedule an update, it will run on the next UI update available + * @method scheduleUpdate + * @memberof Popper + */ + + + /** + * Collection of utilities useful when writing custom modifiers. + * Starting from version 1.7, this method is available only if you + * include `popper-utils.js` before `popper.js`. + * + * **DEPRECATION**: This way to access PopperUtils is deprecated + * and will be removed in v2! Use the PopperUtils module directly instead. + * Due to the high instability of the methods contained in Utils, we can't + * guarantee them to follow semver. Use them at your own risk! + * @static + * @private + * @type {Object} + * @deprecated since version 1.8 + * @member Utils + * @memberof Popper + */ + + }]); + return Popper; + }(); + + /** + * The `referenceObject` is an object that provides an interface compatible with Popper.js + * and lets you use it as replacement of a real DOM node.<br /> + * You can use this method to position a popper relatively to a set of coordinates + * in case you don't have a DOM node to use as reference. + * + * ``` + * new Popper(referenceObject, popperNode); + * ``` + * + * NB: This feature isn't supported in Internet Explorer 10 + * @name referenceObject + * @property {Function} data.getBoundingClientRect + * A function that returns a set of coordinates compatible with the native `getBoundingClientRect` method. + * @property {number} data.clientWidth + * An ES6 getter that will return the width of the virtual reference element. + * @property {number} data.clientHeight + * An ES6 getter that will return the height of the virtual reference element. + */ + + + Popper.Utils = (typeof window !== 'undefined' ? window : global).PopperUtils; + Popper.placements = placements; + Popper.Defaults = Defaults; + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v4.1.3): dropdown.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + + var Dropdown = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'dropdown'; + var VERSION = '4.1.3'; + var DATA_KEY = 'bs.dropdown'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key + + var SPACE_KEYCODE = 32; // KeyboardEvent.which value for space key + + var TAB_KEYCODE = 9; // KeyboardEvent.which value for tab key + + var ARROW_UP_KEYCODE = 38; // KeyboardEvent.which value for up arrow key + + var ARROW_DOWN_KEYCODE = 40; // KeyboardEvent.which value for down arrow key + + var RIGHT_MOUSE_BUTTON_WHICH = 3; // MouseEvent.which value for the right button (assuming a right-handed mouse) + + var REGEXP_KEYDOWN = new RegExp(ARROW_UP_KEYCODE + "|" + ARROW_DOWN_KEYCODE + "|" + ESCAPE_KEYCODE); + var Event = { + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + CLICK: "click" + EVENT_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY, + KEYDOWN_DATA_API: "keydown" + EVENT_KEY + DATA_API_KEY, + KEYUP_DATA_API: "keyup" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + DISABLED: 'disabled', + SHOW: 'show', + DROPUP: 'dropup', + DROPRIGHT: 'dropright', + DROPLEFT: 'dropleft', + MENURIGHT: 'dropdown-menu-right', + MENULEFT: 'dropdown-menu-left', + POSITION_STATIC: 'position-static' + }; + var Selector = { + DATA_TOGGLE: '[data-toggle="dropdown"]', + FORM_CHILD: '.dropdown form', + MENU: '.dropdown-menu', + NAVBAR_NAV: '.navbar-nav', + VISIBLE_ITEMS: '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)' + }; + var AttachmentMap = { + TOP: 'top-start', + TOPEND: 'top-end', + BOTTOM: 'bottom-start', + BOTTOMEND: 'bottom-end', + RIGHT: 'right-start', + RIGHTEND: 'right-end', + LEFT: 'left-start', + LEFTEND: 'left-end' + }; + var Default = { + offset: 0, + flip: true, + boundary: 'scrollParent', + reference: 'toggle', + display: 'dynamic' + }; + var DefaultType = { + offset: '(number|string|function)', + flip: 'boolean', + boundary: '(string|element)', + reference: '(string|element)', + display: 'string' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Dropdown = + /*#__PURE__*/ + function () { + function Dropdown(element, config) { + this._element = element; + this._popper = null; + this._config = this._getConfig(config); + this._menu = this._getMenuElement(); + this._inNavbar = this._detectNavbar(); + + this._addEventListeners(); + } // Getters + + + var _proto = Dropdown.prototype; + + // Public + _proto.toggle = function toggle() { + if (this._element.disabled || $$$1(this._element).hasClass(ClassName.DISABLED)) { + return; + } + + var parent = Dropdown._getParentFromElement(this._element); + + var isActive = $$$1(this._menu).hasClass(ClassName.SHOW); + + Dropdown._clearMenus(); + + if (isActive) { + return; + } + + var relatedTarget = { + relatedTarget: this._element + }; + var showEvent = $$$1.Event(Event.SHOW, relatedTarget); + $$$1(parent).trigger(showEvent); + + if (showEvent.isDefaultPrevented()) { + return; + } // Disable totally Popper.js for Dropdown in Navbar + + + if (!this._inNavbar) { + /** + * Check for Popper dependency + * Popper - https://popper.js.org + */ + if (typeof Popper === 'undefined') { + throw new TypeError('Bootstrap dropdown require Popper.js (https://popper.js.org)'); + } + + var referenceElement = this._element; + + if (this._config.reference === 'parent') { + referenceElement = parent; + } else if (Util.isElement(this._config.reference)) { + referenceElement = this._config.reference; // Check if it's jQuery element + + if (typeof this._config.reference.jquery !== 'undefined') { + referenceElement = this._config.reference[0]; + } + } // If boundary is not `scrollParent`, then set position to `static` + // to allow the menu to "escape" the scroll parent's boundaries + // https://github.com/twbs/bootstrap/issues/24251 + + + if (this._config.boundary !== 'scrollParent') { + $$$1(parent).addClass(ClassName.POSITION_STATIC); + } + + this._popper = new Popper(referenceElement, this._menu, this._getPopperConfig()); + } // If this is a touch-enabled device we add extra + // empty mouseover listeners to the body's immediate children; + // only needed because of broken event delegation on iOS + // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html + + + if ('ontouchstart' in document.documentElement && $$$1(parent).closest(Selector.NAVBAR_NAV).length === 0) { + $$$1(document.body).children().on('mouseover', null, $$$1.noop); + } + + this._element.focus(); + + this._element.setAttribute('aria-expanded', true); + + $$$1(this._menu).toggleClass(ClassName.SHOW); + $$$1(parent).toggleClass(ClassName.SHOW).trigger($$$1.Event(Event.SHOWN, relatedTarget)); + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + $$$1(this._element).off(EVENT_KEY); + this._element = null; + this._menu = null; + + if (this._popper !== null) { + this._popper.destroy(); + + this._popper = null; + } + }; + + _proto.update = function update() { + this._inNavbar = this._detectNavbar(); + + if (this._popper !== null) { + this._popper.scheduleUpdate(); + } + }; // Private + + + _proto._addEventListeners = function _addEventListeners() { + var _this = this; + + $$$1(this._element).on(Event.CLICK, function (event) { + event.preventDefault(); + event.stopPropagation(); + + _this.toggle(); + }); + }; + + _proto._getConfig = function _getConfig(config) { + config = _objectSpread({}, this.constructor.Default, $$$1(this._element).data(), config); + Util.typeCheckConfig(NAME, config, this.constructor.DefaultType); + return config; + }; + + _proto._getMenuElement = function _getMenuElement() { + if (!this._menu) { + var parent = Dropdown._getParentFromElement(this._element); + + if (parent) { + this._menu = parent.querySelector(Selector.MENU); + } + } + + return this._menu; + }; + + _proto._getPlacement = function _getPlacement() { + var $parentDropdown = $$$1(this._element.parentNode); + var placement = AttachmentMap.BOTTOM; // Handle dropup + + if ($parentDropdown.hasClass(ClassName.DROPUP)) { + placement = AttachmentMap.TOP; + + if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) { + placement = AttachmentMap.TOPEND; + } + } else if ($parentDropdown.hasClass(ClassName.DROPRIGHT)) { + placement = AttachmentMap.RIGHT; + } else if ($parentDropdown.hasClass(ClassName.DROPLEFT)) { + placement = AttachmentMap.LEFT; + } else if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) { + placement = AttachmentMap.BOTTOMEND; + } + + return placement; + }; + + _proto._detectNavbar = function _detectNavbar() { + return $$$1(this._element).closest('.navbar').length > 0; + }; + + _proto._getPopperConfig = function _getPopperConfig() { + var _this2 = this; + + var offsetConf = {}; + + if (typeof this._config.offset === 'function') { + offsetConf.fn = function (data) { + data.offsets = _objectSpread({}, data.offsets, _this2._config.offset(data.offsets) || {}); + return data; + }; + } else { + offsetConf.offset = this._config.offset; + } + + var popperConfig = { + placement: this._getPlacement(), + modifiers: { + offset: offsetConf, + flip: { + enabled: this._config.flip + }, + preventOverflow: { + boundariesElement: this._config.boundary + } + } // Disable Popper.js if we have a static display + + }; + + if (this._config.display === 'static') { + popperConfig.modifiers.applyStyle = { + enabled: false + }; + } + + return popperConfig; + }; // Static + + + Dropdown._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = typeof config === 'object' ? config : null; + + if (!data) { + data = new Dropdown(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + Dropdown._clearMenus = function _clearMenus(event) { + if (event && (event.which === RIGHT_MOUSE_BUTTON_WHICH || event.type === 'keyup' && event.which !== TAB_KEYCODE)) { + return; + } + + var toggles = [].slice.call(document.querySelectorAll(Selector.DATA_TOGGLE)); + + for (var i = 0, len = toggles.length; i < len; i++) { + var parent = Dropdown._getParentFromElement(toggles[i]); + + var context = $$$1(toggles[i]).data(DATA_KEY); + var relatedTarget = { + relatedTarget: toggles[i] + }; + + if (event && event.type === 'click') { + relatedTarget.clickEvent = event; + } + + if (!context) { + continue; + } + + var dropdownMenu = context._menu; + + if (!$$$1(parent).hasClass(ClassName.SHOW)) { + continue; + } + + if (event && (event.type === 'click' && /input|textarea/i.test(event.target.tagName) || event.type === 'keyup' && event.which === TAB_KEYCODE) && $$$1.contains(parent, event.target)) { + continue; + } + + var hideEvent = $$$1.Event(Event.HIDE, relatedTarget); + $$$1(parent).trigger(hideEvent); + + if (hideEvent.isDefaultPrevented()) { + continue; + } // If this is a touch-enabled device we remove the extra + // empty mouseover listeners we added for iOS support + + + if ('ontouchstart' in document.documentElement) { + $$$1(document.body).children().off('mouseover', null, $$$1.noop); + } + + toggles[i].setAttribute('aria-expanded', 'false'); + $$$1(dropdownMenu).removeClass(ClassName.SHOW); + $$$1(parent).removeClass(ClassName.SHOW).trigger($$$1.Event(Event.HIDDEN, relatedTarget)); + } + }; + + Dropdown._getParentFromElement = function _getParentFromElement(element) { + var parent; + var selector = Util.getSelectorFromElement(element); + + if (selector) { + parent = document.querySelector(selector); + } + + return parent || element.parentNode; + }; // eslint-disable-next-line complexity + + + Dropdown._dataApiKeydownHandler = function _dataApiKeydownHandler(event) { + // If not input/textarea: + // - And not a key in REGEXP_KEYDOWN => not a dropdown command + // If input/textarea: + // - If space key => not a dropdown command + // - If key is other than escape + // - If key is not up or down => not a dropdown command + // - If trigger inside the menu => not a dropdown command + if (/input|textarea/i.test(event.target.tagName) ? event.which === SPACE_KEYCODE || event.which !== ESCAPE_KEYCODE && (event.which !== ARROW_DOWN_KEYCODE && event.which !== ARROW_UP_KEYCODE || $$$1(event.target).closest(Selector.MENU).length) : !REGEXP_KEYDOWN.test(event.which)) { + return; + } + + event.preventDefault(); + event.stopPropagation(); + + if (this.disabled || $$$1(this).hasClass(ClassName.DISABLED)) { + return; + } + + var parent = Dropdown._getParentFromElement(this); + + var isActive = $$$1(parent).hasClass(ClassName.SHOW); + + if (!isActive && (event.which !== ESCAPE_KEYCODE || event.which !== SPACE_KEYCODE) || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) { + if (event.which === ESCAPE_KEYCODE) { + var toggle = parent.querySelector(Selector.DATA_TOGGLE); + $$$1(toggle).trigger('focus'); + } + + $$$1(this).trigger('click'); + return; + } + + var items = [].slice.call(parent.querySelectorAll(Selector.VISIBLE_ITEMS)); + + if (items.length === 0) { + return; + } + + var index = items.indexOf(event.target); + + if (event.which === ARROW_UP_KEYCODE && index > 0) { + // Up + index--; + } + + if (event.which === ARROW_DOWN_KEYCODE && index < items.length - 1) { + // Down + index++; + } + + if (index < 0) { + index = 0; + } + + items[index].focus(); + }; + + _createClass(Dropdown, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }, { + key: "DefaultType", + get: function get() { + return DefaultType; + } + }]); + + return Dropdown; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.KEYDOWN_DATA_API, Selector.DATA_TOGGLE, Dropdown._dataApiKeydownHandler).on(Event.KEYDOWN_DATA_API, Selector.MENU, Dropdown._dataApiKeydownHandler).on(Event.CLICK_DATA_API + " " + Event.KEYUP_DATA_API, Dropdown._clearMenus).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) { + event.preventDefault(); + event.stopPropagation(); + + Dropdown._jQueryInterface.call($$$1(this), 'toggle'); + }).on(Event.CLICK_DATA_API, Selector.FORM_CHILD, function (e) { + e.stopPropagation(); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Dropdown._jQueryInterface; + $$$1.fn[NAME].Constructor = Dropdown; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Dropdown._jQueryInterface; + }; + + return Dropdown; + }($, Popper); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v4.1.3): modal.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + + var Modal = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'modal'; + var VERSION = '4.1.3'; + var DATA_KEY = 'bs.modal'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key + + var Default = { + backdrop: true, + keyboard: true, + focus: true, + show: true + }; + var DefaultType = { + backdrop: '(boolean|string)', + keyboard: 'boolean', + focus: 'boolean', + show: 'boolean' + }; + var Event = { + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + FOCUSIN: "focusin" + EVENT_KEY, + RESIZE: "resize" + EVENT_KEY, + CLICK_DISMISS: "click.dismiss" + EVENT_KEY, + KEYDOWN_DISMISS: "keydown.dismiss" + EVENT_KEY, + MOUSEUP_DISMISS: "mouseup.dismiss" + EVENT_KEY, + MOUSEDOWN_DISMISS: "mousedown.dismiss" + EVENT_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + SCROLLBAR_MEASURER: 'modal-scrollbar-measure', + BACKDROP: 'modal-backdrop', + OPEN: 'modal-open', + FADE: 'fade', + SHOW: 'show' + }; + var Selector = { + DIALOG: '.modal-dialog', + DATA_TOGGLE: '[data-toggle="modal"]', + DATA_DISMISS: '[data-dismiss="modal"]', + FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top', + STICKY_CONTENT: '.sticky-top' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Modal = + /*#__PURE__*/ + function () { + function Modal(element, config) { + this._config = this._getConfig(config); + this._element = element; + this._dialog = element.querySelector(Selector.DIALOG); + this._backdrop = null; + this._isShown = false; + this._isBodyOverflowing = false; + this._ignoreBackdropClick = false; + this._scrollbarWidth = 0; + } // Getters + + + var _proto = Modal.prototype; + + // Public + _proto.toggle = function toggle(relatedTarget) { + return this._isShown ? this.hide() : this.show(relatedTarget); + }; + + _proto.show = function show(relatedTarget) { + var _this = this; + + if (this._isTransitioning || this._isShown) { + return; + } + + if ($$$1(this._element).hasClass(ClassName.FADE)) { + this._isTransitioning = true; + } + + var showEvent = $$$1.Event(Event.SHOW, { + relatedTarget: relatedTarget + }); + $$$1(this._element).trigger(showEvent); + + if (this._isShown || showEvent.isDefaultPrevented()) { + return; + } + + this._isShown = true; + + this._checkScrollbar(); + + this._setScrollbar(); + + this._adjustDialog(); + + $$$1(document.body).addClass(ClassName.OPEN); + + this._setEscapeEvent(); + + this._setResizeEvent(); + + $$$1(this._element).on(Event.CLICK_DISMISS, Selector.DATA_DISMISS, function (event) { + return _this.hide(event); + }); + $$$1(this._dialog).on(Event.MOUSEDOWN_DISMISS, function () { + $$$1(_this._element).one(Event.MOUSEUP_DISMISS, function (event) { + if ($$$1(event.target).is(_this._element)) { + _this._ignoreBackdropClick = true; + } + }); + }); + + this._showBackdrop(function () { + return _this._showElement(relatedTarget); + }); + }; + + _proto.hide = function hide(event) { + var _this2 = this; + + if (event) { + event.preventDefault(); + } + + if (this._isTransitioning || !this._isShown) { + return; + } + + var hideEvent = $$$1.Event(Event.HIDE); + $$$1(this._element).trigger(hideEvent); + + if (!this._isShown || hideEvent.isDefaultPrevented()) { + return; + } + + this._isShown = false; + var transition = $$$1(this._element).hasClass(ClassName.FADE); + + if (transition) { + this._isTransitioning = true; + } + + this._setEscapeEvent(); + + this._setResizeEvent(); + + $$$1(document).off(Event.FOCUSIN); + $$$1(this._element).removeClass(ClassName.SHOW); + $$$1(this._element).off(Event.CLICK_DISMISS); + $$$1(this._dialog).off(Event.MOUSEDOWN_DISMISS); + + if (transition) { + var transitionDuration = Util.getTransitionDurationFromElement(this._element); + $$$1(this._element).one(Util.TRANSITION_END, function (event) { + return _this2._hideModal(event); + }).emulateTransitionEnd(transitionDuration); + } else { + this._hideModal(); + } + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + $$$1(window, document, this._element, this._backdrop).off(EVENT_KEY); + this._config = null; + this._element = null; + this._dialog = null; + this._backdrop = null; + this._isShown = null; + this._isBodyOverflowing = null; + this._ignoreBackdropClick = null; + this._scrollbarWidth = null; + }; + + _proto.handleUpdate = function handleUpdate() { + this._adjustDialog(); + }; // Private + + + _proto._getConfig = function _getConfig(config) { + config = _objectSpread({}, Default, config); + Util.typeCheckConfig(NAME, config, DefaultType); + return config; + }; + + _proto._showElement = function _showElement(relatedTarget) { + var _this3 = this; + + var transition = $$$1(this._element).hasClass(ClassName.FADE); + + if (!this._element.parentNode || this._element.parentNode.nodeType !== Node.ELEMENT_NODE) { + // Don't move modal's DOM position + document.body.appendChild(this._element); + } + + this._element.style.display = 'block'; + + this._element.removeAttribute('aria-hidden'); + + this._element.scrollTop = 0; + + if (transition) { + Util.reflow(this._element); + } + + $$$1(this._element).addClass(ClassName.SHOW); + + if (this._config.focus) { + this._enforceFocus(); + } + + var shownEvent = $$$1.Event(Event.SHOWN, { + relatedTarget: relatedTarget + }); + + var transitionComplete = function transitionComplete() { + if (_this3._config.focus) { + _this3._element.focus(); + } + + _this3._isTransitioning = false; + $$$1(_this3._element).trigger(shownEvent); + }; + + if (transition) { + var transitionDuration = Util.getTransitionDurationFromElement(this._element); + $$$1(this._dialog).one(Util.TRANSITION_END, transitionComplete).emulateTransitionEnd(transitionDuration); + } else { + transitionComplete(); + } + }; + + _proto._enforceFocus = function _enforceFocus() { + var _this4 = this; + + $$$1(document).off(Event.FOCUSIN) // Guard against infinite focus loop + .on(Event.FOCUSIN, function (event) { + if (document !== event.target && _this4._element !== event.target && $$$1(_this4._element).has(event.target).length === 0) { + _this4._element.focus(); + } + }); + }; + + _proto._setEscapeEvent = function _setEscapeEvent() { + var _this5 = this; + + if (this._isShown && this._config.keyboard) { + $$$1(this._element).on(Event.KEYDOWN_DISMISS, function (event) { + if (event.which === ESCAPE_KEYCODE) { + event.preventDefault(); + + _this5.hide(); + } + }); + } else if (!this._isShown) { + $$$1(this._element).off(Event.KEYDOWN_DISMISS); + } + }; + + _proto._setResizeEvent = function _setResizeEvent() { + var _this6 = this; + + if (this._isShown) { + $$$1(window).on(Event.RESIZE, function (event) { + return _this6.handleUpdate(event); + }); + } else { + $$$1(window).off(Event.RESIZE); + } + }; + + _proto._hideModal = function _hideModal() { + var _this7 = this; + + this._element.style.display = 'none'; + + this._element.setAttribute('aria-hidden', true); + + this._isTransitioning = false; + + this._showBackdrop(function () { + $$$1(document.body).removeClass(ClassName.OPEN); + + _this7._resetAdjustments(); + + _this7._resetScrollbar(); + + $$$1(_this7._element).trigger(Event.HIDDEN); + }); + }; + + _proto._removeBackdrop = function _removeBackdrop() { + if (this._backdrop) { + $$$1(this._backdrop).remove(); + this._backdrop = null; + } + }; + + _proto._showBackdrop = function _showBackdrop(callback) { + var _this8 = this; + + var animate = $$$1(this._element).hasClass(ClassName.FADE) ? ClassName.FADE : ''; + + if (this._isShown && this._config.backdrop) { + this._backdrop = document.createElement('div'); + this._backdrop.className = ClassName.BACKDROP; + + if (animate) { + this._backdrop.classList.add(animate); + } + + $$$1(this._backdrop).appendTo(document.body); + $$$1(this._element).on(Event.CLICK_DISMISS, function (event) { + if (_this8._ignoreBackdropClick) { + _this8._ignoreBackdropClick = false; + return; + } + + if (event.target !== event.currentTarget) { + return; + } + + if (_this8._config.backdrop === 'static') { + _this8._element.focus(); + } else { + _this8.hide(); + } + }); + + if (animate) { + Util.reflow(this._backdrop); + } + + $$$1(this._backdrop).addClass(ClassName.SHOW); + + if (!callback) { + return; + } + + if (!animate) { + callback(); + return; + } + + var backdropTransitionDuration = Util.getTransitionDurationFromElement(this._backdrop); + $$$1(this._backdrop).one(Util.TRANSITION_END, callback).emulateTransitionEnd(backdropTransitionDuration); + } else if (!this._isShown && this._backdrop) { + $$$1(this._backdrop).removeClass(ClassName.SHOW); + + var callbackRemove = function callbackRemove() { + _this8._removeBackdrop(); + + if (callback) { + callback(); + } + }; + + if ($$$1(this._element).hasClass(ClassName.FADE)) { + var _backdropTransitionDuration = Util.getTransitionDurationFromElement(this._backdrop); + + $$$1(this._backdrop).one(Util.TRANSITION_END, callbackRemove).emulateTransitionEnd(_backdropTransitionDuration); + } else { + callbackRemove(); + } + } else if (callback) { + callback(); + } + }; // ---------------------------------------------------------------------- + // the following methods are used to handle overflowing modals + // todo (fat): these should probably be refactored out of modal.js + // ---------------------------------------------------------------------- + + + _proto._adjustDialog = function _adjustDialog() { + var isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight; + + if (!this._isBodyOverflowing && isModalOverflowing) { + this._element.style.paddingLeft = this._scrollbarWidth + "px"; + } + + if (this._isBodyOverflowing && !isModalOverflowing) { + this._element.style.paddingRight = this._scrollbarWidth + "px"; + } + }; + + _proto._resetAdjustments = function _resetAdjustments() { + this._element.style.paddingLeft = ''; + this._element.style.paddingRight = ''; + }; + + _proto._checkScrollbar = function _checkScrollbar() { + var rect = document.body.getBoundingClientRect(); + this._isBodyOverflowing = rect.left + rect.right < window.innerWidth; + this._scrollbarWidth = this._getScrollbarWidth(); + }; + + _proto._setScrollbar = function _setScrollbar() { + var _this9 = this; + + if (this._isBodyOverflowing) { + // Note: DOMNode.style.paddingRight returns the actual value or '' if not set + // while $(DOMNode).css('padding-right') returns the calculated value or 0 if not set + var fixedContent = [].slice.call(document.querySelectorAll(Selector.FIXED_CONTENT)); + var stickyContent = [].slice.call(document.querySelectorAll(Selector.STICKY_CONTENT)); // Adjust fixed content padding + + $$$1(fixedContent).each(function (index, element) { + var actualPadding = element.style.paddingRight; + var calculatedPadding = $$$1(element).css('padding-right'); + $$$1(element).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + _this9._scrollbarWidth + "px"); + }); // Adjust sticky content margin + + $$$1(stickyContent).each(function (index, element) { + var actualMargin = element.style.marginRight; + var calculatedMargin = $$$1(element).css('margin-right'); + $$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) - _this9._scrollbarWidth + "px"); + }); // Adjust body padding + + var actualPadding = document.body.style.paddingRight; + var calculatedPadding = $$$1(document.body).css('padding-right'); + $$$1(document.body).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + this._scrollbarWidth + "px"); + } + }; + + _proto._resetScrollbar = function _resetScrollbar() { + // Restore fixed content padding + var fixedContent = [].slice.call(document.querySelectorAll(Selector.FIXED_CONTENT)); + $$$1(fixedContent).each(function (index, element) { + var padding = $$$1(element).data('padding-right'); + $$$1(element).removeData('padding-right'); + element.style.paddingRight = padding ? padding : ''; + }); // Restore sticky content + + var elements = [].slice.call(document.querySelectorAll("" + Selector.STICKY_CONTENT)); + $$$1(elements).each(function (index, element) { + var margin = $$$1(element).data('margin-right'); + + if (typeof margin !== 'undefined') { + $$$1(element).css('margin-right', margin).removeData('margin-right'); + } + }); // Restore body padding + + var padding = $$$1(document.body).data('padding-right'); + $$$1(document.body).removeData('padding-right'); + document.body.style.paddingRight = padding ? padding : ''; + }; + + _proto._getScrollbarWidth = function _getScrollbarWidth() { + // thx d.walsh + var scrollDiv = document.createElement('div'); + scrollDiv.className = ClassName.SCROLLBAR_MEASURER; + document.body.appendChild(scrollDiv); + var scrollbarWidth = scrollDiv.getBoundingClientRect().width - scrollDiv.clientWidth; + document.body.removeChild(scrollDiv); + return scrollbarWidth; + }; // Static + + + Modal._jQueryInterface = function _jQueryInterface(config, relatedTarget) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = _objectSpread({}, Default, $$$1(this).data(), typeof config === 'object' && config ? config : {}); + + if (!data) { + data = new Modal(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](relatedTarget); + } else if (_config.show) { + data.show(relatedTarget); + } + }); + }; + + _createClass(Modal, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }]); + + return Modal; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) { + var _this10 = this; + + var target; + var selector = Util.getSelectorFromElement(this); + + if (selector) { + target = document.querySelector(selector); + } + + var config = $$$1(target).data(DATA_KEY) ? 'toggle' : _objectSpread({}, $$$1(target).data(), $$$1(this).data()); + + if (this.tagName === 'A' || this.tagName === 'AREA') { + event.preventDefault(); + } + + var $target = $$$1(target).one(Event.SHOW, function (showEvent) { + if (showEvent.isDefaultPrevented()) { + // Only register focus restorer if modal will actually get shown + return; + } + + $target.one(Event.HIDDEN, function () { + if ($$$1(_this10).is(':visible')) { + _this10.focus(); + } + }); + }); + + Modal._jQueryInterface.call($$$1(target), config, this); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Modal._jQueryInterface; + $$$1.fn[NAME].Constructor = Modal; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Modal._jQueryInterface; + }; + + return Modal; + }($); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v4.1.3): tooltip.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + + var Tooltip = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'tooltip'; + var VERSION = '4.1.3'; + var DATA_KEY = 'bs.tooltip'; + var EVENT_KEY = "." + DATA_KEY; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var CLASS_PREFIX = 'bs-tooltip'; + var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g'); + var DefaultType = { + animation: 'boolean', + template: 'string', + title: '(string|element|function)', + trigger: 'string', + delay: '(number|object)', + html: 'boolean', + selector: '(string|boolean)', + placement: '(string|function)', + offset: '(number|string)', + container: '(string|element|boolean)', + fallbackPlacement: '(string|array)', + boundary: '(string|element)' + }; + var AttachmentMap = { + AUTO: 'auto', + TOP: 'top', + RIGHT: 'right', + BOTTOM: 'bottom', + LEFT: 'left' + }; + var Default = { + animation: true, + template: '<div class="tooltip" role="tooltip">' + '<div class="arrow"></div>' + '<div class="tooltip-inner"></div></div>', + trigger: 'hover focus', + title: '', + delay: 0, + html: false, + selector: false, + placement: 'top', + offset: 0, + container: false, + fallbackPlacement: 'flip', + boundary: 'scrollParent' + }; + var HoverState = { + SHOW: 'show', + OUT: 'out' + }; + var Event = { + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + INSERTED: "inserted" + EVENT_KEY, + CLICK: "click" + EVENT_KEY, + FOCUSIN: "focusin" + EVENT_KEY, + FOCUSOUT: "focusout" + EVENT_KEY, + MOUSEENTER: "mouseenter" + EVENT_KEY, + MOUSELEAVE: "mouseleave" + EVENT_KEY + }; + var ClassName = { + FADE: 'fade', + SHOW: 'show' + }; + var Selector = { + TOOLTIP: '.tooltip', + TOOLTIP_INNER: '.tooltip-inner', + ARROW: '.arrow' + }; + var Trigger = { + HOVER: 'hover', + FOCUS: 'focus', + CLICK: 'click', + MANUAL: 'manual' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Tooltip = + /*#__PURE__*/ + function () { + function Tooltip(element, config) { + /** + * Check for Popper dependency + * Popper - https://popper.js.org + */ + if (typeof Popper === 'undefined') { + throw new TypeError('Bootstrap tooltips require Popper.js (https://popper.js.org)'); + } // private + + + this._isEnabled = true; + this._timeout = 0; + this._hoverState = ''; + this._activeTrigger = {}; + this._popper = null; // Protected + + this.element = element; + this.config = this._getConfig(config); + this.tip = null; + + this._setListeners(); + } // Getters + + + var _proto = Tooltip.prototype; + + // Public + _proto.enable = function enable() { + this._isEnabled = true; + }; + + _proto.disable = function disable() { + this._isEnabled = false; + }; + + _proto.toggleEnabled = function toggleEnabled() { + this._isEnabled = !this._isEnabled; + }; + + _proto.toggle = function toggle(event) { + if (!this._isEnabled) { + return; + } + + if (event) { + var dataKey = this.constructor.DATA_KEY; + var context = $$$1(event.currentTarget).data(dataKey); + + if (!context) { + context = new this.constructor(event.currentTarget, this._getDelegateConfig()); + $$$1(event.currentTarget).data(dataKey, context); + } + + context._activeTrigger.click = !context._activeTrigger.click; + + if (context._isWithActiveTrigger()) { + context._enter(null, context); + } else { + context._leave(null, context); + } + } else { + if ($$$1(this.getTipElement()).hasClass(ClassName.SHOW)) { + this._leave(null, this); + + return; + } + + this._enter(null, this); + } + }; + + _proto.dispose = function dispose() { + clearTimeout(this._timeout); + $$$1.removeData(this.element, this.constructor.DATA_KEY); + $$$1(this.element).off(this.constructor.EVENT_KEY); + $$$1(this.element).closest('.modal').off('hide.bs.modal'); + + if (this.tip) { + $$$1(this.tip).remove(); + } + + this._isEnabled = null; + this._timeout = null; + this._hoverState = null; + this._activeTrigger = null; + + if (this._popper !== null) { + this._popper.destroy(); + } + + this._popper = null; + this.element = null; + this.config = null; + this.tip = null; + }; + + _proto.show = function show() { + var _this = this; + + if ($$$1(this.element).css('display') === 'none') { + throw new Error('Please use show on visible elements'); + } + + var showEvent = $$$1.Event(this.constructor.Event.SHOW); + + if (this.isWithContent() && this._isEnabled) { + $$$1(this.element).trigger(showEvent); + var isInTheDom = $$$1.contains(this.element.ownerDocument.documentElement, this.element); + + if (showEvent.isDefaultPrevented() || !isInTheDom) { + return; + } + + var tip = this.getTipElement(); + var tipId = Util.getUID(this.constructor.NAME); + tip.setAttribute('id', tipId); + this.element.setAttribute('aria-describedby', tipId); + this.setContent(); + + if (this.config.animation) { + $$$1(tip).addClass(ClassName.FADE); + } + + var placement = typeof this.config.placement === 'function' ? this.config.placement.call(this, tip, this.element) : this.config.placement; + + var attachment = this._getAttachment(placement); + + this.addAttachmentClass(attachment); + var container = this.config.container === false ? document.body : $$$1(document).find(this.config.container); + $$$1(tip).data(this.constructor.DATA_KEY, this); + + if (!$$$1.contains(this.element.ownerDocument.documentElement, this.tip)) { + $$$1(tip).appendTo(container); + } + + $$$1(this.element).trigger(this.constructor.Event.INSERTED); + this._popper = new Popper(this.element, tip, { + placement: attachment, + modifiers: { + offset: { + offset: this.config.offset + }, + flip: { + behavior: this.config.fallbackPlacement + }, + arrow: { + element: Selector.ARROW + }, + preventOverflow: { + boundariesElement: this.config.boundary + } + }, + onCreate: function onCreate(data) { + if (data.originalPlacement !== data.placement) { + _this._handlePopperPlacementChange(data); + } + }, + onUpdate: function onUpdate(data) { + _this._handlePopperPlacementChange(data); + } + }); + $$$1(tip).addClass(ClassName.SHOW); // If this is a touch-enabled device we add extra + // empty mouseover listeners to the body's immediate children; + // only needed because of broken event delegation on iOS + // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html + + if ('ontouchstart' in document.documentElement) { + $$$1(document.body).children().on('mouseover', null, $$$1.noop); + } + + var complete = function complete() { + if (_this.config.animation) { + _this._fixTransition(); + } + + var prevHoverState = _this._hoverState; + _this._hoverState = null; + $$$1(_this.element).trigger(_this.constructor.Event.SHOWN); + + if (prevHoverState === HoverState.OUT) { + _this._leave(null, _this); + } + }; + + if ($$$1(this.tip).hasClass(ClassName.FADE)) { + var transitionDuration = Util.getTransitionDurationFromElement(this.tip); + $$$1(this.tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration); + } else { + complete(); + } + } + }; + + _proto.hide = function hide(callback) { + var _this2 = this; + + var tip = this.getTipElement(); + var hideEvent = $$$1.Event(this.constructor.Event.HIDE); + + var complete = function complete() { + if (_this2._hoverState !== HoverState.SHOW && tip.parentNode) { + tip.parentNode.removeChild(tip); + } + + _this2._cleanTipClass(); + + _this2.element.removeAttribute('aria-describedby'); + + $$$1(_this2.element).trigger(_this2.constructor.Event.HIDDEN); + + if (_this2._popper !== null) { + _this2._popper.destroy(); + } + + if (callback) { + callback(); + } + }; + + $$$1(this.element).trigger(hideEvent); + + if (hideEvent.isDefaultPrevented()) { + return; + } + + $$$1(tip).removeClass(ClassName.SHOW); // If this is a touch-enabled device we remove the extra + // empty mouseover listeners we added for iOS support + + if ('ontouchstart' in document.documentElement) { + $$$1(document.body).children().off('mouseover', null, $$$1.noop); + } + + this._activeTrigger[Trigger.CLICK] = false; + this._activeTrigger[Trigger.FOCUS] = false; + this._activeTrigger[Trigger.HOVER] = false; + + if ($$$1(this.tip).hasClass(ClassName.FADE)) { + var transitionDuration = Util.getTransitionDurationFromElement(tip); + $$$1(tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration); + } else { + complete(); + } + + this._hoverState = ''; + }; + + _proto.update = function update() { + if (this._popper !== null) { + this._popper.scheduleUpdate(); + } + }; // Protected + + + _proto.isWithContent = function isWithContent() { + return Boolean(this.getTitle()); + }; + + _proto.addAttachmentClass = function addAttachmentClass(attachment) { + $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment); + }; + + _proto.getTipElement = function getTipElement() { + this.tip = this.tip || $$$1(this.config.template)[0]; + return this.tip; + }; + + _proto.setContent = function setContent() { + var tip = this.getTipElement(); + this.setElementContent($$$1(tip.querySelectorAll(Selector.TOOLTIP_INNER)), this.getTitle()); + $$$1(tip).removeClass(ClassName.FADE + " " + ClassName.SHOW); + }; + + _proto.setElementContent = function setElementContent($element, content) { + var html = this.config.html; + + if (typeof content === 'object' && (content.nodeType || content.jquery)) { + // Content is a DOM node or a jQuery + if (html) { + if (!$$$1(content).parent().is($element)) { + $element.empty().append(content); + } + } else { + $element.text($$$1(content).text()); + } + } else { + $element[html ? 'html' : 'text'](content); + } + }; + + _proto.getTitle = function getTitle() { + var title = this.element.getAttribute('data-original-title'); + + if (!title) { + title = typeof this.config.title === 'function' ? this.config.title.call(this.element) : this.config.title; + } + + return title; + }; // Private + + + _proto._getAttachment = function _getAttachment(placement) { + return AttachmentMap[placement.toUpperCase()]; + }; + + _proto._setListeners = function _setListeners() { + var _this3 = this; + + var triggers = this.config.trigger.split(' '); + triggers.forEach(function (trigger) { + if (trigger === 'click') { + $$$1(_this3.element).on(_this3.constructor.Event.CLICK, _this3.config.selector, function (event) { + return _this3.toggle(event); + }); + } else if (trigger !== Trigger.MANUAL) { + var eventIn = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSEENTER : _this3.constructor.Event.FOCUSIN; + var eventOut = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSELEAVE : _this3.constructor.Event.FOCUSOUT; + $$$1(_this3.element).on(eventIn, _this3.config.selector, function (event) { + return _this3._enter(event); + }).on(eventOut, _this3.config.selector, function (event) { + return _this3._leave(event); + }); + } + + $$$1(_this3.element).closest('.modal').on('hide.bs.modal', function () { + return _this3.hide(); + }); + }); + + if (this.config.selector) { + this.config = _objectSpread({}, this.config, { + trigger: 'manual', + selector: '' + }); + } else { + this._fixTitle(); + } + }; + + _proto._fixTitle = function _fixTitle() { + var titleType = typeof this.element.getAttribute('data-original-title'); + + if (this.element.getAttribute('title') || titleType !== 'string') { + this.element.setAttribute('data-original-title', this.element.getAttribute('title') || ''); + this.element.setAttribute('title', ''); + } + }; + + _proto._enter = function _enter(event, context) { + var dataKey = this.constructor.DATA_KEY; + context = context || $$$1(event.currentTarget).data(dataKey); + + if (!context) { + context = new this.constructor(event.currentTarget, this._getDelegateConfig()); + $$$1(event.currentTarget).data(dataKey, context); + } + + if (event) { + context._activeTrigger[event.type === 'focusin' ? Trigger.FOCUS : Trigger.HOVER] = true; + } + + if ($$$1(context.getTipElement()).hasClass(ClassName.SHOW) || context._hoverState === HoverState.SHOW) { + context._hoverState = HoverState.SHOW; + return; + } + + clearTimeout(context._timeout); + context._hoverState = HoverState.SHOW; + + if (!context.config.delay || !context.config.delay.show) { + context.show(); + return; + } + + context._timeout = setTimeout(function () { + if (context._hoverState === HoverState.SHOW) { + context.show(); + } + }, context.config.delay.show); + }; + + _proto._leave = function _leave(event, context) { + var dataKey = this.constructor.DATA_KEY; + context = context || $$$1(event.currentTarget).data(dataKey); + + if (!context) { + context = new this.constructor(event.currentTarget, this._getDelegateConfig()); + $$$1(event.currentTarget).data(dataKey, context); + } + + if (event) { + context._activeTrigger[event.type === 'focusout' ? Trigger.FOCUS : Trigger.HOVER] = false; + } + + if (context._isWithActiveTrigger()) { + return; + } + + clearTimeout(context._timeout); + context._hoverState = HoverState.OUT; + + if (!context.config.delay || !context.config.delay.hide) { + context.hide(); + return; + } + + context._timeout = setTimeout(function () { + if (context._hoverState === HoverState.OUT) { + context.hide(); + } + }, context.config.delay.hide); + }; + + _proto._isWithActiveTrigger = function _isWithActiveTrigger() { + for (var trigger in this._activeTrigger) { + if (this._activeTrigger[trigger]) { + return true; + } + } + + return false; + }; + + _proto._getConfig = function _getConfig(config) { + config = _objectSpread({}, this.constructor.Default, $$$1(this.element).data(), typeof config === 'object' && config ? config : {}); + + if (typeof config.delay === 'number') { + config.delay = { + show: config.delay, + hide: config.delay + }; + } + + if (typeof config.title === 'number') { + config.title = config.title.toString(); + } + + if (typeof config.content === 'number') { + config.content = config.content.toString(); + } + + Util.typeCheckConfig(NAME, config, this.constructor.DefaultType); + return config; + }; + + _proto._getDelegateConfig = function _getDelegateConfig() { + var config = {}; + + if (this.config) { + for (var key in this.config) { + if (this.constructor.Default[key] !== this.config[key]) { + config[key] = this.config[key]; + } + } + } + + return config; + }; + + _proto._cleanTipClass = function _cleanTipClass() { + var $tip = $$$1(this.getTipElement()); + var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX); + + if (tabClass !== null && tabClass.length) { + $tip.removeClass(tabClass.join('')); + } + }; + + _proto._handlePopperPlacementChange = function _handlePopperPlacementChange(popperData) { + var popperInstance = popperData.instance; + this.tip = popperInstance.popper; + + this._cleanTipClass(); + + this.addAttachmentClass(this._getAttachment(popperData.placement)); + }; + + _proto._fixTransition = function _fixTransition() { + var tip = this.getTipElement(); + var initConfigAnimation = this.config.animation; + + if (tip.getAttribute('x-placement') !== null) { + return; + } + + $$$1(tip).removeClass(ClassName.FADE); + this.config.animation = false; + this.hide(); + this.show(); + this.config.animation = initConfigAnimation; + }; // Static + + + Tooltip._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = typeof config === 'object' && config; + + if (!data && /dispose|hide/.test(config)) { + return; + } + + if (!data) { + data = new Tooltip(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + _createClass(Tooltip, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }, { + key: "NAME", + get: function get() { + return NAME; + } + }, { + key: "DATA_KEY", + get: function get() { + return DATA_KEY; + } + }, { + key: "Event", + get: function get() { + return Event; + } + }, { + key: "EVENT_KEY", + get: function get() { + return EVENT_KEY; + } + }, { + key: "DefaultType", + get: function get() { + return DefaultType; + } + }]); + + return Tooltip; + }(); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + + $$$1.fn[NAME] = Tooltip._jQueryInterface; + $$$1.fn[NAME].Constructor = Tooltip; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Tooltip._jQueryInterface; + }; + + return Tooltip; + }($, Popper); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v4.1.3): popover.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + + var Popover = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'popover'; + var VERSION = '4.1.3'; + var DATA_KEY = 'bs.popover'; + var EVENT_KEY = "." + DATA_KEY; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var CLASS_PREFIX = 'bs-popover'; + var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g'); + + var Default = _objectSpread({}, Tooltip.Default, { + placement: 'right', + trigger: 'click', + content: '', + template: '<div class="popover" role="tooltip">' + '<div class="arrow"></div>' + '<h3 class="popover-header"></h3>' + '<div class="popover-body"></div></div>' + }); + + var DefaultType = _objectSpread({}, Tooltip.DefaultType, { + content: '(string|element|function)' + }); + + var ClassName = { + FADE: 'fade', + SHOW: 'show' + }; + var Selector = { + TITLE: '.popover-header', + CONTENT: '.popover-body' + }; + var Event = { + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + INSERTED: "inserted" + EVENT_KEY, + CLICK: "click" + EVENT_KEY, + FOCUSIN: "focusin" + EVENT_KEY, + FOCUSOUT: "focusout" + EVENT_KEY, + MOUSEENTER: "mouseenter" + EVENT_KEY, + MOUSELEAVE: "mouseleave" + EVENT_KEY + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Popover = + /*#__PURE__*/ + function (_Tooltip) { + _inheritsLoose(Popover, _Tooltip); + + function Popover() { + return _Tooltip.apply(this, arguments) || this; + } + + var _proto = Popover.prototype; + + // Overrides + _proto.isWithContent = function isWithContent() { + return this.getTitle() || this._getContent(); + }; + + _proto.addAttachmentClass = function addAttachmentClass(attachment) { + $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment); + }; + + _proto.getTipElement = function getTipElement() { + this.tip = this.tip || $$$1(this.config.template)[0]; + return this.tip; + }; + + _proto.setContent = function setContent() { + var $tip = $$$1(this.getTipElement()); // We use append for html objects to maintain js events + + this.setElementContent($tip.find(Selector.TITLE), this.getTitle()); + + var content = this._getContent(); + + if (typeof content === 'function') { + content = content.call(this.element); + } + + this.setElementContent($tip.find(Selector.CONTENT), content); + $tip.removeClass(ClassName.FADE + " " + ClassName.SHOW); + }; // Private + + + _proto._getContent = function _getContent() { + return this.element.getAttribute('data-content') || this.config.content; + }; + + _proto._cleanTipClass = function _cleanTipClass() { + var $tip = $$$1(this.getTipElement()); + var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX); + + if (tabClass !== null && tabClass.length > 0) { + $tip.removeClass(tabClass.join('')); + } + }; // Static + + + Popover._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = typeof config === 'object' ? config : null; + + if (!data && /destroy|hide/.test(config)) { + return; + } + + if (!data) { + data = new Popover(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + _createClass(Popover, null, [{ + key: "VERSION", + // Getters + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }, { + key: "NAME", + get: function get() { + return NAME; + } + }, { + key: "DATA_KEY", + get: function get() { + return DATA_KEY; + } + }, { + key: "Event", + get: function get() { + return Event; + } + }, { + key: "EVENT_KEY", + get: function get() { + return EVENT_KEY; + } + }, { + key: "DefaultType", + get: function get() { + return DefaultType; + } + }]); + + return Popover; + }(Tooltip); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + + $$$1.fn[NAME] = Popover._jQueryInterface; + $$$1.fn[NAME].Constructor = Popover; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Popover._jQueryInterface; + }; + + return Popover; + }($); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v4.1.3): scrollspy.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + + var ScrollSpy = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'scrollspy'; + var VERSION = '4.1.3'; + var DATA_KEY = 'bs.scrollspy'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var Default = { + offset: 10, + method: 'auto', + target: '' + }; + var DefaultType = { + offset: 'number', + method: 'string', + target: '(string|element)' + }; + var Event = { + ACTIVATE: "activate" + EVENT_KEY, + SCROLL: "scroll" + EVENT_KEY, + LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + DROPDOWN_ITEM: 'dropdown-item', + DROPDOWN_MENU: 'dropdown-menu', + ACTIVE: 'active' + }; + var Selector = { + DATA_SPY: '[data-spy="scroll"]', + ACTIVE: '.active', + NAV_LIST_GROUP: '.nav, .list-group', + NAV_LINKS: '.nav-link', + NAV_ITEMS: '.nav-item', + LIST_ITEMS: '.list-group-item', + DROPDOWN: '.dropdown', + DROPDOWN_ITEMS: '.dropdown-item', + DROPDOWN_TOGGLE: '.dropdown-toggle' + }; + var OffsetMethod = { + OFFSET: 'offset', + POSITION: 'position' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var ScrollSpy = + /*#__PURE__*/ + function () { + function ScrollSpy(element, config) { + var _this = this; + + this._element = element; + this._scrollElement = element.tagName === 'BODY' ? window : element; + this._config = this._getConfig(config); + this._selector = this._config.target + " " + Selector.NAV_LINKS + "," + (this._config.target + " " + Selector.LIST_ITEMS + ",") + (this._config.target + " " + Selector.DROPDOWN_ITEMS); + this._offsets = []; + this._targets = []; + this._activeTarget = null; + this._scrollHeight = 0; + $$$1(this._scrollElement).on(Event.SCROLL, function (event) { + return _this._process(event); + }); + this.refresh(); + + this._process(); + } // Getters + + + var _proto = ScrollSpy.prototype; + + // Public + _proto.refresh = function refresh() { + var _this2 = this; + + var autoMethod = this._scrollElement === this._scrollElement.window ? OffsetMethod.OFFSET : OffsetMethod.POSITION; + var offsetMethod = this._config.method === 'auto' ? autoMethod : this._config.method; + var offsetBase = offsetMethod === OffsetMethod.POSITION ? this._getScrollTop() : 0; + this._offsets = []; + this._targets = []; + this._scrollHeight = this._getScrollHeight(); + var targets = [].slice.call(document.querySelectorAll(this._selector)); + targets.map(function (element) { + var target; + var targetSelector = Util.getSelectorFromElement(element); + + if (targetSelector) { + target = document.querySelector(targetSelector); + } + + if (target) { + var targetBCR = target.getBoundingClientRect(); + + if (targetBCR.width || targetBCR.height) { + // TODO (fat): remove sketch reliance on jQuery position/offset + return [$$$1(target)[offsetMethod]().top + offsetBase, targetSelector]; + } + } + + return null; + }).filter(function (item) { + return item; + }).sort(function (a, b) { + return a[0] - b[0]; + }).forEach(function (item) { + _this2._offsets.push(item[0]); + + _this2._targets.push(item[1]); + }); + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + $$$1(this._scrollElement).off(EVENT_KEY); + this._element = null; + this._scrollElement = null; + this._config = null; + this._selector = null; + this._offsets = null; + this._targets = null; + this._activeTarget = null; + this._scrollHeight = null; + }; // Private + + + _proto._getConfig = function _getConfig(config) { + config = _objectSpread({}, Default, typeof config === 'object' && config ? config : {}); + + if (typeof config.target !== 'string') { + var id = $$$1(config.target).attr('id'); + + if (!id) { + id = Util.getUID(NAME); + $$$1(config.target).attr('id', id); + } + + config.target = "#" + id; + } + + Util.typeCheckConfig(NAME, config, DefaultType); + return config; + }; + + _proto._getScrollTop = function _getScrollTop() { + return this._scrollElement === window ? this._scrollElement.pageYOffset : this._scrollElement.scrollTop; + }; + + _proto._getScrollHeight = function _getScrollHeight() { + return this._scrollElement.scrollHeight || Math.max(document.body.scrollHeight, document.documentElement.scrollHeight); + }; + + _proto._getOffsetHeight = function _getOffsetHeight() { + return this._scrollElement === window ? window.innerHeight : this._scrollElement.getBoundingClientRect().height; + }; + + _proto._process = function _process() { + var scrollTop = this._getScrollTop() + this._config.offset; + + var scrollHeight = this._getScrollHeight(); + + var maxScroll = this._config.offset + scrollHeight - this._getOffsetHeight(); + + if (this._scrollHeight !== scrollHeight) { + this.refresh(); + } + + if (scrollTop >= maxScroll) { + var target = this._targets[this._targets.length - 1]; + + if (this._activeTarget !== target) { + this._activate(target); + } + + return; + } + + if (this._activeTarget && scrollTop < this._offsets[0] && this._offsets[0] > 0) { + this._activeTarget = null; + + this._clear(); + + return; + } + + var offsetLength = this._offsets.length; + + for (var i = offsetLength; i--;) { + var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === 'undefined' || scrollTop < this._offsets[i + 1]); + + if (isActiveTarget) { + this._activate(this._targets[i]); + } + } + }; + + _proto._activate = function _activate(target) { + this._activeTarget = target; + + this._clear(); + + var queries = this._selector.split(','); // eslint-disable-next-line arrow-body-style + + + queries = queries.map(function (selector) { + return selector + "[data-target=\"" + target + "\"]," + (selector + "[href=\"" + target + "\"]"); + }); + var $link = $$$1([].slice.call(document.querySelectorAll(queries.join(',')))); + + if ($link.hasClass(ClassName.DROPDOWN_ITEM)) { + $link.closest(Selector.DROPDOWN).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE); + $link.addClass(ClassName.ACTIVE); + } else { + // Set triggered link as active + $link.addClass(ClassName.ACTIVE); // Set triggered links parents as active + // With both <ul> and <nav> markup a parent is the previous sibling of any nav ancestor + + $link.parents(Selector.NAV_LIST_GROUP).prev(Selector.NAV_LINKS + ", " + Selector.LIST_ITEMS).addClass(ClassName.ACTIVE); // Handle special case when .nav-link is inside .nav-item + + $link.parents(Selector.NAV_LIST_GROUP).prev(Selector.NAV_ITEMS).children(Selector.NAV_LINKS).addClass(ClassName.ACTIVE); + } + + $$$1(this._scrollElement).trigger(Event.ACTIVATE, { + relatedTarget: target + }); + }; + + _proto._clear = function _clear() { + var nodes = [].slice.call(document.querySelectorAll(this._selector)); + $$$1(nodes).filter(Selector.ACTIVE).removeClass(ClassName.ACTIVE); + }; // Static + + + ScrollSpy._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = typeof config === 'object' && config; + + if (!data) { + data = new ScrollSpy(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + _createClass(ScrollSpy, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }]); + + return ScrollSpy; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(window).on(Event.LOAD_DATA_API, function () { + var scrollSpys = [].slice.call(document.querySelectorAll(Selector.DATA_SPY)); + var scrollSpysLength = scrollSpys.length; + + for (var i = scrollSpysLength; i--;) { + var $spy = $$$1(scrollSpys[i]); + + ScrollSpy._jQueryInterface.call($spy, $spy.data()); + } + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = ScrollSpy._jQueryInterface; + $$$1.fn[NAME].Constructor = ScrollSpy; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return ScrollSpy._jQueryInterface; + }; + + return ScrollSpy; + }($); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v4.1.3): tab.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + + var Tab = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'tab'; + var VERSION = '4.1.3'; + var DATA_KEY = 'bs.tab'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var Event = { + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + DROPDOWN_MENU: 'dropdown-menu', + ACTIVE: 'active', + DISABLED: 'disabled', + FADE: 'fade', + SHOW: 'show' + }; + var Selector = { + DROPDOWN: '.dropdown', + NAV_LIST_GROUP: '.nav, .list-group', + ACTIVE: '.active', + ACTIVE_UL: '> li > .active', + DATA_TOGGLE: '[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]', + DROPDOWN_TOGGLE: '.dropdown-toggle', + DROPDOWN_ACTIVE_CHILD: '> .dropdown-menu .active' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Tab = + /*#__PURE__*/ + function () { + function Tab(element) { + this._element = element; + } // Getters + + + var _proto = Tab.prototype; + + // Public + _proto.show = function show() { + var _this = this; + + if (this._element.parentNode && this._element.parentNode.nodeType === Node.ELEMENT_NODE && $$$1(this._element).hasClass(ClassName.ACTIVE) || $$$1(this._element).hasClass(ClassName.DISABLED)) { + return; + } + + var target; + var previous; + var listElement = $$$1(this._element).closest(Selector.NAV_LIST_GROUP)[0]; + var selector = Util.getSelectorFromElement(this._element); + + if (listElement) { + var itemSelector = listElement.nodeName === 'UL' ? Selector.ACTIVE_UL : Selector.ACTIVE; + previous = $$$1.makeArray($$$1(listElement).find(itemSelector)); + previous = previous[previous.length - 1]; + } + + var hideEvent = $$$1.Event(Event.HIDE, { + relatedTarget: this._element + }); + var showEvent = $$$1.Event(Event.SHOW, { + relatedTarget: previous + }); + + if (previous) { + $$$1(previous).trigger(hideEvent); + } + + $$$1(this._element).trigger(showEvent); + + if (showEvent.isDefaultPrevented() || hideEvent.isDefaultPrevented()) { + return; + } + + if (selector) { + target = document.querySelector(selector); + } + + this._activate(this._element, listElement); + + var complete = function complete() { + var hiddenEvent = $$$1.Event(Event.HIDDEN, { + relatedTarget: _this._element + }); + var shownEvent = $$$1.Event(Event.SHOWN, { + relatedTarget: previous + }); + $$$1(previous).trigger(hiddenEvent); + $$$1(_this._element).trigger(shownEvent); + }; + + if (target) { + this._activate(target, target.parentNode, complete); + } else { + complete(); + } + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + this._element = null; + }; // Private + + + _proto._activate = function _activate(element, container, callback) { + var _this2 = this; + + var activeElements; + + if (container.nodeName === 'UL') { + activeElements = $$$1(container).find(Selector.ACTIVE_UL); + } else { + activeElements = $$$1(container).children(Selector.ACTIVE); + } + + var active = activeElements[0]; + var isTransitioning = callback && active && $$$1(active).hasClass(ClassName.FADE); + + var complete = function complete() { + return _this2._transitionComplete(element, active, callback); + }; + + if (active && isTransitioning) { + var transitionDuration = Util.getTransitionDurationFromElement(active); + $$$1(active).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration); + } else { + complete(); + } + }; + + _proto._transitionComplete = function _transitionComplete(element, active, callback) { + if (active) { + $$$1(active).removeClass(ClassName.SHOW + " " + ClassName.ACTIVE); + var dropdownChild = $$$1(active.parentNode).find(Selector.DROPDOWN_ACTIVE_CHILD)[0]; + + if (dropdownChild) { + $$$1(dropdownChild).removeClass(ClassName.ACTIVE); + } + + if (active.getAttribute('role') === 'tab') { + active.setAttribute('aria-selected', false); + } + } + + $$$1(element).addClass(ClassName.ACTIVE); + + if (element.getAttribute('role') === 'tab') { + element.setAttribute('aria-selected', true); + } + + Util.reflow(element); + $$$1(element).addClass(ClassName.SHOW); + + if (element.parentNode && $$$1(element.parentNode).hasClass(ClassName.DROPDOWN_MENU)) { + var dropdownElement = $$$1(element).closest(Selector.DROPDOWN)[0]; + + if (dropdownElement) { + var dropdownToggleList = [].slice.call(dropdownElement.querySelectorAll(Selector.DROPDOWN_TOGGLE)); + $$$1(dropdownToggleList).addClass(ClassName.ACTIVE); + } + + element.setAttribute('aria-expanded', true); + } + + if (callback) { + callback(); + } + }; // Static + + + Tab._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var $this = $$$1(this); + var data = $this.data(DATA_KEY); + + if (!data) { + data = new Tab(this); + $this.data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + _createClass(Tab, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }]); + + return Tab; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) { + event.preventDefault(); + + Tab._jQueryInterface.call($$$1(this), 'show'); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Tab._jQueryInterface; + $$$1.fn[NAME].Constructor = Tab; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Tab._jQueryInterface; + }; + + return Tab; + }($); + + /** + * -------------------------------------------------------------------------- + * Bootstrap (v4.1.3): index.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + + (function ($$$1) { + if (typeof $$$1 === 'undefined') { + throw new TypeError('Bootstrap\'s JavaScript requires jQuery. jQuery must be included before Bootstrap\'s JavaScript.'); + } + + var version = $$$1.fn.jquery.split(' ')[0].split('.'); + var minMajor = 1; + var ltMajor = 2; + var minMinor = 9; + var minPatch = 1; + var maxMajor = 4; + + if (version[0] < ltMajor && version[1] < minMinor || version[0] === minMajor && version[1] === minMinor && version[2] < minPatch || version[0] >= maxMajor) { + throw new Error('Bootstrap\'s JavaScript requires at least jQuery v1.9.1 but less than v4.0.0'); + } + })($); + + exports.Util = Util; + exports.Alert = Alert; + exports.Button = Button; + exports.Carousel = Carousel; + exports.Collapse = Collapse; + exports.Dropdown = Dropdown; + exports.Modal = Modal; + exports.Popover = Popover; + exports.Scrollspy = ScrollSpy; + exports.Tab = Tab; + exports.Tooltip = Tooltip; + + Object.defineProperty(exports, '__esModule', { value: true }); + +}))); +//# sourceMappingURL=bootstrap.bundle.js.map + +/*! + * Daemonite Material v4.1.1 (http://daemonite.github.io/material/) + * Copyright 2011-2018 Daemon Pty Ltd + * Licensed under MIT (https://github.com/Daemonite/material/blob/master/LICENSE) + */ +!function(e,t){"object"==typeof exports&&"undefined"!=typeof module?t(exports,require("jquery")):"function"==typeof define&&define.amd?define(["exports","jquery"],t):t(e.material={},e.jQuery)}(this,function(e,i){"use strict";i=i&&i.hasOwnProperty("default")?i.default:i;var n,t,o,r,a,s,c,l,d,u,h,f,p,m,g,y,v,b,_,k,S=(r="show-predecessor",a="hide"+(t=".bs.collapse"),s=(o="show")+t,c=".expansion-panel",l=".expansion-panel .collapse",void(n=i)(document).on(""+a,l,function(){var e=n(this).closest(c);e.removeClass(o);var t=e.prev(c);t.length&&t.removeClass(r)}).on(""+s,l,function(){var e=n(this).closest(c);e.addClass(o);var t=e.prev(c);t.length&&t.addClass(r)})),w=(h="."+(u="md.floatinglabel"),f="floatinglabel",p=(d=i).fn[f],m="is-focused",g="has-value",y="change"+h,v="focusin"+h,b="focusout"+h,_={DATA_PARENT:".floating-label",DATA_TOGGLE:".floating-label .custom-select, .floating-label .form-control"},k=function(){function i(e){this._element=e,this._parent=d(e).closest(_.DATA_PARENT)[0]}var e=i.prototype;return e.change=function(){d(this._element).val()||d(this._element).is("select")&&""!==d("option:first-child",d(this._element)).html().replace(" ","")?d(this._parent).addClass(g):d(this._parent).removeClass(g)},e.focusin=function(){d(this._parent).addClass(m)},e.focusout=function(){d(this._parent).removeClass(m)},i._jQueryInterface=function(n){return this.each(function(){var e=n||"change",t=d(this).data(u);if(t||(t=new i(this),d(this).data(u,t)),"string"==typeof e){if("undefined"==typeof t[e])throw new Error('No method named "'+e+'"');t[e]()}})},i}(),d(document).on(y+" "+v+" "+b,_.DATA_TOGGLE,function(e){k._jQueryInterface.call(d(this),e.type)}),d.fn[f]=k._jQueryInterface,d.fn[f].Constructor=k,d.fn[f].noConflict=function(){return d.fn[f]=p,k._jQueryInterface},k);function D(e,t){for(var n=0;n<t.length;n++){var i=t[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(e,i.key,i)}}function C(o){for(var e=1;e<arguments.length;e++){var r=null!=arguments[e]?arguments[e]:{},t=Object.keys(r);"function"==typeof Object.getOwnPropertySymbols&&(t=t.concat(Object.getOwnPropertySymbols(r).filter(function(e){return Object.getOwnPropertyDescriptor(r,e).enumerable}))),t.forEach(function(e){var t,n,i;t=o,i=r[n=e],n in t?Object.defineProperty(t,n,{value:i,enumerable:!0,configurable:!0,writable:!0}):t[n]=i})}return o}var O,I,E,x,T,N,M,A,P,$,j,F,R,W=function(i){var t="transitionend";function e(e){var t=this,n=!1;return i(this).one(c.TRANSITION_END,function(){n=!0}),setTimeout(function(){n||c.triggerTransitionEnd(t)},e),this}var c={TRANSITION_END:"mdTransitionEnd",getSelectorFromElement:function(e){var t=e.getAttribute("data-target");t&&"#"!==t||(t=e.getAttribute("href")||"");try{return 0<i(document).find(t).length?t:null}catch(e){return null}},getTransitionDurationFromElement:function(e){if(!e)return 0;var t=i(e).css("transition-duration");return t?(t=t.split(",")[0],1e3*parseFloat(t)):0},getUID:function(e){for(;e+=~~(1e6*Math.random()),document.getElementById(e););return e},isElement:function(e){return(e[0]||e).nodeType},reflow:function(e){return e.offsetHeight},supportsTransitionEnd:function(){return Boolean(t)},triggerTransitionEnd:function(e){i(e).trigger(t)},typeCheckConfig:function(e,t,n){for(var i in n)if(Object.prototype.hasOwnProperty.call(n,i)){var o=n[i],r=t[i],a=r&&c.isElement(r)?"element":(s=r,{}.toString.call(s).match(/\s([a-z]+)/i)[1].toLowerCase());if(!new RegExp(o).test(a))throw new Error(e.toUpperCase()+': Option "'+i+'" provided type "'+a+'" but expected type "'+o+'".')}var s}};return i.fn.emulateTransitionEnd=e,i.event.special[c.TRANSITION_END]={bindType:t,delegateType:t,handle:function(e){if(i(e.target).is(this))return e.handleObj.handler.apply(this,arguments)}},c}(i),Y=(E="."+(I="md.navdrawer"),x="navdrawer",T=(O=i).fn[x],N="navdrawer-backdrop",M="navdrawer-open",P={breakpoint:"",keyboard:!0,show:!0,type:"default"},$={keyboard:"boolean",show:"boolean",type:"string"},j={CLICK_DATA_API:"click"+E+".data-api",CLICK_DISMISS:"click.dismiss"+E,FOCUSIN:"focusin"+E,HIDDEN:"hidden"+E,HIDE:"hide"+E,KEYDOWN_DISMISS:"keydown.dismiss"+E,MOUSEDOWN_DISMISS:"mousedown.dismiss"+E,MOUSEUP_DISMISS:"mouseup.dismiss"+E,SHOW:(A="show")+E,SHOWN:"shown"+E},F={CONTENT:".navdrawer-content",DATA_DISMISS:'[data-dismiss="navdrawer"]',DATA_TOGGLE:'[data-toggle="navdrawer"]'},R=function(){function o(e,t){this._backdrop=null,this._config=this._getConfig(t),this._content=O(e).find(F.CONTENT)[0],this._element=e,this._ignoreBackdropClick=!1,this._isShown=!1,this._typeBreakpoint=""===this._config.breakpoint?"":"-"+this._config.breakpoint}var e,t,n,i=o.prototype;return i.hide=function(e){var t=this;if(e&&e.preventDefault(),!this._isTransitioning&&this._isShown){var n=O.Event(j.HIDE);if(O(this._element).trigger(n),this._isShown&&!n.isDefaultPrevented()){this._isShown=!1,this._isTransitioning=!0,this._setEscapeEvent(),O(document).off(j.FOCUSIN),O(document.body).removeClass(M+"-"+this._config.type+this._typeBreakpoint),O(this._element).removeClass(A),O(this._element).off(j.CLICK_DISMISS),O(this._content).off(j.MOUSEDOWN_DISMISS);var i=W.getTransitionDurationFromElement(this._content);O(this._content).one(W.TRANSITION_END,function(e){return t._hideNavdrawer(e)}).emulateTransitionEnd(i),this._showBackdrop()}}},i.show=function(e){var t=this;if(!this._isTransitioning&&!this._isShown){this._isTransitioning=!0;var n=O.Event(j.SHOW,{relatedTarget:e});O(this._element).trigger(n),this._isShown||n.isDefaultPrevented()||(this._isShown=!0,this._setEscapeEvent(),O(this._element).addClass(x+"-"+this._config.type+this._typeBreakpoint),O(this._element).on(j.CLICK_DISMISS,F.DATA_DISMISS,function(e){return t.hide(e)}),O(this._content).on(j.MOUSEDOWN_DISMISS,function(){O(t._element).one(j.MOUSEUP_DISMISS,function(e){O(e.target).is(t._element)&&(t._ignoreBackdropClick=!0)})}),this._showBackdrop(),this._showElement(e))}},i.toggle=function(e){return this._isShown?this.hide():this.show(e)},i._enforceFocus=function(){var t=this;O(document).off(j.FOCUSIN).on(j.FOCUSIN,function(e){document!==e.target&&t._element!==e.target&&0===O(t._element).has(e.target).length&&t._element.focus()})},i._getConfig=function(e){return e=C({},P,e),W.typeCheckConfig(x,e,$),e},i._hideNavdrawer=function(){this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,O(this._element).trigger(j.HIDDEN)},i._removeBackdrop=function(){this._backdrop&&(O(this._backdrop).remove(),this._backdrop=null)},i._setEscapeEvent=function(){var t=this;this._isShown&&this._config.keyboard?O(this._element).on(j.KEYDOWN_DISMISS,function(e){27===e.which&&(e.preventDefault(),t.hide())}):this._isShown||O(this._element).off(j.KEYDOWN_DISMISS)},i._showBackdrop=function(){var t=this;this._isShown?(this._backdrop=document.createElement("div"),O(this._backdrop).addClass(N).addClass(N+"-"+this._config.type+this._typeBreakpoint).appendTo(document.body),O(this._element).on(j.CLICK_DISMISS,function(e){t._ignoreBackdropClick?t._ignoreBackdropClick=!1:e.target===e.currentTarget&&t.hide()}),W.reflow(this._backdrop),O(this._backdrop).addClass(A)):!this._isShown&&this._backdrop&&(O(this._backdrop).removeClass(A),this._removeBackdrop())},i._showElement=function(e){var t=this;this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),W.reflow(this._element),O(document.body).addClass(M+"-"+this._config.type+this._typeBreakpoint),O(this._element).addClass(A),this._enforceFocus();var n=O.Event(j.SHOWN,{relatedTarget:e}),i=W.getTransitionDurationFromElement(this._content);O(this._content).one(W.TRANSITION_END,function(){t._element.focus(),t._isTransitioning=!1,O(t._element).trigger(n)}).emulateTransitionEnd(i)},o._jQueryInterface=function(n,i){return this.each(function(){var e=C({},P,O(this).data(),"object"==typeof n&&n?n:{}),t=O(this).data(I);if(t||(t=new o(this,e),O(this).data(I,t)),"string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n](i)}else e.show&&t.show(i)})},e=o,n=[{key:"Default",get:function(){return P}}],(t=null)&&D(e.prototype,t),n&&D(e,n),o}(),O(document).on(j.CLICK_DATA_API,F.DATA_TOGGLE,function(e){var t,n=this,i=W.getSelectorFromElement(this);i&&(t=O(i)[0]);var o=O(t).data(I)?"toggle":C({},O(t).data(),O(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||e.preventDefault();var r=O(t).one(j.SHOW,function(e){e.isDefaultPrevented()||r.one(j.HIDDEN,function(){O(n).is(":visible")&&n.focus()})});R._jQueryInterface.call(O(t),o,this)}),O.fn[x]=R._jQueryInterface,O.fn[x].Constructor=R,O.fn[x].noConflict=function(){return O.fn[x]=T,R._jQueryInterface},R);function H(e,t){return e(t={exports:{}},t.exports),t.exports}var U,B,Q,L,J,K,G,q,z,V,X,Z,ee,te,ne,ie,oe,re,ae,se,ce,le,de,ue,he,fe,pe,me,ge,ye,ve=H(function(e,t){ +/*! + * pickadate.js v3.5.6, 2015/04/20 + * By Amsul, http://amsul.ca + * Hosted on http://amsul.github.io/pickadate.js + * Licensed under MIT + */var n;n=function(m){var i=m(window),g=m(document),y=m(document.documentElement),v=null!=document.documentElement.style.transition;function b(i,e,t,n){if(!i)return b;var o=!1,s={id:i.id||"P"+Math.abs(~~(Math.random()*new Date))},c=t?m.extend(!0,{},t.defaults,n):n||{},r=m.extend({},b.klasses(),c.klass),l=m(i),a=function(){return this.start()},d=a.prototype={constructor:a,$node:l,start:function(){return s&&s.start?d:(s.methods={},s.start=!0,s.open=!1,s.type=i.type,i.autofocus=i==S(),i.readOnly=!c.editable,i.id=i.id||s.id,"text"!=i.type&&(i.type="text"),d.component=new t(d,c),d.$root=m('<div class="'+r.picker+'" id="'+i.id+'_root" />'),k(d.$root[0],"hidden",!0),d.$holder=m(u()).appendTo(d.$root),h(),c.formatSubmit&&function(){var e;!0===c.hiddenName?(e=i.name,i.name=""):e=(e=["string"==typeof c.hiddenPrefix?c.hiddenPrefix:"","string"==typeof c.hiddenSuffix?c.hiddenSuffix:"_submit"])[0]+i.name+e[1];d._hidden=m('<input type=hidden name="'+e+'"'+(l.data("value")||i.value?' value="'+d.get("select",c.formatSubmit)+'"':"")+">")[0],l.on("change."+s.id,function(){d._hidden.value=i.value?d.get("select",c.formatSubmit):""})}(),function(){l.data(e,d).addClass(r.input).val(l.data("value")?d.get("select",c.format):i.value),c.editable||l.on("focus."+s.id+" click."+s.id,function(e){e.preventDefault(),d.open()}).on("keydown."+s.id,p);k(i,{haspopup:!0,expanded:!1,readonly:!1,owns:i.id+"_root"})}(),c.containerHidden?m(c.containerHidden).append(d._hidden):l.after(d._hidden),c.container?m(c.container).append(d.$root):l.after(d.$root),d.on({start:d.component.onStart,render:d.component.onRender,stop:d.component.onStop,open:d.component.onOpen,close:d.component.onClose,set:d.component.onSet}).on({start:c.onStart,render:c.onRender,stop:c.onStop,open:c.onOpen,close:c.onClose,set:c.onSet}),o=function(e){var t,n="position";e.currentStyle?t=e.currentStyle[n]:window.getComputedStyle&&(t=getComputedStyle(e)[n]);return"fixed"==t}(d.$holder[0]),i.autofocus&&d.open(),d.trigger("start").trigger("render"))},render:function(e){return e?(d.$holder=m(u()),h(),d.$root.html(d.$holder)):d.$root.find("."+r.box).html(d.component.nodes(s.open)),d.trigger("render")},stop:function(){return s.start&&(d.close(),d._hidden&&d._hidden.parentNode.removeChild(d._hidden),d.$root.remove(),l.removeClass(r.input).removeData(e),setTimeout(function(){l.off("."+s.id)},0),i.type=s.type,i.readOnly=!1,d.trigger("stop"),s.methods={},s.start=!1),d},open:function(e){return s.open?d:(l.addClass(r.active),k(i,"expanded",!0),setTimeout(function(){d.$root.addClass(r.opened),k(d.$root[0],"hidden",!1)},0),!1!==e&&(s.open=!0,o&&y.css("overflow","hidden").css("padding-right","+="+_()),o&&v?d.$holder.find("."+r.frame).one("transitionend",function(){d.$holder[0].focus()}):d.$holder[0].focus(),g.on("click."+s.id+" focusin."+s.id,function(e){var t=e.target;t!=i&&t!=document&&3!=e.which&&d.close(t===d.$holder[0])}).on("keydown."+s.id,function(e){var t=e.keyCode,n=d.component.key[t],i=e.target;27==t?d.close(!0):i!=d.$holder[0]||!n&&13!=t?m.contains(d.$root[0],i)&&13==t&&(e.preventDefault(),i.click()):(e.preventDefault(),n?b._.trigger(d.component.key.go,d,[b._.trigger(n)]):d.$root.find("."+r.highlighted).hasClass(r.disabled)||(d.set("select",d.component.item.highlight),c.closeOnSelect&&d.close(!0)))})),d.trigger("open"))},close:function(e){return e&&(c.editable?i.focus():(d.$holder.off("focus.toOpen").focus(),setTimeout(function(){d.$holder.on("focus.toOpen",f)},0))),l.removeClass(r.active),k(i,"expanded",!1),setTimeout(function(){d.$root.removeClass(r.opened+" "+r.focused),k(d.$root[0],"hidden",!0)},0),s.open?(s.open=!1,o&&y.css("overflow","").css("padding-right","-="+_()),g.off("."+s.id),d.trigger("close")):d},clear:function(e){return d.set("clear",null,e)},set:function(e,t,n){var i,o,r=m.isPlainObject(e),a=r?e:{};if(n=r&&m.isPlainObject(t)?t:n||{},e){for(i in r||(a[e]=t),a)o=a[i],i in d.component.item&&(void 0===o&&(o=null),d.component.set(i,o,n)),"select"!=i&&"clear"!=i||l.val("clear"==i?"":d.get(i,c.format)).trigger("change");d.render()}return n.muted?d:d.trigger("set",a)},get:function(e,t){if(null!=s[e=e||"value"])return s[e];if("valueSubmit"==e){if(d._hidden)return d._hidden.value;e="value"}if("value"==e)return i.value;if(e in d.component.item){if("string"==typeof t){var n=d.component.get(e);return n?b._.trigger(d.component.formats.toString,d.component,[t,n]):""}return d.component.get(e)}},on:function(e,t,n){var i,o,r=m.isPlainObject(e),a=r?e:{};if(e)for(i in r||(a[e]=t),a)o=a[i],n&&(i="_"+i),s.methods[i]=s.methods[i]||[],s.methods[i].push(o);return d},off:function(){var e,t,n=arguments;for(e=0,namesCount=n.length;e<namesCount;e+=1)(t=n[e])in s.methods&&delete s.methods[t];return d},trigger:function(e,n){var t=function(e){var t=s.methods[e];t&&t.map(function(e){b._.trigger(e,d,[n])})};return t("_"+e),t(e),d}};function u(){return b._.node("div",b._.node("div",b._.node("div",b._.node("div",d.component.nodes(s.open),r.box),r.wrap),r.frame),r.holder,'tabindex="-1"')}function h(){d.$holder.on({keydown:p,"focus.toOpen":f,blur:function(){l.removeClass(r.target)},focusin:function(e){d.$root.removeClass(r.focused),e.stopPropagation()},"mousedown click":function(e){var t=e.target;t!=d.$holder[0]&&(e.stopPropagation(),"mousedown"!=e.type||m(t).is("input, select, textarea, button, option")||(e.preventDefault(),d.$holder[0].focus()))}}).on("click","[data-pick], [data-nav], [data-clear], [data-close]",function(){var e=m(this),t=e.data(),n=e.hasClass(r.navDisabled)||e.hasClass(r.disabled),i=S();i=i&&(i.type||i.href),(n||i&&!m.contains(d.$root[0],i))&&d.$holder[0].focus(),!n&&t.nav?d.set("highlight",d.component.item.highlight,{nav:t.nav}):!n&&"pick"in t?(d.set("select",t.pick),c.closeOnSelect&&d.close(!0)):t.clear?(d.clear(),c.closeOnClear&&d.close(!0)):t.close&&d.close(!0)})}function f(e){e.stopPropagation(),l.addClass(r.target),d.$root.addClass(r.focused),d.open()}function p(e){var t=e.keyCode,n=/^(8|46)$/.test(t);if(27==t)return d.close(!0),!1;(32==t||n||!s.open&&d.component.key[t])&&(e.preventDefault(),e.stopPropagation(),n?d.clear().close():d.open())}return new a}function _(){if(y.height()<=i.height())return 0;var e=m('<div style="visibility:hidden;width:100px" />').appendTo("body"),t=e[0].offsetWidth;e.css("overflow","scroll");var n=m('<div style="width:100%" />').appendTo(e)[0].offsetWidth;return e.remove(),t-n}function k(e,t,n){if(m.isPlainObject(t))for(var i in t)o(e,i,t[i]);else o(e,t,n)}function o(e,t,n){e.setAttribute(("role"==t?"":"aria-")+t,n)}function S(){try{return document.activeElement}catch(e){}}return b.klasses=function(e){return{picker:e=e||"picker",opened:e+"--opened",focused:e+"--focused",input:e+"__input",active:e+"__input--active",target:e+"__input--target",holder:e+"__holder",frame:e+"__frame",wrap:e+"__wrap",box:e+"__box"}},b._={group:function(e){for(var t,n="",i=b._.trigger(e.min,e);i<=b._.trigger(e.max,e,[i]);i+=e.i)t=b._.trigger(e.item,e,[i]),n+=b._.node(e.node,t[0],t[1],t[2]);return n},node:function(e,t,n,i){return t?"<"+e+(n=n?' class="'+n+'"':"")+(i=i?" "+i:"")+">"+(t=m.isArray(t)?t.join(""):t)+"</"+e+">":""},lead:function(e){return(e<10?"0":"")+e},trigger:function(e,t,n){return"function"==typeof e?e.apply(t,n||[]):e},digits:function(e){return/\d/.test(e[1])?2:1},isDate:function(e){return-1<{}.toString.call(e).indexOf("Date")&&this.isInteger(e.getDate())},isInteger:function(e){return-1<{}.toString.call(e).indexOf("Number")&&e%1==0},ariaAttr:function(e,t){m.isPlainObject(e)||(e={attribute:t});for(var n in t="",e){var i=("role"==n?"":"aria-")+n,o=e[n];t+=null==o?"":i+'="'+e[n]+'"'}return t}},b.extend=function(i,o){m.fn[i]=function(e,t){var n=this.data(i);return"picker"==e?n:n&&"string"==typeof e?b._.trigger(n[e],n,[t]):this.each(function(){m(this).data(i)||new b(this,i,o,e)})},m.fn[i].defaults=o.defaults},b},e.exports=n(i)}),be=Object.freeze({default:ve,__moduleExports:ve}),_e=be&&ve||be,ke=(H(function(e,t){ +/*! + * Date picker for pickadate.js v3.5.6 + * http://amsul.github.io/pickadate.js/date.htm + */var n;n=function(e,p){var t,y=e._;function n(t,n){var e,i=this,o=t.$node[0],r=o.value,a=t.$node.data("value"),s=a||r,c=a?n.formatSubmit:n.format,l=function(){return o.currentStyle?"rtl"==o.currentStyle.direction:"rtl"==getComputedStyle(t.$root[0]).direction};i.settings=n,i.$node=t.$node,i.queue={min:"measure create",max:"measure create",now:"now create",select:"parse create validate",highlight:"parse navigate create validate",view:"parse create validate viewset",disable:"deactivate",enable:"activate"},i.item={},i.item.clear=null,i.item.disable=(n.disable||[]).slice(0),i.item.enable=-(!0===(e=i.item.disable)[0]?e.shift():-1),i.set("min",n.min).set("max",n.max).set("now"),s?i.set("select",s,{format:c,defaultValue:!0}):i.set("select",null).set("highlight",i.item.now),i.key={40:7,38:-7,39:function(){return l()?-1:1},37:function(){return l()?1:-1},go:function(e){var t=i.item.highlight,n=new Date(t.year,t.month,t.date+e);i.set("highlight",n,{interval:e}),this.render()}},t.on("render",function(){t.$root.find("."+n.klass.selectMonth).on("change",function(){var e=this.value;e&&(t.set("highlight",[t.get("view").year,e,t.get("highlight").date]),t.$root.find("."+n.klass.selectMonth).trigger("focus"))}),t.$root.find("."+n.klass.selectYear).on("change",function(){var e=this.value;e&&(t.set("highlight",[e,t.get("view").month,t.get("highlight").date]),t.$root.find("."+n.klass.selectYear).trigger("focus"))})},1).on("open",function(){var e="";i.disabled(i.get("now"))&&(e=":not(."+n.klass.buttonToday+")"),t.$root.find("button"+e+", select").attr("disabled",!1)},1).on("close",function(){t.$root.find("button, select").attr("disabled",!0)},1)}n.prototype.set=function(t,n,i){var o=this,e=o.item;return null===n?("clear"==t&&(t="select"),e[t]=n):(e["enable"==t?"disable":"flip"==t?"enable":t]=o.queue[t].split(" ").map(function(e){return n=o[e](t,n,i)}).pop(),"select"==t?o.set("highlight",e.select,i):"highlight"==t?o.set("view",e.highlight,i):t.match(/^(flip|min|max|disable|enable)$/)&&(e.select&&o.disabled(e.select)&&o.set("select",e.select,i),e.highlight&&o.disabled(e.highlight)&&o.set("highlight",e.highlight,i))),o},n.prototype.get=function(e){return this.item[e]},n.prototype.create=function(e,t,n){var i;return(t=void 0===t?e:t)==-1/0||t==1/0?i=t:p.isPlainObject(t)&&y.isInteger(t.pick)?t=t.obj:p.isArray(t)?(t=new Date(t[0],t[1],t[2]),t=y.isDate(t)?t:this.create().obj):t=y.isInteger(t)||y.isDate(t)?this.normalize(new Date(t),n):this.now(e,t,n),{year:i||t.getFullYear(),month:i||t.getMonth(),date:i||t.getDate(),day:i||t.getDay(),obj:i||t,pick:i||t.getTime()}},n.prototype.createRange=function(e,t){var n=this,i=function(e){return!0===e||p.isArray(e)||y.isDate(e)?n.create(e):e};return y.isInteger(e)||(e=i(e)),y.isInteger(t)||(t=i(t)),y.isInteger(e)&&p.isPlainObject(t)?e=[t.year,t.month,t.date+e]:y.isInteger(t)&&p.isPlainObject(e)&&(t=[e.year,e.month,e.date+t]),{from:i(e),to:i(t)}},n.prototype.withinRange=function(e,t){return e=this.createRange(e.from,e.to),t.pick>=e.from.pick&&t.pick<=e.to.pick},n.prototype.overlapRanges=function(e,t){var n=this;return e=n.createRange(e.from,e.to),t=n.createRange(t.from,t.to),n.withinRange(e,t.from)||n.withinRange(e,t.to)||n.withinRange(t,e.from)||n.withinRange(t,e.to)},n.prototype.now=function(e,t,n){return t=new Date,n&&n.rel&&t.setDate(t.getDate()+n.rel),this.normalize(t,n)},n.prototype.navigate=function(e,t,n){var i,o,r,a,s=p.isArray(t),c=p.isPlainObject(t),l=this.item.view;if(s||c){for(c?(o=t.year,r=t.month,a=t.date):(o=+t[0],r=+t[1],a=+t[2]),n&&n.nav&&l&&l.month!==r&&(o=l.year,r=l.month),o=(i=new Date(o,r+(n&&n.nav?n.nav:0),1)).getFullYear(),r=i.getMonth();new Date(o,r,a).getMonth()!==r;)a-=1;t=[o,r,a]}return t},n.prototype.normalize=function(e){return e.setHours(0,0,0,0),e},n.prototype.measure=function(e,t){return t?"string"==typeof t?t=this.parse(e,t):y.isInteger(t)&&(t=this.now(e,t,{rel:t})):t="min"==e?-1/0:1/0,t},n.prototype.viewset=function(e,t){return this.create([t.year,t.month,1])},n.prototype.validate=function(e,n,t){var i,o,r,a,s=this,c=n,l=t&&t.interval?t.interval:1,d=-1===s.item.enable,u=s.item.min,h=s.item.max,f=d&&s.item.disable.filter(function(e){if(p.isArray(e)){var t=s.create(e).pick;t<n.pick?i=!0:t>n.pick&&(o=!0)}return y.isInteger(e)}).length;if((!t||!t.nav&&!t.defaultValue)&&(!d&&s.disabled(n)||d&&s.disabled(n)&&(f||i||o)||!d&&(n.pick<=u.pick||n.pick>=h.pick)))for(d&&!f&&(!o&&0<l||!i&&l<0)&&(l*=-1);s.disabled(n)&&(1<Math.abs(l)&&(n.month<c.month||n.month>c.month)&&(n=c,l=0<l?1:-1),n.pick<=u.pick?(r=!0,l=1,n=s.create([u.year,u.month,u.date+(n.pick===u.pick?0:-1)])):n.pick>=h.pick&&(a=!0,l=-1,n=s.create([h.year,h.month,h.date+(n.pick===h.pick?0:1)])),!r||!a);)n=s.create([n.year,n.month,n.date+l]);return n},n.prototype.disabled=function(t){var n=this,e=n.item.disable.filter(function(e){return y.isInteger(e)?t.day===(n.settings.firstDay?e:e-1)%7:p.isArray(e)||y.isDate(e)?t.pick===n.create(e).pick:p.isPlainObject(e)?n.withinRange(e,t):void 0});return e=e.length&&!e.filter(function(e){return p.isArray(e)&&"inverted"==e[3]||p.isPlainObject(e)&&e.inverted}).length,-1===n.item.enable?!e:e||t.pick<n.item.min.pick||t.pick>n.item.max.pick},n.prototype.parse=function(e,i,t){var o=this,r={};return i&&"string"==typeof i?(t&&t.format||((t=t||{}).format=o.settings.format),o.formats.toArray(t.format).map(function(e){var t=o.formats[e],n=t?y.trigger(t,o,[i,r]):e.replace(/^!/,"").length;t&&(r[e]=i.substr(0,n)),i=i.substr(n)}),[r.yyyy||r.yy,+(r.mm||r.m)-1,r.dd||r.d]):i},n.prototype.formats=function(){function i(e,t,n){var i=e.match(/[^\x00-\x7F]+|\w+/)[0];return n.mm||n.m||(n.m=t.indexOf(i)+1),i.length}function n(e){return e.match(/\w+/)[0].length}return{d:function(e,t){return e?y.digits(e):t.date},dd:function(e,t){return e?2:y.lead(t.date)},ddd:function(e,t){return e?n(e):this.settings.weekdaysShort[t.day]},dddd:function(e,t){return e?n(e):this.settings.weekdaysFull[t.day]},m:function(e,t){return e?y.digits(e):t.month+1},mm:function(e,t){return e?2:y.lead(t.month+1)},mmm:function(e,t){var n=this.settings.monthsShort;return e?i(e,n,t):n[t.month]},mmmm:function(e,t){var n=this.settings.monthsFull;return e?i(e,n,t):n[t.month]},yy:function(e,t){return e?2:(""+t.year).slice(2)},yyyy:function(e,t){return e?4:t.year},toArray:function(e){return e.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)},toString:function(e,t){var n=this;return n.formats.toArray(e).map(function(e){return y.trigger(n.formats[e],n,[0,t])||e.replace(/^!/,"")}).join("")}}}(),n.prototype.isDateExact=function(e,t){return y.isInteger(e)&&y.isInteger(t)||"boolean"==typeof e&&"boolean"==typeof t?e===t:(y.isDate(e)||p.isArray(e))&&(y.isDate(t)||p.isArray(t))?this.create(e).pick===this.create(t).pick:!(!p.isPlainObject(e)||!p.isPlainObject(t))&&(this.isDateExact(e.from,t.from)&&this.isDateExact(e.to,t.to))},n.prototype.isDateOverlap=function(e,t){var n=this.settings.firstDay?1:0;return y.isInteger(e)&&(y.isDate(t)||p.isArray(t))?(e=e%7+n)===this.create(t).day+1:y.isInteger(t)&&(y.isDate(e)||p.isArray(e))?(t=t%7+n)===this.create(e).day+1:!(!p.isPlainObject(e)||!p.isPlainObject(t))&&this.overlapRanges(e,t)},n.prototype.flipEnable=function(e){var t=this.item;t.enable=e||(-1==t.enable?1:-1)},n.prototype.deactivate=function(e,t){var i=this,o=i.item.disable.slice(0);return"flip"==t?i.flipEnable():!1===t?(i.flipEnable(1),o=[]):!0===t?(i.flipEnable(-1),o=[]):t.map(function(e){for(var t,n=0;n<o.length;n+=1)if(i.isDateExact(e,o[n])){t=!0;break}t||(y.isInteger(e)||y.isDate(e)||p.isArray(e)||p.isPlainObject(e)&&e.from&&e.to)&&o.push(e)}),o},n.prototype.activate=function(e,t){var r=this,a=r.item.disable,s=a.length;return"flip"==t?r.flipEnable():!0===t?(r.flipEnable(1),a=[]):!1===t?(r.flipEnable(-1),a=[]):t.map(function(e){var t,n,i,o;for(i=0;i<s;i+=1){if(n=a[i],r.isDateExact(n,e)){t=a[i]=null,o=!0;break}if(r.isDateOverlap(n,e)){p.isPlainObject(e)?(e.inverted=!0,t=e):p.isArray(e)?(t=e)[3]||t.push("inverted"):y.isDate(e)&&(t=[e.getFullYear(),e.getMonth(),e.getDate(),"inverted"]);break}}if(t)for(i=0;i<s;i+=1)if(r.isDateExact(a[i],e)){a[i]=null;break}if(o)for(i=0;i<s;i+=1)if(r.isDateOverlap(a[i],e)){a[i]=null;break}t&&a.push(t)}),a.filter(function(e){return null!=e})},n.prototype.nodes=function(c){var t,n,l=this,d=l.settings,e=l.item,a=e.now,s=e.select,u=e.highlight,h=e.view,f=e.disable,p=e.min,m=e.max,i=(t=(d.showWeekdaysFull?d.weekdaysFull:d.weekdaysShort).slice(0),n=d.weekdaysFull.slice(0),d.firstDay&&(t.push(t.shift()),n.push(n.shift())),y.node("thead",y.node("tr",y.group({min:0,max:6,i:1,node:"th",item:function(e){return[t[e],d.klass.weekdays,'scope=col title="'+n[e]+'"']}})))),o=function(e){return y.node("div"," ",d.klass["nav"+(e?"Next":"Prev")]+(e&&h.year>=m.year&&h.month>=m.month||!e&&h.year<=p.year&&h.month<=p.month?" "+d.klass.navDisabled:""),"data-nav="+(e||-1)+" "+y.ariaAttr({role:"button",controls:l.$node[0].id+"_table"})+' title="'+(e?d.labelMonthNext:d.labelMonthPrev)+'"')},r=function(){var t=d.showMonthsShort?d.monthsShort:d.monthsFull;return d.selectMonths?y.node("select",y.group({min:0,max:11,i:1,node:"option",item:function(e){return[t[e],0,"value="+e+(h.month==e?" selected":"")+(h.year==p.year&&e<p.month||h.year==m.year&&e>m.month?" disabled":"")]}}),d.klass.selectMonth,(c?"":"disabled")+" "+y.ariaAttr({controls:l.$node[0].id+"_table"})+' title="'+d.labelMonthSelect+'"'):y.node("div",t[h.month],d.klass.month)},g=function(){var t=h.year,e=!0===d.selectYears?5:~~(d.selectYears/2);if(e){var n=p.year,i=m.year,o=t-e,r=t+e;if(o<n&&(r+=n-o,o=n),i<r){var a=o-n,s=r-i;o-=s<a?s:a,r=i}return y.node("select",y.group({min:o,max:r,i:1,node:"option",item:function(e){return[e,0,"value="+e+(t==e?" selected":"")]}}),d.klass.selectYear,(c?"":"disabled")+" "+y.ariaAttr({controls:l.$node[0].id+"_table"})+' title="'+d.labelYearSelect+'"')}return y.node("div",t,d.klass.year)};return y.node("div",(d.selectYears?g()+r():r()+g())+o()+o(1),d.klass.header)+y.node("table",i+y.node("tbody",y.group({min:0,max:5,i:1,node:"tr",item:function(e){var t=d.firstDay&&0===l.create([h.year,h.month,1]).day?-7:0;return[y.group({min:7*e-h.day+t+1,max:function(){return this.min+7-1},i:1,node:"td",item:function(e){e=l.create([h.year,h.month,e+(d.firstDay?1:0)]);var t,n=s&&s.pick==e.pick,i=u&&u.pick==e.pick,o=f&&l.disabled(e)||e.pick<p.pick||e.pick>m.pick,r=y.trigger(l.formats.toString,l,[d.format,e]);return[y.node("div",e.date,(t=[d.klass.day],t.push(h.month==e.month?d.klass.infocus:d.klass.outfocus),a.pick==e.pick&&t.push(d.klass.now),n&&t.push(d.klass.selected),i&&t.push(d.klass.highlighted),o&&t.push(d.klass.disabled),t.join(" ")),"data-pick="+e.pick+" "+y.ariaAttr({role:"gridcell",label:r,selected:!(!n||l.$node.val()!==r)||null,activedescendant:!!i||null,disabled:!!o||null})),"",y.ariaAttr({role:"presentation"})]}})]}})),d.klass.table,'id="'+l.$node[0].id+'_table" '+y.ariaAttr({role:"grid",controls:l.$node[0].id,readonly:!0}))+y.node("div",y.node("button",d.today,d.klass.buttonToday,"type=button data-pick="+a.pick+(c&&!l.disabled(a)?"":" disabled")+" "+y.ariaAttr({controls:l.$node[0].id}))+y.node("button",d.clear,d.klass.buttonClear,"type=button data-clear=1"+(c?"":" disabled")+" "+y.ariaAttr({controls:l.$node[0].id}))+y.node("button",d.close,d.klass.buttonClose,"type=button data-close=true "+(c?"":" disabled")+" "+y.ariaAttr({controls:l.$node[0].id})),d.klass.footer)},n.defaults={labelMonthNext:"Next month",labelMonthPrev:"Previous month",labelMonthSelect:"Select a month",labelYearSelect:"Select a year",monthsFull:["January","February","March","April","May","June","July","August","September","October","November","December"],monthsShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],weekdaysFull:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],weekdaysShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],today:"Today",clear:"Clear",close:"Close",closeOnSelect:!0,closeOnClear:!0,format:"d mmmm, yyyy",klass:{table:(t=e.klasses().picker+"__")+"table",header:t+"header",navPrev:t+"nav--prev",navNext:t+"nav--next",navDisabled:t+"nav--disabled",month:t+"month",year:t+"year",selectMonth:t+"select--month",selectYear:t+"select--year",weekdays:t+"weekday",day:t+"day",disabled:t+"day--disabled",selected:t+"day--selected",highlighted:t+"day--highlighted",now:t+"day--today",infocus:t+"day--infocus",outfocus:t+"day--outfocus",footer:t+"footer",buttonClear:t+"button--clear",buttonToday:t+"button--today",buttonClose:t+"button--close"}},e.extend("pickadate",n)},e.exports=n(_e,i)}),B="md.pickdate",Q="pickdate",L=(U=i).fn[Q],J={cancel:"Cancel",closeOnCancel:!0,closeOnSelect:!1,container:"",containerHidden:"",disable:[],firstDay:0,format:"d/m/yyyy",formatSubmit:"",hiddenName:!1,hiddenPrefix:"",hiddenSuffix:"",klass:{buttonClear:"btn btn-outline-primary picker-button-clear",buttonClose:"btn btn-outline-primary picker-button-close",buttonToday:"btn btn-outline-primary picker-button-today",day:"picker-day",disabled:"picker-day-disabled",highlighted:"picker-day-highlighted",infocus:"picker-day-infocus",now:"picker-day-today",outfocus:"picker-day-outfocus",selected:"picker-day-selected",weekdays:"picker-weekday",box:"picker-box",footer:"picker-footer",frame:"picker-frame",header:"picker-header",holder:"picker-holder",table:"picker-table",wrap:"picker-wrap",active:"picker-input-active",input:"picker-input",month:"picker-month",navDisabled:"picker-nav-disabled",navNext:"material-icons picker-nav-next",navPrev:"material-icons picker-nav-prev",selectMonth:"picker-select-month",selectYear:"picker-select-year",year:"picker-year",focused:"picker-focused",opened:"picker-opened",picker:"picker"},labelMonthNext:"Next month",labelMonthPrev:"Previous month",labelMonthSelect:"Select a month",labelYearSelect:"Select a year",max:!1,min:!1,monthsFull:["January","February","March","April","May","June","July","August","September","October","November","December"],monthsShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],ok:"OK",onClose:function(){},onOpen:function(){},onRender:function(){},onSet:function(){},onStart:function(){},onStop:function(){},selectMonths:!1,selectYears:!1,today:"",weekdaysFull:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],weekdaysShort:["S","M","T","W","T","F","S"]},K={cancel:"string",closeOnCancel:"boolean",closeOnSelect:"boolean",container:"string",containerHidden:"string",disable:"array",firstDay:"number",format:"string",formatSubmit:"string",hiddenName:"boolean",hiddenPrefix:"string",hiddenSuffix:"string",klass:"object",labelMonthNext:"string",labelMonthPrev:"string",labelMonthSelect:"string",labelYearSelect:"string",max:"boolean || date",min:"boolean || date",monthsFull:"array",monthsShort:"array",ok:"string",onClose:"function",onOpen:"function",onRender:"function",onSet:"function",onStart:"function",onStop:"function",selectMonths:"boolean",selectYears:"boolean || number",today:"string",weekdaysFull:"array",weekdaysShort:"array"},G=function(){function i(e,t){this._config=this._getConfig(t),this._element=e}var e=i.prototype;return e.display=function(e,t,n){U(".picker-date-display",t).remove(),U(".picker-wrap",t).prepend('<div class="picker-date-display"><div class="picker-date-display-top"><span class="picker-year-display">'+e.get(n,"yyyy")+'</span></div><div class="picker-date-display-bottom"><span class="picker-weekday-display">'+e.get(n,"dddd")+'</span><span class="picker-day-display">'+e.get(n,"d")+'</span><span class="picker-month-display">'+e.get(n,"mmm")+"</span></div></div>")},e.show=function(){var e=this;U(this._element).pickadate({clear:this._config.cancel,close:this._config.ok,closeOnClear:this._config.closeOnCancel,closeOnSelect:this._config.closeOnSelect,container:this._config.container,containerHidden:this._config.containerHidden,disable:this._config.disable,firstDay:this._config.firstDay,format:this._config.format,formatSubmit:this._config.formatSubmit,klass:this._config.klass,hiddenName:this._config.hiddenName,hiddenPrefix:this._config.hiddenPrefix,hiddenSuffix:this._config.hiddenSuffix,labelMonthNext:this._config.labelMonthNext,labelMonthPrev:this._config.labelMonthPrev,labelMonthSelect:this._config.labelMonthSelect,labelYearSelect:this._config.labelYearSelect,max:this._config.max,min:this._config.min,monthsFull:this._config.monthsFull,monthsShort:this._config.monthsShort,onClose:this._config.onClose,onOpen:this._config.onOpen,onRender:this._config.onRender,onSet:this._config.onSet,onStart:this._config.onStart,onStop:this._config.onStop,selectMonths:this._config.selectMonths,selectYears:this._config.selectYears,today:this._config.today,weekdaysFull:this._config.weekdaysFull,weekdaysShort:this._config.weekdaysShort});var t=U(this._element).pickadate("picker"),n=t.$root;t.on({close:function(){U(document.activeElement).blur()},open:function(){U(".picker__date-display",n).length||e.display(t,n,"highlight")},set:function(){null!==t.get("select")&&e.display(t,n,"select")}})},e._getConfig=function(e){return e=C({},J,e),W.typeCheckConfig(Q,e,K),e},i._jQueryInterface=function(n){return this.each(function(){var e=C({},J,U(this).data(),"object"==typeof n&&n?n:{}),t=U(this).data(B);t||(t=new i(this,e),U(this).data(B,t)),t.show()})},i}(),U.fn[Q]=G._jQueryInterface,U.fn[Q].Constructor=G,void(U.fn[Q].noConflict=function(){return U.fn[Q]=L,G._jQueryInterface})),Se=(X={IS_MOUSEDOWN:!(V="focus")},Z="blur"+(z=".md.selectioncontrolfocus"),ee="focus"+z,te="mousedown"+z,ne="mouseup"+z,ie=".custom-control",oe=".custom-control-input",void(q=i)(document).on(""+Z,oe,function(){q(this).removeClass(V)}).on(""+ee,oe,function(){!1===X.IS_MOUSEDOWN&&q(this).addClass(V)}).on(""+te,ie,function(){X.IS_MOUSEDOWN=!0}).on(""+ne,ie,function(){setTimeout(function(){X.IS_MOUSEDOWN=!1},1)})),we=(ae="md.tabswitch",se="tabswitch",ce=(re=i).fn[se],le="animate",de="dropdown-item",ue="nav-tabs-indicator",he="nav-tabs-material",fe="show",pe='.nav-tabs [data-toggle="tab"]',me=".dropdown",ge=".nav-tabs",ye=function(){function i(e){this._nav=e,this._navindicator=null}var e=i.prototype;return e.switch=function(e,t){var n=this,i=re(this._nav).offset().left,o=re(this._nav).scrollLeft(),r=re(this._nav).outerWidth();this._navindicator||this._createIndicator(i,o,r,t),re(e).hasClass(de)&&(e=re(e).closest(me));var a=re(e).offset().left,s=re(e).outerWidth();re(this._navindicator).addClass(fe),W.reflow(this._navindicator),re(this._nav).addClass(le),re(this._navindicator).css({left:a+o-i,right:r-(a+o-i+s)});var c=W.getTransitionDurationFromElement(this._navindicator);re(this._navindicator).one(W.TRANSITION_END,function(){re(n._nav).removeClass(le),re(n._navindicator).removeClass(fe)}).emulateTransitionEnd(c)},e._createIndicator=function(e,t,n,i){if(this._navindicator=document.createElement("div"),re(this._navindicator).addClass(ue).appendTo(this._nav),"undefined"!=typeof i){re(i).hasClass(de)&&(i=re(i).closest(me));var o=re(i).offset().left,r=re(i).outerWidth();re(this._navindicator).css({left:o+t-e,right:n-(o+t-e+r)})}re(this._nav).addClass(he)},i._jQueryInterface=function(n){return this.each(function(){var e=re(this).closest(ge)[0];if(e){var t=re(e).data(ae);t||(t=new i(e),re(e).data(ae,t)),t.switch(this,n)}})},i}(),re(document).on("show.bs.tab",pe,function(e){ye._jQueryInterface.call(re(this),e.relatedTarget)}),re.fn[se]=ye._jQueryInterface,re.fn[se].Constructor=ye,re.fn[se].noConflict=function(){return re.fn[se]=ce,ye._jQueryInterface},ye);e.Util=W,e.ExpansionPanel=S,e.FloatingLabel=w,e.NavDrawer=Y,e.PickDate=ke,e.SelectionControlFocus=Se,e.TabSwitch=we,Object.defineProperty(e,"__esModule",{value:!0})}); +//# sourceMappingURL=material.min.js.map +/** + * File skip-link-focus-fix.js. + * + * Helps with accessibility for keyboard only users. + * + * Learn more: https://git.io/vWdr2 + */ +( function() { + var isWebkit = navigator.userAgent.toLowerCase().indexOf( 'webkit' ) > -1, + isOpera = navigator.userAgent.toLowerCase().indexOf( 'opera' ) > -1, + isIe = navigator.userAgent.toLowerCase().indexOf( 'msie' ) > -1; + + if ( ( isWebkit || isOpera || isIe ) && document.getElementById && window.addEventListener ) { + window.addEventListener( 'hashchange', function() { + var id = location.hash.substring( 1 ), + element; + + if ( ! ( /^[A-z0-9_-]+$/.test( id ) ) ) { + return; + } + + element = document.getElementById( id ); + + if ( element ) { + if ( ! ( /^(?:a|select|input|button|textarea)$/i.test( element.tagName ) ) ) { + element.tabIndex = -1; + } + + element.focus(); + } + }, false ); + } +})(); + +jQuery(window).load(function () { + jQuery(window).scroll(function () { + if (jQuery(this).scrollTop() > 50) { + jQuery('#back-to-top').fadeIn(); + jQuery('#back-to-top').tooltip(); + } else { + jQuery('#back-to-top').fadeOut(); + } + }); + // scroll body to 0px on click + jQuery('#back-to-top').click(function () { + jQuery('#back-to-top').tooltip('hide'); + jQuery('body,html').animate({ + scrollTop: 0 + }, 'slow'); + return false; + }); + + if ( jQuery('#back-to-top').is(":visible") ) { + jQuery('#back-to-top').tooltip('show'); + } +}); +/* +window.onload = function(){ + +}; +*/ diff --git a/js/theme.min.js b/js/theme.min.js new file mode 100644 index 0000000..9438579 --- /dev/null +++ b/js/theme.min.js @@ -0,0 +1 @@ +!function(e,t){"object"==typeof exports&&"undefined"!=typeof module?t(exports,require("jquery")):"function"==typeof define&&define.amd?define(["exports","jquery"],t):t(e.bootstrap={},e.jQuery)}(this,function(e,t){"use strict";function i(e,t){for(var n=0;n<t.length;n++){var i=t[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(e,i.key,i)}}function a(e,t,n){return t&&i(e.prototype,t),n&&i(e,n),e}function l(o){for(var e=1;e<arguments.length;e++){var r=null!=arguments[e]?arguments[e]:{},t=Object.keys(r);"function"==typeof Object.getOwnPropertySymbols&&(t=t.concat(Object.getOwnPropertySymbols(r).filter(function(e){return Object.getOwnPropertyDescriptor(r,e).enumerable}))),t.forEach(function(e){var t,n,i;t=o,i=r[n=e],n in t?Object.defineProperty(t,n,{value:i,enumerable:!0,configurable:!0,writable:!0}):t[n]=i})}return o}for(var o,n,r,s,c,u,d,h,f,p,m,g,_,v,y,b,E,w,S,C,k,T,D,I,A,O,N,x,P,j,M,L,F,H,R,W,U,B,Q,q,$,K,Y,V,J,z,G,Z,X,ee,te,ne,ie,oe,re,ae,se,le,ce,ue,de,he,fe,pe,me,ge,_e,ve,ye,be,Ee,we=function(i){var t="transitionend";function e(e){var t=this,n=!1;return i(this).one(l.TRANSITION_END,function(){n=!0}),setTimeout(function(){n||l.triggerTransitionEnd(t)},e),this}var l={TRANSITION_END:"bsTransitionEnd",getUID:function(e){for(;e+=~~(1e6*Math.random()),document.getElementById(e););return e},getSelectorFromElement:function(e){var t=e.getAttribute("data-target");t&&"#"!==t||(t=e.getAttribute("href")||"");try{return document.querySelector(t)?t:null}catch(e){return null}},getTransitionDurationFromElement:function(e){if(!e)return 0;var t=i(e).css("transition-duration");return parseFloat(t)?(t=t.split(",")[0],1e3*parseFloat(t)):0},reflow:function(e){return e.offsetHeight},triggerTransitionEnd:function(e){i(e).trigger(t)},supportsTransitionEnd:function(){return Boolean(t)},isElement:function(e){return(e[0]||e).nodeType},typeCheckConfig:function(e,t,n){for(var i in n)if(Object.prototype.hasOwnProperty.call(n,i)){var o=n[i],r=t[i],a=r&&l.isElement(r)?"element":(s=r,{}.toString.call(s).match(/\s([a-z]+)/i)[1].toLowerCase());if(!new RegExp(o).test(a))throw new Error(e.toUpperCase()+': Option "'+i+'" provided type "'+a+'" but expected type "'+o+'".')}var s}};return i.fn.emulateTransitionEnd=e,i.event.special[l.TRANSITION_END]={bindType:t,delegateType:t,handle:function(e){if(i(e.target).is(this))return e.handleObj.handler.apply(this,arguments)}},l}(t=t&&t.hasOwnProperty("default")?t.default:t),Se=(n="alert",s="."+(r="bs.alert"),c=(o=t).fn[n],u={CLOSE:"close"+s,CLOSED:"closed"+s,CLICK_DATA_API:"click"+s+".data-api"},d="alert",h="fade",f="show",p=function(){function i(e){this._element=e}var e=i.prototype;return e.close=function(e){var t=this._element;e&&(t=this._getRootElement(e)),this._triggerCloseEvent(t).isDefaultPrevented()||this._removeElement(t)},e.dispose=function(){o.removeData(this._element,r),this._element=null},e._getRootElement=function(e){var t=we.getSelectorFromElement(e),n=!1;return t&&(n=document.querySelector(t)),n||(n=o(e).closest("."+d)[0]),n},e._triggerCloseEvent=function(e){var t=o.Event(u.CLOSE);return o(e).trigger(t),t},e._removeElement=function(t){var n=this;if(o(t).removeClass(f),o(t).hasClass(h)){var e=we.getTransitionDurationFromElement(t);o(t).one(we.TRANSITION_END,function(e){return n._destroyElement(t,e)}).emulateTransitionEnd(e)}else this._destroyElement(t)},e._destroyElement=function(e){o(e).detach().trigger(u.CLOSED).remove()},i._jQueryInterface=function(n){return this.each(function(){var e=o(this),t=e.data(r);t||(t=new i(this),e.data(r,t)),"close"===n&&t[n](this)})},i._handleDismiss=function(t){return function(e){e&&e.preventDefault(),t.close(this)}},a(i,null,[{key:"VERSION",get:function(){return"4.1.3"}}]),i}(),o(document).on(u.CLICK_DATA_API,'[data-dismiss="alert"]',p._handleDismiss(new p)),o.fn[n]=p._jQueryInterface,o.fn[n].Constructor=p,o.fn[n].noConflict=function(){return o.fn[n]=c,p._jQueryInterface},p),Ce=(g="button",v="."+(_="bs.button"),y=".data-api",b=(m=t).fn[g],E="active",w="btn",C='[data-toggle^="button"]',k='[data-toggle="buttons"]',T="input",D=".active",I=".btn",A={CLICK_DATA_API:"click"+v+y,FOCUS_BLUR_DATA_API:(S="focus")+v+y+" blur"+v+y},O=function(){function n(e){this._element=e}var e=n.prototype;return e.toggle=function(){var e=!0,t=!0,n=m(this._element).closest(k)[0];if(n){var i=this._element.querySelector(T);if(i){if("radio"===i.type)if(i.checked&&this._element.classList.contains(E))e=!1;else{var o=n.querySelector(D);o&&m(o).removeClass(E)}if(e){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!this._element.classList.contains(E),m(i).trigger("change")}i.focus(),t=!1}}t&&this._element.setAttribute("aria-pressed",!this._element.classList.contains(E)),e&&m(this._element).toggleClass(E)},e.dispose=function(){m.removeData(this._element,_),this._element=null},n._jQueryInterface=function(t){return this.each(function(){var e=m(this).data(_);e||(e=new n(this),m(this).data(_,e)),"toggle"===t&&e[t]()})},a(n,null,[{key:"VERSION",get:function(){return"4.1.3"}}]),n}(),m(document).on(A.CLICK_DATA_API,C,function(e){e.preventDefault();var t=e.target;m(t).hasClass(w)||(t=m(t).closest(I)),O._jQueryInterface.call(m(t),"toggle")}).on(A.FOCUS_BLUR_DATA_API,C,function(e){var t=m(e.target).closest(I)[0];m(t).toggleClass(S,/^focus(in)?$/.test(e.type))}),m.fn[g]=O._jQueryInterface,m.fn[g].Constructor=O,m.fn[g].noConflict=function(){return m.fn[g]=b,O._jQueryInterface},O),ke=(x="carousel",j="."+(P="bs.carousel"),M=".data-api",L=(N=t).fn[x],F={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},H={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean"},R="next",W="prev",U="left",B="right",Q={SLIDE:"slide"+j,SLID:"slid"+j,KEYDOWN:"keydown"+j,MOUSEENTER:"mouseenter"+j,MOUSELEAVE:"mouseleave"+j,TOUCHEND:"touchend"+j,LOAD_DATA_API:"load"+j+M,CLICK_DATA_API:"click"+j+M},q="carousel",$="active",K="slide",Y="carousel-item-right",V="carousel-item-left",J="carousel-item-next",z="carousel-item-prev",G=".active",Z=".active.carousel-item",X=".carousel-item",ee=".carousel-item-next, .carousel-item-prev",te=".carousel-indicators",ne="[data-slide], [data-slide-to]",ie='[data-ride="carousel"]',oe=function(){function r(e,t){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(t),this._element=N(e)[0],this._indicatorsElement=this._element.querySelector(te),this._addEventListeners()}var e=r.prototype;return e.next=function(){this._isSliding||this._slide(R)},e.nextWhenVisible=function(){!document.hidden&&N(this._element).is(":visible")&&"hidden"!==N(this._element).css("visibility")&&this.next()},e.prev=function(){this._isSliding||this._slide(W)},e.pause=function(e){e||(this._isPaused=!0),this._element.querySelector(ee)&&(we.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},e.cycle=function(e){e||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},e.to=function(e){var t=this;this._activeElement=this._element.querySelector(Z);var n=this._getItemIndex(this._activeElement);if(!(e>this._items.length-1||e<0))if(this._isSliding)N(this._element).one(Q.SLID,function(){return t.to(e)});else{if(n===e)return this.pause(),void this.cycle();var i=n<e?R:W;this._slide(i,this._items[e])}},e.dispose=function(){N(this._element).off(j),N.removeData(this._element,P),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},e._getConfig=function(e){return e=l({},F,e),we.typeCheckConfig(x,e,H),e},e._addEventListeners=function(){var t=this;this._config.keyboard&&N(this._element).on(Q.KEYDOWN,function(e){return t._keydown(e)}),"hover"===this._config.pause&&(N(this._element).on(Q.MOUSEENTER,function(e){return t.pause(e)}).on(Q.MOUSELEAVE,function(e){return t.cycle(e)}),"ontouchstart"in document.documentElement&&N(this._element).on(Q.TOUCHEND,function(){t.pause(),t.touchTimeout&&clearTimeout(t.touchTimeout),t.touchTimeout=setTimeout(function(e){return t.cycle(e)},500+t._config.interval)}))},e._keydown=function(e){if(!/input|textarea/i.test(e.target.tagName))switch(e.which){case 37:e.preventDefault(),this.prev();break;case 39:e.preventDefault(),this.next()}},e._getItemIndex=function(e){return this._items=e&&e.parentNode?[].slice.call(e.parentNode.querySelectorAll(X)):[],this._items.indexOf(e)},e._getItemByDirection=function(e,t){var n=e===R,i=e===W,o=this._getItemIndex(t),r=this._items.length-1;if((i&&0===o||n&&o===r)&&!this._config.wrap)return t;var a=(o+(e===W?-1:1))%this._items.length;return-1===a?this._items[this._items.length-1]:this._items[a]},e._triggerSlideEvent=function(e,t){var n=this._getItemIndex(e),i=this._getItemIndex(this._element.querySelector(Z)),o=N.Event(Q.SLIDE,{relatedTarget:e,direction:t,from:i,to:n});return N(this._element).trigger(o),o},e._setActiveIndicatorElement=function(e){if(this._indicatorsElement){var t=[].slice.call(this._indicatorsElement.querySelectorAll(G));N(t).removeClass($);var n=this._indicatorsElement.children[this._getItemIndex(e)];n&&N(n).addClass($)}},e._slide=function(e,t){var n,i,o,r=this,a=this._element.querySelector(Z),s=this._getItemIndex(a),l=t||a&&this._getItemByDirection(e,a),c=this._getItemIndex(l),u=Boolean(this._interval);if(o=e===R?(n=V,i=J,U):(n=Y,i=z,B),l&&N(l).hasClass($))this._isSliding=!1;else if(!this._triggerSlideEvent(l,o).isDefaultPrevented()&&a&&l){this._isSliding=!0,u&&this.pause(),this._setActiveIndicatorElement(l);var d=N.Event(Q.SLID,{relatedTarget:l,direction:o,from:s,to:c});if(N(this._element).hasClass(K)){N(l).addClass(i),we.reflow(l),N(a).addClass(n),N(l).addClass(n);var h=we.getTransitionDurationFromElement(a);N(a).one(we.TRANSITION_END,function(){N(l).removeClass(n+" "+i).addClass($),N(a).removeClass($+" "+i+" "+n),r._isSliding=!1,setTimeout(function(){return N(r._element).trigger(d)},0)}).emulateTransitionEnd(h)}else N(a).removeClass($),N(l).addClass($),this._isSliding=!1,N(this._element).trigger(d);u&&this.cycle()}},r._jQueryInterface=function(i){return this.each(function(){var e=N(this).data(P),t=l({},F,N(this).data());"object"==typeof i&&(t=l({},t,i));var n="string"==typeof i?i:t.slide;if(e||(e=new r(this,t),N(this).data(P,e)),"number"==typeof i)e.to(i);else if("string"==typeof n){if(void 0===e[n])throw new TypeError('No method named "'+n+'"');e[n]()}else t.interval&&(e.pause(),e.cycle())})},r._dataApiClickHandler=function(e){var t=we.getSelectorFromElement(this);if(t){var n=N(t)[0];if(n&&N(n).hasClass(q)){var i=l({},N(n).data(),N(this).data()),o=this.getAttribute("data-slide-to");o&&(i.interval=!1),r._jQueryInterface.call(N(n),i),o&&N(n).data(P).to(o),e.preventDefault()}}},a(r,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return F}}]),r}(),N(document).on(Q.CLICK_DATA_API,ne,oe._dataApiClickHandler),N(window).on(Q.LOAD_DATA_API,function(){for(var e=[].slice.call(document.querySelectorAll(ie)),t=0,n=e.length;t<n;t++){var i=N(e[t]);oe._jQueryInterface.call(i,i.data())}}),N.fn[x]=oe._jQueryInterface,N.fn[x].Constructor=oe,N.fn[x].noConflict=function(){return N.fn[x]=L,oe._jQueryInterface},oe),Te=(ae="collapse",le="."+(se="bs.collapse"),ce=(re=t).fn[ae],ue={toggle:!0,parent:""},de={toggle:"boolean",parent:"(string|element)"},he={SHOW:"show"+le,SHOWN:"shown"+le,HIDE:"hide"+le,HIDDEN:"hidden"+le,CLICK_DATA_API:"click"+le+".data-api"},fe="show",pe="collapse",me="collapsing",ge="collapsed",_e="width",ve="height",ye=".show, .collapsing",be='[data-toggle="collapse"]',Ee=function(){function s(t,e){this._isTransitioning=!1,this._element=t,this._config=this._getConfig(e),this._triggerArray=re.makeArray(document.querySelectorAll('[data-toggle="collapse"][href="#'+t.id+'"],[data-toggle="collapse"][data-target="#'+t.id+'"]'));for(var n=[].slice.call(document.querySelectorAll(be)),i=0,o=n.length;i<o;i++){var r=n[i],a=we.getSelectorFromElement(r),s=[].slice.call(document.querySelectorAll(a)).filter(function(e){return e===t});null!==a&&0<s.length&&(this._selector=a,this._triggerArray.push(r))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var e=s.prototype;return e.toggle=function(){re(this._element).hasClass(fe)?this.hide():this.show()},e.show=function(){var e,t,n=this;if(!this._isTransitioning&&!re(this._element).hasClass(fe)&&(this._parent&&0===(e=[].slice.call(this._parent.querySelectorAll(ye)).filter(function(e){return e.getAttribute("data-parent")===n._config.parent})).length&&(e=null),!(e&&(t=re(e).not(this._selector).data(se))&&t._isTransitioning))){var i=re.Event(he.SHOW);if(re(this._element).trigger(i),!i.isDefaultPrevented()){e&&(s._jQueryInterface.call(re(e).not(this._selector),"hide"),t||re(e).data(se,null));var o=this._getDimension();re(this._element).removeClass(pe).addClass(me),this._element.style[o]=0,this._triggerArray.length&&re(this._triggerArray).removeClass(ge).attr("aria-expanded",!0),this.setTransitioning(!0);var r="scroll"+(o[0].toUpperCase()+o.slice(1)),a=we.getTransitionDurationFromElement(this._element);re(this._element).one(we.TRANSITION_END,function(){re(n._element).removeClass(me).addClass(pe).addClass(fe),n._element.style[o]="",n.setTransitioning(!1),re(n._element).trigger(he.SHOWN)}).emulateTransitionEnd(a),this._element.style[o]=this._element[r]+"px"}}},e.hide=function(){var e=this;if(!this._isTransitioning&&re(this._element).hasClass(fe)){var t=re.Event(he.HIDE);if(re(this._element).trigger(t),!t.isDefaultPrevented()){var n=this._getDimension();this._element.style[n]=this._element.getBoundingClientRect()[n]+"px",we.reflow(this._element),re(this._element).addClass(me).removeClass(pe).removeClass(fe);var i=this._triggerArray.length;if(0<i)for(var o=0;o<i;o++){var r=this._triggerArray[o],a=we.getSelectorFromElement(r);if(null!==a)re([].slice.call(document.querySelectorAll(a))).hasClass(fe)||re(r).addClass(ge).attr("aria-expanded",!1)}this.setTransitioning(!0);this._element.style[n]="";var s=we.getTransitionDurationFromElement(this._element);re(this._element).one(we.TRANSITION_END,function(){e.setTransitioning(!1),re(e._element).removeClass(me).addClass(pe).trigger(he.HIDDEN)}).emulateTransitionEnd(s)}}},e.setTransitioning=function(e){this._isTransitioning=e},e.dispose=function(){re.removeData(this._element,se),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},e._getConfig=function(e){return(e=l({},ue,e)).toggle=Boolean(e.toggle),we.typeCheckConfig(ae,e,de),e},e._getDimension=function(){return re(this._element).hasClass(_e)?_e:ve},e._getParent=function(){var n=this,e=null;we.isElement(this._config.parent)?(e=this._config.parent,void 0!==this._config.parent.jquery&&(e=this._config.parent[0])):e=document.querySelector(this._config.parent);var t='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]',i=[].slice.call(e.querySelectorAll(t));return re(i).each(function(e,t){n._addAriaAndCollapsedClass(s._getTargetFromElement(t),[t])}),e},e._addAriaAndCollapsedClass=function(e,t){if(e){var n=re(e).hasClass(fe);t.length&&re(t).toggleClass(ge,!n).attr("aria-expanded",n)}},s._getTargetFromElement=function(e){var t=we.getSelectorFromElement(e);return t?document.querySelector(t):null},s._jQueryInterface=function(i){return this.each(function(){var e=re(this),t=e.data(se),n=l({},ue,e.data(),"object"==typeof i&&i?i:{});if(!t&&n.toggle&&/show|hide/.test(i)&&(n.toggle=!1),t||(t=new s(this,n),e.data(se,t)),"string"==typeof i){if(void 0===t[i])throw new TypeError('No method named "'+i+'"');t[i]()}})},a(s,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return ue}}]),s}(),re(document).on(he.CLICK_DATA_API,be,function(e){"A"===e.currentTarget.tagName&&e.preventDefault();var n=re(this),t=we.getSelectorFromElement(this),i=[].slice.call(document.querySelectorAll(t));re(i).each(function(){var e=re(this),t=e.data(se)?"toggle":n.data();Ee._jQueryInterface.call(e,t)})}),re.fn[ae]=Ee._jQueryInterface,re.fn[ae].Constructor=Ee,re.fn[ae].noConflict=function(){return re.fn[ae]=ce,Ee._jQueryInterface},Ee),De="undefined"!=typeof window&&"undefined"!=typeof document,Ie=["Edge","Trident","Firefox"],Ae=0,Oe=0;Oe<Ie.length;Oe+=1)if(De&&0<=navigator.userAgent.indexOf(Ie[Oe])){Ae=1;break}var Ne=De&&window.Promise?function(e){var t=!1;return function(){t||(t=!0,window.Promise.resolve().then(function(){t=!1,e()}))}}:function(e){var t=!1;return function(){t||(t=!0,setTimeout(function(){t=!1,e()},Ae))}};function xe(e){return e&&"[object Function]"==={}.toString.call(e)}function Pe(e,t){if(1!==e.nodeType)return[];var n=getComputedStyle(e,null);return t?n[t]:n}function je(e){return"HTML"===e.nodeName?e:e.parentNode||e.host}function Me(e){if(!e)return document.body;switch(e.nodeName){case"HTML":case"BODY":return e.ownerDocument.body;case"#document":return e.body}var t=Pe(e),n=t.overflow,i=t.overflowX,o=t.overflowY;return/(auto|scroll|overlay)/.test(n+o+i)?e:Me(je(e))}var Le=De&&!(!window.MSInputMethodContext||!document.documentMode),Fe=De&&/MSIE 10/.test(navigator.userAgent);function He(e){return 11===e?Le:10===e?Fe:Le||Fe}function Re(e){if(!e)return document.documentElement;for(var t=He(10)?document.body:null,n=e.offsetParent;n===t&&e.nextElementSibling;)n=(e=e.nextElementSibling).offsetParent;var i=n&&n.nodeName;return i&&"BODY"!==i&&"HTML"!==i?-1!==["TD","TABLE"].indexOf(n.nodeName)&&"static"===Pe(n,"position")?Re(n):n:e?e.ownerDocument.documentElement:document.documentElement}function We(e){return null!==e.parentNode?We(e.parentNode):e}function Ue(e,t){if(!(e&&e.nodeType&&t&&t.nodeType))return document.documentElement;var n=e.compareDocumentPosition(t)&Node.DOCUMENT_POSITION_FOLLOWING,i=n?e:t,o=n?t:e,r=document.createRange();r.setStart(i,0),r.setEnd(o,0);var a,s,l=r.commonAncestorContainer;if(e!==l&&t!==l||i.contains(o))return"BODY"===(s=(a=l).nodeName)||"HTML"!==s&&Re(a.firstElementChild)!==a?Re(l):l;var c=We(e);return c.host?Ue(c.host,t):Ue(e,We(t).host)}function Be(e){var t="top"===(1<arguments.length&&void 0!==arguments[1]?arguments[1]:"top")?"scrollTop":"scrollLeft",n=e.nodeName;if("BODY"!==n&&"HTML"!==n)return e[t];var i=e.ownerDocument.documentElement;return(e.ownerDocument.scrollingElement||i)[t]}function Qe(e,t){var n="x"===t?"Left":"Top",i="Left"===n?"Right":"Bottom";return parseFloat(e["border"+n+"Width"],10)+parseFloat(e["border"+i+"Width"],10)}function qe(e,t,n,i){return Math.max(t["offset"+e],t["scroll"+e],n["client"+e],n["offset"+e],n["scroll"+e],He(10)?n["offset"+e]+i["margin"+("Height"===e?"Top":"Left")]+i["margin"+("Height"===e?"Bottom":"Right")]:0)}function $e(){var e=document.body,t=document.documentElement,n=He(10)&&getComputedStyle(t);return{height:qe("Height",e,t,n),width:qe("Width",e,t,n)}}var Ke=function(){function i(e,t){for(var n=0;n<t.length;n++){var i=t[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(e,i.key,i)}}return function(e,t,n){return t&&i(e.prototype,t),n&&i(e,n),e}}(),Ye=function(e,t,n){return t in e?Object.defineProperty(e,t,{value:n,enumerable:!0,configurable:!0,writable:!0}):e[t]=n,e},Ve=Object.assign||function(e){for(var t=1;t<arguments.length;t++){var n=arguments[t];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(e[i]=n[i])}return e};function Je(e){return Ve({},e,{right:e.left+e.width,bottom:e.top+e.height})}function ze(e){var t={};try{if(He(10)){t=e.getBoundingClientRect();var n=Be(e,"top"),i=Be(e,"left");t.top+=n,t.left+=i,t.bottom+=n,t.right+=i}else t=e.getBoundingClientRect()}catch(e){}var o={left:t.left,top:t.top,width:t.right-t.left,height:t.bottom-t.top},r="HTML"===e.nodeName?$e():{},a=r.width||e.clientWidth||o.right-o.left,s=r.height||e.clientHeight||o.bottom-o.top,l=e.offsetWidth-a,c=e.offsetHeight-s;if(l||c){var u=Pe(e);l-=Qe(u,"x"),c-=Qe(u,"y"),o.width-=l,o.height-=c}return Je(o)}function Ge(e,t){var n=2<arguments.length&&void 0!==arguments[2]&&arguments[2],i=He(10),o="HTML"===t.nodeName,r=ze(e),a=ze(t),s=Me(e),l=Pe(t),c=parseFloat(l.borderTopWidth,10),u=parseFloat(l.borderLeftWidth,10);n&&"HTML"===t.nodeName&&(a.top=Math.max(a.top,0),a.left=Math.max(a.left,0));var d=Je({top:r.top-a.top-c,left:r.left-a.left-u,width:r.width,height:r.height});if(d.marginTop=0,d.marginLeft=0,!i&&o){var h=parseFloat(l.marginTop,10),f=parseFloat(l.marginLeft,10);d.top-=c-h,d.bottom-=c-h,d.left-=u-f,d.right-=u-f,d.marginTop=h,d.marginLeft=f}return(i&&!n?t.contains(s):t===s&&"BODY"!==s.nodeName)&&(d=function(e,t){var n=2<arguments.length&&void 0!==arguments[2]&&arguments[2],i=Be(t,"top"),o=Be(t,"left"),r=n?-1:1;return e.top+=i*r,e.bottom+=i*r,e.left+=o*r,e.right+=o*r,e}(d,t)),d}function Ze(e){if(!e||!e.parentElement||He())return document.documentElement;for(var t=e.parentElement;t&&"none"===Pe(t,"transform");)t=t.parentElement;return t||document.documentElement}function Xe(e,t,n,i){var o=4<arguments.length&&void 0!==arguments[4]&&arguments[4],r={top:0,left:0},a=o?Ze(e):Ue(e,t);if("viewport"===i)r=function(e){var t=1<arguments.length&&void 0!==arguments[1]&&arguments[1],n=e.ownerDocument.documentElement,i=Ge(e,n),o=Math.max(n.clientWidth,window.innerWidth||0),r=Math.max(n.clientHeight,window.innerHeight||0),a=t?0:Be(n),s=t?0:Be(n,"left");return Je({top:a-i.top+i.marginTop,left:s-i.left+i.marginLeft,width:o,height:r})}(a,o);else{var s=void 0;"scrollParent"===i?"BODY"===(s=Me(je(t))).nodeName&&(s=e.ownerDocument.documentElement):s="window"===i?e.ownerDocument.documentElement:i;var l=Ge(s,a,o);if("HTML"!==s.nodeName||function e(t){var n=t.nodeName;return"BODY"!==n&&"HTML"!==n&&("fixed"===Pe(t,"position")||e(je(t)))}(a))r=l;else{var c=$e(),u=c.height,d=c.width;r.top+=l.top-l.marginTop,r.bottom=u+l.top,r.left+=l.left-l.marginLeft,r.right=d+l.left}}return r.left+=n,r.top+=n,r.right-=n,r.bottom-=n,r}function et(e,t,i,n,o){var r=5<arguments.length&&void 0!==arguments[5]?arguments[5]:0;if(-1===e.indexOf("auto"))return e;var a=Xe(i,n,r,o),s={top:{width:a.width,height:t.top-a.top},right:{width:a.right-t.right,height:a.height},bottom:{width:a.width,height:a.bottom-t.bottom},left:{width:t.left-a.left,height:a.height}},l=Object.keys(s).map(function(e){return Ve({key:e},s[e],{area:(t=s[e],t.width*t.height)});var t}).sort(function(e,t){return t.area-e.area}),c=l.filter(function(e){var t=e.width,n=e.height;return t>=i.clientWidth&&n>=i.clientHeight}),u=0<c.length?c[0].key:l[0].key,d=e.split("-")[1];return u+(d?"-"+d:"")}function tt(e,t,n){var i=3<arguments.length&&void 0!==arguments[3]?arguments[3]:null;return Ge(n,i?Ze(t):Ue(t,n),i)}function nt(e){var t=getComputedStyle(e),n=parseFloat(t.marginTop)+parseFloat(t.marginBottom),i=parseFloat(t.marginLeft)+parseFloat(t.marginRight);return{width:e.offsetWidth+i,height:e.offsetHeight+n}}function it(e){var t={left:"right",right:"left",bottom:"top",top:"bottom"};return e.replace(/left|right|bottom|top/g,function(e){return t[e]})}function ot(e,t,n){n=n.split("-")[0];var i=nt(e),o={width:i.width,height:i.height},r=-1!==["right","left"].indexOf(n),a=r?"top":"left",s=r?"left":"top",l=r?"height":"width",c=r?"width":"height";return o[a]=t[a]+t[l]/2-i[l]/2,o[s]=n===s?t[s]-i[c]:t[it(s)],o}function rt(e,t){return Array.prototype.find?e.find(t):e.filter(t)[0]}function at(e,n,t){return(void 0===t?e:e.slice(0,function(e,t,n){if(Array.prototype.findIndex)return e.findIndex(function(e){return e[t]===n});var i=rt(e,function(e){return e[t]===n});return e.indexOf(i)}(e,"name",t))).forEach(function(e){e.function&&console.warn("`modifier.function` is deprecated, use `modifier.fn`!");var t=e.function||e.fn;e.enabled&&xe(t)&&(n.offsets.popper=Je(n.offsets.popper),n.offsets.reference=Je(n.offsets.reference),n=t(n,e))}),n}function st(e,n){return e.some(function(e){var t=e.name;return e.enabled&&t===n})}function lt(e){for(var t=[!1,"ms","Webkit","Moz","O"],n=e.charAt(0).toUpperCase()+e.slice(1),i=0;i<t.length;i++){var o=t[i],r=o?""+o+n:e;if(void 0!==document.body.style[r])return r}return null}function ct(e){var t=e.ownerDocument;return t?t.defaultView:window}function ut(e,t,n,i){n.updateBound=i,ct(e).addEventListener("resize",n.updateBound,{passive:!0});var o=Me(e);return function e(t,n,i,o){var r="BODY"===t.nodeName,a=r?t.ownerDocument.defaultView:t;a.addEventListener(n,i,{passive:!0}),r||e(Me(a.parentNode),n,i,o),o.push(a)}(o,"scroll",n.updateBound,n.scrollParents),n.scrollElement=o,n.eventsEnabled=!0,n}function dt(){var e,t;this.state.eventsEnabled&&(cancelAnimationFrame(this.scheduleUpdate),this.state=(e=this.reference,t=this.state,ct(e).removeEventListener("resize",t.updateBound),t.scrollParents.forEach(function(e){e.removeEventListener("scroll",t.updateBound)}),t.updateBound=null,t.scrollParents=[],t.scrollElement=null,t.eventsEnabled=!1,t))}function ht(e){return""!==e&&!isNaN(parseFloat(e))&&isFinite(e)}function ft(n,i){Object.keys(i).forEach(function(e){var t="";-1!==["width","height","top","right","bottom","left"].indexOf(e)&&ht(i[e])&&(t="px"),n.style[e]=i[e]+t})}function pt(e,t,n){var i=rt(e,function(e){return e.name===t}),o=!!i&&e.some(function(e){return e.name===n&&e.enabled&&e.order<i.order});if(!o){var r="`"+t+"`",a="`"+n+"`";console.warn(a+" modifier is required by "+r+" modifier in order to work, be sure to include it before "+r+"!")}return o}var mt=["auto-start","auto","auto-end","top-start","top","top-end","right-start","right","right-end","bottom-end","bottom","bottom-start","left-end","left","left-start"],gt=mt.slice(3);function _t(e){var t=1<arguments.length&&void 0!==arguments[1]&&arguments[1],n=gt.indexOf(e),i=gt.slice(n+1).concat(gt.slice(0,n));return t?i.reverse():i}var vt="flip",yt="clockwise",bt="counterclockwise";function Et(e,o,r,t){var a=[0,0],s=-1!==["right","left"].indexOf(t),n=e.split(/(\+|\-)/).map(function(e){return e.trim()}),i=n.indexOf(rt(n,function(e){return-1!==e.search(/,|\s/)}));n[i]&&-1===n[i].indexOf(",")&&console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead.");var l=/\s*,\s*|\s+/,c=-1!==i?[n.slice(0,i).concat([n[i].split(l)[0]]),[n[i].split(l)[1]].concat(n.slice(i+1))]:[n];return(c=c.map(function(e,t){var n=(1===t?!s:s)?"height":"width",i=!1;return e.reduce(function(e,t){return""===e[e.length-1]&&-1!==["+","-"].indexOf(t)?(e[e.length-1]=t,i=!0,e):i?(e[e.length-1]+=t,i=!1,e):e.concat(t)},[]).map(function(e){return function(e,t,n,i){var o=e.match(/((?:\-|\+)?\d*\.?\d*)(.*)/),r=+o[1],a=o[2];if(!r)return e;if(0!==a.indexOf("%"))return"vh"!==a&&"vw"!==a?r:("vh"===a?Math.max(document.documentElement.clientHeight,window.innerHeight||0):Math.max(document.documentElement.clientWidth,window.innerWidth||0))/100*r;var s=void 0;switch(a){case"%p":s=n;break;case"%":case"%r":default:s=i}return Je(s)[t]/100*r}(e,n,o,r)})})).forEach(function(n,i){n.forEach(function(e,t){ht(e)&&(a[i]+=e*("-"===n[t-1]?-1:1))})}),a}var wt={placement:"bottom",positionFixed:!1,eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(e){var t=e.placement,n=t.split("-")[0],i=t.split("-")[1];if(i){var o=e.offsets,r=o.reference,a=o.popper,s=-1!==["bottom","top"].indexOf(n),l=s?"left":"top",c=s?"width":"height",u={start:Ye({},l,r[l]),end:Ye({},l,r[l]+r[c]-a[c])};e.offsets.popper=Ve({},a,u[i])}return e}},offset:{order:200,enabled:!0,fn:function(e,t){var n=t.offset,i=e.placement,o=e.offsets,r=o.popper,a=o.reference,s=i.split("-")[0],l=void 0;return l=ht(+n)?[+n,0]:Et(n,r,a,s),"left"===s?(r.top+=l[0],r.left-=l[1]):"right"===s?(r.top+=l[0],r.left+=l[1]):"top"===s?(r.left+=l[0],r.top-=l[1]):"bottom"===s&&(r.left+=l[0],r.top+=l[1]),e.popper=r,e},offset:0},preventOverflow:{order:300,enabled:!0,fn:function(e,i){var t=i.boundariesElement||Re(e.instance.popper);e.instance.reference===t&&(t=Re(t));var n=lt("transform"),o=e.instance.popper.style,r=o.top,a=o.left,s=o[n];o.top="",o.left="",o[n]="";var l=Xe(e.instance.popper,e.instance.reference,i.padding,t,e.positionFixed);o.top=r,o.left=a,o[n]=s,i.boundaries=l;var c=i.priority,u=e.offsets.popper,d={primary:function(e){var t=u[e];return u[e]<l[e]&&!i.escapeWithReference&&(t=Math.max(u[e],l[e])),Ye({},e,t)},secondary:function(e){var t="right"===e?"left":"top",n=u[t];return u[e]>l[e]&&!i.escapeWithReference&&(n=Math.min(u[t],l[e]-("right"===e?u.width:u.height))),Ye({},t,n)}};return c.forEach(function(e){var t=-1!==["left","top"].indexOf(e)?"primary":"secondary";u=Ve({},u,d[t](e))}),e.offsets.popper=u,e},priority:["left","right","top","bottom"],padding:5,boundariesElement:"scrollParent"},keepTogether:{order:400,enabled:!0,fn:function(e){var t=e.offsets,n=t.popper,i=t.reference,o=e.placement.split("-")[0],r=Math.floor,a=-1!==["top","bottom"].indexOf(o),s=a?"right":"bottom",l=a?"left":"top",c=a?"width":"height";return n[s]<r(i[l])&&(e.offsets.popper[l]=r(i[l])-n[c]),n[l]>r(i[s])&&(e.offsets.popper[l]=r(i[s])),e}},arrow:{order:500,enabled:!0,fn:function(e,t){var n;if(!pt(e.instance.modifiers,"arrow","keepTogether"))return e;var i=t.element;if("string"==typeof i){if(!(i=e.instance.popper.querySelector(i)))return e}else if(!e.instance.popper.contains(i))return console.warn("WARNING: `arrow.element` must be child of its popper element!"),e;var o=e.placement.split("-")[0],r=e.offsets,a=r.popper,s=r.reference,l=-1!==["left","right"].indexOf(o),c=l?"height":"width",u=l?"Top":"Left",d=u.toLowerCase(),h=l?"left":"top",f=l?"bottom":"right",p=nt(i)[c];s[f]-p<a[d]&&(e.offsets.popper[d]-=a[d]-(s[f]-p)),s[d]+p>a[f]&&(e.offsets.popper[d]+=s[d]+p-a[f]),e.offsets.popper=Je(e.offsets.popper);var m=s[d]+s[c]/2-p/2,g=Pe(e.instance.popper),_=parseFloat(g["margin"+u],10),v=parseFloat(g["border"+u+"Width"],10),y=m-e.offsets.popper[d]-_-v;return y=Math.max(Math.min(a[c]-p,y),0),e.arrowElement=i,e.offsets.arrow=(Ye(n={},d,Math.round(y)),Ye(n,h,""),n),e},element:"[x-arrow]"},flip:{order:600,enabled:!0,fn:function(p,m){if(st(p.instance.modifiers,"inner"))return p;if(p.flipped&&p.placement===p.originalPlacement)return p;var g=Xe(p.instance.popper,p.instance.reference,m.padding,m.boundariesElement,p.positionFixed),_=p.placement.split("-")[0],v=it(_),y=p.placement.split("-")[1]||"",b=[];switch(m.behavior){case vt:b=[_,v];break;case yt:b=_t(_);break;case bt:b=_t(_,!0);break;default:b=m.behavior}return b.forEach(function(e,t){if(_!==e||b.length===t+1)return p;_=p.placement.split("-")[0],v=it(_);var n,i=p.offsets.popper,o=p.offsets.reference,r=Math.floor,a="left"===_&&r(i.right)>r(o.left)||"right"===_&&r(i.left)<r(o.right)||"top"===_&&r(i.bottom)>r(o.top)||"bottom"===_&&r(i.top)<r(o.bottom),s=r(i.left)<r(g.left),l=r(i.right)>r(g.right),c=r(i.top)<r(g.top),u=r(i.bottom)>r(g.bottom),d="left"===_&&s||"right"===_&&l||"top"===_&&c||"bottom"===_&&u,h=-1!==["top","bottom"].indexOf(_),f=!!m.flipVariations&&(h&&"start"===y&&s||h&&"end"===y&&l||!h&&"start"===y&&c||!h&&"end"===y&&u);(a||d||f)&&(p.flipped=!0,(a||d)&&(_=b[t+1]),f&&(y="end"===(n=y)?"start":"start"===n?"end":n),p.placement=_+(y?"-"+y:""),p.offsets.popper=Ve({},p.offsets.popper,ot(p.instance.popper,p.offsets.reference,p.placement)),p=at(p.instance.modifiers,p,"flip"))}),p},behavior:"flip",padding:5,boundariesElement:"viewport"},inner:{order:700,enabled:!1,fn:function(e){var t=e.placement,n=t.split("-")[0],i=e.offsets,o=i.popper,r=i.reference,a=-1!==["left","right"].indexOf(n),s=-1===["top","left"].indexOf(n);return o[a?"left":"top"]=r[n]-(s?o[a?"width":"height"]:0),e.placement=it(t),e.offsets.popper=Je(o),e}},hide:{order:800,enabled:!0,fn:function(e){if(!pt(e.instance.modifiers,"hide","preventOverflow"))return e;var t=e.offsets.reference,n=rt(e.instance.modifiers,function(e){return"preventOverflow"===e.name}).boundaries;if(t.bottom<n.top||t.left>n.right||t.top>n.bottom||t.right<n.left){if(!0===e.hide)return e;e.hide=!0,e.attributes["x-out-of-boundaries"]=""}else{if(!1===e.hide)return e;e.hide=!1,e.attributes["x-out-of-boundaries"]=!1}return e}},computeStyle:{order:850,enabled:!0,fn:function(e,t){var n=t.x,i=t.y,o=e.offsets.popper,r=rt(e.instance.modifiers,function(e){return"applyStyle"===e.name}).gpuAcceleration;void 0!==r&&console.warn("WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!");var a=void 0!==r?r:t.gpuAcceleration,s=ze(Re(e.instance.popper)),l={position:o.position},c={left:Math.floor(o.left),top:Math.round(o.top),bottom:Math.round(o.bottom),right:Math.floor(o.right)},u="bottom"===n?"top":"bottom",d="right"===i?"left":"right",h=lt("transform"),f=void 0,p=void 0;if(p="bottom"===u?-s.height+c.bottom:c.top,f="right"===d?-s.width+c.right:c.left,a&&h)l[h]="translate3d("+f+"px, "+p+"px, 0)",l[u]=0,l[d]=0,l.willChange="transform";else{var m="bottom"===u?-1:1,g="right"===d?-1:1;l[u]=p*m,l[d]=f*g,l.willChange=u+", "+d}var _={"x-placement":e.placement};return e.attributes=Ve({},_,e.attributes),e.styles=Ve({},l,e.styles),e.arrowStyles=Ve({},e.offsets.arrow,e.arrowStyles),e},gpuAcceleration:!0,x:"bottom",y:"right"},applyStyle:{order:900,enabled:!0,fn:function(e){var t,n;return ft(e.instance.popper,e.styles),t=e.instance.popper,n=e.attributes,Object.keys(n).forEach(function(e){!1!==n[e]?t.setAttribute(e,n[e]):t.removeAttribute(e)}),e.arrowElement&&Object.keys(e.arrowStyles).length&&ft(e.arrowElement,e.arrowStyles),e},onLoad:function(e,t,n,i,o){var r=tt(o,t,e,n.positionFixed),a=et(n.placement,r,t,e,n.modifiers.flip.boundariesElement,n.modifiers.flip.padding);return t.setAttribute("x-placement",a),ft(t,{position:n.positionFixed?"fixed":"absolute"}),n},gpuAcceleration:void 0}}},St=function(){function r(e,t){var n=this,i=2<arguments.length&&void 0!==arguments[2]?arguments[2]:{};!function(e,t){if(!(e instanceof t))throw new TypeError("Cannot call a class as a function")}(this,r),this.scheduleUpdate=function(){return requestAnimationFrame(n.update)},this.update=Ne(this.update.bind(this)),this.options=Ve({},r.Defaults,i),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=e&&e.jquery?e[0]:e,this.popper=t&&t.jquery?t[0]:t,this.options.modifiers={},Object.keys(Ve({},r.Defaults.modifiers,i.modifiers)).forEach(function(e){n.options.modifiers[e]=Ve({},r.Defaults.modifiers[e]||{},i.modifiers?i.modifiers[e]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(e){return Ve({name:e},n.options.modifiers[e])}).sort(function(e,t){return e.order-t.order}),this.modifiers.forEach(function(e){e.enabled&&xe(e.onLoad)&&e.onLoad(n.reference,n.popper,n.options,e,n.state)}),this.update();var o=this.options.eventsEnabled;o&&this.enableEventListeners(),this.state.eventsEnabled=o}return Ke(r,[{key:"update",value:function(){return function(){if(!this.state.isDestroyed){var e={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};e.offsets.reference=tt(this.state,this.popper,this.reference,this.options.positionFixed),e.placement=et(this.options.placement,e.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),e.originalPlacement=e.placement,e.positionFixed=this.options.positionFixed,e.offsets.popper=ot(this.popper,e.offsets.reference,e.placement),e.offsets.popper.position=this.options.positionFixed?"fixed":"absolute",e=at(this.modifiers,e),this.state.isCreated?this.options.onUpdate(e):(this.state.isCreated=!0,this.options.onCreate(e))}}.call(this)}},{key:"destroy",value:function(){return function(){return this.state.isDestroyed=!0,st(this.modifiers,"applyStyle")&&(this.popper.removeAttribute("x-placement"),this.popper.style.position="",this.popper.style.top="",this.popper.style.left="",this.popper.style.right="",this.popper.style.bottom="",this.popper.style.willChange="",this.popper.style[lt("transform")]=""),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}.call(this)}},{key:"enableEventListeners",value:function(){return function(){this.state.eventsEnabled||(this.state=ut(this.reference,this.options,this.state,this.scheduleUpdate))}.call(this)}},{key:"disableEventListeners",value:function(){return dt.call(this)}}]),r}();St.Utils=("undefined"!=typeof window?window:global).PopperUtils,St.placements=mt,St.Defaults=wt;var Ct,kt,Tt,Dt,It,At,Ot,Nt,xt,Pt,jt,Mt,Lt,Ft,Ht,Rt,Wt,Ut,Bt,Qt,qt,$t,Kt,Yt,Vt,Jt,zt,Gt,Zt,Xt,en,tn,nn,on,rn,an,sn,ln,cn,un,dn,hn,fn,pn,mn,gn,_n,vn,yn,bn,En,wn,Sn,Cn,kn,Tn,Dn,In,An,On,Nn,xn,Pn,jn,Mn,Ln,Fn,Hn,Rn,Wn,Un,Bn,Qn,qn,$n,Kn,Yn,Vn,Jn,zn,Gn,Zn,Xn,ei,ti,ni,ii,oi,ri,ai,si,li,ci,ui,di,hi,fi,pi,mi,gi,_i,vi,yi,bi,Ei,wi,Si,Ci,ki,Ti,Di,Ii,Ai,Oi,Ni,xi,Pi,ji,Mi,Li,Fi,Hi,Ri,Wi,Ui,Bi=(kt="dropdown",Dt="."+(Tt="bs.dropdown"),It=".data-api",At=(Ct=t).fn[kt],Ot=new RegExp("38|40|27"),Nt={HIDE:"hide"+Dt,HIDDEN:"hidden"+Dt,SHOW:"show"+Dt,SHOWN:"shown"+Dt,CLICK:"click"+Dt,CLICK_DATA_API:"click"+Dt+It,KEYDOWN_DATA_API:"keydown"+Dt+It,KEYUP_DATA_API:"keyup"+Dt+It},xt="disabled",Pt="show",jt="dropup",Mt="dropright",Lt="dropleft",Ft="dropdown-menu-right",Ht="position-static",Rt='[data-toggle="dropdown"]',Wt=".dropdown form",Ut=".dropdown-menu",Bt=".navbar-nav",Qt=".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",qt="top-start",$t="top-end",Kt="bottom-start",Yt="bottom-end",Vt="right-start",Jt="left-start",zt={offset:0,flip:!0,boundary:"scrollParent",reference:"toggle",display:"dynamic"},Gt={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)",reference:"(string|element)",display:"string"},Zt=function(){function c(e,t){this._element=e,this._popper=null,this._config=this._getConfig(t),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var e=c.prototype;return e.toggle=function(){if(!this._element.disabled&&!Ct(this._element).hasClass(xt)){var e=c._getParentFromElement(this._element),t=Ct(this._menu).hasClass(Pt);if(c._clearMenus(),!t){var n={relatedTarget:this._element},i=Ct.Event(Nt.SHOW,n);if(Ct(e).trigger(i),!i.isDefaultPrevented()){if(!this._inNavbar){if(void 0===St)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var o=this._element;"parent"===this._config.reference?o=e:we.isElement(this._config.reference)&&(o=this._config.reference,void 0!==this._config.reference.jquery&&(o=this._config.reference[0])),"scrollParent"!==this._config.boundary&&Ct(e).addClass(Ht),this._popper=new St(o,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===Ct(e).closest(Bt).length&&Ct(document.body).children().on("mouseover",null,Ct.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),Ct(this._menu).toggleClass(Pt),Ct(e).toggleClass(Pt).trigger(Ct.Event(Nt.SHOWN,n))}}}},e.dispose=function(){Ct.removeData(this._element,Tt),Ct(this._element).off(Dt),this._element=null,(this._menu=null)!==this._popper&&(this._popper.destroy(),this._popper=null)},e.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},e._addEventListeners=function(){var t=this;Ct(this._element).on(Nt.CLICK,function(e){e.preventDefault(),e.stopPropagation(),t.toggle()})},e._getConfig=function(e){return e=l({},this.constructor.Default,Ct(this._element).data(),e),we.typeCheckConfig(kt,e,this.constructor.DefaultType),e},e._getMenuElement=function(){if(!this._menu){var e=c._getParentFromElement(this._element);e&&(this._menu=e.querySelector(Ut))}return this._menu},e._getPlacement=function(){var e=Ct(this._element.parentNode),t=Kt;return e.hasClass(jt)?(t=qt,Ct(this._menu).hasClass(Ft)&&(t=$t)):e.hasClass(Mt)?t=Vt:e.hasClass(Lt)?t=Jt:Ct(this._menu).hasClass(Ft)&&(t=Yt),t},e._detectNavbar=function(){return 0<Ct(this._element).closest(".navbar").length},e._getPopperConfig=function(){var t=this,e={};"function"==typeof this._config.offset?e.fn=function(e){return e.offsets=l({},e.offsets,t._config.offset(e.offsets)||{}),e}:e.offset=this._config.offset;var n={placement:this._getPlacement(),modifiers:{offset:e,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}};return"static"===this._config.display&&(n.modifiers.applyStyle={enabled:!1}),n},c._jQueryInterface=function(t){return this.each(function(){var e=Ct(this).data(Tt);if(e||(e=new c(this,"object"==typeof t?t:null),Ct(this).data(Tt,e)),"string"==typeof t){if(void 0===e[t])throw new TypeError('No method named "'+t+'"');e[t]()}})},c._clearMenus=function(e){if(!e||3!==e.which&&("keyup"!==e.type||9===e.which))for(var t=[].slice.call(document.querySelectorAll(Rt)),n=0,i=t.length;n<i;n++){var o=c._getParentFromElement(t[n]),r=Ct(t[n]).data(Tt),a={relatedTarget:t[n]};if(e&&"click"===e.type&&(a.clickEvent=e),r){var s=r._menu;if(Ct(o).hasClass(Pt)&&!(e&&("click"===e.type&&/input|textarea/i.test(e.target.tagName)||"keyup"===e.type&&9===e.which)&&Ct.contains(o,e.target))){var l=Ct.Event(Nt.HIDE,a);Ct(o).trigger(l),l.isDefaultPrevented()||("ontouchstart"in document.documentElement&&Ct(document.body).children().off("mouseover",null,Ct.noop),t[n].setAttribute("aria-expanded","false"),Ct(s).removeClass(Pt),Ct(o).removeClass(Pt).trigger(Ct.Event(Nt.HIDDEN,a)))}}}},c._getParentFromElement=function(e){var t,n=we.getSelectorFromElement(e);return n&&(t=document.querySelector(n)),t||e.parentNode},c._dataApiKeydownHandler=function(e){if((/input|textarea/i.test(e.target.tagName)?!(32===e.which||27!==e.which&&(40!==e.which&&38!==e.which||Ct(e.target).closest(Ut).length)):Ot.test(e.which))&&(e.preventDefault(),e.stopPropagation(),!this.disabled&&!Ct(this).hasClass(xt))){var t=c._getParentFromElement(this),n=Ct(t).hasClass(Pt);if((n||27===e.which&&32===e.which)&&(!n||27!==e.which&&32!==e.which)){var i=[].slice.call(t.querySelectorAll(Qt));if(0!==i.length){var o=i.indexOf(e.target);38===e.which&&0<o&&o--,40===e.which&&o<i.length-1&&o++,o<0&&(o=0),i[o].focus()}}else{if(27===e.which){var r=t.querySelector(Rt);Ct(r).trigger("focus")}Ct(this).trigger("click")}}},a(c,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return zt}},{key:"DefaultType",get:function(){return Gt}}]),c}(),Ct(document).on(Nt.KEYDOWN_DATA_API,Rt,Zt._dataApiKeydownHandler).on(Nt.KEYDOWN_DATA_API,Ut,Zt._dataApiKeydownHandler).on(Nt.CLICK_DATA_API+" "+Nt.KEYUP_DATA_API,Zt._clearMenus).on(Nt.CLICK_DATA_API,Rt,function(e){e.preventDefault(),e.stopPropagation(),Zt._jQueryInterface.call(Ct(this),"toggle")}).on(Nt.CLICK_DATA_API,Wt,function(e){e.stopPropagation()}),Ct.fn[kt]=Zt._jQueryInterface,Ct.fn[kt].Constructor=Zt,Ct.fn[kt].noConflict=function(){return Ct.fn[kt]=At,Zt._jQueryInterface},Zt),Qi=(en="modal",nn="."+(tn="bs.modal"),on=(Xt=t).fn[en],rn={backdrop:!0,keyboard:!0,focus:!0,show:!0},an={backdrop:"(boolean|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},sn={HIDE:"hide"+nn,HIDDEN:"hidden"+nn,SHOW:"show"+nn,SHOWN:"shown"+nn,FOCUSIN:"focusin"+nn,RESIZE:"resize"+nn,CLICK_DISMISS:"click.dismiss"+nn,KEYDOWN_DISMISS:"keydown.dismiss"+nn,MOUSEUP_DISMISS:"mouseup.dismiss"+nn,MOUSEDOWN_DISMISS:"mousedown.dismiss"+nn,CLICK_DATA_API:"click"+nn+".data-api"},ln="modal-scrollbar-measure",cn="modal-backdrop",un="modal-open",dn="fade",hn="show",fn=".modal-dialog",pn='[data-toggle="modal"]',mn='[data-dismiss="modal"]',gn=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",_n=".sticky-top",vn=function(){function o(e,t){this._config=this._getConfig(t),this._element=e,this._dialog=e.querySelector(fn),this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._scrollbarWidth=0}var e=o.prototype;return e.toggle=function(e){return this._isShown?this.hide():this.show(e)},e.show=function(e){var t=this;if(!this._isTransitioning&&!this._isShown){Xt(this._element).hasClass(dn)&&(this._isTransitioning=!0);var n=Xt.Event(sn.SHOW,{relatedTarget:e});Xt(this._element).trigger(n),this._isShown||n.isDefaultPrevented()||(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),Xt(document.body).addClass(un),this._setEscapeEvent(),this._setResizeEvent(),Xt(this._element).on(sn.CLICK_DISMISS,mn,function(e){return t.hide(e)}),Xt(this._dialog).on(sn.MOUSEDOWN_DISMISS,function(){Xt(t._element).one(sn.MOUSEUP_DISMISS,function(e){Xt(e.target).is(t._element)&&(t._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return t._showElement(e)}))}},e.hide=function(e){var t=this;if(e&&e.preventDefault(),!this._isTransitioning&&this._isShown){var n=Xt.Event(sn.HIDE);if(Xt(this._element).trigger(n),this._isShown&&!n.isDefaultPrevented()){this._isShown=!1;var i=Xt(this._element).hasClass(dn);if(i&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),Xt(document).off(sn.FOCUSIN),Xt(this._element).removeClass(hn),Xt(this._element).off(sn.CLICK_DISMISS),Xt(this._dialog).off(sn.MOUSEDOWN_DISMISS),i){var o=we.getTransitionDurationFromElement(this._element);Xt(this._element).one(we.TRANSITION_END,function(e){return t._hideModal(e)}).emulateTransitionEnd(o)}else this._hideModal()}}},e.dispose=function(){Xt.removeData(this._element,tn),Xt(window,document,this._element,this._backdrop).off(nn),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._scrollbarWidth=null},e.handleUpdate=function(){this._adjustDialog()},e._getConfig=function(e){return e=l({},rn,e),we.typeCheckConfig(en,e,an),e},e._showElement=function(e){var t=this,n=Xt(this._element).hasClass(dn);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.scrollTop=0,n&&we.reflow(this._element),Xt(this._element).addClass(hn),this._config.focus&&this._enforceFocus();var i=Xt.Event(sn.SHOWN,{relatedTarget:e}),o=function(){t._config.focus&&t._element.focus(),t._isTransitioning=!1,Xt(t._element).trigger(i)};if(n){var r=we.getTransitionDurationFromElement(this._element);Xt(this._dialog).one(we.TRANSITION_END,o).emulateTransitionEnd(r)}else o()},e._enforceFocus=function(){var t=this;Xt(document).off(sn.FOCUSIN).on(sn.FOCUSIN,function(e){document!==e.target&&t._element!==e.target&&0===Xt(t._element).has(e.target).length&&t._element.focus()})},e._setEscapeEvent=function(){var t=this;this._isShown&&this._config.keyboard?Xt(this._element).on(sn.KEYDOWN_DISMISS,function(e){27===e.which&&(e.preventDefault(),t.hide())}):this._isShown||Xt(this._element).off(sn.KEYDOWN_DISMISS)},e._setResizeEvent=function(){var t=this;this._isShown?Xt(window).on(sn.RESIZE,function(e){return t.handleUpdate(e)}):Xt(window).off(sn.RESIZE)},e._hideModal=function(){var e=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,this._showBackdrop(function(){Xt(document.body).removeClass(un),e._resetAdjustments(),e._resetScrollbar(),Xt(e._element).trigger(sn.HIDDEN)})},e._removeBackdrop=function(){this._backdrop&&(Xt(this._backdrop).remove(),this._backdrop=null)},e._showBackdrop=function(e){var t=this,n=Xt(this._element).hasClass(dn)?dn:"";if(this._isShown&&this._config.backdrop){if(this._backdrop=document.createElement("div"),this._backdrop.className=cn,n&&this._backdrop.classList.add(n),Xt(this._backdrop).appendTo(document.body),Xt(this._element).on(sn.CLICK_DISMISS,function(e){t._ignoreBackdropClick?t._ignoreBackdropClick=!1:e.target===e.currentTarget&&("static"===t._config.backdrop?t._element.focus():t.hide())}),n&&we.reflow(this._backdrop),Xt(this._backdrop).addClass(hn),!e)return;if(!n)return void e();var i=we.getTransitionDurationFromElement(this._backdrop);Xt(this._backdrop).one(we.TRANSITION_END,e).emulateTransitionEnd(i)}else if(!this._isShown&&this._backdrop){Xt(this._backdrop).removeClass(hn);var o=function(){t._removeBackdrop(),e&&e()};if(Xt(this._element).hasClass(dn)){var r=we.getTransitionDurationFromElement(this._backdrop);Xt(this._backdrop).one(we.TRANSITION_END,o).emulateTransitionEnd(r)}else o()}else e&&e()},e._adjustDialog=function(){var e=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&e&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!e&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},e._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},e._checkScrollbar=function(){var e=document.body.getBoundingClientRect();this._isBodyOverflowing=e.left+e.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},e._setScrollbar=function(){var o=this;if(this._isBodyOverflowing){var e=[].slice.call(document.querySelectorAll(gn)),t=[].slice.call(document.querySelectorAll(_n));Xt(e).each(function(e,t){var n=t.style.paddingRight,i=Xt(t).css("padding-right");Xt(t).data("padding-right",n).css("padding-right",parseFloat(i)+o._scrollbarWidth+"px")}),Xt(t).each(function(e,t){var n=t.style.marginRight,i=Xt(t).css("margin-right");Xt(t).data("margin-right",n).css("margin-right",parseFloat(i)-o._scrollbarWidth+"px")});var n=document.body.style.paddingRight,i=Xt(document.body).css("padding-right");Xt(document.body).data("padding-right",n).css("padding-right",parseFloat(i)+this._scrollbarWidth+"px")}},e._resetScrollbar=function(){var e=[].slice.call(document.querySelectorAll(gn));Xt(e).each(function(e,t){var n=Xt(t).data("padding-right");Xt(t).removeData("padding-right"),t.style.paddingRight=n||""});var t=[].slice.call(document.querySelectorAll(""+_n));Xt(t).each(function(e,t){var n=Xt(t).data("margin-right");void 0!==n&&Xt(t).css("margin-right",n).removeData("margin-right")});var n=Xt(document.body).data("padding-right");Xt(document.body).removeData("padding-right"),document.body.style.paddingRight=n||""},e._getScrollbarWidth=function(){var e=document.createElement("div");e.className=ln,document.body.appendChild(e);var t=e.getBoundingClientRect().width-e.clientWidth;return document.body.removeChild(e),t},o._jQueryInterface=function(n,i){return this.each(function(){var e=Xt(this).data(tn),t=l({},rn,Xt(this).data(),"object"==typeof n&&n?n:{});if(e||(e=new o(this,t),Xt(this).data(tn,e)),"string"==typeof n){if(void 0===e[n])throw new TypeError('No method named "'+n+'"');e[n](i)}else t.show&&e.show(i)})},a(o,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return rn}}]),o}(),Xt(document).on(sn.CLICK_DATA_API,pn,function(e){var t,n=this,i=we.getSelectorFromElement(this);i&&(t=document.querySelector(i));var o=Xt(t).data(tn)?"toggle":l({},Xt(t).data(),Xt(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||e.preventDefault();var r=Xt(t).one(sn.SHOW,function(e){e.isDefaultPrevented()||r.one(sn.HIDDEN,function(){Xt(n).is(":visible")&&n.focus()})});vn._jQueryInterface.call(Xt(t),o,this)}),Xt.fn[en]=vn._jQueryInterface,Xt.fn[en].Constructor=vn,Xt.fn[en].noConflict=function(){return Xt.fn[en]=on,vn._jQueryInterface},vn),qi=(bn="tooltip",wn="."+(En="bs.tooltip"),Sn=(yn=t).fn[bn],Cn="bs-tooltip",kn=new RegExp("(^|\\s)"+Cn+"\\S+","g"),In={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!(Dn={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"}),selector:!(Tn={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"(number|string)",container:"(string|element|boolean)",fallbackPlacement:"(string|array)",boundary:"(string|element)"}),placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},On="out",Nn={HIDE:"hide"+wn,HIDDEN:"hidden"+wn,SHOW:(An="show")+wn,SHOWN:"shown"+wn,INSERTED:"inserted"+wn,CLICK:"click"+wn,FOCUSIN:"focusin"+wn,FOCUSOUT:"focusout"+wn,MOUSEENTER:"mouseenter"+wn,MOUSELEAVE:"mouseleave"+wn},xn="fade",Pn="show",jn=".tooltip-inner",Mn=".arrow",Ln="hover",Fn="focus",Hn="click",Rn="manual",Wn=function(){function i(e,t){if(void 0===St)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=e,this.config=this._getConfig(t),this.tip=null,this._setListeners()}var e=i.prototype;return e.enable=function(){this._isEnabled=!0},e.disable=function(){this._isEnabled=!1},e.toggleEnabled=function(){this._isEnabled=!this._isEnabled},e.toggle=function(e){if(this._isEnabled)if(e){var t=this.constructor.DATA_KEY,n=yn(e.currentTarget).data(t);n||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),yn(e.currentTarget).data(t,n)),n._activeTrigger.click=!n._activeTrigger.click,n._isWithActiveTrigger()?n._enter(null,n):n._leave(null,n)}else{if(yn(this.getTipElement()).hasClass(Pn))return void this._leave(null,this);this._enter(null,this)}},e.dispose=function(){clearTimeout(this._timeout),yn.removeData(this.element,this.constructor.DATA_KEY),yn(this.element).off(this.constructor.EVENT_KEY),yn(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&yn(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,(this._activeTrigger=null)!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},e.show=function(){var t=this;if("none"===yn(this.element).css("display"))throw new Error("Please use show on visible elements");var e=yn.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){yn(this.element).trigger(e);var n=yn.contains(this.element.ownerDocument.documentElement,this.element);if(e.isDefaultPrevented()||!n)return;var i=this.getTipElement(),o=we.getUID(this.constructor.NAME);i.setAttribute("id",o),this.element.setAttribute("aria-describedby",o),this.setContent(),this.config.animation&&yn(i).addClass(xn);var r="function"==typeof this.config.placement?this.config.placement.call(this,i,this.element):this.config.placement,a=this._getAttachment(r);this.addAttachmentClass(a);var s=!1===this.config.container?document.body:yn(document).find(this.config.container);yn(i).data(this.constructor.DATA_KEY,this),yn.contains(this.element.ownerDocument.documentElement,this.tip)||yn(i).appendTo(s),yn(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new St(this.element,i,{placement:a,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:Mn},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(e){e.originalPlacement!==e.placement&&t._handlePopperPlacementChange(e)},onUpdate:function(e){t._handlePopperPlacementChange(e)}}),yn(i).addClass(Pn),"ontouchstart"in document.documentElement&&yn(document.body).children().on("mouseover",null,yn.noop);var l=function(){t.config.animation&&t._fixTransition();var e=t._hoverState;t._hoverState=null,yn(t.element).trigger(t.constructor.Event.SHOWN),e===On&&t._leave(null,t)};if(yn(this.tip).hasClass(xn)){var c=we.getTransitionDurationFromElement(this.tip);yn(this.tip).one(we.TRANSITION_END,l).emulateTransitionEnd(c)}else l()}},e.hide=function(e){var t=this,n=this.getTipElement(),i=yn.Event(this.constructor.Event.HIDE),o=function(){t._hoverState!==An&&n.parentNode&&n.parentNode.removeChild(n),t._cleanTipClass(),t.element.removeAttribute("aria-describedby"),yn(t.element).trigger(t.constructor.Event.HIDDEN),null!==t._popper&&t._popper.destroy(),e&&e()};if(yn(this.element).trigger(i),!i.isDefaultPrevented()){if(yn(n).removeClass(Pn),"ontouchstart"in document.documentElement&&yn(document.body).children().off("mouseover",null,yn.noop),this._activeTrigger[Hn]=!1,this._activeTrigger[Fn]=!1,this._activeTrigger[Ln]=!1,yn(this.tip).hasClass(xn)){var r=we.getTransitionDurationFromElement(n);yn(n).one(we.TRANSITION_END,o).emulateTransitionEnd(r)}else o();this._hoverState=""}},e.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},e.isWithContent=function(){return Boolean(this.getTitle())},e.addAttachmentClass=function(e){yn(this.getTipElement()).addClass(Cn+"-"+e)},e.getTipElement=function(){return this.tip=this.tip||yn(this.config.template)[0],this.tip},e.setContent=function(){var e=this.getTipElement();this.setElementContent(yn(e.querySelectorAll(jn)),this.getTitle()),yn(e).removeClass(xn+" "+Pn)},e.setElementContent=function(e,t){var n=this.config.html;"object"==typeof t&&(t.nodeType||t.jquery)?n?yn(t).parent().is(e)||e.empty().append(t):e.text(yn(t).text()):e[n?"html":"text"](t)},e.getTitle=function(){var e=this.element.getAttribute("data-original-title");return e||(e="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),e},e._getAttachment=function(e){return Dn[e.toUpperCase()]},e._setListeners=function(){var i=this;this.config.trigger.split(" ").forEach(function(e){if("click"===e)yn(i.element).on(i.constructor.Event.CLICK,i.config.selector,function(e){return i.toggle(e)});else if(e!==Rn){var t=e===Ln?i.constructor.Event.MOUSEENTER:i.constructor.Event.FOCUSIN,n=e===Ln?i.constructor.Event.MOUSELEAVE:i.constructor.Event.FOCUSOUT;yn(i.element).on(t,i.config.selector,function(e){return i._enter(e)}).on(n,i.config.selector,function(e){return i._leave(e)})}yn(i.element).closest(".modal").on("hide.bs.modal",function(){return i.hide()})}),this.config.selector?this.config=l({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},e._fixTitle=function(){var e=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==e)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},e._enter=function(e,t){var n=this.constructor.DATA_KEY;(t=t||yn(e.currentTarget).data(n))||(t=new this.constructor(e.currentTarget,this._getDelegateConfig()),yn(e.currentTarget).data(n,t)),e&&(t._activeTrigger["focusin"===e.type?Fn:Ln]=!0),yn(t.getTipElement()).hasClass(Pn)||t._hoverState===An?t._hoverState=An:(clearTimeout(t._timeout),t._hoverState=An,t.config.delay&&t.config.delay.show?t._timeout=setTimeout(function(){t._hoverState===An&&t.show()},t.config.delay.show):t.show())},e._leave=function(e,t){var n=this.constructor.DATA_KEY;(t=t||yn(e.currentTarget).data(n))||(t=new this.constructor(e.currentTarget,this._getDelegateConfig()),yn(e.currentTarget).data(n,t)),e&&(t._activeTrigger["focusout"===e.type?Fn:Ln]=!1),t._isWithActiveTrigger()||(clearTimeout(t._timeout),t._hoverState=On,t.config.delay&&t.config.delay.hide?t._timeout=setTimeout(function(){t._hoverState===On&&t.hide()},t.config.delay.hide):t.hide())},e._isWithActiveTrigger=function(){for(var e in this._activeTrigger)if(this._activeTrigger[e])return!0;return!1},e._getConfig=function(e){return"number"==typeof(e=l({},this.constructor.Default,yn(this.element).data(),"object"==typeof e&&e?e:{})).delay&&(e.delay={show:e.delay,hide:e.delay}),"number"==typeof e.title&&(e.title=e.title.toString()),"number"==typeof e.content&&(e.content=e.content.toString()),we.typeCheckConfig(bn,e,this.constructor.DefaultType),e},e._getDelegateConfig=function(){var e={};if(this.config)for(var t in this.config)this.constructor.Default[t]!==this.config[t]&&(e[t]=this.config[t]);return e},e._cleanTipClass=function(){var e=yn(this.getTipElement()),t=e.attr("class").match(kn);null!==t&&t.length&&e.removeClass(t.join(""))},e._handlePopperPlacementChange=function(e){var t=e.instance;this.tip=t.popper,this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(e.placement))},e._fixTransition=function(){var e=this.getTipElement(),t=this.config.animation;null===e.getAttribute("x-placement")&&(yn(e).removeClass(xn),this.config.animation=!1,this.hide(),this.show(),this.config.animation=t)},i._jQueryInterface=function(n){return this.each(function(){var e=yn(this).data(En),t="object"==typeof n&&n;if((e||!/dispose|hide/.test(n))&&(e||(e=new i(this,t),yn(this).data(En,e)),"string"==typeof n)){if(void 0===e[n])throw new TypeError('No method named "'+n+'"');e[n]()}})},a(i,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return In}},{key:"NAME",get:function(){return bn}},{key:"DATA_KEY",get:function(){return En}},{key:"Event",get:function(){return Nn}},{key:"EVENT_KEY",get:function(){return wn}},{key:"DefaultType",get:function(){return Tn}}]),i}(),yn.fn[bn]=Wn._jQueryInterface,yn.fn[bn].Constructor=Wn,yn.fn[bn].noConflict=function(){return yn.fn[bn]=Sn,Wn._jQueryInterface},Wn),$i=(Bn="popover",qn="."+(Qn="bs.popover"),$n=(Un=t).fn[Bn],Kn="bs-popover",Yn=new RegExp("(^|\\s)"+Kn+"\\S+","g"),Vn=l({},qi.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),Jn=l({},qi.DefaultType,{content:"(string|element|function)"}),zn="fade",Zn=".popover-header",Xn=".popover-body",ei={HIDE:"hide"+qn,HIDDEN:"hidden"+qn,SHOW:(Gn="show")+qn,SHOWN:"shown"+qn,INSERTED:"inserted"+qn,CLICK:"click"+qn,FOCUSIN:"focusin"+qn,FOCUSOUT:"focusout"+qn,MOUSEENTER:"mouseenter"+qn,MOUSELEAVE:"mouseleave"+qn},ti=function(e){var t,n;function i(){return e.apply(this,arguments)||this}n=e,(t=i).prototype=Object.create(n.prototype),(t.prototype.constructor=t).__proto__=n;var o=i.prototype;return o.isWithContent=function(){return this.getTitle()||this._getContent()},o.addAttachmentClass=function(e){Un(this.getTipElement()).addClass(Kn+"-"+e)},o.getTipElement=function(){return this.tip=this.tip||Un(this.config.template)[0],this.tip},o.setContent=function(){var e=Un(this.getTipElement());this.setElementContent(e.find(Zn),this.getTitle());var t=this._getContent();"function"==typeof t&&(t=t.call(this.element)),this.setElementContent(e.find(Xn),t),e.removeClass(zn+" "+Gn)},o._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},o._cleanTipClass=function(){var e=Un(this.getTipElement()),t=e.attr("class").match(Yn);null!==t&&0<t.length&&e.removeClass(t.join(""))},i._jQueryInterface=function(n){return this.each(function(){var e=Un(this).data(Qn),t="object"==typeof n?n:null;if((e||!/destroy|hide/.test(n))&&(e||(e=new i(this,t),Un(this).data(Qn,e)),"string"==typeof n)){if(void 0===e[n])throw new TypeError('No method named "'+n+'"');e[n]()}})},a(i,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return Vn}},{key:"NAME",get:function(){return Bn}},{key:"DATA_KEY",get:function(){return Qn}},{key:"Event",get:function(){return ei}},{key:"EVENT_KEY",get:function(){return qn}},{key:"DefaultType",get:function(){return Jn}}]),i}(qi),Un.fn[Bn]=ti._jQueryInterface,Un.fn[Bn].Constructor=ti,Un.fn[Bn].noConflict=function(){return Un.fn[Bn]=$n,ti._jQueryInterface},ti),Ki=(ii="scrollspy",ri="."+(oi="bs.scrollspy"),ai=(ni=t).fn[ii],si={offset:10,method:"auto",target:""},li={offset:"number",method:"string",target:"(string|element)"},ci={ACTIVATE:"activate"+ri,SCROLL:"scroll"+ri,LOAD_DATA_API:"load"+ri+".data-api"},ui="dropdown-item",di="active",hi='[data-spy="scroll"]',fi=".active",pi=".nav, .list-group",mi=".nav-link",gi=".nav-item",_i=".list-group-item",vi=".dropdown",yi=".dropdown-item",bi=".dropdown-toggle",Ei="offset",wi="position",Si=function(){function n(e,t){var n=this;this._element=e,this._scrollElement="BODY"===e.tagName?window:e,this._config=this._getConfig(t),this._selector=this._config.target+" "+mi+","+this._config.target+" "+_i+","+this._config.target+" "+yi,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,ni(this._scrollElement).on(ci.SCROLL,function(e){return n._process(e)}),this.refresh(),this._process()}var e=n.prototype;return e.refresh=function(){var t=this,e=this._scrollElement===this._scrollElement.window?Ei:wi,o="auto"===this._config.method?e:this._config.method,r=o===wi?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),[].slice.call(document.querySelectorAll(this._selector)).map(function(e){var t,n=we.getSelectorFromElement(e);if(n&&(t=document.querySelector(n)),t){var i=t.getBoundingClientRect();if(i.width||i.height)return[ni(t)[o]().top+r,n]}return null}).filter(function(e){return e}).sort(function(e,t){return e[0]-t[0]}).forEach(function(e){t._offsets.push(e[0]),t._targets.push(e[1])})},e.dispose=function(){ni.removeData(this._element,oi),ni(this._scrollElement).off(ri),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},e._getConfig=function(e){if("string"!=typeof(e=l({},si,"object"==typeof e&&e?e:{})).target){var t=ni(e.target).attr("id");t||(t=we.getUID(ii),ni(e.target).attr("id",t)),e.target="#"+t}return we.typeCheckConfig(ii,e,li),e},e._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},e._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},e._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},e._process=function(){var e=this._getScrollTop()+this._config.offset,t=this._getScrollHeight(),n=this._config.offset+t-this._getOffsetHeight();if(this._scrollHeight!==t&&this.refresh(),n<=e){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&e<this._offsets[0]&&0<this._offsets[0])return this._activeTarget=null,void this._clear();for(var o=this._offsets.length;o--;){this._activeTarget!==this._targets[o]&&e>=this._offsets[o]&&(void 0===this._offsets[o+1]||e<this._offsets[o+1])&&this._activate(this._targets[o])}}},e._activate=function(t){this._activeTarget=t,this._clear();var e=this._selector.split(",");e=e.map(function(e){return e+'[data-target="'+t+'"],'+e+'[href="'+t+'"]'});var n=ni([].slice.call(document.querySelectorAll(e.join(","))));n.hasClass(ui)?(n.closest(vi).find(bi).addClass(di),n.addClass(di)):(n.addClass(di),n.parents(pi).prev(mi+", "+_i).addClass(di),n.parents(pi).prev(gi).children(mi).addClass(di)),ni(this._scrollElement).trigger(ci.ACTIVATE,{relatedTarget:t})},e._clear=function(){var e=[].slice.call(document.querySelectorAll(this._selector));ni(e).filter(fi).removeClass(di)},n._jQueryInterface=function(t){return this.each(function(){var e=ni(this).data(oi);if(e||(e=new n(this,"object"==typeof t&&t),ni(this).data(oi,e)),"string"==typeof t){if(void 0===e[t])throw new TypeError('No method named "'+t+'"');e[t]()}})},a(n,null,[{key:"VERSION",get:function(){return"4.1.3"}},{key:"Default",get:function(){return si}}]),n}(),ni(window).on(ci.LOAD_DATA_API,function(){for(var e=[].slice.call(document.querySelectorAll(hi)),t=e.length;t--;){var n=ni(e[t]);Si._jQueryInterface.call(n,n.data())}}),ni.fn[ii]=Si._jQueryInterface,ni.fn[ii].Constructor=Si,ni.fn[ii].noConflict=function(){return ni.fn[ii]=ai,Si._jQueryInterface},Si),Yi=(Ti="."+(ki="bs.tab"),Di=(Ci=t).fn.tab,Ii={HIDE:"hide"+Ti,HIDDEN:"hidden"+Ti,SHOW:"show"+Ti,SHOWN:"shown"+Ti,CLICK_DATA_API:"click"+Ti+".data-api"},Ai="dropdown-menu",Oi="active",Ni="disabled",xi="fade",Pi="show",ji=".dropdown",Mi=".nav, .list-group",Li=".active",Fi="> li > .active",Hi='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',Ri=".dropdown-toggle",Wi="> .dropdown-menu .active",Ui=function(){function i(e){this._element=e}var e=i.prototype;return e.show=function(){var n=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&Ci(this._element).hasClass(Oi)||Ci(this._element).hasClass(Ni))){var e,i,t=Ci(this._element).closest(Mi)[0],o=we.getSelectorFromElement(this._element);if(t){var r="UL"===t.nodeName?Fi:Li;i=(i=Ci.makeArray(Ci(t).find(r)))[i.length-1]}var a=Ci.Event(Ii.HIDE,{relatedTarget:this._element}),s=Ci.Event(Ii.SHOW,{relatedTarget:i});if(i&&Ci(i).trigger(a),Ci(this._element).trigger(s),!s.isDefaultPrevented()&&!a.isDefaultPrevented()){o&&(e=document.querySelector(o)),this._activate(this._element,t);var l=function(){var e=Ci.Event(Ii.HIDDEN,{relatedTarget:n._element}),t=Ci.Event(Ii.SHOWN,{relatedTarget:i});Ci(i).trigger(e),Ci(n._element).trigger(t)};e?this._activate(e,e.parentNode,l):l()}}},e.dispose=function(){Ci.removeData(this._element,ki),this._element=null},e._activate=function(e,t,n){var i=this,o=("UL"===t.nodeName?Ci(t).find(Fi):Ci(t).children(Li))[0],r=n&&o&&Ci(o).hasClass(xi),a=function(){return i._transitionComplete(e,o,n)};if(o&&r){var s=we.getTransitionDurationFromElement(o);Ci(o).one(we.TRANSITION_END,a).emulateTransitionEnd(s)}else a()},e._transitionComplete=function(e,t,n){if(t){Ci(t).removeClass(Pi+" "+Oi);var i=Ci(t.parentNode).find(Wi)[0];i&&Ci(i).removeClass(Oi),"tab"===t.getAttribute("role")&&t.setAttribute("aria-selected",!1)}if(Ci(e).addClass(Oi),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!0),we.reflow(e),Ci(e).addClass(Pi),e.parentNode&&Ci(e.parentNode).hasClass(Ai)){var o=Ci(e).closest(ji)[0];if(o){var r=[].slice.call(o.querySelectorAll(Ri));Ci(r).addClass(Oi)}e.setAttribute("aria-expanded",!0)}n&&n()},i._jQueryInterface=function(n){return this.each(function(){var e=Ci(this),t=e.data(ki);if(t||(t=new i(this),e.data(ki,t)),"string"==typeof n){if(void 0===t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},a(i,null,[{key:"VERSION",get:function(){return"4.1.3"}}]),i}(),Ci(document).on(Ii.CLICK_DATA_API,Hi,function(e){e.preventDefault(),Ui._jQueryInterface.call(Ci(this),"show")}),Ci.fn.tab=Ui._jQueryInterface,Ci.fn.tab.Constructor=Ui,Ci.fn.tab.noConflict=function(){return Ci.fn.tab=Di,Ui._jQueryInterface},Ui);!function(e){if(void 0===e)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var t=e.fn.jquery.split(" ")[0].split(".");if(t[0]<2&&t[1]<9||1===t[0]&&9===t[1]&&t[2]<1||4<=t[0])throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(t),e.Util=we,e.Alert=Se,e.Button=Ce,e.Carousel=ke,e.Collapse=Te,e.Dropdown=Bi,e.Modal=Qi,e.Popover=$i,e.Scrollspy=Ki,e.Tab=Yi,e.Tooltip=qi,Object.defineProperty(e,"__esModule",{value:!0})}),function(e,t){"object"==typeof exports&&"undefined"!=typeof module?t(exports,require("jquery")):"function"==typeof define&&define.amd?define(["exports","jquery"],t):t(e.material={},e.jQuery)}(this,function(e,i){"use strict";i=i&&i.hasOwnProperty("default")?i.default:i;var n,o,t,r,a,s,l,c,u,d,h,f,p,m,g,_,v,y,b=(o="show-predecessor",t="hide"+".bs.collapse",r="show"+".bs.collapse",a=".expansion-panel",s=".expansion-panel .collapse",void(n=i)(document).on(""+t,s,function(){var e=n(this).closest(a);e.removeClass("show");var t=e.prev(a);t.length&&t.removeClass(o)}).on(""+r,s,function(){var e=n(this).closest(a);e.addClass("show");var t=e.prev(a);t.length&&t.addClass(o)})),E=(u="."+(c="md.floatinglabel"),d="floatinglabel",h=(l=i).fn[d],f="is-focused",p="has-value",m="change"+u,g="focusin"+u,_="focusout"+u,v={DATA_PARENT:".floating-label",DATA_TOGGLE:".floating-label .custom-select, .floating-label .form-control"},y=function(){function i(e){this._element=e,this._parent=l(e).closest(v.DATA_PARENT)[0]}var e=i.prototype;return e.change=function(){l(this._element).val()||l(this._element).is("select")&&""!==l("option:first-child",l(this._element)).html().replace(" ","")?l(this._parent).addClass(p):l(this._parent).removeClass(p)},e.focusin=function(){l(this._parent).addClass(f)},e.focusout=function(){l(this._parent).removeClass(f)},i._jQueryInterface=function(n){return this.each(function(){var e=n||"change",t=l(this).data(c);if(t||(t=new i(this),l(this).data(c,t)),"string"==typeof e){if(void 0===t[e])throw new Error('No method named "'+e+'"');t[e]()}})},i}(),l(document).on(m+" "+g+" "+_,v.DATA_TOGGLE,function(e){y._jQueryInterface.call(l(this),e.type)}),l.fn[d]=y._jQueryInterface,l.fn[d].Constructor=y,l.fn[d].noConflict=function(){return l.fn[d]=h,y._jQueryInterface},y);function w(e,t){for(var n=0;n<t.length;n++){var i=t[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(e,i.key,i)}}function S(o){for(var e=1;e<arguments.length;e++){var r=null!=arguments[e]?arguments[e]:{},t=Object.keys(r);"function"==typeof Object.getOwnPropertySymbols&&(t=t.concat(Object.getOwnPropertySymbols(r).filter(function(e){return Object.getOwnPropertyDescriptor(r,e).enumerable}))),t.forEach(function(e){var t,n,i;t=o,i=r[n=e],n in t?Object.defineProperty(t,n,{value:i,enumerable:!0,configurable:!0,writable:!0}):t[n]=i})}return o}var C,k,T,D,I,A,O,N,x,P,j,M,L,F,H,R,W=(H="transitionend",R={TRANSITION_END:"mdTransitionEnd",getSelectorFromElement:function(e){var t=e.getAttribute("data-target");t&&"#"!==t||(t=e.getAttribute("href")||"");try{return 0<F(document).find(t).length?t:null}catch(e){return null}},getTransitionDurationFromElement:function(e){if(!e)return 0;var t=F(e).css("transition-duration");return t?(t=t.split(",")[0],1e3*parseFloat(t)):0},getUID:function(e){for(;e+=~~(1e6*Math.random()),document.getElementById(e););return e},isElement:function(e){return(e[0]||e).nodeType},reflow:function(e){return e.offsetHeight},supportsTransitionEnd:function(){return Boolean(H)},triggerTransitionEnd:function(e){F(e).trigger(H)},typeCheckConfig:function(e,t,n){for(var i in n)if(Object.prototype.hasOwnProperty.call(n,i)){var o=n[i],r=t[i],a=r&&R.isElement(r)?"element":(s=r,{}.toString.call(s).match(/\s([a-z]+)/i)[1].toLowerCase());if(!new RegExp(o).test(a))throw new Error(e.toUpperCase()+': Option "'+i+'" provided type "'+a+'" but expected type "'+o+'".')}var s}},(F=i).fn.emulateTransitionEnd=function(e){var t=this,n=!1;return F(this).one(R.TRANSITION_END,function(){n=!0}),setTimeout(function(){n||R.triggerTransitionEnd(t)},e),this},F.event.special[R.TRANSITION_END]={bindType:H,delegateType:H,handle:function(e){if(F(e.target).is(this))return e.handleObj.handler.apply(this,arguments)}},R),U=(T="."+(k="md.navdrawer"),D="navdrawer",I=(C=i).fn[D],A="navdrawer-backdrop",O="navdrawer-open",x={breakpoint:"",keyboard:!0,show:!0,type:"default"},P={keyboard:"boolean",show:"boolean",type:"string"},j={CLICK_DATA_API:"click"+T+".data-api",CLICK_DISMISS:"click.dismiss"+T,FOCUSIN:"focusin"+T,HIDDEN:"hidden"+T,HIDE:"hide"+T,KEYDOWN_DISMISS:"keydown.dismiss"+T,MOUSEDOWN_DISMISS:"mousedown.dismiss"+T,MOUSEUP_DISMISS:"mouseup.dismiss"+T,SHOW:(N="show")+T,SHOWN:"shown"+T},M={CONTENT:".navdrawer-content",DATA_DISMISS:'[data-dismiss="navdrawer"]',DATA_TOGGLE:'[data-toggle="navdrawer"]'},L=function(){function o(e,t){this._backdrop=null,this._config=this._getConfig(t),this._content=C(e).find(M.CONTENT)[0],this._element=e,this._ignoreBackdropClick=!1,this._isShown=!1,this._typeBreakpoint=""===this._config.breakpoint?"":"-"+this._config.breakpoint}var e,t,n=o.prototype;return n.hide=function(e){var t=this;if(e&&e.preventDefault(),!this._isTransitioning&&this._isShown){var n=C.Event(j.HIDE);if(C(this._element).trigger(n),this._isShown&&!n.isDefaultPrevented()){this._isShown=!1,this._isTransitioning=!0,this._setEscapeEvent(),C(document).off(j.FOCUSIN),C(document.body).removeClass(O+"-"+this._config.type+this._typeBreakpoint),C(this._element).removeClass(N),C(this._element).off(j.CLICK_DISMISS),C(this._content).off(j.MOUSEDOWN_DISMISS);var i=W.getTransitionDurationFromElement(this._content);C(this._content).one(W.TRANSITION_END,function(e){return t._hideNavdrawer(e)}).emulateTransitionEnd(i),this._showBackdrop()}}},n.show=function(e){var t=this;if(!this._isTransitioning&&!this._isShown){this._isTransitioning=!0;var n=C.Event(j.SHOW,{relatedTarget:e});C(this._element).trigger(n),this._isShown||n.isDefaultPrevented()||(this._isShown=!0,this._setEscapeEvent(),C(this._element).addClass(D+"-"+this._config.type+this._typeBreakpoint),C(this._element).on(j.CLICK_DISMISS,M.DATA_DISMISS,function(e){return t.hide(e)}),C(this._content).on(j.MOUSEDOWN_DISMISS,function(){C(t._element).one(j.MOUSEUP_DISMISS,function(e){C(e.target).is(t._element)&&(t._ignoreBackdropClick=!0)})}),this._showBackdrop(),this._showElement(e))}},n.toggle=function(e){return this._isShown?this.hide():this.show(e)},n._enforceFocus=function(){var t=this;C(document).off(j.FOCUSIN).on(j.FOCUSIN,function(e){document!==e.target&&t._element!==e.target&&0===C(t._element).has(e.target).length&&t._element.focus()})},n._getConfig=function(e){return e=S({},x,e),W.typeCheckConfig(D,e,P),e},n._hideNavdrawer=function(){this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,C(this._element).trigger(j.HIDDEN)},n._removeBackdrop=function(){this._backdrop&&(C(this._backdrop).remove(),this._backdrop=null)},n._setEscapeEvent=function(){var t=this;this._isShown&&this._config.keyboard?C(this._element).on(j.KEYDOWN_DISMISS,function(e){27===e.which&&(e.preventDefault(),t.hide())}):this._isShown||C(this._element).off(j.KEYDOWN_DISMISS)},n._showBackdrop=function(){var t=this;this._isShown?(this._backdrop=document.createElement("div"),C(this._backdrop).addClass(A).addClass(A+"-"+this._config.type+this._typeBreakpoint).appendTo(document.body),C(this._element).on(j.CLICK_DISMISS,function(e){t._ignoreBackdropClick?t._ignoreBackdropClick=!1:e.target===e.currentTarget&&t.hide()}),W.reflow(this._backdrop),C(this._backdrop).addClass(N)):!this._isShown&&this._backdrop&&(C(this._backdrop).removeClass(N),this._removeBackdrop())},n._showElement=function(e){var t=this;this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),W.reflow(this._element),C(document.body).addClass(O+"-"+this._config.type+this._typeBreakpoint),C(this._element).addClass(N),this._enforceFocus();var n=C.Event(j.SHOWN,{relatedTarget:e}),i=W.getTransitionDurationFromElement(this._content);C(this._content).one(W.TRANSITION_END,function(){t._element.focus(),t._isTransitioning=!1,C(t._element).trigger(n)}).emulateTransitionEnd(i)},o._jQueryInterface=function(n,i){return this.each(function(){var e=S({},x,C(this).data(),"object"==typeof n&&n?n:{}),t=C(this).data(k);if(t||(t=new o(this,e),C(this).data(k,t)),"string"==typeof n){if(void 0===t[n])throw new TypeError('No method named "'+n+'"');t[n](i)}else e.show&&t.show(i)})},e=o,t=[{key:"Default",get:function(){return x}}],null&&w(e.prototype,null),w(e,t),o}(),C(document).on(j.CLICK_DATA_API,M.DATA_TOGGLE,function(e){var t,n=this,i=W.getSelectorFromElement(this);i&&(t=C(i)[0]);var o=C(t).data(k)?"toggle":S({},C(t).data(),C(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||e.preventDefault();var r=C(t).one(j.SHOW,function(e){e.isDefaultPrevented()||r.one(j.HIDDEN,function(){C(n).is(":visible")&&n.focus()})});L._jQueryInterface.call(C(t),o,this)}),C.fn[D]=L._jQueryInterface,C.fn[D].Constructor=L,C.fn[D].noConflict=function(){return C.fn[D]=I,L._jQueryInterface},L);function B(e,t){return e(t={exports:{}},t.exports),t.exports}var Q,q,$,K,Y,V,J,z,G,Z,X,ee,te,ne,ie,oe,re,ae,se,le,ce,ue=B(function(e,t){var n;n=function(g){var i=g(window),_=g(document),v=g(document.documentElement),y=null!=document.documentElement.style.transition;function b(o,r,a,e){if(!o)return b;var s=!1,l={id:o.id||"P"+Math.abs(~~(Math.random()*new Date))},c=a?g.extend(!0,{},a.defaults,e):e||{},u=g.extend({},b.klasses(),c.klass),d=g(o),t=function(){return this.start()},h=t.prototype={constructor:t,$node:d,start:function(){return l&&l.start?h:(l.methods={},l.start=!0,l.open=!1,l.type=o.type,o.autofocus=o==S(),o.readOnly=!c.editable,o.id=o.id||l.id,"text"!=o.type&&(o.type="text"),h.component=new a(h,c),h.$root=g('<div class="'+u.picker+'" id="'+o.id+'_root" />'),w(h.$root[0],"hidden",!0),h.$holder=g(f()).appendTo(h.$root),p(),c.formatSubmit&&(!0===c.hiddenName?(i=o.name,o.name=""):i=(i=["string"==typeof c.hiddenPrefix?c.hiddenPrefix:"","string"==typeof c.hiddenSuffix?c.hiddenSuffix:"_submit"])[0]+o.name+i[1],h._hidden=g('<input type=hidden name="'+i+'"'+(d.data("value")||o.value?' value="'+h.get("select",c.formatSubmit)+'"':"")+">")[0],d.on("change."+l.id,function(){h._hidden.value=o.value?h.get("select",c.formatSubmit):""})),d.data(r,h).addClass(u.input).val(d.data("value")?h.get("select",c.format):o.value),c.editable||d.on("focus."+l.id+" click."+l.id,function(e){e.preventDefault(),h.open()}).on("keydown."+l.id,m),w(o,{haspopup:!0,expanded:!1,readonly:!1,owns:o.id+"_root"}),c.containerHidden?g(c.containerHidden).append(h._hidden):d.after(h._hidden),c.container?g(c.container).append(h.$root):d.after(h.$root),h.on({start:h.component.onStart,render:h.component.onRender,stop:h.component.onStop,open:h.component.onOpen,close:h.component.onClose,set:h.component.onSet}).on({start:c.onStart,render:c.onRender,stop:c.onStop,open:c.onOpen,close:c.onClose,set:c.onSet}),e=h.$holder[0],n="position",e.currentStyle?t=e.currentStyle[n]:window.getComputedStyle&&(t=getComputedStyle(e)[n]),s="fixed"==t,o.autofocus&&h.open(),h.trigger("start").trigger("render"));var e,t,n,i},render:function(e){return e?(h.$holder=g(f()),p(),h.$root.html(h.$holder)):h.$root.find("."+u.box).html(h.component.nodes(l.open)),h.trigger("render")},stop:function(){return l.start&&(h.close(),h._hidden&&h._hidden.parentNode.removeChild(h._hidden),h.$root.remove(),d.removeClass(u.input).removeData(r),setTimeout(function(){d.off("."+l.id)},0),o.type=l.type,o.readOnly=!1,h.trigger("stop"),l.methods={},l.start=!1),h},open:function(e){return l.open?h:(d.addClass(u.active),w(o,"expanded",!0),setTimeout(function(){h.$root.addClass(u.opened),w(h.$root[0],"hidden",!1)},0),!1!==e&&(l.open=!0,s&&v.css("overflow","hidden").css("padding-right","+="+E()),s&&y?h.$holder.find("."+u.frame).one("transitionend",function(){h.$holder[0].focus()}):h.$holder[0].focus(),_.on("click."+l.id+" focusin."+l.id,function(e){var t=e.target;t!=o&&t!=document&&3!=e.which&&h.close(t===h.$holder[0])}).on("keydown."+l.id,function(e){var t=e.keyCode,n=h.component.key[t],i=e.target;27==t?h.close(!0):i!=h.$holder[0]||!n&&13!=t?g.contains(h.$root[0],i)&&13==t&&(e.preventDefault(),i.click()):(e.preventDefault(),n?b._.trigger(h.component.key.go,h,[b._.trigger(n)]):h.$root.find("."+u.highlighted).hasClass(u.disabled)||(h.set("select",h.component.item.highlight),c.closeOnSelect&&h.close(!0)))})),h.trigger("open"))},close:function(e){return e&&(c.editable?o.focus():(h.$holder.off("focus.toOpen").focus(),setTimeout(function(){h.$holder.on("focus.toOpen",n)},0))),d.removeClass(u.active),w(o,"expanded",!1),setTimeout(function(){h.$root.removeClass(u.opened+" "+u.focused),w(h.$root[0],"hidden",!0)},0),l.open?(l.open=!1,s&&v.css("overflow","").css("padding-right","-="+E()),_.off("."+l.id),h.trigger("close")):h},clear:function(e){return h.set("clear",null,e)},set:function(e,t,n){var i,o,r=g.isPlainObject(e),a=r?e:{};if(n=r&&g.isPlainObject(t)?t:n||{},e){for(i in r||(a[e]=t),a)o=a[i],i in h.component.item&&(void 0===o&&(o=null),h.component.set(i,o,n)),"select"!=i&&"clear"!=i||d.val("clear"==i?"":h.get(i,c.format)).trigger("change");h.render()}return n.muted?h:h.trigger("set",a)},get:function(e,t){if(null!=l[e=e||"value"])return l[e];if("valueSubmit"==e){if(h._hidden)return h._hidden.value;e="value"}if("value"==e)return o.value;if(e in h.component.item){if("string"!=typeof t)return h.component.get(e);var n=h.component.get(e);return n?b._.trigger(h.component.formats.toString,h.component,[t,n]):""}},on:function(e,t,n){var i,o,r=g.isPlainObject(e),a=r?e:{};if(e)for(i in r||(a[e]=t),a)o=a[i],n&&(i="_"+i),l.methods[i]=l.methods[i]||[],l.methods[i].push(o);return h},off:function(){var e,t,n=arguments;for(e=0,namesCount=n.length;e<namesCount;e+=1)(t=n[e])in l.methods&&delete l.methods[t];return h},trigger:function(e,n){var t=function(e){var t=l.methods[e];t&&t.map(function(e){b._.trigger(e,h,[n])})};return t("_"+e),t(e),h}};function f(){return b._.node("div",b._.node("div",b._.node("div",b._.node("div",h.component.nodes(l.open),u.box),u.wrap),u.frame),u.holder,'tabindex="-1"')}function p(){h.$holder.on({keydown:m,"focus.toOpen":n,blur:function(){d.removeClass(u.target)},focusin:function(e){h.$root.removeClass(u.focused),e.stopPropagation()},"mousedown click":function(e){var t=e.target;t!=h.$holder[0]&&(e.stopPropagation(),"mousedown"!=e.type||g(t).is("input, select, textarea, button, option")||(e.preventDefault(),h.$holder[0].focus()))}}).on("click","[data-pick], [data-nav], [data-clear], [data-close]",function(){var e=g(this),t=e.data(),n=e.hasClass(u.navDisabled)||e.hasClass(u.disabled),i=S();i=i&&(i.type||i.href),(n||i&&!g.contains(h.$root[0],i))&&h.$holder[0].focus(),!n&&t.nav?h.set("highlight",h.component.item.highlight,{nav:t.nav}):!n&&"pick"in t?(h.set("select",t.pick),c.closeOnSelect&&h.close(!0)):t.clear?(h.clear(),c.closeOnClear&&h.close(!0)):t.close&&h.close(!0)})}function n(e){e.stopPropagation(),d.addClass(u.target),h.$root.addClass(u.focused),h.open()}function m(e){var t=e.keyCode,n=/^(8|46)$/.test(t);if(27==t)return h.close(!0),!1;(32==t||n||!l.open&&h.component.key[t])&&(e.preventDefault(),e.stopPropagation(),n?h.clear().close():h.open())}return new t}function E(){if(v.height()<=i.height())return 0;var e=g('<div style="visibility:hidden;width:100px" />').appendTo("body"),t=e[0].offsetWidth;e.css("overflow","scroll");var n=g('<div style="width:100%" />').appendTo(e)[0].offsetWidth;return e.remove(),t-n}function w(e,t,n){if(g.isPlainObject(t))for(var i in t)o(e,i,t[i]);else o(e,t,n)}function o(e,t,n){e.setAttribute(("role"==t?"":"aria-")+t,n)}function S(){try{return document.activeElement}catch(e){}}return b.klasses=function(e){return{picker:e=e||"picker",opened:e+"--opened",focused:e+"--focused",input:e+"__input",active:e+"__input--active",target:e+"__input--target",holder:e+"__holder",frame:e+"__frame",wrap:e+"__wrap",box:e+"__box"}},b._={group:function(e){for(var t,n="",i=b._.trigger(e.min,e);i<=b._.trigger(e.max,e,[i]);i+=e.i)t=b._.trigger(e.item,e,[i]),n+=b._.node(e.node,t[0],t[1],t[2]);return n},node:function(e,t,n,i){return t?"<"+e+(n=n?' class="'+n+'"':"")+(i=i?" "+i:"")+">"+(t=g.isArray(t)?t.join(""):t)+"</"+e+">":""},lead:function(e){return(e<10?"0":"")+e},trigger:function(e,t,n){return"function"==typeof e?e.apply(t,n||[]):e},digits:function(e){return/\d/.test(e[1])?2:1},isDate:function(e){return-1<{}.toString.call(e).indexOf("Date")&&this.isInteger(e.getDate())},isInteger:function(e){return-1<{}.toString.call(e).indexOf("Number")&&e%1==0},ariaAttr:function(e,t){for(var n in g.isPlainObject(e)||(e={attribute:t}),t="",e){var i=("role"==n?"":"aria-")+n;t+=null==e[n]?"":i+'="'+e[n]+'"'}return t}},b.extend=function(i,o){g.fn[i]=function(e,t){var n=this.data(i);return"picker"==e?n:n&&"string"==typeof e?b._.trigger(n[e],n,[t]):this.each(function(){g(this).data(i)||new b(this,i,o,e)})},g.fn[i].defaults=o.defaults},b},e.exports=n(i)}),de=Object.freeze({default:ue,__moduleExports:ue}),he=de&&ue||de,fe=(B(function(e,t){var n;n=function(e,p){var t,_=e._;function n(t,n){var e,i=this,o=t.$node[0],r=o.value,a=t.$node.data("value"),s=a||r,l=a?n.formatSubmit:n.format,c=function(){return o.currentStyle?"rtl"==o.currentStyle.direction:"rtl"==getComputedStyle(t.$root[0]).direction};i.settings=n,i.$node=t.$node,i.queue={min:"measure create",max:"measure create",now:"now create",select:"parse create validate",highlight:"parse navigate create validate",view:"parse create validate viewset",disable:"deactivate",enable:"activate"},i.item={},i.item.clear=null,i.item.disable=(n.disable||[]).slice(0),i.item.enable=-(!0===(e=i.item.disable)[0]?e.shift():-1),i.set("min",n.min).set("max",n.max).set("now"),s?i.set("select",s,{format:l,defaultValue:!0}):i.set("select",null).set("highlight",i.item.now),i.key={40:7,38:-7,39:function(){return c()?-1:1},37:function(){return c()?1:-1},go:function(e){var t=i.item.highlight,n=new Date(t.year,t.month,t.date+e);i.set("highlight",n,{interval:e}),this.render()}},t.on("render",function(){t.$root.find("."+n.klass.selectMonth).on("change",function(){var e=this.value;e&&(t.set("highlight",[t.get("view").year,e,t.get("highlight").date]),t.$root.find("."+n.klass.selectMonth).trigger("focus"))}),t.$root.find("."+n.klass.selectYear).on("change",function(){var e=this.value;e&&(t.set("highlight",[e,t.get("view").month,t.get("highlight").date]),t.$root.find("."+n.klass.selectYear).trigger("focus"))})},1).on("open",function(){var e="";i.disabled(i.get("now"))&&(e=":not(."+n.klass.buttonToday+")"),t.$root.find("button"+e+", select").attr("disabled",!1)},1).on("close",function(){t.$root.find("button, select").attr("disabled",!0)},1)}n.prototype.set=function(t,n,i){var o=this,e=o.item;return null===n?("clear"==t&&(t="select"),e[t]=n):(e["enable"==t?"disable":"flip"==t?"enable":t]=o.queue[t].split(" ").map(function(e){return n=o[e](t,n,i)}).pop(),"select"==t?o.set("highlight",e.select,i):"highlight"==t?o.set("view",e.highlight,i):t.match(/^(flip|min|max|disable|enable)$/)&&(e.select&&o.disabled(e.select)&&o.set("select",e.select,i),e.highlight&&o.disabled(e.highlight)&&o.set("highlight",e.highlight,i))),o},n.prototype.get=function(e){return this.item[e]},n.prototype.create=function(e,t,n){var i;return(t=void 0===t?e:t)==-1/0||t==1/0?i=t:t=p.isPlainObject(t)&&_.isInteger(t.pick)?t.obj:p.isArray(t)?(t=new Date(t[0],t[1],t[2]),_.isDate(t)?t:this.create().obj):_.isInteger(t)||_.isDate(t)?this.normalize(new Date(t),n):this.now(e,t,n),{year:i||t.getFullYear(),month:i||t.getMonth(),date:i||t.getDate(),day:i||t.getDay(),obj:i||t,pick:i||t.getTime()}},n.prototype.createRange=function(e,t){var n=this,i=function(e){return!0===e||p.isArray(e)||_.isDate(e)?n.create(e):e};return _.isInteger(e)||(e=i(e)),_.isInteger(t)||(t=i(t)),_.isInteger(e)&&p.isPlainObject(t)?e=[t.year,t.month,t.date+e]:_.isInteger(t)&&p.isPlainObject(e)&&(t=[e.year,e.month,e.date+t]),{from:i(e),to:i(t)}},n.prototype.withinRange=function(e,t){return e=this.createRange(e.from,e.to),t.pick>=e.from.pick&&t.pick<=e.to.pick},n.prototype.overlapRanges=function(e,t){var n=this;return e=n.createRange(e.from,e.to),t=n.createRange(t.from,t.to),n.withinRange(e,t.from)||n.withinRange(e,t.to)||n.withinRange(t,e.from)||n.withinRange(t,e.to)},n.prototype.now=function(e,t,n){return t=new Date,n&&n.rel&&t.setDate(t.getDate()+n.rel),this.normalize(t,n)},n.prototype.navigate=function(e,t,n){var i,o,r,a,s=p.isArray(t),l=p.isPlainObject(t),c=this.item.view;if(s||l){for(a=l?(o=t.year,r=t.month,t.date):(o=+t[0],r=+t[1],+t[2]),n&&n.nav&&c&&c.month!==r&&(o=c.year,r=c.month),o=(i=new Date(o,r+(n&&n.nav?n.nav:0),1)).getFullYear(),r=i.getMonth();new Date(o,r,a).getMonth()!==r;)a-=1;t=[o,r,a]}return t},n.prototype.normalize=function(e){return e.setHours(0,0,0,0),e},n.prototype.measure=function(e,t){return t?"string"==typeof t?t=this.parse(e,t):_.isInteger(t)&&(t=this.now(e,t,{rel:t})):t="min"==e?-1/0:1/0,t},n.prototype.viewset=function(e,t){return this.create([t.year,t.month,1])},n.prototype.validate=function(e,n,t){var i,o,r,a,s=this,l=n,c=t&&t.interval?t.interval:1,u=-1===s.item.enable,d=s.item.min,h=s.item.max,f=u&&s.item.disable.filter(function(e){if(p.isArray(e)){var t=s.create(e).pick;t<n.pick?i=!0:t>n.pick&&(o=!0)}return _.isInteger(e)}).length;if((!t||!t.nav&&!t.defaultValue)&&(!u&&s.disabled(n)||u&&s.disabled(n)&&(f||i||o)||!u&&(n.pick<=d.pick||n.pick>=h.pick)))for(u&&!f&&(!o&&0<c||!i&&c<0)&&(c*=-1);s.disabled(n)&&(1<Math.abs(c)&&(n.month<l.month||n.month>l.month)&&(n=l,c=0<c?1:-1),n.pick<=d.pick?(r=!0,c=1,n=s.create([d.year,d.month,d.date+(n.pick===d.pick?0:-1)])):n.pick>=h.pick&&(a=!0,c=-1,n=s.create([h.year,h.month,h.date+(n.pick===h.pick?0:1)])),!r||!a);)n=s.create([n.year,n.month,n.date+c]);return n},n.prototype.disabled=function(t){var n=this,e=n.item.disable.filter(function(e){return _.isInteger(e)?t.day===(n.settings.firstDay?e:e-1)%7:p.isArray(e)||_.isDate(e)?t.pick===n.create(e).pick:p.isPlainObject(e)?n.withinRange(e,t):void 0});return e=e.length&&!e.filter(function(e){return p.isArray(e)&&"inverted"==e[3]||p.isPlainObject(e)&&e.inverted}).length,-1===n.item.enable?!e:e||t.pick<n.item.min.pick||t.pick>n.item.max.pick},n.prototype.parse=function(e,i,t){var o=this,r={};return i&&"string"==typeof i?(t&&t.format||((t=t||{}).format=o.settings.format),o.formats.toArray(t.format).map(function(e){var t=o.formats[e],n=t?_.trigger(t,o,[i,r]):e.replace(/^!/,"").length;t&&(r[e]=i.substr(0,n)),i=i.substr(n)}),[r.yyyy||r.yy,+(r.mm||r.m)-1,r.dd||r.d]):i},n.prototype.formats=function(){function i(e,t,n){var i=e.match(/[^\x00-\x7F]+|\w+/)[0];return n.mm||n.m||(n.m=t.indexOf(i)+1),i.length}function n(e){return e.match(/\w+/)[0].length}return{d:function(e,t){return e?_.digits(e):t.date},dd:function(e,t){return e?2:_.lead(t.date)},ddd:function(e,t){return e?n(e):this.settings.weekdaysShort[t.day]},dddd:function(e,t){return e?n(e):this.settings.weekdaysFull[t.day]},m:function(e,t){return e?_.digits(e):t.month+1},mm:function(e,t){return e?2:_.lead(t.month+1)},mmm:function(e,t){var n=this.settings.monthsShort;return e?i(e,n,t):n[t.month]},mmmm:function(e,t){var n=this.settings.monthsFull;return e?i(e,n,t):n[t.month]},yy:function(e,t){return e?2:(""+t.year).slice(2)},yyyy:function(e,t){return e?4:t.year},toArray:function(e){return e.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)},toString:function(e,t){var n=this;return n.formats.toArray(e).map(function(e){return _.trigger(n.formats[e],n,[0,t])||e.replace(/^!/,"")}).join("")}}}(),n.prototype.isDateExact=function(e,t){return _.isInteger(e)&&_.isInteger(t)||"boolean"==typeof e&&"boolean"==typeof t?e===t:(_.isDate(e)||p.isArray(e))&&(_.isDate(t)||p.isArray(t))?this.create(e).pick===this.create(t).pick:!(!p.isPlainObject(e)||!p.isPlainObject(t))&&this.isDateExact(e.from,t.from)&&this.isDateExact(e.to,t.to)},n.prototype.isDateOverlap=function(e,t){var n=this.settings.firstDay?1:0;return _.isInteger(e)&&(_.isDate(t)||p.isArray(t))?(e=e%7+n)===this.create(t).day+1:_.isInteger(t)&&(_.isDate(e)||p.isArray(e))?(t=t%7+n)===this.create(e).day+1:!(!p.isPlainObject(e)||!p.isPlainObject(t))&&this.overlapRanges(e,t)},n.prototype.flipEnable=function(e){var t=this.item;t.enable=e||(-1==t.enable?1:-1)},n.prototype.deactivate=function(e,t){var i=this,o=i.item.disable.slice(0);return"flip"==t?i.flipEnable():!1===t?(i.flipEnable(1),o=[]):!0===t?(i.flipEnable(-1),o=[]):t.map(function(e){for(var t,n=0;n<o.length;n+=1)if(i.isDateExact(e,o[n])){t=!0;break}t||(_.isInteger(e)||_.isDate(e)||p.isArray(e)||p.isPlainObject(e)&&e.from&&e.to)&&o.push(e)}),o},n.prototype.activate=function(e,t){var r=this,a=r.item.disable,s=a.length;return"flip"==t?r.flipEnable():!0===t?(r.flipEnable(1),a=[]):!1===t?(r.flipEnable(-1),a=[]):t.map(function(e){var t,n,i,o;for(i=0;i<s;i+=1){if(n=a[i],r.isDateExact(n,e)){t=a[i]=null,o=!0;break}if(r.isDateOverlap(n,e)){p.isPlainObject(e)?(e.inverted=!0,t=e):p.isArray(e)?(t=e)[3]||t.push("inverted"):_.isDate(e)&&(t=[e.getFullYear(),e.getMonth(),e.getDate(),"inverted"]);break}}if(t)for(i=0;i<s;i+=1)if(r.isDateExact(a[i],e)){a[i]=null;break}if(o)for(i=0;i<s;i+=1)if(r.isDateOverlap(a[i],e)){a[i]=null;break}t&&a.push(t)}),a.filter(function(e){return null!=e})},n.prototype.nodes=function(l){var t,n,c=this,u=c.settings,e=c.item,a=e.now,s=e.select,d=e.highlight,h=e.view,f=e.disable,p=e.min,m=e.max,i=(t=(u.showWeekdaysFull?u.weekdaysFull:u.weekdaysShort).slice(0),n=u.weekdaysFull.slice(0),u.firstDay&&(t.push(t.shift()),n.push(n.shift())),_.node("thead",_.node("tr",_.group({min:0,max:6,i:1,node:"th",item:function(e){return[t[e],u.klass.weekdays,'scope=col title="'+n[e]+'"']}})))),o=function(e){return _.node("div"," ",u.klass["nav"+(e?"Next":"Prev")]+(e&&h.year>=m.year&&h.month>=m.month||!e&&h.year<=p.year&&h.month<=p.month?" "+u.klass.navDisabled:""),"data-nav="+(e||-1)+" "+_.ariaAttr({role:"button",controls:c.$node[0].id+"_table"})+' title="'+(e?u.labelMonthNext:u.labelMonthPrev)+'"')},r=function(){var t=u.showMonthsShort?u.monthsShort:u.monthsFull;return u.selectMonths?_.node("select",_.group({min:0,max:11,i:1,node:"option",item:function(e){return[t[e],0,"value="+e+(h.month==e?" selected":"")+(h.year==p.year&&e<p.month||h.year==m.year&&e>m.month?" disabled":"")]}}),u.klass.selectMonth,(l?"":"disabled")+" "+_.ariaAttr({controls:c.$node[0].id+"_table"})+' title="'+u.labelMonthSelect+'"'):_.node("div",t[h.month],u.klass.month)},g=function(){var t=h.year,e=!0===u.selectYears?5:~~(u.selectYears/2);if(e){var n=p.year,i=m.year,o=t-e,r=t+e;if(o<n&&(r+=n-o,o=n),i<r){var a=o-n,s=r-i;o-=s<a?s:a,r=i}return _.node("select",_.group({min:o,max:r,i:1,node:"option",item:function(e){return[e,0,"value="+e+(t==e?" selected":"")]}}),u.klass.selectYear,(l?"":"disabled")+" "+_.ariaAttr({controls:c.$node[0].id+"_table"})+' title="'+u.labelYearSelect+'"')}return _.node("div",t,u.klass.year)};return _.node("div",(u.selectYears?g()+r():r()+g())+o()+o(1),u.klass.header)+_.node("table",i+_.node("tbody",_.group({min:0,max:5,i:1,node:"tr",item:function(e){var t=u.firstDay&&0===c.create([h.year,h.month,1]).day?-7:0;return[_.group({min:7*e-h.day+t+1,max:function(){return this.min+7-1},i:1,node:"td",item:function(e){e=c.create([h.year,h.month,e+(u.firstDay?1:0)]);var t,n=s&&s.pick==e.pick,i=d&&d.pick==e.pick,o=f&&c.disabled(e)||e.pick<p.pick||e.pick>m.pick,r=_.trigger(c.formats.toString,c,[u.format,e]);return[_.node("div",e.date,(t=[u.klass.day],t.push(h.month==e.month?u.klass.infocus:u.klass.outfocus),a.pick==e.pick&&t.push(u.klass.now),n&&t.push(u.klass.selected),i&&t.push(u.klass.highlighted),o&&t.push(u.klass.disabled),t.join(" ")),"data-pick="+e.pick+" "+_.ariaAttr({role:"gridcell",label:r,selected:!(!n||c.$node.val()!==r)||null,activedescendant:!!i||null,disabled:!!o||null})),"",_.ariaAttr({role:"presentation"})]}})]}})),u.klass.table,'id="'+c.$node[0].id+'_table" '+_.ariaAttr({role:"grid",controls:c.$node[0].id,readonly:!0}))+_.node("div",_.node("button",u.today,u.klass.buttonToday,"type=button data-pick="+a.pick+(l&&!c.disabled(a)?"":" disabled")+" "+_.ariaAttr({controls:c.$node[0].id}))+_.node("button",u.clear,u.klass.buttonClear,"type=button data-clear=1"+(l?"":" disabled")+" "+_.ariaAttr({controls:c.$node[0].id}))+_.node("button",u.close,u.klass.buttonClose,"type=button data-close=true "+(l?"":" disabled")+" "+_.ariaAttr({controls:c.$node[0].id})),u.klass.footer)},n.defaults={labelMonthNext:"Next month",labelMonthPrev:"Previous month",labelMonthSelect:"Select a month",labelYearSelect:"Select a year",monthsFull:["January","February","March","April","May","June","July","August","September","October","November","December"],monthsShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],weekdaysFull:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],weekdaysShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],today:"Today",clear:"Clear",close:"Close",closeOnSelect:!0,closeOnClear:!0,format:"d mmmm, yyyy",klass:{table:(t=e.klasses().picker+"__")+"table",header:t+"header",navPrev:t+"nav--prev",navNext:t+"nav--next",navDisabled:t+"nav--disabled",month:t+"month",year:t+"year",selectMonth:t+"select--month",selectYear:t+"select--year",weekdays:t+"weekday",day:t+"day",disabled:t+"day--disabled",selected:t+"day--selected",highlighted:t+"day--highlighted",now:t+"day--today",infocus:t+"day--infocus",outfocus:t+"day--outfocus",footer:t+"footer",buttonClear:t+"button--clear",buttonToday:t+"button--today",buttonClose:t+"button--close"}},e.extend("pickadate",n)},e.exports=n(he,i)}),q="md.pickdate",$="pickdate",K=(Q=i).fn[$],Y={cancel:"Cancel",closeOnCancel:!0,closeOnSelect:!1,container:"",containerHidden:"",disable:[],firstDay:0,format:"d/m/yyyy",formatSubmit:"",hiddenName:!1,hiddenPrefix:"",hiddenSuffix:"",klass:{buttonClear:"btn btn-outline-primary picker-button-clear",buttonClose:"btn btn-outline-primary picker-button-close",buttonToday:"btn btn-outline-primary picker-button-today",day:"picker-day",disabled:"picker-day-disabled",highlighted:"picker-day-highlighted",infocus:"picker-day-infocus",now:"picker-day-today",outfocus:"picker-day-outfocus",selected:"picker-day-selected",weekdays:"picker-weekday",box:"picker-box",footer:"picker-footer",frame:"picker-frame",header:"picker-header",holder:"picker-holder",table:"picker-table",wrap:"picker-wrap",active:"picker-input-active",input:"picker-input",month:"picker-month",navDisabled:"picker-nav-disabled",navNext:"material-icons picker-nav-next",navPrev:"material-icons picker-nav-prev",selectMonth:"picker-select-month",selectYear:"picker-select-year",year:"picker-year",focused:"picker-focused",opened:"picker-opened",picker:"picker"},labelMonthNext:"Next month",labelMonthPrev:"Previous month",labelMonthSelect:"Select a month",labelYearSelect:"Select a year",max:!1,min:!1,monthsFull:["January","February","March","April","May","June","July","August","September","October","November","December"],monthsShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],ok:"OK",onClose:function(){},onOpen:function(){},onRender:function(){},onSet:function(){},onStart:function(){},onStop:function(){},selectMonths:!1,selectYears:!1,today:"",weekdaysFull:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],weekdaysShort:["S","M","T","W","T","F","S"]},V={cancel:"string",closeOnCancel:"boolean",closeOnSelect:"boolean",container:"string",containerHidden:"string",disable:"array",firstDay:"number",format:"string",formatSubmit:"string",hiddenName:"boolean",hiddenPrefix:"string",hiddenSuffix:"string",klass:"object",labelMonthNext:"string",labelMonthPrev:"string",labelMonthSelect:"string",labelYearSelect:"string",max:"boolean || date",min:"boolean || date",monthsFull:"array",monthsShort:"array",ok:"string",onClose:"function",onOpen:"function",onRender:"function",onSet:"function",onStart:"function",onStop:"function",selectMonths:"boolean",selectYears:"boolean || number",today:"string",weekdaysFull:"array",weekdaysShort:"array"},J=function(){function i(e,t){this._config=this._getConfig(t),this._element=e}var e=i.prototype;return e.display=function(e,t,n){Q(".picker-date-display",t).remove(),Q(".picker-wrap",t).prepend('<div class="picker-date-display"><div class="picker-date-display-top"><span class="picker-year-display">'+e.get(n,"yyyy")+'</span></div><div class="picker-date-display-bottom"><span class="picker-weekday-display">'+e.get(n,"dddd")+'</span><span class="picker-day-display">'+e.get(n,"d")+'</span><span class="picker-month-display">'+e.get(n,"mmm")+"</span></div></div>")},e.show=function(){var e=this;Q(this._element).pickadate({clear:this._config.cancel,close:this._config.ok,closeOnClear:this._config.closeOnCancel,closeOnSelect:this._config.closeOnSelect,container:this._config.container,containerHidden:this._config.containerHidden,disable:this._config.disable,firstDay:this._config.firstDay,format:this._config.format,formatSubmit:this._config.formatSubmit,klass:this._config.klass,hiddenName:this._config.hiddenName,hiddenPrefix:this._config.hiddenPrefix,hiddenSuffix:this._config.hiddenSuffix,labelMonthNext:this._config.labelMonthNext,labelMonthPrev:this._config.labelMonthPrev,labelMonthSelect:this._config.labelMonthSelect,labelYearSelect:this._config.labelYearSelect,max:this._config.max,min:this._config.min,monthsFull:this._config.monthsFull,monthsShort:this._config.monthsShort,onClose:this._config.onClose,onOpen:this._config.onOpen,onRender:this._config.onRender,onSet:this._config.onSet,onStart:this._config.onStart,onStop:this._config.onStop,selectMonths:this._config.selectMonths,selectYears:this._config.selectYears,today:this._config.today,weekdaysFull:this._config.weekdaysFull,weekdaysShort:this._config.weekdaysShort});var t=Q(this._element).pickadate("picker"),n=t.$root;t.on({close:function(){Q(document.activeElement).blur()},open:function(){Q(".picker__date-display",n).length||e.display(t,n,"highlight")},set:function(){null!==t.get("select")&&e.display(t,n,"select")}})},e._getConfig=function(e){return e=S({},Y,e),W.typeCheckConfig($,e,V),e},i._jQueryInterface=function(n){return this.each(function(){var e=S({},Y,Q(this).data(),"object"==typeof n&&n?n:{}),t=Q(this).data(q);t||(t=new i(this,e),Q(this).data(q,t)),t.show()})},i}(),Q.fn[$]=J._jQueryInterface,Q.fn[$].Constructor=J,void(Q.fn[$].noConflict=function(){return Q.fn[$]=K,J._jQueryInterface})),pe=(Z={IS_MOUSEDOWN:!"focus"},X="blur"+(G=".md.selectioncontrolfocus"),"focus"+G,"mousedown"+G,"mouseup"+G,ee=".custom-control",te=".custom-control-input",void(z=i)(document).on(""+X,te,function(){z(this).removeClass("focus")}).on("focus.md.selectioncontrolfocus",te,function(){!1===Z.IS_MOUSEDOWN&&z(this).addClass("focus")}).on("mousedown.md.selectioncontrolfocus",ee,function(){Z.IS_MOUSEDOWN=!0}).on("mouseup.md.selectioncontrolfocus",ee,function(){setTimeout(function(){Z.IS_MOUSEDOWN=!1},1)})),me=(ie="md.tabswitch",oe="tabswitch",re=(ne=i).fn[oe],ae="animate",se="dropdown-item","nav-tabs-indicator","nav-tabs-material","show",'.nav-tabs [data-toggle="tab"]',le=".dropdown",".nav-tabs",ce=function(){function i(e){this._nav=e,this._navindicator=null}var e=i.prototype;return e.switch=function(e,t){var n=this,i=ne(this._nav).offset().left,o=ne(this._nav).scrollLeft(),r=ne(this._nav).outerWidth();this._navindicator||this._createIndicator(i,o,r,t),ne(e).hasClass(se)&&(e=ne(e).closest(le));var a=ne(e).offset().left,s=ne(e).outerWidth();ne(this._navindicator).addClass("show"),W.reflow(this._navindicator),ne(this._nav).addClass(ae),ne(this._navindicator).css({left:a+o-i,right:r-(a+o-i+s)});var l=W.getTransitionDurationFromElement(this._navindicator);ne(this._navindicator).one(W.TRANSITION_END,function(){ne(n._nav).removeClass(ae),ne(n._navindicator).removeClass("show")}).emulateTransitionEnd(l)},e._createIndicator=function(e,t,n,i){if(this._navindicator=document.createElement("div"),ne(this._navindicator).addClass("nav-tabs-indicator").appendTo(this._nav),void 0!==i){ne(i).hasClass(se)&&(i=ne(i).closest(le));var o=ne(i).offset().left,r=ne(i).outerWidth();ne(this._navindicator).css({left:o+t-e,right:n-(o+t-e+r)})}ne(this._nav).addClass("nav-tabs-material")},i._jQueryInterface=function(n){return this.each(function(){var e=ne(this).closest(".nav-tabs")[0];if(e){var t=ne(e).data(ie);t||(t=new i(e),ne(e).data(ie,t)),t.switch(this,n)}})},i}(),ne(document).on("show.bs.tab",'.nav-tabs [data-toggle="tab"]',function(e){ce._jQueryInterface.call(ne(this),e.relatedTarget)}),ne.fn[oe]=ce._jQueryInterface,ne.fn[oe].Constructor=ce,ne.fn[oe].noConflict=function(){return ne.fn[oe]=re,ce._jQueryInterface},ce);e.Util=W,e.ExpansionPanel=b,e.FloatingLabel=E,e.NavDrawer=U,e.PickDate=fe,e.SelectionControlFocus=pe,e.TabSwitch=me,Object.defineProperty(e,"__esModule",{value:!0})}),function(){var e=-1<navigator.userAgent.toLowerCase().indexOf("webkit"),t=-1<navigator.userAgent.toLowerCase().indexOf("opera"),n=-1<navigator.userAgent.toLowerCase().indexOf("msie");(e||t||n)&&document.getElementById&&window.addEventListener&&window.addEventListener("hashchange",function(){var e,t=location.hash.substring(1);/^[A-z0-9_-]+$/.test(t)&&(e=document.getElementById(t))&&(/^(?:a|select|input|button|textarea)$/i.test(e.tagName)||(e.tabIndex=-1),e.focus())},!1)}(),jQuery(window).load(function(){jQuery(window).scroll(function(){50<jQuery(this).scrollTop()?(jQuery("#back-to-top").fadeIn(),jQuery("#back-to-top").tooltip()):jQuery("#back-to-top").fadeOut()}),jQuery("#back-to-top").click(function(){return jQuery("#back-to-top").tooltip("hide"),jQuery("body,html").animate({scrollTop:0},"slow"),!1}),jQuery("#back-to-top").is(":visible")&&jQuery("#back-to-top").tooltip("show")});
\ No newline at end of file |
